From be78f596a56580ae6984895355168376d49d9099 Mon Sep 17 00:00:00 2001 From: Liong Sauw Ming Date: Wed, 18 Apr 2012 02:38:42 +0000 Subject: Fixed #1276: Add baseclasses sample in third_party directory required by dshow_dev git-svn-id: http://svn.pjsip.org/repos/pjproject/trunk@4061 74dad513-b988-da41-8d7b-12977e46ad98 --- third_party/BaseClasses/amextra.cpp | 111 + third_party/BaseClasses/amextra.h | 56 + third_party/BaseClasses/amfilter.cpp | 5358 ++++++++++++++++++++++++++++ third_party/BaseClasses/amfilter.h | 1587 ++++++++ third_party/BaseClasses/amvideo.cpp | 275 ++ third_party/BaseClasses/arithutil.cpp | 360 ++ third_party/BaseClasses/baseclasses.sln | 38 + third_party/BaseClasses/baseclasses.vcproj | 826 +++++ third_party/BaseClasses/cache.h | 74 + third_party/BaseClasses/checkbmi.h | 120 + third_party/BaseClasses/combase.cpp | 265 ++ third_party/BaseClasses/combase.h | 305 ++ third_party/BaseClasses/cprop.cpp | 383 ++ third_party/BaseClasses/cprop.h | 95 + third_party/BaseClasses/ctlutil.cpp | 2541 +++++++++++++ third_party/BaseClasses/ctlutil.h | 923 +++++ third_party/BaseClasses/ddmm.cpp | 129 + third_party/BaseClasses/ddmm.h | 28 + third_party/BaseClasses/dllentry.cpp | 367 ++ third_party/BaseClasses/dllsetup.cpp | 693 ++++ third_party/BaseClasses/dllsetup.h | 46 + third_party/BaseClasses/dxmperf.h | 250 ++ third_party/BaseClasses/fourcc.h | 101 + third_party/BaseClasses/measure.h | 222 ++ third_party/BaseClasses/msgthrd.h | 120 + third_party/BaseClasses/mtype.cpp | 478 +++ third_party/BaseClasses/mtype.h | 89 + third_party/BaseClasses/outputq.cpp | 801 +++++ third_party/BaseClasses/outputq.h | 137 + third_party/BaseClasses/perflog.cpp | 347 ++ third_party/BaseClasses/perflog.h | 56 + third_party/BaseClasses/perfstruct.h | 194 + third_party/BaseClasses/pstream.cpp | 197 + third_party/BaseClasses/pstream.h | 114 + third_party/BaseClasses/pullpin.cpp | 588 +++ third_party/BaseClasses/pullpin.h | 152 + third_party/BaseClasses/refclock.cpp | 402 +++ third_party/BaseClasses/refclock.h | 184 + third_party/BaseClasses/reftime.h | 116 + third_party/BaseClasses/renbase.cpp | 2858 +++++++++++++++ third_party/BaseClasses/renbase.h | 478 +++ third_party/BaseClasses/schedule.cpp | 284 ++ third_party/BaseClasses/schedule.h | 128 + third_party/BaseClasses/seekpt.cpp | 83 + third_party/BaseClasses/seekpt.h | 30 + third_party/BaseClasses/source.cpp | 522 +++ third_party/BaseClasses/source.h | 172 + third_party/BaseClasses/streams.h | 202 ++ third_party/BaseClasses/strmctl.cpp | 402 +++ third_party/BaseClasses/strmctl.h | 157 + third_party/BaseClasses/sysclock.cpp | 74 + third_party/BaseClasses/sysclock.h | 39 + third_party/BaseClasses/transfrm.cpp | 1016 ++++++ third_party/BaseClasses/transfrm.h | 304 ++ third_party/BaseClasses/transip.cpp | 974 +++++ third_party/BaseClasses/transip.h | 250 ++ third_party/BaseClasses/videoctl.cpp | 746 ++++ third_party/BaseClasses/videoctl.h | 168 + third_party/BaseClasses/vtrans.cpp | 468 +++ third_party/BaseClasses/vtrans.h | 143 + third_party/BaseClasses/winctrl.cpp | 2081 +++++++++++ third_party/BaseClasses/winctrl.h | 224 ++ third_party/BaseClasses/winutil.cpp | 2746 ++++++++++++++ third_party/BaseClasses/winutil.h | 419 +++ third_party/BaseClasses/wxdebug.cpp | 1474 ++++++++ third_party/BaseClasses/wxdebug.h | 359 ++ third_party/BaseClasses/wxlist.cpp | 891 +++++ third_party/BaseClasses/wxlist.h | 553 +++ third_party/BaseClasses/wxutil.cpp | 769 ++++ third_party/BaseClasses/wxutil.h | 532 +++ 70 files changed, 38674 insertions(+) create mode 100644 third_party/BaseClasses/amextra.cpp create mode 100644 third_party/BaseClasses/amextra.h create mode 100644 third_party/BaseClasses/amfilter.cpp create mode 100644 third_party/BaseClasses/amfilter.h create mode 100644 third_party/BaseClasses/amvideo.cpp create mode 100644 third_party/BaseClasses/arithutil.cpp create mode 100644 third_party/BaseClasses/baseclasses.sln create mode 100644 third_party/BaseClasses/baseclasses.vcproj create mode 100644 third_party/BaseClasses/cache.h create mode 100644 third_party/BaseClasses/checkbmi.h create mode 100644 third_party/BaseClasses/combase.cpp create mode 100644 third_party/BaseClasses/combase.h create mode 100644 third_party/BaseClasses/cprop.cpp create mode 100644 third_party/BaseClasses/cprop.h create mode 100644 third_party/BaseClasses/ctlutil.cpp create mode 100644 third_party/BaseClasses/ctlutil.h create mode 100644 third_party/BaseClasses/ddmm.cpp create mode 100644 third_party/BaseClasses/ddmm.h create mode 100644 third_party/BaseClasses/dllentry.cpp create mode 100644 third_party/BaseClasses/dllsetup.cpp create mode 100644 third_party/BaseClasses/dllsetup.h create mode 100644 third_party/BaseClasses/dxmperf.h create mode 100644 third_party/BaseClasses/fourcc.h create mode 100644 third_party/BaseClasses/measure.h create mode 100644 third_party/BaseClasses/msgthrd.h create mode 100644 third_party/BaseClasses/mtype.cpp create mode 100644 third_party/BaseClasses/mtype.h create mode 100644 third_party/BaseClasses/outputq.cpp create mode 100644 third_party/BaseClasses/outputq.h create mode 100644 third_party/BaseClasses/perflog.cpp create mode 100644 third_party/BaseClasses/perflog.h create mode 100644 third_party/BaseClasses/perfstruct.h create mode 100644 third_party/BaseClasses/pstream.cpp create mode 100644 third_party/BaseClasses/pstream.h create mode 100644 third_party/BaseClasses/pullpin.cpp create mode 100644 third_party/BaseClasses/pullpin.h create mode 100644 third_party/BaseClasses/refclock.cpp create mode 100644 third_party/BaseClasses/refclock.h create mode 100644 third_party/BaseClasses/reftime.h create mode 100644 third_party/BaseClasses/renbase.cpp create mode 100644 third_party/BaseClasses/renbase.h create mode 100644 third_party/BaseClasses/schedule.cpp create mode 100644 third_party/BaseClasses/schedule.h create mode 100644 third_party/BaseClasses/seekpt.cpp create mode 100644 third_party/BaseClasses/seekpt.h create mode 100644 third_party/BaseClasses/source.cpp create mode 100644 third_party/BaseClasses/source.h create mode 100644 third_party/BaseClasses/streams.h create mode 100644 third_party/BaseClasses/strmctl.cpp create mode 100644 third_party/BaseClasses/strmctl.h create mode 100644 third_party/BaseClasses/sysclock.cpp create mode 100644 third_party/BaseClasses/sysclock.h create mode 100644 third_party/BaseClasses/transfrm.cpp create mode 100644 third_party/BaseClasses/transfrm.h create mode 100644 third_party/BaseClasses/transip.cpp create mode 100644 third_party/BaseClasses/transip.h create mode 100644 third_party/BaseClasses/videoctl.cpp create mode 100644 third_party/BaseClasses/videoctl.h create mode 100644 third_party/BaseClasses/vtrans.cpp create mode 100644 third_party/BaseClasses/vtrans.h create mode 100644 third_party/BaseClasses/winctrl.cpp create mode 100644 third_party/BaseClasses/winctrl.h create mode 100644 third_party/BaseClasses/winutil.cpp create mode 100644 third_party/BaseClasses/winutil.h create mode 100644 third_party/BaseClasses/wxdebug.cpp create mode 100644 third_party/BaseClasses/wxdebug.h create mode 100644 third_party/BaseClasses/wxlist.cpp create mode 100644 third_party/BaseClasses/wxlist.h create mode 100644 third_party/BaseClasses/wxutil.cpp create mode 100644 third_party/BaseClasses/wxutil.h diff --git a/third_party/BaseClasses/amextra.cpp b/third_party/BaseClasses/amextra.cpp new file mode 100644 index 00000000..af0de96d --- /dev/null +++ b/third_party/BaseClasses/amextra.cpp @@ -0,0 +1,111 @@ +//------------------------------------------------------------------------------ +// File: AMExtra.cpp +// +// Desc: DirectShow base classes - implements CRenderedInputPin class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include // DirectShow base class definitions +#include // Needed for definition of timeGetTime +#include // Standard data type limit definitions +#include // Used for time critical log functions + +#include "amextra.h" + +#pragma warning(disable:4355) + +// Implements CRenderedInputPin class + +CRenderedInputPin::CRenderedInputPin(__in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName) : + CBaseInputPin(pObjectName, pFilter, pLock, phr, pName), + m_bAtEndOfStream(FALSE), + m_bCompleteNotified(FALSE) +{ +} +#ifdef UNICODE +CRenderedInputPin::CRenderedInputPin(__in_opt LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName) : + CBaseInputPin(pObjectName, pFilter, pLock, phr, pName), + m_bAtEndOfStream(FALSE), + m_bCompleteNotified(FALSE) +{ +} +#endif + +// Flush end of stream condition - caller should do any +// necessary stream level locking before calling this + +STDMETHODIMP CRenderedInputPin::EndOfStream() +{ + HRESULT hr = CheckStreaming(); + + // Do EC_COMPLETE handling for rendered pins + if (S_OK == hr && !m_bAtEndOfStream) { + m_bAtEndOfStream = TRUE; + FILTER_STATE fs; + EXECUTE_ASSERT(SUCCEEDED(m_pFilter->GetState(0, &fs))); + if (fs == State_Running) { + DoCompleteHandling(); + } + } + return hr; +} + + +// Called to complete the flush + +STDMETHODIMP CRenderedInputPin::EndFlush() +{ + CAutoLock lck(m_pLock); + + // Clean up renderer state + m_bAtEndOfStream = FALSE; + m_bCompleteNotified = FALSE; + + return CBaseInputPin::EndFlush(); +} + + +// Notify of Run() from filter + +HRESULT CRenderedInputPin::Run(REFERENCE_TIME tStart) +{ + UNREFERENCED_PARAMETER(tStart); + m_bCompleteNotified = FALSE; + if (m_bAtEndOfStream) { + DoCompleteHandling(); + } + return S_OK; +} + + +// Clear status on going into paused state + +HRESULT CRenderedInputPin::Active() +{ + m_bAtEndOfStream = FALSE; + m_bCompleteNotified = FALSE; + return CBaseInputPin::Active(); +} + + +// Do stuff to deliver end of stream + +void CRenderedInputPin::DoCompleteHandling() +{ + ASSERT(m_bAtEndOfStream); + if (!m_bCompleteNotified) { + m_bCompleteNotified = TRUE; + m_pFilter->NotifyEvent(EC_COMPLETE, S_OK, (LONG_PTR)(IBaseFilter *)m_pFilter); + } +} + diff --git a/third_party/BaseClasses/amextra.h b/third_party/BaseClasses/amextra.h new file mode 100644 index 00000000..5a861bf1 --- /dev/null +++ b/third_party/BaseClasses/amextra.h @@ -0,0 +1,56 @@ +//------------------------------------------------------------------------------ +// File: AMExtra.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __AMEXTRA__ +#define __AMEXTRA__ + +// Simple rendered input pin +// +// NOTE if your filter queues stuff before rendering then it may not be +// appropriate to use this class +// +// In that case queue the end of stream condition until the last sample +// is actually rendered and flush the condition appropriately + +class CRenderedInputPin : public CBaseInputPin +{ +public: + + CRenderedInputPin(__in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); +#ifdef UNICODE + CRenderedInputPin(__in_opt LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); +#endif + + // Override methods to track end of stream state + STDMETHODIMP EndOfStream(); + STDMETHODIMP EndFlush(); + + HRESULT Active(); + HRESULT Run(REFERENCE_TIME tStart); + +protected: + + // Member variables to track state + BOOL m_bAtEndOfStream; // Set by EndOfStream + BOOL m_bCompleteNotified; // Set when we notify for EC_COMPLETE + +private: + void DoCompleteHandling(); +}; + +#endif // __AMEXTRA__ + diff --git a/third_party/BaseClasses/amfilter.cpp b/third_party/BaseClasses/amfilter.cpp new file mode 100644 index 00000000..03c13d14 --- /dev/null +++ b/third_party/BaseClasses/amfilter.cpp @@ -0,0 +1,5358 @@ +//------------------------------------------------------------------------------ +// File: AMFilter.cpp +// +// Desc: DirectShow base classes - implements class hierarchy for streams +// architecture. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +//===================================================================== +//===================================================================== +// The following classes are declared in this header: +// +// +// CBaseMediaFilter Basic IMediaFilter support (abstract class) +// CBaseFilter Support for IBaseFilter (incl. IMediaFilter) +// CEnumPins Enumerate input and output pins +// CEnumMediaTypes Enumerate the preferred pin formats +// CBasePin Abstract base class for IPin interface +// CBaseOutputPin Adds data provider member functions +// CBaseInputPin Implements IMemInputPin interface +// CMediaSample Basic transport unit for IMemInputPin +// CBaseAllocator General list guff for most allocators +// CMemAllocator Implements memory buffer allocation +// +//===================================================================== +//===================================================================== + +#include +#include + +#ifdef DXMPERF +#include "dxmperf.h" +#endif // DXMPERF + + +//===================================================================== +// Helpers +//===================================================================== +STDAPI CreateMemoryAllocator(__deref_out IMemAllocator **ppAllocator) +{ + return CoCreateInstance(CLSID_MemoryAllocator, + 0, + CLSCTX_INPROC_SERVER, + IID_IMemAllocator, + (void **)ppAllocator); +} + +// Put this one here rather than in ctlutil.cpp to avoid linking +// anything brought in by ctlutil.cpp +STDAPI CreatePosPassThru( + __in_opt LPUNKNOWN pAgg, + BOOL bRenderer, + IPin *pPin, + __deref_out IUnknown **ppPassThru +) +{ + *ppPassThru = NULL; + IUnknown *pUnkSeek; + HRESULT hr = CoCreateInstance(CLSID_SeekingPassThru, + pAgg, + CLSCTX_INPROC_SERVER, + IID_IUnknown, + (void **)&pUnkSeek + ); + if (FAILED(hr)) { + return hr; + } + + ISeekingPassThru *pPassThru; + hr = pUnkSeek->QueryInterface(IID_ISeekingPassThru, (void**)&pPassThru); + if (FAILED(hr)) { + pUnkSeek->Release(); + return hr; + } + hr = pPassThru->Init(bRenderer, pPin); + pPassThru->Release(); + if (FAILED(hr)) { + pUnkSeek->Release(); + return hr; + } + *ppPassThru = pUnkSeek; + return S_OK; +} + + + +#define CONNECT_TRACE_LEVEL 3 + +//===================================================================== +//===================================================================== +// Implements CBaseMediaFilter +//===================================================================== +//===================================================================== + + +/* Constructor */ + +CBaseMediaFilter::CBaseMediaFilter(__in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + __in CCritSec *pLock, + REFCLSID clsid) : + CUnknown(pName, pUnk), + m_pLock(pLock), + m_clsid(clsid), + m_State(State_Stopped), + m_pClock(NULL) +{ +} + + +/* Destructor */ + +CBaseMediaFilter::~CBaseMediaFilter() +{ + // must be stopped, but can't call Stop here since + // our critsec has been destroyed. + + /* Release any clock we were using */ + + if (m_pClock) { + m_pClock->Release(); + m_pClock = NULL; + } +} + + +/* Override this to say what interfaces we support and where */ + +STDMETHODIMP +CBaseMediaFilter::NonDelegatingQueryInterface( + REFIID riid, + __deref_out void ** ppv) +{ + if (riid == IID_IMediaFilter) { + return GetInterface((IMediaFilter *) this, ppv); + } else if (riid == IID_IPersist) { + return GetInterface((IPersist *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + +/* Return the filter's clsid */ +STDMETHODIMP +CBaseMediaFilter::GetClassID(__out CLSID *pClsID) +{ + CheckPointer(pClsID,E_POINTER); + ValidateReadWritePtr(pClsID,sizeof(CLSID)); + *pClsID = m_clsid; + return NOERROR; +} + +/* Override this if your state changes are not done synchronously */ + +STDMETHODIMP +CBaseMediaFilter::GetState(DWORD dwMSecs, __out FILTER_STATE *State) +{ + UNREFERENCED_PARAMETER(dwMSecs); + CheckPointer(State,E_POINTER); + ValidateReadWritePtr(State,sizeof(FILTER_STATE)); + + *State = m_State; + return S_OK; +} + + +/* Set the clock we will use for synchronisation */ + +STDMETHODIMP +CBaseMediaFilter::SetSyncSource(__inout_opt IReferenceClock *pClock) +{ + CAutoLock cObjectLock(m_pLock); + + // Ensure the new one does not go away - even if the same as the old + if (pClock) { + pClock->AddRef(); + } + + // if we have a clock, release it + if (m_pClock) { + m_pClock->Release(); + } + + // Set the new reference clock (might be NULL) + // Should we query it to ensure it is a clock? Consider for a debug build. + m_pClock = pClock; + + return NOERROR; +} + +/* Return the clock we are using for synchronisation */ +STDMETHODIMP +CBaseMediaFilter::GetSyncSource(__deref_out_opt IReferenceClock **pClock) +{ + CheckPointer(pClock,E_POINTER); + ValidateReadWritePtr(pClock,sizeof(IReferenceClock *)); + CAutoLock cObjectLock(m_pLock); + + if (m_pClock) { + // returning an interface... addref it... + m_pClock->AddRef(); + } + *pClock = (IReferenceClock*)m_pClock; + return NOERROR; +} + + +/* Put the filter into a stopped state */ + +STDMETHODIMP +CBaseMediaFilter::Stop() +{ + CAutoLock cObjectLock(m_pLock); + + m_State = State_Stopped; + return S_OK; +} + + +/* Put the filter into a paused state */ + +STDMETHODIMP +CBaseMediaFilter::Pause() +{ + CAutoLock cObjectLock(m_pLock); + + m_State = State_Paused; + return S_OK; +} + + +// Put the filter into a running state. + +// The time parameter is the offset to be added to the samples' +// stream time to get the reference time at which they should be presented. +// +// you can either add these two and compare it against the reference clock, +// or you can call CBaseMediaFilter::StreamTime and compare that against +// the sample timestamp. + +STDMETHODIMP +CBaseMediaFilter::Run(REFERENCE_TIME tStart) +{ + CAutoLock cObjectLock(m_pLock); + + // remember the stream time offset + m_tStart = tStart; + + if (m_State == State_Stopped){ + HRESULT hr = Pause(); + + if (FAILED(hr)) { + return hr; + } + } + m_State = State_Running; + return S_OK; +} + + +// +// return the current stream time - samples with start timestamps of this +// time or before should be rendered by now +HRESULT +CBaseMediaFilter::StreamTime(CRefTime& rtStream) +{ + // Caller must lock for synchronization + // We can't grab the filter lock because we want to be able to call + // this from worker threads without deadlocking + + if (m_pClock == NULL) { + return VFW_E_NO_CLOCK; + } + + // get the current reference time + HRESULT hr = m_pClock->GetTime((REFERENCE_TIME*)&rtStream); + if (FAILED(hr)) { + return hr; + } + + // subtract the stream offset to get stream time + rtStream -= m_tStart; + + return S_OK; +} + + +//===================================================================== +//===================================================================== +// Implements CBaseFilter +//===================================================================== +//===================================================================== + + +/* Override this to say what interfaces we support and where */ + +STDMETHODIMP CBaseFilter::NonDelegatingQueryInterface(REFIID riid, + __deref_out void **ppv) +{ + /* Do we have this interface */ + + if (riid == IID_IBaseFilter) { + return GetInterface((IBaseFilter *) this, ppv); + } else if (riid == IID_IMediaFilter) { + return GetInterface((IMediaFilter *) this, ppv); + } else if (riid == IID_IPersist) { + return GetInterface((IPersist *) this, ppv); + } else if (riid == IID_IAMovieSetup) { + return GetInterface((IAMovieSetup *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + +#ifdef DEBUG +STDMETHODIMP_(ULONG) CBaseFilter::NonDelegatingRelease() +{ + if (m_cRef == 1) { + KASSERT(m_pGraph == NULL); + } + return CUnknown::NonDelegatingRelease(); +} +#endif + + +/* Constructor */ + +CBaseFilter::CBaseFilter(__in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + __in CCritSec *pLock, + REFCLSID clsid) : + CUnknown( pName, pUnk ), + m_pLock(pLock), + m_clsid(clsid), + m_State(State_Stopped), + m_pClock(NULL), + m_pGraph(NULL), + m_pSink(NULL), + m_pName(NULL), + m_PinVersion(1) +{ +#ifdef DXMPERF + PERFLOG_CTOR( pName ? pName : L"CBaseFilter", (IBaseFilter *) this ); +#endif // DXMPERF + + ASSERT(pLock != NULL); +} + +/* Passes in a redundant HRESULT argument */ + +CBaseFilter::CBaseFilter(__in_opt LPCTSTR pName, + __in_opt LPUNKNOWN pUnk, + __in CCritSec *pLock, + REFCLSID clsid, + __inout HRESULT *phr) : + CUnknown( pName, pUnk ), + m_pLock(pLock), + m_clsid(clsid), + m_State(State_Stopped), + m_pClock(NULL), + m_pGraph(NULL), + m_pSink(NULL), + m_pName(NULL), + m_PinVersion(1) +{ +#ifdef DXMPERF + PERFLOG_CTOR( pName ? pName : L"CBaseFilter", (IBaseFilter *) this ); +#endif // DXMPERF + + ASSERT(pLock != NULL); + UNREFERENCED_PARAMETER(phr); +} + +#ifdef UNICODE +CBaseFilter::CBaseFilter(__in_opt LPCSTR pName, + __in_opt LPUNKNOWN pUnk, + __in CCritSec *pLock, + REFCLSID clsid) : + CUnknown( pName, pUnk ), + m_pLock(pLock), + m_clsid(clsid), + m_State(State_Stopped), + m_pClock(NULL), + m_pGraph(NULL), + m_pSink(NULL), + m_pName(NULL), + m_PinVersion(1) +{ +#ifdef DXMPERF + PERFLOG_CTOR( L"CBaseFilter", (IBaseFilter *) this ); +#endif // DXMPERF + + ASSERT(pLock != NULL); +} +CBaseFilter::CBaseFilter(__in_opt LPCSTR pName, + __in_opt LPUNKNOWN pUnk, + __in CCritSec *pLock, + REFCLSID clsid, + __inout HRESULT *phr) : + CUnknown( pName, pUnk ), + m_pLock(pLock), + m_clsid(clsid), + m_State(State_Stopped), + m_pClock(NULL), + m_pGraph(NULL), + m_pSink(NULL), + m_pName(NULL), + m_PinVersion(1) +{ +#ifdef DXMPERF + PERFLOG_CTOR( L"CBaseFilter", (IBaseFilter *) this ); +#endif // DXMPERF + + ASSERT(pLock != NULL); + UNREFERENCED_PARAMETER(phr); +} +#endif + +/* Destructor */ + +CBaseFilter::~CBaseFilter() +{ +#ifdef DXMPERF + PERFLOG_DTOR( L"CBaseFilter", (IBaseFilter *) this ); +#endif // DXMPERF + + // NOTE we do NOT hold references on the filtergraph for m_pGraph or m_pSink + // When we did we had the circular reference problem. Nothing would go away. + + delete[] m_pName; + + // must be stopped, but can't call Stop here since + // our critsec has been destroyed. + + /* Release any clock we were using */ + if (m_pClock) { + m_pClock->Release(); + m_pClock = NULL; + } +} + +/* Return the filter's clsid */ +STDMETHODIMP +CBaseFilter::GetClassID(__out CLSID *pClsID) +{ + CheckPointer(pClsID,E_POINTER); + ValidateReadWritePtr(pClsID,sizeof(CLSID)); + *pClsID = m_clsid; + return NOERROR; +} + +/* Override this if your state changes are not done synchronously */ +STDMETHODIMP +CBaseFilter::GetState(DWORD dwMSecs, __out FILTER_STATE *State) +{ + UNREFERENCED_PARAMETER(dwMSecs); + CheckPointer(State,E_POINTER); + ValidateReadWritePtr(State,sizeof(FILTER_STATE)); + + *State = m_State; + return S_OK; +} + + +/* Set the clock we will use for synchronisation */ + +STDMETHODIMP +CBaseFilter::SetSyncSource(__in_opt IReferenceClock *pClock) +{ + CAutoLock cObjectLock(m_pLock); + + // Ensure the new one does not go away - even if the same as the old + if (pClock) { + pClock->AddRef(); + } + + // if we have a clock, release it + if (m_pClock) { + m_pClock->Release(); + } + + // Set the new reference clock (might be NULL) + // Should we query it to ensure it is a clock? Consider for a debug build. + m_pClock = pClock; + + return NOERROR; +} + +/* Return the clock we are using for synchronisation */ +STDMETHODIMP +CBaseFilter::GetSyncSource(__deref_out_opt IReferenceClock **pClock) +{ + CheckPointer(pClock,E_POINTER); + ValidateReadWritePtr(pClock,sizeof(IReferenceClock *)); + CAutoLock cObjectLock(m_pLock); + + if (m_pClock) { + // returning an interface... addref it... + m_pClock->AddRef(); + } + *pClock = (IReferenceClock*)m_pClock; + return NOERROR; +} + + + +// override CBaseMediaFilter Stop method, to deactivate any pins this +// filter has. +STDMETHODIMP +CBaseFilter::Stop() +{ + CAutoLock cObjectLock(m_pLock); + HRESULT hr = NOERROR; + + // notify all pins of the state change + if (m_State != State_Stopped) { + int cPins = GetPinCount(); + for (int c = 0; c < cPins; c++) { + + CBasePin *pPin = GetPin(c); + if (NULL == pPin) { + break; + } + + // Disconnected pins are not activated - this saves pins worrying + // about this state themselves. We ignore the return code to make + // sure everyone is inactivated regardless. The base input pin + // class can return an error if it has no allocator but Stop can + // be used to resync the graph state after something has gone bad + + if (pPin->IsConnected()) { + HRESULT hrTmp = pPin->Inactive(); + if (FAILED(hrTmp) && SUCCEEDED(hr)) { + hr = hrTmp; + } + } + } + } + +#ifdef DXMPERF + PERFLOG_STOP( m_pName ? m_pName : L"CBaseFilter", (IBaseFilter *) this, m_State ); +#endif // DXMPERF + + m_State = State_Stopped; + return hr; +} + + +// override CBaseMediaFilter Pause method to activate any pins +// this filter has (also called from Run) + +STDMETHODIMP +CBaseFilter::Pause() +{ + CAutoLock cObjectLock(m_pLock); + + // notify all pins of the change to active state + if (m_State == State_Stopped) { + int cPins = GetPinCount(); + for (int c = 0; c < cPins; c++) { + + CBasePin *pPin = GetPin(c); + if (NULL == pPin) { + break; + } + + // Disconnected pins are not activated - this saves pins + // worrying about this state themselves + + if (pPin->IsConnected()) { + HRESULT hr = pPin->Active(); + if (FAILED(hr)) { + return hr; + } + } + } + } + + +#ifdef DXMPERF + PERFLOG_PAUSE( m_pName ? m_pName : L"CBaseFilter", (IBaseFilter *) this, m_State ); +#endif // DXMPERF + + m_State = State_Paused; + return S_OK; +} + +// Put the filter into a running state. + +// The time parameter is the offset to be added to the samples' +// stream time to get the reference time at which they should be presented. +// +// you can either add these two and compare it against the reference clock, +// or you can call CBaseFilter::StreamTime and compare that against +// the sample timestamp. + +STDMETHODIMP +CBaseFilter::Run(REFERENCE_TIME tStart) +{ + CAutoLock cObjectLock(m_pLock); + + // remember the stream time offset + m_tStart = tStart; + + if (m_State == State_Stopped){ + HRESULT hr = Pause(); + + if (FAILED(hr)) { + return hr; + } + } + // notify all pins of the change to active state + if (m_State != State_Running) { + int cPins = GetPinCount(); + for (int c = 0; c < cPins; c++) { + + CBasePin *pPin = GetPin(c); + if (NULL == pPin) { + break; + } + + // Disconnected pins are not activated - this saves pins + // worrying about this state themselves + + if (pPin->IsConnected()) { + HRESULT hr = pPin->Run(tStart); + if (FAILED(hr)) { + return hr; + } + } + } + } + +#ifdef DXMPERF + PERFLOG_RUN( m_pName ? m_pName : L"CBaseFilter", (IBaseFilter *) this, tStart, m_State ); +#endif // DXMPERF + + m_State = State_Running; + return S_OK; +} + +// +// return the current stream time - samples with start timestamps of this +// time or before should be rendered by now +HRESULT +CBaseFilter::StreamTime(CRefTime& rtStream) +{ + // Caller must lock for synchronization + // We can't grab the filter lock because we want to be able to call + // this from worker threads without deadlocking + + if (m_pClock == NULL) { + return VFW_E_NO_CLOCK; + } + + // get the current reference time + HRESULT hr = m_pClock->GetTime((REFERENCE_TIME*)&rtStream); + if (FAILED(hr)) { + return hr; + } + + // subtract the stream offset to get stream time + rtStream -= m_tStart; + + return S_OK; +} + + +/* Create an enumerator for the pins attached to this filter */ + +STDMETHODIMP +CBaseFilter::EnumPins(__deref_out IEnumPins **ppEnum) +{ + CheckPointer(ppEnum,E_POINTER); + ValidateReadWritePtr(ppEnum,sizeof(IEnumPins *)); + + /* Create a new ref counted enumerator */ + + *ppEnum = new CEnumPins(this, + NULL); + + return *ppEnum == NULL ? E_OUTOFMEMORY : NOERROR; +} + + +// default behaviour of FindPin is to assume pins are named +// by their pin names +STDMETHODIMP +CBaseFilter::FindPin( + LPCWSTR Id, + __deref_out IPin ** ppPin +) +{ + CheckPointer(ppPin,E_POINTER); + ValidateReadWritePtr(ppPin,sizeof(IPin *)); + + // We're going to search the pin list so maintain integrity + CAutoLock lck(m_pLock); + int iCount = GetPinCount(); + for (int i = 0; i < iCount; i++) { + CBasePin *pPin = GetPin(i); + if (NULL == pPin) { + break; + } + + if (0 == lstrcmpW(pPin->Name(), Id)) { + // Found one that matches + // + // AddRef() and return it + *ppPin = pPin; + pPin->AddRef(); + return S_OK; + } + } + *ppPin = NULL; + return VFW_E_NOT_FOUND; +} + +/* Return information about this filter */ + +STDMETHODIMP +CBaseFilter::QueryFilterInfo(__out FILTER_INFO * pInfo) +{ + CheckPointer(pInfo,E_POINTER); + ValidateReadWritePtr(pInfo,sizeof(FILTER_INFO)); + + if (m_pName) { + (void)StringCchCopyW(pInfo->achName, NUMELMS(pInfo->achName), m_pName); + } else { + pInfo->achName[0] = L'\0'; + } + pInfo->pGraph = m_pGraph; + if (m_pGraph) + m_pGraph->AddRef(); + return NOERROR; +} + + +/* Provide the filter with a filter graph */ + +STDMETHODIMP +CBaseFilter::JoinFilterGraph( + __inout_opt IFilterGraph * pGraph, + __in_opt LPCWSTR pName) +{ + CAutoLock cObjectLock(m_pLock); + + // NOTE: we no longer hold references on the graph (m_pGraph, m_pSink) + + m_pGraph = pGraph; + if (m_pGraph) { + HRESULT hr = m_pGraph->QueryInterface(IID_IMediaEventSink, + (void**) &m_pSink); + if (FAILED(hr)) { + ASSERT(m_pSink == NULL); + } + else m_pSink->Release(); // we do NOT keep a reference on it. + } else { + // if graph pointer is null, then we should + // also release the IMediaEventSink on the same object - we don't + // refcount it, so just set it to null + m_pSink = NULL; + } + + + if (m_pName) { + delete[] m_pName; + m_pName = NULL; + } + + if (pName) { + size_t namelen; + HRESULT hr = StringCchLengthW(pName, STRSAFE_MAX_CCH, &namelen); + if (FAILED(hr)) { + return hr; + } + m_pName = new WCHAR[namelen + 1]; + if (m_pName) { + (void)StringCchCopyW(m_pName, namelen + 1, pName); + } else { + return E_OUTOFMEMORY; + } + } + +#ifdef DXMPERF + PERFLOG_JOINGRAPH( m_pName ? m_pName : L"CBaseFilter",(IBaseFilter *) this, pGraph ); +#endif // DXMPERF + + return NOERROR; +} + + +// return a Vendor information string. Optional - may return E_NOTIMPL. +// memory returned should be freed using CoTaskMemFree +// default implementation returns E_NOTIMPL +STDMETHODIMP +CBaseFilter::QueryVendorInfo( + __deref_out LPWSTR* pVendorInfo) +{ + UNREFERENCED_PARAMETER(pVendorInfo); + return E_NOTIMPL; +} + + +// send an event notification to the filter graph if we know about it. +// returns S_OK if delivered, S_FALSE if the filter graph does not sink +// events, or an error otherwise. +HRESULT +CBaseFilter::NotifyEvent( + long EventCode, + LONG_PTR EventParam1, + LONG_PTR EventParam2) +{ + // Snapshot so we don't have to lock up + IMediaEventSink *pSink = m_pSink; + if (pSink) { + if (EC_COMPLETE == EventCode) { + EventParam2 = (LONG_PTR)(IBaseFilter*)this; + } + + return pSink->Notify(EventCode, EventParam1, EventParam2); + } else { + return E_NOTIMPL; + } +} + +// Request reconnect +// pPin is the pin to reconnect +// pmt is the type to reconnect with - can be NULL +// Calls ReconnectEx on the filter graph +HRESULT +CBaseFilter::ReconnectPin( + IPin *pPin, + __in_opt AM_MEDIA_TYPE const *pmt +) +{ + IFilterGraph2 *pGraph2; + if (m_pGraph != NULL) { + HRESULT hr = m_pGraph->QueryInterface(IID_IFilterGraph2, (void **)&pGraph2); + if (SUCCEEDED(hr)) { + hr = pGraph2->ReconnectEx(pPin, pmt); + pGraph2->Release(); + return hr; + } else { + return m_pGraph->Reconnect(pPin); + } + } else { + return E_NOINTERFACE; + } +} + + + +/* This is the same idea as the media type version does for type enumeration + on pins but for the list of pins available. So if the list of pins you + provide changes dynamically then either override this virtual function + to provide the version number, or more simply call IncrementPinVersion */ + +LONG CBaseFilter::GetPinVersion() +{ + return m_PinVersion; +} + + +/* Increment the current pin version cookie */ + +void CBaseFilter::IncrementPinVersion() +{ + InterlockedIncrement(&m_PinVersion); +} + +/* register filter */ + +STDMETHODIMP CBaseFilter::Register() +{ + // get setup data, if it exists + // + LPAMOVIESETUP_FILTER psetupdata = GetSetupData(); + + // check we've got data + // + if( NULL == psetupdata ) return S_FALSE; + + // init is ref counted so call just in case + // we're being called cold. + // + HRESULT hr = CoInitialize( (LPVOID)NULL ); + ASSERT( SUCCEEDED(hr) ); + + // get hold of IFilterMapper + // + IFilterMapper *pIFM; + hr = CoCreateInstance( CLSID_FilterMapper + , NULL + , CLSCTX_INPROC_SERVER + , IID_IFilterMapper + , (void **)&pIFM ); + if( SUCCEEDED(hr) ) + { + hr = AMovieSetupRegisterFilter( psetupdata, pIFM, TRUE ); + pIFM->Release(); + } + + // and clear up + // + CoFreeUnusedLibraries(); + CoUninitialize(); + + return NOERROR; +} + + +/* unregister filter */ + +STDMETHODIMP CBaseFilter::Unregister() +{ + // get setup data, if it exists + // + LPAMOVIESETUP_FILTER psetupdata = GetSetupData(); + + // check we've got data + // + if( NULL == psetupdata ) return S_FALSE; + + // OLE init is ref counted so call + // just in case we're being called cold. + // + HRESULT hr = CoInitialize( (LPVOID)NULL ); + ASSERT( SUCCEEDED(hr) ); + + // get hold of IFilterMapper + // + IFilterMapper *pIFM; + hr = CoCreateInstance( CLSID_FilterMapper + , NULL + , CLSCTX_INPROC_SERVER + , IID_IFilterMapper + , (void **)&pIFM ); + if( SUCCEEDED(hr) ) + { + hr = AMovieSetupRegisterFilter( psetupdata, pIFM, FALSE ); + + // release interface + // + pIFM->Release(); + } + + // clear up + // + CoFreeUnusedLibraries(); + CoUninitialize(); + + // handle one acceptable "error" - that + // of filter not being registered! + // (couldn't find a suitable #define'd + // name for the error!) + // + if( 0x80070002 == hr) + return NOERROR; + else + return hr; +} + + +//===================================================================== +//===================================================================== +// Implements CEnumPins +//===================================================================== +//===================================================================== + + +CEnumPins::CEnumPins(__in CBaseFilter *pFilter, + __in_opt CEnumPins *pEnumPins) : + m_Position(0), + m_PinCount(0), + m_pFilter(pFilter), + m_cRef(1), // Already ref counted + m_PinCache(NAME("Pin Cache")) +{ + +#ifdef DEBUG + m_dwCookie = DbgRegisterObjectCreation("CEnumPins", 0); +#endif + + /* We must be owned by a filter derived from CBaseFilter */ + + ASSERT(pFilter != NULL); + + /* Hold a reference count on our filter */ + m_pFilter->AddRef(); + + /* Are we creating a new enumerator */ + + if (pEnumPins == NULL) { + m_Version = m_pFilter->GetPinVersion(); + m_PinCount = m_pFilter->GetPinCount(); + } else { + ASSERT(m_Position <= m_PinCount); + m_Position = pEnumPins->m_Position; + m_PinCount = pEnumPins->m_PinCount; + m_Version = pEnumPins->m_Version; + m_PinCache.AddTail(&(pEnumPins->m_PinCache)); + } +} + + +/* Destructor releases the reference count on our filter NOTE since we hold + a reference count on the filter who created us we know it is safe to + release it, no access can be made to it afterwards though as we have just + caused the last reference count to go and the object to be deleted */ + +CEnumPins::~CEnumPins() +{ + m_pFilter->Release(); + +#ifdef DEBUG + DbgRegisterObjectDestruction(m_dwCookie); +#endif +} + + +/* Override this to say what interfaces we support where */ + +STDMETHODIMP +CEnumPins::QueryInterface(REFIID riid, __deref_out void **ppv) +{ + CheckPointer(ppv, E_POINTER); + + /* Do we have this interface */ + + if (riid == IID_IEnumPins || riid == IID_IUnknown) { + return GetInterface((IEnumPins *) this, ppv); + } else { + *ppv = NULL; + return E_NOINTERFACE; + } +} + +STDMETHODIMP_(ULONG) +CEnumPins::AddRef() +{ + return InterlockedIncrement(&m_cRef); +} + +STDMETHODIMP_(ULONG) +CEnumPins::Release() +{ + ULONG cRef = InterlockedDecrement(&m_cRef); + if (cRef == 0) { + delete this; + } + return cRef; +} + +/* One of an enumerator's basic member functions allows us to create a cloned + interface that initially has the same state. Since we are taking a snapshot + of an object (current position and all) we must lock access at the start */ + +STDMETHODIMP +CEnumPins::Clone(__deref_out IEnumPins **ppEnum) +{ + CheckPointer(ppEnum,E_POINTER); + ValidateReadWritePtr(ppEnum,sizeof(IEnumPins *)); + HRESULT hr = NOERROR; + + /* Check we are still in sync with the filter */ + if (AreWeOutOfSync() == TRUE) { + *ppEnum = NULL; + hr = VFW_E_ENUM_OUT_OF_SYNC; + } else { + *ppEnum = new CEnumPins(m_pFilter, + this); + if (*ppEnum == NULL) { + hr = E_OUTOFMEMORY; + } + } + return hr; +} + + +/* Return the next pin after the current position */ + +STDMETHODIMP +CEnumPins::Next(ULONG cPins, // place this many pins... + __out_ecount(cPins) IPin **ppPins, // ...in this array + __out_opt ULONG *pcFetched) // actual count passed returned here +{ + CheckPointer(ppPins,E_POINTER); + ValidateReadWritePtr(ppPins,cPins * sizeof(IPin *)); + + ASSERT(ppPins); + + if (pcFetched!=NULL) { + ValidateWritePtr(pcFetched, sizeof(ULONG)); + *pcFetched = 0; // default unless we succeed + } + // now check that the parameter is valid + else if (cPins>1) { // pcFetched == NULL + return E_INVALIDARG; + } + ULONG cFetched = 0; // increment as we get each one. + + /* Check we are still in sync with the filter */ + if (AreWeOutOfSync() == TRUE) { + // If we are out of sync, we should refresh the enumerator. + // This will reset the position and update the other members, but + // will not clear cache of pins we have already returned. + Refresh(); + } + + /* Return each pin interface NOTE GetPin returns CBasePin * not addrefed + so we must QI for the IPin (which increments its reference count) + If while we are retrieving a pin from the filter an error occurs we + assume that our internal state is stale with respect to the filter + (for example someone has deleted a pin) so we + return VFW_E_ENUM_OUT_OF_SYNC */ + + while (cFetched < cPins && m_PinCount > m_Position) { + + /* Get the next pin object from the filter */ + + CBasePin *pPin = m_pFilter->GetPin(m_Position++); + if (pPin == NULL) { + // If this happend, and it's not the first time through, then we've got a problem, + // since we should really go back and release the iPins, which we have previously + // AddRef'ed. + ASSERT( cFetched==0 ); + return VFW_E_ENUM_OUT_OF_SYNC; + } + + /* We only want to return this pin, if it is not in our cache */ + if (0 == m_PinCache.Find(pPin)) + { + /* From the object get an IPin interface */ + + *ppPins = pPin; + pPin->AddRef(); + + cFetched++; + ppPins++; + + m_PinCache.AddTail(pPin); + } + } + + if (pcFetched!=NULL) { + *pcFetched = cFetched; + } + + return (cPins==cFetched ? NOERROR : S_FALSE); +} + + +/* Skip over one or more entries in the enumerator */ + +STDMETHODIMP +CEnumPins::Skip(ULONG cPins) +{ + /* Check we are still in sync with the filter */ + if (AreWeOutOfSync() == TRUE) { + return VFW_E_ENUM_OUT_OF_SYNC; + } + + /* Work out how many pins are left to skip over */ + /* We could position at the end if we are asked to skip too many... */ + /* ..which would match the base implementation for CEnumMediaTypes::Skip */ + + ULONG PinsLeft = m_PinCount - m_Position; + if (cPins > PinsLeft) { + return S_FALSE; + } + m_Position += cPins; + return NOERROR; +} + + +/* Set the current position back to the start */ +/* Reset has 4 simple steps: + * + * Set position to head of list + * Sync enumerator with object being enumerated + * Clear the cache of pins already returned + * return S_OK + */ + +STDMETHODIMP +CEnumPins::Reset() +{ + m_Version = m_pFilter->GetPinVersion(); + m_PinCount = m_pFilter->GetPinCount(); + + m_Position = 0; + + // Clear the cache + m_PinCache.RemoveAll(); + + return S_OK; +} + + +/* Set the current position back to the start */ +/* Refresh has 3 simple steps: + * + * Set position to head of list + * Sync enumerator with object being enumerated + * return S_OK + */ + +STDMETHODIMP +CEnumPins::Refresh() +{ + m_Version = m_pFilter->GetPinVersion(); + m_PinCount = m_pFilter->GetPinCount(); + + m_Position = 0; + return S_OK; +} + + +//===================================================================== +//===================================================================== +// Implements CEnumMediaTypes +//===================================================================== +//===================================================================== + + +CEnumMediaTypes::CEnumMediaTypes(__in CBasePin *pPin, + __in_opt CEnumMediaTypes *pEnumMediaTypes) : + m_Position(0), + m_pPin(pPin), + m_cRef(1) +{ + +#ifdef DEBUG + m_dwCookie = DbgRegisterObjectCreation("CEnumMediaTypes", 0); +#endif + + /* We must be owned by a pin derived from CBasePin */ + + ASSERT(pPin != NULL); + + /* Hold a reference count on our pin */ + m_pPin->AddRef(); + + /* Are we creating a new enumerator */ + + if (pEnumMediaTypes == NULL) { + m_Version = m_pPin->GetMediaTypeVersion(); + return; + } + + m_Position = pEnumMediaTypes->m_Position; + m_Version = pEnumMediaTypes->m_Version; +} + + +/* Destructor releases the reference count on our base pin. NOTE since we hold + a reference count on the pin who created us we know it is safe to release + it, no access can be made to it afterwards though as we might have just + caused the last reference count to go and the object to be deleted */ + +CEnumMediaTypes::~CEnumMediaTypes() +{ +#ifdef DEBUG + DbgRegisterObjectDestruction(m_dwCookie); +#endif + m_pPin->Release(); +} + + +/* Override this to say what interfaces we support where */ + +STDMETHODIMP +CEnumMediaTypes::QueryInterface(REFIID riid, __deref_out void **ppv) +{ + CheckPointer(ppv, E_POINTER); + + /* Do we have this interface */ + + if (riid == IID_IEnumMediaTypes || riid == IID_IUnknown) { + return GetInterface((IEnumMediaTypes *) this, ppv); + } else { + *ppv = NULL; + return E_NOINTERFACE; + } +} + +STDMETHODIMP_(ULONG) +CEnumMediaTypes::AddRef() +{ + return InterlockedIncrement(&m_cRef); +} + +STDMETHODIMP_(ULONG) +CEnumMediaTypes::Release() +{ + ULONG cRef = InterlockedDecrement(&m_cRef); + if (cRef == 0) { + delete this; + } + return cRef; +} + +/* One of an enumerator's basic member functions allows us to create a cloned + interface that initially has the same state. Since we are taking a snapshot + of an object (current position and all) we must lock access at the start */ + +STDMETHODIMP +CEnumMediaTypes::Clone(__deref_out IEnumMediaTypes **ppEnum) +{ + CheckPointer(ppEnum,E_POINTER); + ValidateReadWritePtr(ppEnum,sizeof(IEnumMediaTypes *)); + HRESULT hr = NOERROR; + + /* Check we are still in sync with the pin */ + if (AreWeOutOfSync() == TRUE) { + *ppEnum = NULL; + hr = VFW_E_ENUM_OUT_OF_SYNC; + } else { + + *ppEnum = new CEnumMediaTypes(m_pPin, + this); + + if (*ppEnum == NULL) { + hr = E_OUTOFMEMORY; + } + } + return hr; +} + + +/* Enumerate the next pin(s) after the current position. The client using this + interface passes in a pointer to an array of pointers each of which will + be filled in with a pointer to a fully initialised media type format + Return NOERROR if it all works, + S_FALSE if fewer than cMediaTypes were enumerated. + VFW_E_ENUM_OUT_OF_SYNC if the enumerator has been broken by + state changes in the filter + The actual count always correctly reflects the number of types in the array. +*/ + +STDMETHODIMP +CEnumMediaTypes::Next(ULONG cMediaTypes, // place this many types... + __out_ecount(cMediaTypes) AM_MEDIA_TYPE **ppMediaTypes, // ...in this array + __out ULONG *pcFetched) // actual count passed +{ + CheckPointer(ppMediaTypes,E_POINTER); + ValidateReadWritePtr(ppMediaTypes,cMediaTypes * sizeof(AM_MEDIA_TYPE *)); + /* Check we are still in sync with the pin */ + if (AreWeOutOfSync() == TRUE) { + return VFW_E_ENUM_OUT_OF_SYNC; + } + + if (pcFetched!=NULL) { + ValidateWritePtr(pcFetched, sizeof(ULONG)); + *pcFetched = 0; // default unless we succeed + } + // now check that the parameter is valid + else if (cMediaTypes>1) { // pcFetched == NULL + return E_INVALIDARG; + } + ULONG cFetched = 0; // increment as we get each one. + + /* Return each media type by asking the filter for them in turn - If we + have an error code retured to us while we are retrieving a media type + we assume that our internal state is stale with respect to the filter + (for example the window size changing) so we return + VFW_E_ENUM_OUT_OF_SYNC */ + + while (cMediaTypes) { + + CMediaType cmt; + + HRESULT hr = m_pPin->GetMediaType(m_Position++, &cmt); + if (S_OK != hr) { + break; + } + + /* We now have a CMediaType object that contains the next media type + but when we assign it to the array position we CANNOT just assign + the AM_MEDIA_TYPE structure because as soon as the object goes out of + scope it will delete the memory we have just copied. The function + we use is CreateMediaType which allocates a task memory block */ + + /* Transfer across the format block manually to save an allocate + and free on the format block and generally go faster */ + + *ppMediaTypes = (AM_MEDIA_TYPE *)CoTaskMemAlloc(sizeof(AM_MEDIA_TYPE)); + if (*ppMediaTypes == NULL) { + break; + } + + /* Do a regular copy */ + **ppMediaTypes = cmt; + + /* Make sure the destructor doesn't free these */ + cmt.pbFormat = NULL; + cmt.cbFormat = NULL; + cmt.pUnk = NULL; + + + ppMediaTypes++; + cFetched++; + cMediaTypes--; + } + + if (pcFetched!=NULL) { + *pcFetched = cFetched; + } + + return ( cMediaTypes==0 ? NOERROR : S_FALSE ); +} + + +/* Skip over one or more entries in the enumerator */ + +STDMETHODIMP +CEnumMediaTypes::Skip(ULONG cMediaTypes) +{ + // If we're skipping 0 elements we're guaranteed to skip the + // correct number of elements + if (cMediaTypes == 0) { + return S_OK; + } + + /* Check we are still in sync with the pin */ + if (AreWeOutOfSync() == TRUE) { + return VFW_E_ENUM_OUT_OF_SYNC; + } + + m_Position += cMediaTypes; + + /* See if we're over the end */ + CMediaType cmt; + return S_OK == m_pPin->GetMediaType(m_Position - 1, &cmt) ? S_OK : S_FALSE; +} + + +/* Set the current position back to the start */ +/* Reset has 3 simple steps: + * + * set position to head of list + * sync enumerator with object being enumerated + * return S_OK + */ + +STDMETHODIMP +CEnumMediaTypes::Reset() + +{ + m_Position = 0; + + // Bring the enumerator back into step with the current state. This + // may be a noop but ensures that the enumerator will be valid on the + // next call. + m_Version = m_pPin->GetMediaTypeVersion(); + return NOERROR; +} + + +//===================================================================== +//===================================================================== +// Implements CBasePin +//===================================================================== +//===================================================================== + + +/* NOTE The implementation of this class calls the CUnknown constructor with + a NULL outer unknown pointer. This has the effect of making us a self + contained class, ie any QueryInterface, AddRef or Release calls will be + routed to the class's NonDelegatingUnknown methods. You will typically + find that the classes that do this then override one or more of these + virtual functions to provide more specialised behaviour. A good example + of this is where a class wants to keep the QueryInterface internal but + still wants its lifetime controlled by the external object */ + +/* Constructor */ + +CBasePin::CBasePin(__in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName, + PIN_DIRECTION dir) : + CUnknown( pObjectName, NULL ), + m_pFilter(pFilter), + m_pLock(pLock), + m_pName(NULL), + m_Connected(NULL), + m_dir(dir), + m_bRunTimeError(FALSE), + m_pQSink(NULL), + m_TypeVersion(1), + m_tStart(), + m_tStop(MAX_TIME), + m_bCanReconnectWhenActive(false), + m_bTryMyTypesFirst(false), + m_dRate(1.0) +{ + /* WARNING - pFilter is often not a properly constituted object at + this state (in particular QueryInterface may not work) - this + is because its owner is often its containing object and we + have been called from the containing object's constructor so + the filter's owner has not yet had its CUnknown constructor + called + */ +#ifdef DXMPERF + PERFLOG_CTOR( pName ? pName : L"CBasePin", (IPin *) this ); +#endif // DXMPERF + + ASSERT(pFilter != NULL); + ASSERT(pLock != NULL); + + if (pName) { + size_t cchName; + HRESULT hr = StringCchLengthW(pName, STRSAFE_MAX_CCH, &cchName); + if (SUCCEEDED(hr)) { + m_pName = new WCHAR[cchName + 1]; + if (m_pName) { + (void)StringCchCopyW(m_pName, cchName + 1, pName); + } + } + } + +#ifdef DEBUG + m_cRef = 0; +#endif +} + +#ifdef UNICODE +CBasePin::CBasePin(__in_opt LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName, + PIN_DIRECTION dir) : + CUnknown( pObjectName, NULL ), + m_pFilter(pFilter), + m_pLock(pLock), + m_pName(NULL), + m_Connected(NULL), + m_dir(dir), + m_bRunTimeError(FALSE), + m_pQSink(NULL), + m_TypeVersion(1), + m_tStart(), + m_tStop(MAX_TIME), + m_bCanReconnectWhenActive(false), + m_bTryMyTypesFirst(false), + m_dRate(1.0) +{ + /* WARNING - pFilter is often not a properly constituted object at + this state (in particular QueryInterface may not work) - this + is because its owner is often its containing object and we + have been called from the containing object's constructor so + the filter's owner has not yet had its CUnknown constructor + called + */ +#ifdef DXMPERF + PERFLOG_CTOR( pName ? pName : L"CBasePin", (IPin *) this ); +#endif // DXMPERF + + ASSERT(pFilter != NULL); + ASSERT(pLock != NULL); + + if (pName) { + size_t cchName; + HRESULT hr = StringCchLengthW(pName, STRSAFE_MAX_CCH, &cchName); + if (SUCCEEDED(hr)) { + m_pName = new WCHAR[cchName + 1]; + if (m_pName) { + (void)StringCchCopyW(m_pName, cchName + 1, pName); + } + } + } + + +#ifdef DEBUG + m_cRef = 0; +#endif +} +#endif + +/* Destructor since a connected pin holds a reference count on us there is + no way that we can be deleted unless we are not currently connected */ + +CBasePin::~CBasePin() +{ +#ifdef DXMPERF + PERFLOG_DTOR( m_pName ? m_pName : L"CBasePin", (IPin *) this ); +#endif // DXMPERF + + // We don't call disconnect because if the filter is going away + // all the pins must have a reference count of zero so they must + // have been disconnected anyway - (but check the assumption) + ASSERT(m_Connected == FALSE); + + delete[] m_pName; + + // check the internal reference count is consistent + ASSERT(m_cRef == 0); +} + + +/* Override this to say what interfaces we support and where */ + +STDMETHODIMP +CBasePin::NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv) +{ + /* Do we have this interface */ + + if (riid == IID_IPin) { + return GetInterface((IPin *) this, ppv); + } else if (riid == IID_IQualityControl) { + return GetInterface((IQualityControl *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +/* Override to increment the owning filter's reference count */ + +STDMETHODIMP_(ULONG) +CBasePin::NonDelegatingAddRef() +{ + ASSERT(InterlockedIncrement(&m_cRef) > 0); + return m_pFilter->AddRef(); +} + + +/* Override to decrement the owning filter's reference count */ + +STDMETHODIMP_(ULONG) +CBasePin::NonDelegatingRelease() +{ + ASSERT(InterlockedDecrement(&m_cRef) >= 0); + return m_pFilter->Release(); +} + + +/* Displays pin connection information */ + +#ifdef DEBUG +void +CBasePin::DisplayPinInfo(IPin *pReceivePin) +{ + + if (DbgCheckModuleLevel(LOG_TRACE, CONNECT_TRACE_LEVEL)) { + PIN_INFO ConnectPinInfo; + PIN_INFO ReceivePinInfo; + + if (FAILED(QueryPinInfo(&ConnectPinInfo))) { + StringCchCopyW(ConnectPinInfo.achName, sizeof(ConnectPinInfo.achName)/sizeof(WCHAR), L"Bad Pin"); + } else { + QueryPinInfoReleaseFilter(ConnectPinInfo); + } + + if (FAILED(pReceivePin->QueryPinInfo(&ReceivePinInfo))) { + StringCchCopyW(ReceivePinInfo.achName, sizeof(ReceivePinInfo.achName)/sizeof(WCHAR), L"Bad Pin"); + } else { + QueryPinInfoReleaseFilter(ReceivePinInfo); + } + + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Trying to connect Pins :"))); + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT(" <%ls>"), ConnectPinInfo.achName)); + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT(" <%ls>"), ReceivePinInfo.achName)); + } +} +#endif + + +/* Displays general information on the pin media type */ + +#ifdef DEBUG +void CBasePin::DisplayTypeInfo(IPin *pPin, const CMediaType *pmt) +{ + UNREFERENCED_PARAMETER(pPin); + if (DbgCheckModuleLevel(LOG_TRACE, CONNECT_TRACE_LEVEL)) { + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Trying media type:"))); + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT(" major type: %hs"), + GuidNames[*pmt->Type()])); + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT(" sub type : %hs"), + GuidNames[*pmt->Subtype()])); + } +} +#endif + +/* Asked to connect to a pin. A pin is always attached to an owning filter + object so we always delegate our locking to that object. We first of all + retrieve a media type enumerator for the input pin and see if we accept + any of the formats that it would ideally like, failing that we retrieve + our enumerator and see if it will accept any of our preferred types */ + +STDMETHODIMP +CBasePin::Connect( + IPin * pReceivePin, + __in_opt const AM_MEDIA_TYPE *pmt // optional media type +) +{ + CheckPointer(pReceivePin,E_POINTER); + ValidateReadPtr(pReceivePin,sizeof(IPin)); + CAutoLock cObjectLock(m_pLock); + DisplayPinInfo(pReceivePin); + + /* See if we are already connected */ + + if (m_Connected) { + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Already connected"))); + return VFW_E_ALREADY_CONNECTED; + } + + /* See if the filter is active */ + if (!IsStopped() && !m_bCanReconnectWhenActive) { + return VFW_E_NOT_STOPPED; + } + + + // Find a mutually agreeable media type - + // Pass in the template media type. If this is partially specified, + // each of the enumerated media types will need to be checked against + // it. If it is non-null and fully specified, we will just try to connect + // with this. + + const CMediaType * ptype = (CMediaType*)pmt; + HRESULT hr = AgreeMediaType(pReceivePin, ptype); + if (FAILED(hr)) { + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Failed to agree type"))); + + // Since the procedure is already returning an error code, there + // is nothing else this function can do to report the error. + EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) ); + +#ifdef DXMPERF + PERFLOG_CONNECT( (IPin *) this, pReceivePin, hr, pmt ); +#endif // DXMPERF + + return hr; + } + + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Connection succeeded"))); + +#ifdef DXMPERF + PERFLOG_CONNECT( (IPin *) this, pReceivePin, NOERROR, pmt ); +#endif // DXMPERF + + return NOERROR; +} + +// given a specific media type, attempt a connection (includes +// checking that the type is acceptable to this pin) +HRESULT +CBasePin::AttemptConnection( + IPin* pReceivePin, // connect to this pin + const CMediaType* pmt // using this type +) +{ + // The caller should hold the filter lock becasue this function + // uses m_Connected. The caller should also hold the filter lock + // because this function calls SetMediaType(), IsStopped() and + // CompleteConnect(). + ASSERT(CritCheckIn(m_pLock)); + + // Check that the connection is valid -- need to do this for every + // connect attempt since BreakConnect will undo it. + HRESULT hr = CheckConnect(pReceivePin); + if (FAILED(hr)) { + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("CheckConnect failed"))); + + // Since the procedure is already returning an error code, there + // is nothing else this function can do to report the error. + EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) ); + + return hr; + } + + DisplayTypeInfo(pReceivePin, pmt); + + /* Check we will accept this media type */ + + hr = CheckMediaType(pmt); + if (hr == NOERROR) { + + /* Make ourselves look connected otherwise ReceiveConnection + may not be able to complete the connection + */ + m_Connected = pReceivePin; + m_Connected->AddRef(); + hr = SetMediaType(pmt); + if (SUCCEEDED(hr)) { + /* See if the other pin will accept this type */ + + hr = pReceivePin->ReceiveConnection((IPin *)this, pmt); + if (SUCCEEDED(hr)) { + /* Complete the connection */ + + hr = CompleteConnect(pReceivePin); + if (SUCCEEDED(hr)) { + return hr; + } else { + DbgLog((LOG_TRACE, + CONNECT_TRACE_LEVEL, + TEXT("Failed to complete connection"))); + pReceivePin->Disconnect(); + } + } + } + } else { + // we cannot use this media type + + // return a specific media type error if there is one + // or map a general failure code to something more helpful + // (in particular S_FALSE gets changed to an error code) + if (SUCCEEDED(hr) || + (hr == E_FAIL) || + (hr == E_INVALIDARG)) { + hr = VFW_E_TYPE_NOT_ACCEPTED; + } + } + + // BreakConnect and release any connection here in case CheckMediaType + // failed, or if we set anything up during a call back during + // ReceiveConnection. + + // Since the procedure is already returning an error code, there + // is nothing else this function can do to report the error. + EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) ); + + /* If failed then undo our state */ + if (m_Connected) { + m_Connected->Release(); + m_Connected = NULL; + } + + return hr; +} + +/* Given an enumerator we cycle through all the media types it proposes and + firstly suggest them to our derived pin class and if that succeeds try + them with the pin in a ReceiveConnection call. This means that if our pin + proposes a media type we still check in here that we can support it. This + is deliberate so that in simple cases the enumerator can hold all of the + media types even if some of them are not really currently available */ + +HRESULT CBasePin::TryMediaTypes( + IPin *pReceivePin, + __in_opt const CMediaType *pmt, + IEnumMediaTypes *pEnum) +{ + /* Reset the current enumerator position */ + + HRESULT hr = pEnum->Reset(); + if (FAILED(hr)) { + return hr; + } + + CMediaType *pMediaType = NULL; + ULONG ulMediaCount = 0; + + // attempt to remember a specific error code if there is one + HRESULT hrFailure = S_OK; + + for (;;) { + + /* Retrieve the next media type NOTE each time round the loop the + enumerator interface will allocate another AM_MEDIA_TYPE structure + If we are successful then we copy it into our output object, if + not then we must delete the memory allocated before returning */ + + hr = pEnum->Next(1, (AM_MEDIA_TYPE**)&pMediaType,&ulMediaCount); + if (hr != S_OK) { + if (S_OK == hrFailure) { + hrFailure = VFW_E_NO_ACCEPTABLE_TYPES; + } + return hrFailure; + } + + + ASSERT(ulMediaCount == 1); + ASSERT(pMediaType); + + // check that this matches the partial type (if any) + + if (pMediaType && + ((pmt == NULL) || + pMediaType->MatchesPartial(pmt))) { + + hr = AttemptConnection(pReceivePin, pMediaType); + + // attempt to remember a specific error code + if (FAILED(hr) && + SUCCEEDED(hrFailure) && + (hr != E_FAIL) && + (hr != E_INVALIDARG) && + (hr != VFW_E_TYPE_NOT_ACCEPTED)) { + hrFailure = hr; + } + } else { + hr = VFW_E_NO_ACCEPTABLE_TYPES; + } + + if(pMediaType) { + DeleteMediaType(pMediaType); + pMediaType = NULL; + } + + if (S_OK == hr) { + return hr; + } + } +} + + +/* This is called to make the connection, including the taask of finding + a media type for the pin connection. pmt is the proposed media type + from the Connect call: if this is fully specified, we will try that. + Otherwise we enumerate and try all the input pin's types first and + if that fails we then enumerate and try all our preferred media types. + For each media type we check it against pmt (if non-null and partially + specified) as well as checking that both pins will accept it. + */ + +HRESULT CBasePin::AgreeMediaType( + IPin *pReceivePin, + const CMediaType *pmt) +{ + ASSERT(pReceivePin); + IEnumMediaTypes *pEnumMediaTypes = NULL; + + // if the media type is fully specified then use that + if ( (pmt != NULL) && (!pmt->IsPartiallySpecified())) { + + // if this media type fails, then we must fail the connection + // since if pmt is nonnull we are only allowed to connect + // using a type that matches it. + + return AttemptConnection(pReceivePin, pmt); + } + + + /* Try the other pin's enumerator */ + + HRESULT hrFailure = VFW_E_NO_ACCEPTABLE_TYPES; + + for (int i = 0; i < 2; i++) { + HRESULT hr; + if (i == (int)m_bTryMyTypesFirst) { + hr = pReceivePin->EnumMediaTypes(&pEnumMediaTypes); + } else { + hr = EnumMediaTypes(&pEnumMediaTypes); + } + if (SUCCEEDED(hr)) { + ASSERT(pEnumMediaTypes); + hr = TryMediaTypes(pReceivePin,pmt,pEnumMediaTypes); + pEnumMediaTypes->Release(); + if (SUCCEEDED(hr)) { + return NOERROR; + } else { + // try to remember specific error codes if there are any + if ((hr != E_FAIL) && + (hr != E_INVALIDARG) && + (hr != VFW_E_TYPE_NOT_ACCEPTED)) { + hrFailure = hr; + } + } + } + } + + return hrFailure; +} + + +/* Called when we want to complete a connection to another filter. Failing + this will also fail the connection and disconnect the other pin as well */ + +HRESULT +CBasePin::CompleteConnect(IPin *pReceivePin) +{ + UNREFERENCED_PARAMETER(pReceivePin); + return NOERROR; +} + + +/* This is called to set the format for a pin connection - CheckMediaType + will have been called to check the connection format and if it didn't + return an error code then this (virtual) function will be invoked */ + +HRESULT +CBasePin::SetMediaType(const CMediaType *pmt) +{ + HRESULT hr = m_mt.Set(*pmt); + if (FAILED(hr)) { + return hr; + } + + return NOERROR; +} + + +/* This is called during Connect() to provide a virtual method that can do + any specific check needed for connection such as QueryInterface. This + base class method just checks that the pin directions don't match */ + +HRESULT +CBasePin::CheckConnect(IPin * pPin) +{ + /* Check that pin directions DONT match */ + + PIN_DIRECTION pd; + pPin->QueryDirection(&pd); + + ASSERT((pd == PINDIR_OUTPUT) || (pd == PINDIR_INPUT)); + ASSERT((m_dir == PINDIR_OUTPUT) || (m_dir == PINDIR_INPUT)); + + // we should allow for non-input and non-output connections? + if (pd == m_dir) { + return VFW_E_INVALID_DIRECTION; + } + return NOERROR; +} + + +/* This is called when we realise we can't make a connection to the pin and + must undo anything we did in CheckConnect - override to release QIs done */ + +HRESULT +CBasePin::BreakConnect() +{ + return NOERROR; +} + + +/* Called normally by an output pin on an input pin to try and establish a + connection. +*/ + +STDMETHODIMP +CBasePin::ReceiveConnection( + IPin * pConnector, // this is the pin who we will connect to + const AM_MEDIA_TYPE *pmt // this is the media type we will exchange +) +{ + CheckPointer(pConnector,E_POINTER); + CheckPointer(pmt,E_POINTER); + ValidateReadPtr(pConnector,sizeof(IPin)); + ValidateReadPtr(pmt,sizeof(AM_MEDIA_TYPE)); + CAutoLock cObjectLock(m_pLock); + + /* Are we already connected */ + if (m_Connected) { + return VFW_E_ALREADY_CONNECTED; + } + + /* See if the filter is active */ + if (!IsStopped() && !m_bCanReconnectWhenActive) { + return VFW_E_NOT_STOPPED; + } + + HRESULT hr = CheckConnect(pConnector); + if (FAILED(hr)) { + // Since the procedure is already returning an error code, there + // is nothing else this function can do to report the error. + EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) ); + +#ifdef DXMPERF + PERFLOG_RXCONNECT( pConnector, (IPin *) this, hr, pmt ); +#endif // DXMPERF + + return hr; + } + + /* Ask derived class if this media type is ok */ + + CMediaType * pcmt = (CMediaType*) pmt; + hr = CheckMediaType(pcmt); + if (hr != NOERROR) { + // no -we don't support this media type + + // Since the procedure is already returning an error code, there + // is nothing else this function can do to report the error. + EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) ); + + // return a specific media type error if there is one + // or map a general failure code to something more helpful + // (in particular S_FALSE gets changed to an error code) + if (SUCCEEDED(hr) || + (hr == E_FAIL) || + (hr == E_INVALIDARG)) { + hr = VFW_E_TYPE_NOT_ACCEPTED; + } + +#ifdef DXMPERF + PERFLOG_RXCONNECT( pConnector, (IPin *) this, hr, pmt ); +#endif // DXMPERF + + return hr; + } + + /* Complete the connection */ + + m_Connected = pConnector; + m_Connected->AddRef(); + hr = SetMediaType(pcmt); + if (SUCCEEDED(hr)) { + hr = CompleteConnect(pConnector); + if (SUCCEEDED(hr)) { + +#ifdef DXMPERF + PERFLOG_RXCONNECT( pConnector, (IPin *) this, NOERROR, pmt ); +#endif // DXMPERF + + return NOERROR; + } + } + + DbgLog((LOG_TRACE, CONNECT_TRACE_LEVEL, TEXT("Failed to set the media type or failed to complete the connection."))); + m_Connected->Release(); + m_Connected = NULL; + + // Since the procedure is already returning an error code, there + // is nothing else this function can do to report the error. + EXECUTE_ASSERT( SUCCEEDED( BreakConnect() ) ); + +#ifdef DXMPERF + PERFLOG_RXCONNECT( pConnector, (IPin *) this, hr, pmt ); +#endif // DXMPERF + + return hr; +} + + +/* Called when we want to terminate a pin connection */ + +STDMETHODIMP +CBasePin::Disconnect() +{ + CAutoLock cObjectLock(m_pLock); + + /* See if the filter is active */ + if (!IsStopped()) { + return VFW_E_NOT_STOPPED; + } + + return DisconnectInternal(); +} + +STDMETHODIMP +CBasePin::DisconnectInternal() +{ + ASSERT(CritCheckIn(m_pLock)); + + if (m_Connected) { + HRESULT hr = BreakConnect(); + if( FAILED( hr ) ) { + +#ifdef DXMPERF + PERFLOG_DISCONNECT( (IPin *) this, m_Connected, hr ); +#endif // DXMPERF + + // There is usually a bug in the program if BreakConnect() fails. + DbgBreak( "WARNING: BreakConnect() failed in CBasePin::Disconnect()." ); + return hr; + } + + m_Connected->Release(); + m_Connected = NULL; + +#ifdef DXMPERF + PERFLOG_DISCONNECT( (IPin *) this, m_Connected, S_OK ); +#endif // DXMPERF + + return S_OK; + } else { + // no connection - not an error + +#ifdef DXMPERF + PERFLOG_DISCONNECT( (IPin *) this, m_Connected, S_FALSE ); +#endif // DXMPERF + + return S_FALSE; + } +} + + +/* Return an AddRef()'d pointer to the connected pin if there is one */ +STDMETHODIMP +CBasePin::ConnectedTo( + __deref_out IPin **ppPin +) +{ + CheckPointer(ppPin,E_POINTER); + ValidateReadWritePtr(ppPin,sizeof(IPin *)); + // + // It's pointless to lock here. + // The caller should ensure integrity. + // + + IPin *pPin = m_Connected; + *ppPin = pPin; + if (pPin != NULL) { + pPin->AddRef(); + return S_OK; + } else { + ASSERT(*ppPin == NULL); + return VFW_E_NOT_CONNECTED; + } +} + +/* Return the media type of the connection */ +STDMETHODIMP +CBasePin::ConnectionMediaType( + __out AM_MEDIA_TYPE *pmt +) +{ + CheckPointer(pmt,E_POINTER); + ValidateReadWritePtr(pmt,sizeof(AM_MEDIA_TYPE)); + CAutoLock cObjectLock(m_pLock); + + /* Copy constructor of m_mt allocates the memory */ + if (IsConnected()) { + CopyMediaType( pmt, &m_mt ); + return S_OK; + } else { + ((CMediaType *)pmt)->InitMediaType(); + return VFW_E_NOT_CONNECTED; + } +} + +/* Return information about the filter we are connect to */ + +STDMETHODIMP +CBasePin::QueryPinInfo( + __out PIN_INFO * pInfo +) +{ + CheckPointer(pInfo,E_POINTER); + ValidateReadWritePtr(pInfo,sizeof(PIN_INFO)); + + pInfo->pFilter = m_pFilter; + if (m_pFilter) { + m_pFilter->AddRef(); + } + + if (m_pName) { + (void)StringCchCopyW(pInfo->achName, NUMELMS(pInfo->achName), m_pName); + } else { + pInfo->achName[0] = L'\0'; + } + + pInfo->dir = m_dir; + + return NOERROR; +} + +STDMETHODIMP +CBasePin::QueryDirection( + __out PIN_DIRECTION * pPinDir +) +{ + CheckPointer(pPinDir,E_POINTER); + ValidateReadWritePtr(pPinDir,sizeof(PIN_DIRECTION)); + + *pPinDir = m_dir; + return NOERROR; +} + +// Default QueryId to return the pin's name +STDMETHODIMP +CBasePin::QueryId( + __deref_out LPWSTR * Id +) +{ + // We're not going away because someone's got a pointer to us + // so there's no need to lock + + return AMGetWideString(Name(), Id); +} + +/* Does this pin support this media type WARNING this interface function does + not lock the main object as it is meant to be asynchronous by nature - if + the media types you support depend on some internal state that is updated + dynamically then you will need to implement locking in a derived class */ + +STDMETHODIMP +CBasePin::QueryAccept( + const AM_MEDIA_TYPE *pmt +) +{ + CheckPointer(pmt,E_POINTER); + ValidateReadPtr(pmt,sizeof(AM_MEDIA_TYPE)); + + /* The CheckMediaType method is valid to return error codes if the media + type is horrible, an example might be E_INVALIDARG. What we do here + is map all the error codes into either S_OK or S_FALSE regardless */ + + HRESULT hr = CheckMediaType((CMediaType*)pmt); + if (FAILED(hr)) { + return S_FALSE; + } + // note that the only defined success codes should be S_OK and S_FALSE... + return hr; +} + + +/* This can be called to return an enumerator for the pin's list of preferred + media types. An input pin is not obliged to have any preferred formats + although it can do. For example, the window renderer has a preferred type + which describes a video image that matches the current window size. All + output pins should expose at least one preferred format otherwise it is + possible that neither pin has any types and so no connection is possible */ + +STDMETHODIMP +CBasePin::EnumMediaTypes( + __deref_out IEnumMediaTypes **ppEnum +) +{ + CheckPointer(ppEnum,E_POINTER); + ValidateReadWritePtr(ppEnum,sizeof(IEnumMediaTypes *)); + + /* Create a new ref counted enumerator */ + + *ppEnum = new CEnumMediaTypes(this, + NULL); + + if (*ppEnum == NULL) { + return E_OUTOFMEMORY; + } + + return NOERROR; +} + + + +/* This is a virtual function that returns a media type corresponding with + place iPosition in the list. This base class simply returns an error as + we support no media types by default but derived classes should override */ + +HRESULT CBasePin::GetMediaType(int iPosition, __inout CMediaType *pMediaType) +{ + UNREFERENCED_PARAMETER(iPosition); + UNREFERENCED_PARAMETER(pMediaType); + return E_UNEXPECTED; +} + + +/* This is a virtual function that returns the current media type version. + The base class initialises the media type enumerators with the value 1 + By default we always returns that same value. A Derived class may change + the list of media types available and after doing so it should increment + the version either in a method derived from this, or more simply by just + incrementing the m_TypeVersion base pin variable. The type enumerators + call this when they want to see if their enumerations are out of date */ + +LONG CBasePin::GetMediaTypeVersion() +{ + return m_TypeVersion; +} + + +/* Increment the cookie representing the current media type version */ + +void CBasePin::IncrementTypeVersion() +{ + InterlockedIncrement(&m_TypeVersion); +} + + +/* Called by IMediaFilter implementation when the state changes from Stopped + to either paused or running and in derived classes could do things like + commit memory and grab hardware resource (the default is to do nothing) */ + +HRESULT +CBasePin::Active(void) +{ + return NOERROR; +} + +/* Called by IMediaFilter implementation when the state changes from + to either paused to running and in derived classes could do things like + commit memory and grab hardware resource (the default is to do nothing) */ + +HRESULT +CBasePin::Run(REFERENCE_TIME tStart) +{ + UNREFERENCED_PARAMETER(tStart); + return NOERROR; +} + + +/* Also called by the IMediaFilter implementation when the state changes to + Stopped at which point you should decommit allocators and free hardware + resources you grabbed in the Active call (default is also to do nothing) */ + +HRESULT +CBasePin::Inactive(void) +{ + m_bRunTimeError = FALSE; + return NOERROR; +} + + +// Called when no more data will arrive +STDMETHODIMP +CBasePin::EndOfStream(void) +{ + return S_OK; +} + + +STDMETHODIMP +CBasePin::SetSink(IQualityControl * piqc) +{ + CAutoLock cObjectLock(m_pLock); + if (piqc) ValidateReadPtr(piqc,sizeof(IQualityControl)); + m_pQSink = piqc; + return NOERROR; +} // SetSink + + +STDMETHODIMP +CBasePin::Notify(IBaseFilter * pSender, Quality q) +{ + UNREFERENCED_PARAMETER(q); + UNREFERENCED_PARAMETER(pSender); + DbgBreak("IQualityControl::Notify not over-ridden from CBasePin. (IGNORE is OK)"); + return E_NOTIMPL; +} //Notify + + +// NewSegment notifies of the start/stop/rate applying to the data +// about to be received. Default implementation records data and +// returns S_OK. +// Override this to pass downstream. +STDMETHODIMP +CBasePin::NewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate) +{ + m_tStart = tStart; + m_tStop = tStop; + m_dRate = dRate; + + return S_OK; +} + + +//===================================================================== +//===================================================================== +// Implements CBaseOutputPin +//===================================================================== +//===================================================================== + + +CBaseOutputPin::CBaseOutputPin(__in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName) : + CBasePin(pObjectName, pFilter, pLock, phr, pName, PINDIR_OUTPUT), + m_pAllocator(NULL), + m_pInputPin(NULL) +{ + ASSERT(pFilter); +} + +#ifdef UNICODE +CBaseOutputPin::CBaseOutputPin(__in_opt LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName) : + CBasePin(pObjectName, pFilter, pLock, phr, pName, PINDIR_OUTPUT), + m_pAllocator(NULL), + m_pInputPin(NULL) +{ + ASSERT(pFilter); +} +#endif + +/* This is called after a media type has been proposed + + Try to complete the connection by agreeing the allocator +*/ +HRESULT +CBaseOutputPin::CompleteConnect(IPin *pReceivePin) +{ + UNREFERENCED_PARAMETER(pReceivePin); + return DecideAllocator(m_pInputPin, &m_pAllocator); +} + + +/* This method is called when the output pin is about to try and connect to + an input pin. It is at this point that you should try and grab any extra + interfaces that you need, in this case IMemInputPin. Because this is + only called if we are not currently connected we do NOT need to call + BreakConnect. This also makes it easier to derive classes from us as + BreakConnect is only called when we actually have to break a connection + (or a partly made connection) and not when we are checking a connection */ + +/* Overriden from CBasePin */ + +HRESULT +CBaseOutputPin::CheckConnect(IPin * pPin) +{ + HRESULT hr = CBasePin::CheckConnect(pPin); + if (FAILED(hr)) { + return hr; + } + + // get an input pin and an allocator interface + hr = pPin->QueryInterface(IID_IMemInputPin, (void **) &m_pInputPin); + if (FAILED(hr)) { + return hr; + } + return NOERROR; +} + + +/* Overriden from CBasePin */ + +HRESULT +CBaseOutputPin::BreakConnect() +{ + /* Release any allocator we hold */ + + if (m_pAllocator) { + // Always decommit the allocator because a downstream filter may or + // may not decommit the connection's allocator. A memory leak could + // occur if the allocator is not decommited when a connection is broken. + HRESULT hr = m_pAllocator->Decommit(); + if( FAILED( hr ) ) { + return hr; + } + + m_pAllocator->Release(); + m_pAllocator = NULL; + } + + /* Release any input pin interface we hold */ + + if (m_pInputPin) { + m_pInputPin->Release(); + m_pInputPin = NULL; + } + return NOERROR; +} + + +/* This is called when the input pin didn't give us a valid allocator */ + +HRESULT +CBaseOutputPin::InitAllocator(__deref_out IMemAllocator **ppAlloc) +{ + return CreateMemoryAllocator(ppAlloc); +} + + +/* Decide on an allocator, override this if you want to use your own allocator + Override DecideBufferSize to call SetProperties. If the input pin fails + the GetAllocator call then this will construct a CMemAllocator and call + DecideBufferSize on that, and if that fails then we are completely hosed. + If the you succeed the DecideBufferSize call, we will notify the input + pin of the selected allocator. NOTE this is called during Connect() which + therefore looks after grabbing and locking the object's critical section */ + +// We query the input pin for its requested properties and pass this to +// DecideBufferSize to allow it to fulfill requests that it is happy +// with (eg most people don't care about alignment and are thus happy to +// use the downstream pin's alignment request). + +HRESULT +CBaseOutputPin::DecideAllocator(IMemInputPin *pPin, __deref_out IMemAllocator **ppAlloc) +{ + HRESULT hr = NOERROR; + *ppAlloc = NULL; + + // get downstream prop request + // the derived class may modify this in DecideBufferSize, but + // we assume that he will consistently modify it the same way, + // so we only get it once + ALLOCATOR_PROPERTIES prop; + ZeroMemory(&prop, sizeof(prop)); + + // whatever he returns, we assume prop is either all zeros + // or he has filled it out. + pPin->GetAllocatorRequirements(&prop); + + // if he doesn't care about alignment, then set it to 1 + if (prop.cbAlign == 0) { + prop.cbAlign = 1; + } + + /* Try the allocator provided by the input pin */ + + hr = pPin->GetAllocator(ppAlloc); + if (SUCCEEDED(hr)) { + + hr = DecideBufferSize(*ppAlloc, &prop); + if (SUCCEEDED(hr)) { + hr = pPin->NotifyAllocator(*ppAlloc, FALSE); + if (SUCCEEDED(hr)) { + return NOERROR; + } + } + } + + /* If the GetAllocator failed we may not have an interface */ + + if (*ppAlloc) { + (*ppAlloc)->Release(); + *ppAlloc = NULL; + } + + /* Try the output pin's allocator by the same method */ + + hr = InitAllocator(ppAlloc); + if (SUCCEEDED(hr)) { + + // note - the properties passed here are in the same + // structure as above and may have been modified by + // the previous call to DecideBufferSize + hr = DecideBufferSize(*ppAlloc, &prop); + if (SUCCEEDED(hr)) { + hr = pPin->NotifyAllocator(*ppAlloc, FALSE); + if (SUCCEEDED(hr)) { + return NOERROR; + } + } + } + + /* Likewise we may not have an interface to release */ + + if (*ppAlloc) { + (*ppAlloc)->Release(); + *ppAlloc = NULL; + } + return hr; +} + + +/* This returns an empty sample buffer from the allocator WARNING the same + dangers and restrictions apply here as described below for Deliver() */ + +HRESULT +CBaseOutputPin::GetDeliveryBuffer(__deref_out IMediaSample ** ppSample, + __in_opt REFERENCE_TIME * pStartTime, + __in_opt REFERENCE_TIME * pEndTime, + DWORD dwFlags) +{ + if (m_pAllocator != NULL) { + return m_pAllocator->GetBuffer(ppSample,pStartTime,pEndTime,dwFlags); + } else { + return E_NOINTERFACE; + } +} + + +/* Deliver a filled-in sample to the connected input pin. NOTE the object must + have locked itself before calling us otherwise we may get halfway through + executing this method only to find the filter graph has got in and + disconnected us from the input pin. If the filter has no worker threads + then the lock is best applied on Receive(), otherwise it should be done + when the worker thread is ready to deliver. There is a wee snag to worker + threads that this shows up. The worker thread must lock the object when + it is ready to deliver a sample, but it may have to wait until a state + change has completed, but that may never complete because the state change + is waiting for the worker thread to complete. The way to handle this is for + the state change code to grab the critical section, then set an abort event + for the worker thread, then release the critical section and wait for the + worker thread to see the event we set and then signal that it has finished + (with another event). At which point the state change code can complete */ + +// note (if you've still got any breath left after reading that) that you +// need to release the sample yourself after this call. if the connected +// input pin needs to hold onto the sample beyond the call, it will addref +// the sample itself. + +// of course you must release this one and call GetDeliveryBuffer for the +// next. You cannot reuse it directly. + +HRESULT +CBaseOutputPin::Deliver(IMediaSample * pSample) +{ + if (m_pInputPin == NULL) { + return VFW_E_NOT_CONNECTED; + } + +#ifdef DXMPERF + PERFLOG_DELIVER( m_pName ? m_pName : L"CBaseOutputPin", (IPin *) this, (IPin *) m_pInputPin, pSample, &m_mt ); +#endif // DXMPERF + + return m_pInputPin->Receive(pSample); +} + + +// called from elsewhere in our filter to pass EOS downstream to +// our connected input pin +HRESULT +CBaseOutputPin::DeliverEndOfStream(void) +{ + // remember this is on IPin not IMemInputPin + if (m_Connected == NULL) { + return VFW_E_NOT_CONNECTED; + } + return m_Connected->EndOfStream(); +} + + +/* Commit the allocator's memory, this is called through IMediaFilter + which is responsible for locking the object before calling us */ + +HRESULT +CBaseOutputPin::Active(void) +{ + if (m_pAllocator == NULL) { + return VFW_E_NO_ALLOCATOR; + } + return m_pAllocator->Commit(); +} + + +/* Free up or unprepare allocator's memory, this is called through + IMediaFilter which is responsible for locking the object first */ + +HRESULT +CBaseOutputPin::Inactive(void) +{ + m_bRunTimeError = FALSE; + if (m_pAllocator == NULL) { + return VFW_E_NO_ALLOCATOR; + } + return m_pAllocator->Decommit(); +} + +// we have a default handling of EndOfStream which is to return +// an error, since this should be called on input pins only +STDMETHODIMP +CBaseOutputPin::EndOfStream(void) +{ + return E_UNEXPECTED; +} + + +// BeginFlush should be called on input pins only +STDMETHODIMP +CBaseOutputPin::BeginFlush(void) +{ + return E_UNEXPECTED; +} + +// EndFlush should be called on input pins only +STDMETHODIMP +CBaseOutputPin::EndFlush(void) +{ + return E_UNEXPECTED; +} + +// call BeginFlush on the connected input pin +HRESULT +CBaseOutputPin::DeliverBeginFlush(void) +{ + // remember this is on IPin not IMemInputPin + if (m_Connected == NULL) { + return VFW_E_NOT_CONNECTED; + } + return m_Connected->BeginFlush(); +} + +// call EndFlush on the connected input pin +HRESULT +CBaseOutputPin::DeliverEndFlush(void) +{ + // remember this is on IPin not IMemInputPin + if (m_Connected == NULL) { + return VFW_E_NOT_CONNECTED; + } + return m_Connected->EndFlush(); +} +// deliver NewSegment to connected pin +HRESULT +CBaseOutputPin::DeliverNewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate) +{ + if (m_Connected == NULL) { + return VFW_E_NOT_CONNECTED; + } + return m_Connected->NewSegment(tStart, tStop, dRate); +} + + +//===================================================================== +//===================================================================== +// Implements CBaseInputPin +//===================================================================== +//===================================================================== + + +/* Constructor creates a default allocator object */ + +CBaseInputPin::CBaseInputPin(__in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pPinName) : + CBasePin(pObjectName, pFilter, pLock, phr, pPinName, PINDIR_INPUT), + m_pAllocator(NULL), + m_bReadOnly(FALSE), + m_bFlushing(FALSE) +{ + ZeroMemory(&m_SampleProps, sizeof(m_SampleProps)); +} + +#ifdef UNICODE +CBaseInputPin::CBaseInputPin(__in LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pPinName) : + CBasePin(pObjectName, pFilter, pLock, phr, pPinName, PINDIR_INPUT), + m_pAllocator(NULL), + m_bReadOnly(FALSE), + m_bFlushing(FALSE) +{ + ZeroMemory(&m_SampleProps, sizeof(m_SampleProps)); +} +#endif + +/* Destructor releases it's reference count on the default allocator */ + +CBaseInputPin::~CBaseInputPin() +{ + if (m_pAllocator != NULL) { + m_pAllocator->Release(); + m_pAllocator = NULL; + } +} + + +// override this to publicise our interfaces +STDMETHODIMP +CBaseInputPin::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + /* Do we know about this interface */ + + if (riid == IID_IMemInputPin) { + return GetInterface((IMemInputPin *) this, ppv); + } else { + return CBasePin::NonDelegatingQueryInterface(riid, ppv); + } +} + + +/* Return the allocator interface that this input pin would like the output + pin to use. NOTE subsequent calls to GetAllocator should all return an + interface onto the SAME object so we create one object at the start + + Note: + The allocator is Release()'d on disconnect and replaced on + NotifyAllocator(). + + Override this to provide your own allocator. +*/ + +STDMETHODIMP +CBaseInputPin::GetAllocator( + __deref_out IMemAllocator **ppAllocator) +{ + CheckPointer(ppAllocator,E_POINTER); + ValidateReadWritePtr(ppAllocator,sizeof(IMemAllocator *)); + CAutoLock cObjectLock(m_pLock); + + if (m_pAllocator == NULL) { + HRESULT hr = CreateMemoryAllocator(&m_pAllocator); + if (FAILED(hr)) { + return hr; + } + } + ASSERT(m_pAllocator != NULL); + *ppAllocator = m_pAllocator; + m_pAllocator->AddRef(); + return NOERROR; +} + + +/* Tell the input pin which allocator the output pin is actually going to use + Override this if you care - NOTE the locking we do both here and also in + GetAllocator is unnecessary but derived classes that do something useful + will undoubtedly have to lock the object so this might help remind people */ + +STDMETHODIMP +CBaseInputPin::NotifyAllocator( + IMemAllocator * pAllocator, + BOOL bReadOnly) +{ + CheckPointer(pAllocator,E_POINTER); + ValidateReadPtr(pAllocator,sizeof(IMemAllocator)); + CAutoLock cObjectLock(m_pLock); + + IMemAllocator *pOldAllocator = m_pAllocator; + pAllocator->AddRef(); + m_pAllocator = pAllocator; + + if (pOldAllocator != NULL) { + pOldAllocator->Release(); + } + + // the readonly flag indicates whether samples from this allocator should + // be regarded as readonly - if true, then inplace transforms will not be + // allowed. + m_bReadOnly = (BYTE)bReadOnly; + return NOERROR; +} + + +HRESULT +CBaseInputPin::BreakConnect() +{ + /* We don't need our allocator any more */ + if (m_pAllocator) { + // Always decommit the allocator because a downstream filter may or + // may not decommit the connection's allocator. A memory leak could + // occur if the allocator is not decommited when a pin is disconnected. + HRESULT hr = m_pAllocator->Decommit(); + if( FAILED( hr ) ) { + return hr; + } + + m_pAllocator->Release(); + m_pAllocator = NULL; + } + + return S_OK; +} + + +/* Do something with this media sample - this base class checks to see if the + format has changed with this media sample and if so checks that the filter + will accept it, generating a run time error if not. Once we have raised a + run time error we set a flag so that no more samples will be accepted + + It is important that any filter should override this method and implement + synchronization so that samples are not processed when the pin is + disconnected etc +*/ + +STDMETHODIMP +CBaseInputPin::Receive(IMediaSample *pSample) +{ + CheckPointer(pSample,E_POINTER); + ValidateReadPtr(pSample,sizeof(IMediaSample)); + ASSERT(pSample); + + HRESULT hr = CheckStreaming(); + if (S_OK != hr) { + return hr; + } + +#ifdef DXMPERF + PERFLOG_RECEIVE( m_pName ? m_pName : L"CBaseInputPin", (IPin *) m_Connected, (IPin *) this, pSample, &m_mt ); +#endif // DXMPERF + + + /* Check for IMediaSample2 */ + IMediaSample2 *pSample2; + if (SUCCEEDED(pSample->QueryInterface(IID_IMediaSample2, (void **)&pSample2))) { + hr = pSample2->GetProperties(sizeof(m_SampleProps), (PBYTE)&m_SampleProps); + pSample2->Release(); + if (FAILED(hr)) { + return hr; + } + } else { + /* Get the properties the hard way */ + m_SampleProps.cbData = sizeof(m_SampleProps); + m_SampleProps.dwTypeSpecificFlags = 0; + m_SampleProps.dwStreamId = AM_STREAM_MEDIA; + m_SampleProps.dwSampleFlags = 0; + if (S_OK == pSample->IsDiscontinuity()) { + m_SampleProps.dwSampleFlags |= AM_SAMPLE_DATADISCONTINUITY; + } + if (S_OK == pSample->IsPreroll()) { + m_SampleProps.dwSampleFlags |= AM_SAMPLE_PREROLL; + } + if (S_OK == pSample->IsSyncPoint()) { + m_SampleProps.dwSampleFlags |= AM_SAMPLE_SPLICEPOINT; + } + if (SUCCEEDED(pSample->GetTime(&m_SampleProps.tStart, + &m_SampleProps.tStop))) { + m_SampleProps.dwSampleFlags |= AM_SAMPLE_TIMEVALID | + AM_SAMPLE_STOPVALID; + } + if (S_OK == pSample->GetMediaType(&m_SampleProps.pMediaType)) { + m_SampleProps.dwSampleFlags |= AM_SAMPLE_TYPECHANGED; + } + pSample->GetPointer(&m_SampleProps.pbBuffer); + m_SampleProps.lActual = pSample->GetActualDataLength(); + m_SampleProps.cbBuffer = pSample->GetSize(); + } + + /* Has the format changed in this sample */ + + if (!(m_SampleProps.dwSampleFlags & AM_SAMPLE_TYPECHANGED)) { + return NOERROR; + } + + /* Check the derived class accepts this format */ + /* This shouldn't fail as the source must call QueryAccept first */ + + hr = CheckMediaType((CMediaType *)m_SampleProps.pMediaType); + + if (hr == NOERROR) { + return NOERROR; + } + + /* Raise a runtime error if we fail the media type */ + + m_bRunTimeError = TRUE; + EndOfStream(); + m_pFilter->NotifyEvent(EC_ERRORABORT,VFW_E_TYPE_NOT_ACCEPTED,0); + return VFW_E_INVALIDMEDIATYPE; +} + + +/* Receive multiple samples */ +STDMETHODIMP +CBaseInputPin::ReceiveMultiple ( + __in_ecount(nSamples) IMediaSample **pSamples, + long nSamples, + __out long *nSamplesProcessed) +{ + CheckPointer(pSamples,E_POINTER); + ValidateReadPtr(pSamples,nSamples * sizeof(IMediaSample *)); + + HRESULT hr = S_OK; + *nSamplesProcessed = 0; + while (nSamples-- > 0) { + hr = Receive(pSamples[*nSamplesProcessed]); + + /* S_FALSE means don't send any more */ + if (hr != S_OK) { + break; + } + (*nSamplesProcessed)++; + } + return hr; +} + +/* See if Receive() might block */ +STDMETHODIMP +CBaseInputPin::ReceiveCanBlock() +{ + /* Ask all the output pins if they block + If there are no output pin assume we do block + */ + int cPins = m_pFilter->GetPinCount(); + int cOutputPins = 0; + for (int c = 0; c < cPins; c++) { + CBasePin *pPin = m_pFilter->GetPin(c); + if (NULL == pPin) { + break; + } + PIN_DIRECTION pd; + HRESULT hr = pPin->QueryDirection(&pd); + if (FAILED(hr)) { + return hr; + } + + if (pd == PINDIR_OUTPUT) { + + IPin *pConnected; + hr = pPin->ConnectedTo(&pConnected); + if (SUCCEEDED(hr)) { + ASSERT(pConnected != NULL); + cOutputPins++; + IMemInputPin *pInputPin; + hr = pConnected->QueryInterface( + IID_IMemInputPin, + (void **)&pInputPin); + pConnected->Release(); + if (SUCCEEDED(hr)) { + hr = pInputPin->ReceiveCanBlock(); + pInputPin->Release(); + if (hr != S_FALSE) { + return S_OK; + } + } else { + /* There's a transport we don't understand here */ + return S_OK; + } + } + } + } + return cOutputPins == 0 ? S_OK : S_FALSE; +} + +// Default handling for BeginFlush - call at the beginning +// of your implementation (makes sure that all Receive calls +// fail). After calling this, you need to free any queued data +// and then call downstream. +STDMETHODIMP +CBaseInputPin::BeginFlush(void) +{ + // BeginFlush is NOT synchronized with streaming but is part of + // a control action - hence we synchronize with the filter + CAutoLock lck(m_pLock); + + // if we are already in mid-flush, this is probably a mistake + // though not harmful - try to pick it up for now so I can think about it + ASSERT(!m_bFlushing); + + // first thing to do is ensure that no further Receive calls succeed + m_bFlushing = TRUE; + + // now discard any data and call downstream - must do that + // in derived classes + return S_OK; +} + +// default handling for EndFlush - call at end of your implementation +// - before calling this, ensure that there is no queued data and no thread +// pushing any more without a further receive, then call downstream, +// then call this method to clear the m_bFlushing flag and re-enable +// receives +STDMETHODIMP +CBaseInputPin::EndFlush(void) +{ + // Endlush is NOT synchronized with streaming but is part of + // a control action - hence we synchronize with the filter + CAutoLock lck(m_pLock); + + // almost certainly a mistake if we are not in mid-flush + ASSERT(m_bFlushing); + + // before calling, sync with pushing thread and ensure + // no more data is going downstream, then call EndFlush on + // downstream pins. + + // now re-enable Receives + m_bFlushing = FALSE; + + // No more errors + m_bRunTimeError = FALSE; + + return S_OK; +} + + +STDMETHODIMP +CBaseInputPin::Notify(IBaseFilter * pSender, Quality q) +{ + UNREFERENCED_PARAMETER(q); + CheckPointer(pSender,E_POINTER); + ValidateReadPtr(pSender,sizeof(IBaseFilter)); + DbgBreak("IQuality::Notify called on an input pin"); + return NOERROR; +} // Notify + +/* Free up or unprepare allocator's memory, this is called through + IMediaFilter which is responsible for locking the object first */ + +HRESULT +CBaseInputPin::Inactive(void) +{ + m_bRunTimeError = FALSE; + if (m_pAllocator == NULL) { + return VFW_E_NO_ALLOCATOR; + } + + m_bFlushing = FALSE; + + return m_pAllocator->Decommit(); +} + +// what requirements do we have of the allocator - override if you want +// to support other people's allocators but need a specific alignment +// or prefix. +STDMETHODIMP +CBaseInputPin::GetAllocatorRequirements(__out ALLOCATOR_PROPERTIES*pProps) +{ + UNREFERENCED_PARAMETER(pProps); + return E_NOTIMPL; +} + +// Check if it's OK to process data +// +HRESULT +CBaseInputPin::CheckStreaming() +{ + // Shouldn't be able to get any data if we're not connected! + ASSERT(IsConnected()); + + // Don't process stuff in Stopped state + if (IsStopped()) { + return VFW_E_WRONG_STATE; + } + if (m_bFlushing) { + return S_FALSE; + } + if (m_bRunTimeError) { + return VFW_E_RUNTIME_ERROR; + } + return S_OK; +} + +// Pass on the Quality notification q to +// a. Our QualityControl sink (if we have one) or else +// b. to our upstream filter +// and if that doesn't work, throw it away with a bad return code +HRESULT +CBaseInputPin::PassNotify(Quality& q) +{ + // We pass the message on, which means that we find the quality sink + // for our input pin and send it there + + DbgLog((LOG_TRACE,3,TEXT("Passing Quality notification through transform"))); + if (m_pQSink!=NULL) { + return m_pQSink->Notify(m_pFilter, q); + } else { + // no sink set, so pass it upstream + HRESULT hr; + IQualityControl * pIQC; + + hr = VFW_E_NOT_FOUND; // default + if (m_Connected) { + m_Connected->QueryInterface(IID_IQualityControl, (void**)&pIQC); + + if (pIQC!=NULL) { + hr = pIQC->Notify(m_pFilter, q); + pIQC->Release(); + } + } + return hr; + } + +} // PassNotify + +//===================================================================== +//===================================================================== +// Memory allocation class, implements CMediaSample +//===================================================================== +//===================================================================== + + +/* NOTE The implementation of this class calls the CUnknown constructor with + a NULL outer unknown pointer. This has the effect of making us a self + contained class, ie any QueryInterface, AddRef or Release calls will be + routed to the class's NonDelegatingUnknown methods. You will typically + find that the classes that do this then override one or more of these + virtual functions to provide more specialised behaviour. A good example + of this is where a class wants to keep the QueryInterface internal but + still wants it's lifetime controlled by the external object */ + +/* The last two parameters have default values of NULL and zero */ + +CMediaSample::CMediaSample(__in_opt LPCTSTR pName, + __in_opt CBaseAllocator *pAllocator, + __inout_opt HRESULT *phr, + __in_bcount_opt(length) LPBYTE pBuffer, + LONG length) : + m_pBuffer(pBuffer), // Initialise the buffer + m_cbBuffer(length), // And it's length + m_lActual(length), // By default, actual = length + m_pMediaType(NULL), // No media type change + m_dwFlags(0), // Nothing set + m_cRef(0), // 0 ref count + m_dwTypeSpecificFlags(0), // Type specific flags + m_dwStreamId(AM_STREAM_MEDIA), // Stream id + m_pAllocator(pAllocator) // Allocator +{ +#ifdef DXMPERF + PERFLOG_CTOR( pName ? pName : L"CMediaSample", (IMediaSample *) this ); +#endif // DXMPERF + + /* We must have an owner and it must also be derived from class + CBaseAllocator BUT we do not hold a reference count on it */ + + ASSERT(pAllocator); + + if (length < 0) { + *phr = VFW_E_BUFFER_OVERFLOW; + m_cbBuffer = 0; + } +} + +#ifdef UNICODE +CMediaSample::CMediaSample(__in_opt LPCSTR pName, + __in_opt CBaseAllocator *pAllocator, + __inout_opt HRESULT *phr, + __in_bcount_opt(length) LPBYTE pBuffer, + LONG length) : + m_pBuffer(pBuffer), // Initialise the buffer + m_cbBuffer(length), // And it's length + m_lActual(length), // By default, actual = length + m_pMediaType(NULL), // No media type change + m_dwFlags(0), // Nothing set + m_cRef(0), // 0 ref count + m_dwTypeSpecificFlags(0), // Type specific flags + m_dwStreamId(AM_STREAM_MEDIA), // Stream id + m_pAllocator(pAllocator) // Allocator +{ +#ifdef DXMPERF + PERFLOG_CTOR( L"CMediaSample", (IMediaSample *) this ); +#endif // DXMPERF + + /* We must have an owner and it must also be derived from class + CBaseAllocator BUT we do not hold a reference count on it */ + + ASSERT(pAllocator); +} +#endif + +/* Destructor deletes the media type memory */ + +CMediaSample::~CMediaSample() +{ +#ifdef DXMPERF + PERFLOG_DTOR( L"CMediaSample", (IMediaSample *) this ); +#endif // DXMPERF + + if (m_pMediaType) { + DeleteMediaType(m_pMediaType); + } +} + +/* Override this to publicise our interfaces */ + +STDMETHODIMP +CMediaSample::QueryInterface(REFIID riid, __deref_out void **ppv) +{ + if (riid == IID_IMediaSample || + riid == IID_IMediaSample2 || + riid == IID_IUnknown) { + return GetInterface((IMediaSample *) this, ppv); + } else { + *ppv = NULL; + return E_NOINTERFACE; + } +} + +STDMETHODIMP_(ULONG) +CMediaSample::AddRef() +{ + return InterlockedIncrement(&m_cRef); +} + + +// -- CMediaSample lifetimes -- +// +// On final release of this sample buffer it is not deleted but +// returned to the freelist of the owning memory allocator +// +// The allocator may be waiting for the last buffer to be placed on the free +// list in order to decommit all the memory, so the ReleaseBuffer() call may +// result in this sample being deleted. We also need to hold a refcount on +// the allocator to stop that going away until we have finished with this. +// However, we cannot release the allocator before the ReleaseBuffer, as the +// release may cause us to be deleted. Similarly we can't do it afterwards. +// +// Thus we must leave it to the allocator to hold an addref on our behalf. +// When he issues us in GetBuffer, he addref's himself. When ReleaseBuffer +// is called, he releases himself, possibly causing us and him to be deleted. + + +STDMETHODIMP_(ULONG) +CMediaSample::Release() +{ + /* Decrement our own private reference count */ + LONG lRef; + if (m_cRef == 1) { + lRef = 0; + m_cRef = 0; + } else { + lRef = InterlockedDecrement(&m_cRef); + } + ASSERT(lRef >= 0); + + DbgLog((LOG_MEMORY,3,TEXT(" Unknown %X ref-- = %d"), + this, m_cRef)); + + /* Did we release our final reference count */ + if (lRef == 0) { + /* Free all resources */ + if (m_dwFlags & Sample_TypeChanged) { + SetMediaType(NULL); + } + ASSERT(m_pMediaType == NULL); + m_dwFlags = 0; + m_dwTypeSpecificFlags = 0; + m_dwStreamId = AM_STREAM_MEDIA; + + /* This may cause us to be deleted */ + // Our refcount is reliably 0 thus no-one will mess with us + m_pAllocator->ReleaseBuffer(this); + } + return (ULONG)lRef; +} + + +// set the buffer pointer and length. Used by allocators that +// want variable sized pointers or pointers into already-read data. +// This is only available through a CMediaSample* not an IMediaSample* +// and so cannot be changed by clients. +HRESULT +CMediaSample::SetPointer(__in_bcount(cBytes) BYTE * ptr, LONG cBytes) +{ + if (cBytes < 0) { + return VFW_E_BUFFER_OVERFLOW; + } + m_pBuffer = ptr; // new buffer area (could be null) + m_cbBuffer = cBytes; // length of buffer + m_lActual = cBytes; // length of data in buffer (assume full) + + return S_OK; +} + + +// get me a read/write pointer to this buffer's memory. I will actually +// want to use sizeUsed bytes. +STDMETHODIMP +CMediaSample::GetPointer(__deref_out BYTE ** ppBuffer) +{ + ValidateReadWritePtr(ppBuffer,sizeof(BYTE *)); + + // creator must have set pointer either during + // constructor or by SetPointer + ASSERT(m_pBuffer); + + *ppBuffer = m_pBuffer; + return NOERROR; +} + + +// return the size in bytes of this buffer +STDMETHODIMP_(LONG) +CMediaSample::GetSize(void) +{ + return m_cbBuffer; +} + + +// get the stream time at which this sample should start and finish. +STDMETHODIMP +CMediaSample::GetTime( + __out REFERENCE_TIME * pTimeStart, // put time here + __out REFERENCE_TIME * pTimeEnd +) +{ + ValidateReadWritePtr(pTimeStart,sizeof(REFERENCE_TIME)); + ValidateReadWritePtr(pTimeEnd,sizeof(REFERENCE_TIME)); + + if (!(m_dwFlags & Sample_StopValid)) { + if (!(m_dwFlags & Sample_TimeValid)) { + return VFW_E_SAMPLE_TIME_NOT_SET; + } else { + *pTimeStart = m_Start; + + // Make sure old stuff works + *pTimeEnd = m_Start + 1; + return VFW_S_NO_STOP_TIME; + } + } + + *pTimeStart = m_Start; + *pTimeEnd = m_End; + return NOERROR; +} + + +// Set the stream time at which this sample should start and finish. +// NULL pointers means the time is reset +STDMETHODIMP +CMediaSample::SetTime( + __in_opt REFERENCE_TIME * pTimeStart, + __in_opt REFERENCE_TIME * pTimeEnd +) +{ + if (pTimeStart == NULL) { + ASSERT(pTimeEnd == NULL); + m_dwFlags &= ~(Sample_TimeValid | Sample_StopValid); + } else { + if (pTimeEnd == NULL) { + m_Start = *pTimeStart; + m_dwFlags |= Sample_TimeValid; + m_dwFlags &= ~Sample_StopValid; + } else { + ValidateReadPtr(pTimeStart,sizeof(REFERENCE_TIME)); + ValidateReadPtr(pTimeEnd,sizeof(REFERENCE_TIME)); + ASSERT(*pTimeEnd >= *pTimeStart); + + m_Start = *pTimeStart; + m_End = *pTimeEnd; + m_dwFlags |= Sample_TimeValid | Sample_StopValid; + } + } + return NOERROR; +} + + +// get the media times (eg bytes) for this sample +STDMETHODIMP +CMediaSample::GetMediaTime( + __out LONGLONG * pTimeStart, + __out LONGLONG * pTimeEnd +) +{ + ValidateReadWritePtr(pTimeStart,sizeof(LONGLONG)); + ValidateReadWritePtr(pTimeEnd,sizeof(LONGLONG)); + + if (!(m_dwFlags & Sample_MediaTimeValid)) { + return VFW_E_MEDIA_TIME_NOT_SET; + } + + *pTimeStart = m_MediaStart; + *pTimeEnd = (m_MediaStart + m_MediaEnd); + return NOERROR; +} + + +// Set the media times for this sample +STDMETHODIMP +CMediaSample::SetMediaTime( + __in_opt LONGLONG * pTimeStart, + __in_opt LONGLONG * pTimeEnd +) +{ + if (pTimeStart == NULL) { + ASSERT(pTimeEnd == NULL); + m_dwFlags &= ~Sample_MediaTimeValid; + } else { + if (NULL == pTimeEnd) { + return E_POINTER; + } + ValidateReadPtr(pTimeStart,sizeof(LONGLONG)); + ValidateReadPtr(pTimeEnd,sizeof(LONGLONG)); + ASSERT(*pTimeEnd >= *pTimeStart); + + m_MediaStart = *pTimeStart; + m_MediaEnd = (LONG)(*pTimeEnd - *pTimeStart); + m_dwFlags |= Sample_MediaTimeValid; + } + return NOERROR; +} + + +STDMETHODIMP +CMediaSample::IsSyncPoint(void) +{ + if (m_dwFlags & Sample_SyncPoint) { + return S_OK; + } else { + return S_FALSE; + } +} + + +STDMETHODIMP +CMediaSample::SetSyncPoint(BOOL bIsSyncPoint) +{ + if (bIsSyncPoint) { + m_dwFlags |= Sample_SyncPoint; + } else { + m_dwFlags &= ~Sample_SyncPoint; + } + return NOERROR; +} + +// returns S_OK if there is a discontinuity in the data (this same is +// not a continuation of the previous stream of data +// - there has been a seek). +STDMETHODIMP +CMediaSample::IsDiscontinuity(void) +{ + if (m_dwFlags & Sample_Discontinuity) { + return S_OK; + } else { + return S_FALSE; + } +} + +// set the discontinuity property - TRUE if this sample is not a +// continuation, but a new sample after a seek. +STDMETHODIMP +CMediaSample::SetDiscontinuity(BOOL bDiscont) +{ + // should be TRUE or FALSE + if (bDiscont) { + m_dwFlags |= Sample_Discontinuity; + } else { + m_dwFlags &= ~Sample_Discontinuity; + } + return S_OK; +} + +STDMETHODIMP +CMediaSample::IsPreroll(void) +{ + if (m_dwFlags & Sample_Preroll) { + return S_OK; + } else { + return S_FALSE; + } +} + + +STDMETHODIMP +CMediaSample::SetPreroll(BOOL bIsPreroll) +{ + if (bIsPreroll) { + m_dwFlags |= Sample_Preroll; + } else { + m_dwFlags &= ~Sample_Preroll; + } + return NOERROR; +} + +STDMETHODIMP_(LONG) +CMediaSample::GetActualDataLength(void) +{ + return m_lActual; +} + + +STDMETHODIMP +CMediaSample::SetActualDataLength(LONG lActual) +{ + if (lActual > m_cbBuffer || lActual < 0) { + ASSERT(lActual <= GetSize()); + return VFW_E_BUFFER_OVERFLOW; + } + m_lActual = lActual; + return NOERROR; +} + + +/* These allow for limited format changes in band */ + +STDMETHODIMP +CMediaSample::GetMediaType(__deref_out AM_MEDIA_TYPE **ppMediaType) +{ + ValidateReadWritePtr(ppMediaType,sizeof(AM_MEDIA_TYPE *)); + ASSERT(ppMediaType); + + /* Do we have a new media type for them */ + + if (!(m_dwFlags & Sample_TypeChanged)) { + ASSERT(m_pMediaType == NULL); + *ppMediaType = NULL; + return S_FALSE; + } + + ASSERT(m_pMediaType); + + /* Create a copy of our media type */ + + *ppMediaType = CreateMediaType(m_pMediaType); + if (*ppMediaType == NULL) { + return E_OUTOFMEMORY; + } + return NOERROR; +} + + +/* Mark this sample as having a different format type */ + +STDMETHODIMP +CMediaSample::SetMediaType(__in_opt AM_MEDIA_TYPE *pMediaType) +{ + /* Delete the current media type */ + + if (m_pMediaType) { + DeleteMediaType(m_pMediaType); + m_pMediaType = NULL; + } + + /* Mechanism for resetting the format type */ + + if (pMediaType == NULL) { + m_dwFlags &= ~Sample_TypeChanged; + return NOERROR; + } + + ASSERT(pMediaType); + ValidateReadPtr(pMediaType,sizeof(AM_MEDIA_TYPE)); + + /* Take a copy of the media type */ + + m_pMediaType = CreateMediaType(pMediaType); + if (m_pMediaType == NULL) { + m_dwFlags &= ~Sample_TypeChanged; + return E_OUTOFMEMORY; + } + + m_dwFlags |= Sample_TypeChanged; + return NOERROR; +} + +// Set and get properties (IMediaSample2) +STDMETHODIMP CMediaSample::GetProperties( + DWORD cbProperties, + __out_bcount(cbProperties) BYTE * pbProperties +) +{ + if (0 != cbProperties) { + CheckPointer(pbProperties, E_POINTER); + // Return generic stuff up to the length + AM_SAMPLE2_PROPERTIES Props; + Props.cbData = min(cbProperties, sizeof(Props)); + Props.dwSampleFlags = m_dwFlags & ~Sample_MediaTimeValid; + Props.dwTypeSpecificFlags = m_dwTypeSpecificFlags; + Props.pbBuffer = m_pBuffer; + Props.cbBuffer = m_cbBuffer; + Props.lActual = m_lActual; + Props.tStart = m_Start; + Props.tStop = m_End; + Props.dwStreamId = m_dwStreamId; + if (m_dwFlags & AM_SAMPLE_TYPECHANGED) { + Props.pMediaType = m_pMediaType; + } else { + Props.pMediaType = NULL; + } + CopyMemory(pbProperties, &Props, Props.cbData); + } + return S_OK; +} + +#define CONTAINS_FIELD(type, field, offset) \ + ((FIELD_OFFSET(type, field) + sizeof(((type *)0)->field)) <= offset) + +HRESULT CMediaSample::SetProperties( + DWORD cbProperties, + __in_bcount(cbProperties) const BYTE * pbProperties +) +{ + + /* Generic properties */ + AM_MEDIA_TYPE *pMediaType = NULL; + + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, cbData, cbProperties)) { + CheckPointer(pbProperties, E_POINTER); + AM_SAMPLE2_PROPERTIES *pProps = + (AM_SAMPLE2_PROPERTIES *)pbProperties; + + /* Don't use more data than is actually there */ + if (pProps->cbData < cbProperties) { + cbProperties = pProps->cbData; + } + /* We only handle IMediaSample2 */ + if (cbProperties > sizeof(*pProps) || + pProps->cbData > sizeof(*pProps)) { + return E_INVALIDARG; + } + /* Do checks first, the assignments (for backout) */ + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, dwSampleFlags, cbProperties)) { + /* Check the flags */ + if (pProps->dwSampleFlags & + (~Sample_ValidFlags | Sample_MediaTimeValid)) { + return E_INVALIDARG; + } + /* Check a flag isn't being set for a property + not being provided + */ + if ((pProps->dwSampleFlags & AM_SAMPLE_TIMEVALID) && + !(m_dwFlags & AM_SAMPLE_TIMEVALID) && + !CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, tStop, cbProperties)) { + return E_INVALIDARG; + } + } + /* NB - can't SET the pointer or size */ + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, pbBuffer, cbProperties)) { + + /* Check pbBuffer */ + if (pProps->pbBuffer != 0 && pProps->pbBuffer != m_pBuffer) { + return E_INVALIDARG; + } + } + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, cbBuffer, cbProperties)) { + + /* Check cbBuffer */ + if (pProps->cbBuffer != 0 && pProps->cbBuffer != m_cbBuffer) { + return E_INVALIDARG; + } + } + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, cbBuffer, cbProperties) && + CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, lActual, cbProperties)) { + + /* Check lActual */ + if (pProps->cbBuffer < pProps->lActual) { + return E_INVALIDARG; + } + } + + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, pMediaType, cbProperties)) { + + /* Check pMediaType */ + if (pProps->dwSampleFlags & AM_SAMPLE_TYPECHANGED) { + CheckPointer(pProps->pMediaType, E_POINTER); + pMediaType = CreateMediaType(pProps->pMediaType); + if (pMediaType == NULL) { + return E_OUTOFMEMORY; + } + } + } + + /* Now do the assignments */ + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, dwStreamId, cbProperties)) { + m_dwStreamId = pProps->dwStreamId; + } + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, dwSampleFlags, cbProperties)) { + /* Set the flags */ + m_dwFlags = pProps->dwSampleFlags | + (m_dwFlags & Sample_MediaTimeValid); + m_dwTypeSpecificFlags = pProps->dwTypeSpecificFlags; + } else { + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, dwTypeSpecificFlags, cbProperties)) { + m_dwTypeSpecificFlags = pProps->dwTypeSpecificFlags; + } + } + + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, lActual, cbProperties)) { + /* Set lActual */ + m_lActual = pProps->lActual; + } + + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, tStop, cbProperties)) { + + /* Set the times */ + m_End = pProps->tStop; + } + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, tStart, cbProperties)) { + + /* Set the times */ + m_Start = pProps->tStart; + } + + if (CONTAINS_FIELD(AM_SAMPLE2_PROPERTIES, pMediaType, cbProperties)) { + /* Set pMediaType */ + if (pProps->dwSampleFlags & AM_SAMPLE_TYPECHANGED) { + if (m_pMediaType != NULL) { + DeleteMediaType(m_pMediaType); + } + m_pMediaType = pMediaType; + } + } + + /* Fix up the type changed flag to correctly reflect the current state + If, for instance the input contained no type change but the + output does then if we don't do this we'd lose the + output media type. + */ + if (m_pMediaType) { + m_dwFlags |= Sample_TypeChanged; + } else { + m_dwFlags &= ~Sample_TypeChanged; + } + } + + return S_OK; +} + + +// +// The streaming thread calls IPin::NewSegment(), IPin::EndOfStream(), +// IMemInputPin::Receive() and IMemInputPin::ReceiveMultiple() on the +// connected input pin. The application thread calls Block(). The +// following class members can only be called by the streaming thread. +// +// Deliver() +// DeliverNewSegment() +// StartUsingOutputPin() +// StopUsingOutputPin() +// ChangeOutputFormat() +// ChangeMediaType() +// DynamicReconnect() +// +// The following class members can only be called by the application thread. +// +// Block() +// SynchronousBlockOutputPin() +// AsynchronousBlockOutputPin() +// + +CDynamicOutputPin::CDynamicOutputPin( + __in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName) : + CBaseOutputPin(pObjectName, pFilter, pLock, phr, pName), + m_hStopEvent(NULL), + m_pGraphConfig(NULL), + m_bPinUsesReadOnlyAllocator(FALSE), + m_BlockState(NOT_BLOCKED), + m_hUnblockOutputPinEvent(NULL), + m_hNotifyCallerPinBlockedEvent(NULL), + m_dwBlockCallerThreadID(0), + m_dwNumOutstandingOutputPinUsers(0) +{ + HRESULT hr = Initialize(); + if( FAILED( hr ) ) { + *phr = hr; + return; + } +} + +#ifdef UNICODE +CDynamicOutputPin::CDynamicOutputPin( + __in_opt LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName) : + CBaseOutputPin(pObjectName, pFilter, pLock, phr, pName), + m_hStopEvent(NULL), + m_pGraphConfig(NULL), + m_bPinUsesReadOnlyAllocator(FALSE), + m_BlockState(NOT_BLOCKED), + m_hUnblockOutputPinEvent(NULL), + m_hNotifyCallerPinBlockedEvent(NULL), + m_dwBlockCallerThreadID(0), + m_dwNumOutstandingOutputPinUsers(0) +{ + HRESULT hr = Initialize(); + if( FAILED( hr ) ) { + *phr = hr; + return; + } +} +#endif + +CDynamicOutputPin::~CDynamicOutputPin() +{ + if(NULL != m_hUnblockOutputPinEvent) { + // This call should not fail because we have access to m_hUnblockOutputPinEvent + // and m_hUnblockOutputPinEvent is a valid event. + EXECUTE_ASSERT(::CloseHandle(m_hUnblockOutputPinEvent)); + } + + if(NULL != m_hNotifyCallerPinBlockedEvent) { + // This call should not fail because we have access to m_hNotifyCallerPinBlockedEvent + // and m_hNotifyCallerPinBlockedEvent is a valid event. + EXECUTE_ASSERT(::CloseHandle(m_hNotifyCallerPinBlockedEvent)); + } +} + +HRESULT CDynamicOutputPin::Initialize(void) +{ + m_hUnblockOutputPinEvent = ::CreateEvent( NULL, // The event will have the default security descriptor. + TRUE, // This is a manual reset event. + TRUE, // The event is initially signaled. + NULL ); // The event is not named. + + // CreateEvent() returns NULL if an error occurs. + if(NULL == m_hUnblockOutputPinEvent) { + return AmGetLastErrorToHResult(); + } + + // Set flag to say we can reconnect while streaming. + SetReconnectWhenActive(true); + + return S_OK; +} + +STDMETHODIMP CDynamicOutputPin::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + if(riid == IID_IPinFlowControl) { + return GetInterface(static_cast(this), ppv); + } else { + return CBaseOutputPin::NonDelegatingQueryInterface(riid, ppv); + } +} + +STDMETHODIMP CDynamicOutputPin::Disconnect(void) +{ + CAutoLock cObjectLock(m_pLock); + return DisconnectInternal(); +} + +STDMETHODIMP CDynamicOutputPin::Block(DWORD dwBlockFlags, HANDLE hEvent) +{ + const DWORD VALID_FLAGS = AM_PIN_FLOW_CONTROL_BLOCK; + + // Check for illegal flags. + if(dwBlockFlags & ~VALID_FLAGS) { + return E_INVALIDARG; + } + + // Make sure the event is unsignaled. + if((dwBlockFlags & AM_PIN_FLOW_CONTROL_BLOCK) && (NULL != hEvent)) { + if( !::ResetEvent( hEvent ) ) { + return AmGetLastErrorToHResult(); + } + } + + // No flags are set if we are unblocking the output pin. + if(0 == dwBlockFlags) { + + // This parameter should be NULL because unblock operations are always synchronous. + // There is no need to notify the caller when the event is done. + if(NULL != hEvent) { + return E_INVALIDARG; + } + } + + #ifdef DEBUG + AssertValid(); + #endif // DEBUG + + HRESULT hr; + + if(dwBlockFlags & AM_PIN_FLOW_CONTROL_BLOCK) { + // IPinFlowControl::Block()'s hEvent parameter is NULL if the block is synchronous. + // If hEvent is not NULL, the block is asynchronous. + if(NULL == hEvent) { + hr = SynchronousBlockOutputPin(); + } else { + hr = AsynchronousBlockOutputPin(hEvent); + } + } else { + hr = UnblockOutputPin(); + } + + #ifdef DEBUG + AssertValid(); + #endif // DEBUG + + if(FAILED(hr)) { + return hr; + } + + return S_OK; +} + +HRESULT CDynamicOutputPin::SynchronousBlockOutputPin(void) +{ + HANDLE hNotifyCallerPinBlockedEvent = :: CreateEvent( NULL, // The event will have the default security attributes. + FALSE, // This is an automatic reset event. + FALSE, // The event is initially unsignaled. + NULL ); // The event is not named. + + // CreateEvent() returns NULL if an error occurs. + if(NULL == hNotifyCallerPinBlockedEvent) { + return AmGetLastErrorToHResult(); + } + + HRESULT hr = AsynchronousBlockOutputPin(hNotifyCallerPinBlockedEvent); + if(FAILED(hr)) { + // This call should not fail because we have access to hNotifyCallerPinBlockedEvent + // and hNotifyCallerPinBlockedEvent is a valid event. + EXECUTE_ASSERT(::CloseHandle(hNotifyCallerPinBlockedEvent)); + + return hr; + } + + hr = WaitEvent(hNotifyCallerPinBlockedEvent); + + // This call should not fail because we have access to hNotifyCallerPinBlockedEvent + // and hNotifyCallerPinBlockedEvent is a valid event. + EXECUTE_ASSERT(::CloseHandle(hNotifyCallerPinBlockedEvent)); + + if(FAILED(hr)) { + return hr; + } + + return S_OK; +} + +HRESULT CDynamicOutputPin::AsynchronousBlockOutputPin(HANDLE hNotifyCallerPinBlockedEvent) +{ + // This function holds the m_BlockStateLock because it uses + // m_dwBlockCallerThreadID, m_BlockState and + // m_hNotifyCallerPinBlockedEvent. + CAutoLock alBlockStateLock(&m_BlockStateLock); + + if(NOT_BLOCKED != m_BlockState) { + if(m_dwBlockCallerThreadID == ::GetCurrentThreadId()) { + return VFW_E_PIN_ALREADY_BLOCKED_ON_THIS_THREAD; + } else { + return VFW_E_PIN_ALREADY_BLOCKED; + } + } + + BOOL fSuccess = ::DuplicateHandle( ::GetCurrentProcess(), + hNotifyCallerPinBlockedEvent, + ::GetCurrentProcess(), + &m_hNotifyCallerPinBlockedEvent, + EVENT_MODIFY_STATE, + FALSE, + 0 ); + if( !fSuccess ) { + return AmGetLastErrorToHResult(); + } + + m_BlockState = PENDING; + m_dwBlockCallerThreadID = ::GetCurrentThreadId(); + + // The output pin cannot be blocked if the streaming thread is + // calling IPin::NewSegment(), IPin::EndOfStream(), IMemInputPin::Receive() + // or IMemInputPin::ReceiveMultiple() on the connected input pin. Also, it + // cannot be blocked if the streaming thread is calling DynamicReconnect(), + // ChangeMediaType() or ChangeOutputFormat(). + if(!StreamingThreadUsingOutputPin()) { + + // The output pin can be immediately blocked. + BlockOutputPin(); + } + + return S_OK; +} + +void CDynamicOutputPin::BlockOutputPin(void) +{ + // The caller should always hold the m_BlockStateLock because this function + // uses m_BlockState and m_hNotifyCallerPinBlockedEvent. + ASSERT(CritCheckIn(&m_BlockStateLock)); + + // This function should not be called if the streaming thread is modifying + // the connection state or it's passing data downstream. + ASSERT(!StreamingThreadUsingOutputPin()); + + // This should not fail because we successfully created the event + // and we have the security permissions to change it's state. + EXECUTE_ASSERT(::ResetEvent(m_hUnblockOutputPinEvent)); + + // This event should not fail because AsynchronousBlockOutputPin() successfully + // duplicated this handle and we have the appropriate security permissions. + EXECUTE_ASSERT(::SetEvent(m_hNotifyCallerPinBlockedEvent)); + EXECUTE_ASSERT(::CloseHandle(m_hNotifyCallerPinBlockedEvent)); + + m_BlockState = BLOCKED; + m_hNotifyCallerPinBlockedEvent = NULL; +} + +HRESULT CDynamicOutputPin::UnblockOutputPin(void) +{ + // UnblockOutputPin() holds the m_BlockStateLock because it + // uses m_BlockState, m_dwBlockCallerThreadID and + // m_hNotifyCallerPinBlockedEvent. + CAutoLock alBlockStateLock(&m_BlockStateLock); + + if(NOT_BLOCKED == m_BlockState) { + return S_FALSE; + } + + // This should not fail because we successfully created the event + // and we have the security permissions to change it's state. + EXECUTE_ASSERT(::SetEvent(m_hUnblockOutputPinEvent)); + + // Cancel the block operation if it's still pending. + if(NULL != m_hNotifyCallerPinBlockedEvent) { + // This event should not fail because AsynchronousBlockOutputPin() successfully + // duplicated this handle and we have the appropriate security permissions. + EXECUTE_ASSERT(::SetEvent(m_hNotifyCallerPinBlockedEvent)); + EXECUTE_ASSERT(::CloseHandle(m_hNotifyCallerPinBlockedEvent)); + } + + m_BlockState = NOT_BLOCKED; + m_dwBlockCallerThreadID = 0; + m_hNotifyCallerPinBlockedEvent = NULL; + + return S_OK; +} + +HRESULT CDynamicOutputPin::StartUsingOutputPin(void) +{ + // The caller should not hold m_BlockStateLock. If the caller does, + // a deadlock could occur. + ASSERT(CritCheckOut(&m_BlockStateLock)); + + CAutoLock alBlockStateLock(&m_BlockStateLock); + + #ifdef DEBUG + AssertValid(); + #endif // DEBUG + + // Are we in the middle of a block operation? + while(BLOCKED == m_BlockState) { + m_BlockStateLock.Unlock(); + + // If this ASSERT fires, a deadlock could occur. The caller should make sure + // that this thread never acquires the Block State lock more than once. + ASSERT(CritCheckOut( &m_BlockStateLock )); + + // WaitForMultipleObjects() returns WAIT_OBJECT_0 if the unblock event + // is fired. It returns WAIT_OBJECT_0 + 1 if the stop event if fired. + // See the Windows SDK documentation for more information on + // WaitForMultipleObjects(). + const DWORD UNBLOCK = WAIT_OBJECT_0; + const DWORD STOP = WAIT_OBJECT_0 + 1; + + HANDLE ahWaitEvents[] = { m_hUnblockOutputPinEvent, m_hStopEvent }; + DWORD dwNumWaitEvents = sizeof(ahWaitEvents)/sizeof(HANDLE); + + DWORD dwReturnValue = ::WaitForMultipleObjects( dwNumWaitEvents, ahWaitEvents, FALSE, INFINITE ); + + m_BlockStateLock.Lock(); + + #ifdef DEBUG + AssertValid(); + #endif // DEBUG + + switch( dwReturnValue ) { + case UNBLOCK: + break; + + case STOP: + return VFW_E_STATE_CHANGED; + + case WAIT_FAILED: + return AmGetLastErrorToHResult(); + + default: + DbgBreak( "An Unexpected case occured in CDynamicOutputPin::StartUsingOutputPin()." ); + return E_UNEXPECTED; + } + } + + m_dwNumOutstandingOutputPinUsers++; + + #ifdef DEBUG + AssertValid(); + #endif // DEBUG + + return S_OK; +} + +void CDynamicOutputPin::StopUsingOutputPin(void) +{ + CAutoLock alBlockStateLock(&m_BlockStateLock); + + #ifdef DEBUG + AssertValid(); + #endif // DEBUG + + m_dwNumOutstandingOutputPinUsers--; + + if((m_dwNumOutstandingOutputPinUsers == 0) && (NOT_BLOCKED != m_BlockState)) { + BlockOutputPin(); + } + + #ifdef DEBUG + AssertValid(); + #endif // DEBUG +} + +bool CDynamicOutputPin::StreamingThreadUsingOutputPin(void) +{ + CAutoLock alBlockStateLock(&m_BlockStateLock); + + return (m_dwNumOutstandingOutputPinUsers > 0); +} + +void CDynamicOutputPin::SetConfigInfo(IGraphConfig *pGraphConfig, HANDLE hStopEvent) +{ + // This pointer is not addrefed because filters are not allowed to + // hold references to the filter graph manager. See the documentation for + // IBaseFilter::JoinFilterGraph() in the Direct Show SDK for more information. + m_pGraphConfig = pGraphConfig; + + m_hStopEvent = hStopEvent; +} + +HRESULT CDynamicOutputPin::Active(void) +{ + // Make sure the user initialized the object by calling SetConfigInfo(). + if((NULL == m_hStopEvent) || (NULL == m_pGraphConfig)) { + DbgBreak( ERROR: CDynamicOutputPin::Active() failed because m_pGraphConfig and m_hStopEvent were not initialized. Call SetConfigInfo() to initialize them. ); + return E_FAIL; + } + + // If this ASSERT fires, the user may have passed an invalid event handle to SetConfigInfo(). + // The ASSERT can also fire if the event if destroyed and then Active() is called. An event + // handle is invalid if 1) the event does not exist or the user does not have the security + // permissions to use the event. + EXECUTE_ASSERT(ResetEvent(m_hStopEvent)); + + return CBaseOutputPin::Active(); +} + +HRESULT CDynamicOutputPin::Inactive(void) +{ + // If this ASSERT fires, the user may have passed an invalid event handle to SetConfigInfo(). + // The ASSERT can also fire if the event if destroyed and then Active() is called. An event + // handle is invalid if 1) the event does not exist or the user does not have the security + // permissions to use the event. + EXECUTE_ASSERT(SetEvent(m_hStopEvent)); + + return CBaseOutputPin::Inactive(); +} + +HRESULT CDynamicOutputPin::DeliverBeginFlush(void) +{ + // If this ASSERT fires, the user may have passed an invalid event handle to SetConfigInfo(). + // The ASSERT can also fire if the event if destroyed and then DeliverBeginFlush() is called. + // An event handle is invalid if 1) the event does not exist or the user does not have the security + // permissions to use the event. + EXECUTE_ASSERT(SetEvent(m_hStopEvent)); + + return CBaseOutputPin::DeliverBeginFlush(); +} + +HRESULT CDynamicOutputPin::DeliverEndFlush(void) +{ + // If this ASSERT fires, the user may have passed an invalid event handle to SetConfigInfo(). + // The ASSERT can also fire if the event if destroyed and then DeliverBeginFlush() is called. + // An event handle is invalid if 1) the event does not exist or the user does not have the security + // permissions to use the event. + EXECUTE_ASSERT(ResetEvent(m_hStopEvent)); + + return CBaseOutputPin::DeliverEndFlush(); +} + + +// ChangeOutputFormat() either dynamicly changes the connection's format type or it dynamicly +// reconnects the output pin. +HRESULT CDynamicOutputPin::ChangeOutputFormat + ( + const AM_MEDIA_TYPE *pmt, + REFERENCE_TIME tSegmentStart, + REFERENCE_TIME tSegmentStop, + double dSegmentRate + ) +{ + // The caller should call StartUsingOutputPin() before calling this + // method. + ASSERT(StreamingThreadUsingOutputPin()); + + // Callers should always pass a valid media type to ChangeOutputFormat() . + ASSERT(NULL != pmt); + + CMediaType cmt(*pmt); + HRESULT hr = ChangeMediaType(&cmt); + if (FAILED(hr)) { + return hr; + } + + hr = DeliverNewSegment(tSegmentStart, tSegmentStop, dSegmentRate); + if( FAILED( hr ) ) { + return hr; + } + + return S_OK; +} + +HRESULT CDynamicOutputPin::ChangeMediaType(const CMediaType *pmt) +{ + // The caller should call StartUsingOutputPin() before calling this + // method. + ASSERT(StreamingThreadUsingOutputPin()); + + // This function assumes the filter graph is running. + ASSERT(!IsStopped()); + + if(!IsConnected()) { + return VFW_E_NOT_CONNECTED; + } + + /* First check if the downstream pin will accept a dynamic + format change + */ + QzCComPtr pConnection; + + m_Connected->QueryInterface(IID_IPinConnection, (void **)&pConnection); + if(pConnection != NULL) { + + if(S_OK == pConnection->DynamicQueryAccept(pmt)) { + + HRESULT hr = ChangeMediaTypeHelper(pmt); + if(FAILED(hr)) { + return hr; + } + + return S_OK; + } + } + + /* Can't do the dynamic connection */ + return DynamicReconnect(pmt); +} + +HRESULT CDynamicOutputPin::ChangeMediaTypeHelper(const CMediaType *pmt) +{ + // The caller should call StartUsingOutputPin() before calling this + // method. + ASSERT(StreamingThreadUsingOutputPin()); + + HRESULT hr = m_Connected->ReceiveConnection(this, pmt); + if(FAILED(hr)) { + return hr; + } + + hr = SetMediaType(pmt); + if(FAILED(hr)) { + return hr; + } + + // Does this pin use the local memory transport? + if(NULL != m_pInputPin) { + // This function assumes that m_pInputPin and m_Connected are + // two different interfaces to the same object. + ASSERT(::IsEqualObject(m_Connected, m_pInputPin)); + + ALLOCATOR_PROPERTIES apInputPinRequirements; + apInputPinRequirements.cbAlign = 0; + apInputPinRequirements.cbBuffer = 0; + apInputPinRequirements.cbPrefix = 0; + apInputPinRequirements.cBuffers = 0; + + m_pInputPin->GetAllocatorRequirements(&apInputPinRequirements); + + // A zero allignment does not make any sense. + if(0 == apInputPinRequirements.cbAlign) { + apInputPinRequirements.cbAlign = 1; + } + + hr = m_pAllocator->Decommit(); + if(FAILED(hr)) { + return hr; + } + + hr = DecideBufferSize(m_pAllocator, &apInputPinRequirements); + if(FAILED(hr)) { + return hr; + } + + hr = m_pAllocator->Commit(); + if(FAILED(hr)) { + return hr; + } + + hr = m_pInputPin->NotifyAllocator(m_pAllocator, m_bPinUsesReadOnlyAllocator); + if(FAILED(hr)) { + return hr; + } + } + + return S_OK; +} + +// this method has to be called from the thread that is pushing data, +// and it's the caller's responsibility to make sure that the thread +// has no outstand samples because they cannot be delivered after a +// reconnect +// +HRESULT CDynamicOutputPin::DynamicReconnect( const CMediaType* pmt ) +{ + // The caller should call StartUsingOutputPin() before calling this + // method. + ASSERT(StreamingThreadUsingOutputPin()); + + if((m_pGraphConfig == NULL) || (NULL == m_hStopEvent)) { + return E_FAIL; + } + + HRESULT hr = m_pGraphConfig->Reconnect( + this, + NULL, + pmt, + NULL, + m_hStopEvent, + AM_GRAPH_CONFIG_RECONNECT_CACHE_REMOVED_FILTERS ); + + return hr; +} + +HRESULT CDynamicOutputPin::CompleteConnect(IPin *pReceivePin) +{ + HRESULT hr = CBaseOutputPin::CompleteConnect(pReceivePin); + if(SUCCEEDED(hr)) { + if(!IsStopped() && m_pAllocator) { + hr = m_pAllocator->Commit(); + ASSERT(hr != VFW_E_ALREADY_COMMITTED); + } + } + + return hr; +} + +#ifdef DEBUG +void CDynamicOutputPin::AssertValid(void) +{ + // Make sure the object was correctly initialized. + + // This ASSERT only fires if the object failed to initialize + // and the user ignored the constructor's return code (phr). + ASSERT(NULL != m_hUnblockOutputPinEvent); + + // If either of these ASSERTs fire, the user did not correctly call + // SetConfigInfo(). + ASSERT(NULL != m_hStopEvent); + ASSERT(NULL != m_pGraphConfig); + + // Make sure the block state is consistent. + + CAutoLock alBlockStateLock(&m_BlockStateLock); + + // BLOCK_STATE variables only have three legal values: PENDING, BLOCKED and NOT_BLOCKED. + ASSERT((NOT_BLOCKED == m_BlockState) || (PENDING == m_BlockState) || (BLOCKED == m_BlockState)); + + // m_hNotifyCallerPinBlockedEvent is only needed when a block operation cannot complete + // immediately. + ASSERT(((NULL == m_hNotifyCallerPinBlockedEvent) && (PENDING != m_BlockState)) || + ((NULL != m_hNotifyCallerPinBlockedEvent) && (PENDING == m_BlockState)) ); + + // m_dwBlockCallerThreadID should always be 0 if the pin is not blocked and + // the user is not trying to block the pin. + ASSERT((0 == m_dwBlockCallerThreadID) || (NOT_BLOCKED != m_BlockState)); + + // If this ASSERT fires, the streaming thread is using the output pin and the + // output pin is blocked. + ASSERT(((0 != m_dwNumOutstandingOutputPinUsers) && (BLOCKED != m_BlockState)) || + ((0 == m_dwNumOutstandingOutputPinUsers) && (NOT_BLOCKED != m_BlockState)) || + ((0 == m_dwNumOutstandingOutputPinUsers) && (NOT_BLOCKED == m_BlockState)) ); +} +#endif // DEBUG + +HRESULT CDynamicOutputPin::WaitEvent(HANDLE hEvent) +{ + const DWORD EVENT_SIGNALED = WAIT_OBJECT_0; + + DWORD dwReturnValue = ::WaitForSingleObject(hEvent, INFINITE); + + switch( dwReturnValue ) { + case EVENT_SIGNALED: + return S_OK; + + case WAIT_FAILED: + return AmGetLastErrorToHResult(); + + default: + DbgBreak( "An Unexpected case occured in CDynamicOutputPin::WaitEvent()." ); + return E_UNEXPECTED; + } +} + +//===================================================================== +//===================================================================== +// Implements CBaseAllocator +//===================================================================== +//===================================================================== + + +/* Constructor overrides the default settings for the free list to request + that it be alertable (ie the list can be cast to a handle which can be + passed to WaitForSingleObject). Both of the allocator lists also ask for + object locking, the all list matches the object default settings but I + have included them here just so it is obvious what kind of list it is */ + +CBaseAllocator::CBaseAllocator(__in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + __inout HRESULT *phr, + BOOL bEvent, + BOOL fEnableReleaseCallback + ) : + CUnknown(pName, pUnk), + m_lAllocated(0), + m_bChanged(FALSE), + m_bCommitted(FALSE), + m_bDecommitInProgress(FALSE), + m_lSize(0), + m_lCount(0), + m_lAlignment(0), + m_lPrefix(0), + m_hSem(NULL), + m_lWaiting(0), + m_fEnableReleaseCallback(fEnableReleaseCallback), + m_pNotify(NULL) +{ +#ifdef DXMPERF + PERFLOG_CTOR( pName ? pName : L"CBaseAllocator", (IMemAllocator *) this ); +#endif // DXMPERF + + if (bEvent) { + m_hSem = CreateSemaphore(NULL, 0, 0x7FFFFFFF, NULL); + if (m_hSem == NULL) { + *phr = E_OUTOFMEMORY; + return; + } + } +} + +#ifdef UNICODE +CBaseAllocator::CBaseAllocator(__in_opt LPCSTR pName, + __inout_opt LPUNKNOWN pUnk, + __inout HRESULT *phr, + BOOL bEvent, + BOOL fEnableReleaseCallback) : + CUnknown(pName, pUnk), + m_lAllocated(0), + m_bChanged(FALSE), + m_bCommitted(FALSE), + m_bDecommitInProgress(FALSE), + m_lSize(0), + m_lCount(0), + m_lAlignment(0), + m_lPrefix(0), + m_hSem(NULL), + m_lWaiting(0), + m_fEnableReleaseCallback(fEnableReleaseCallback), + m_pNotify(NULL) +{ +#ifdef DXMPERF + PERFLOG_CTOR( L"CBaseAllocator", (IMemAllocator *) this ); +#endif // DXMPERF + + if (bEvent) { + m_hSem = CreateSemaphore(NULL, 0, 0x7FFFFFFF, NULL); + if (m_hSem == NULL) { + *phr = E_OUTOFMEMORY; + return; + } + } +} +#endif + +/* Destructor */ + +CBaseAllocator::~CBaseAllocator() +{ + // we can't call Decommit here since that would mean a call to a + // pure virtual in destructor. + // We must assume that the derived class has gone into decommit state in + // its destructor. +#ifdef DXMPERF + PERFLOG_DTOR( L"CBaseAllocator", (IMemAllocator *) this ); +#endif // DXMPERF + + ASSERT(!m_bCommitted); + if (m_hSem != NULL) { + EXECUTE_ASSERT(CloseHandle(m_hSem)); + } + if (m_pNotify) { + m_pNotify->Release(); + } +} + + +/* Override this to publicise our interfaces */ + +STDMETHODIMP +CBaseAllocator::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + /* Do we know about this interface */ + + if (riid == IID_IMemAllocator || + riid == IID_IMemAllocatorCallbackTemp && m_fEnableReleaseCallback) { + return GetInterface((IMemAllocatorCallbackTemp *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +/* This sets the size and count of the required samples. The memory isn't + actually allocated until Commit() is called, if memory has already been + allocated then assuming no samples are outstanding the user may call us + to change the buffering, the memory will be released in Commit() */ + +STDMETHODIMP +CBaseAllocator::SetProperties( + __in ALLOCATOR_PROPERTIES* pRequest, + __out ALLOCATOR_PROPERTIES* pActual) +{ + CheckPointer(pRequest, E_POINTER); + CheckPointer(pActual, E_POINTER); + ValidateReadWritePtr(pActual, sizeof(ALLOCATOR_PROPERTIES)); + CAutoLock cObjectLock(this); + + ZeroMemory(pActual, sizeof(ALLOCATOR_PROPERTIES)); + + ASSERT(pRequest->cbBuffer > 0); + + /* Check the alignment requested */ + if (pRequest->cbAlign != 1) { + DbgLog((LOG_ERROR, 2, TEXT("Alignment requested was 0x%x, not 1"), + pRequest->cbAlign)); + return VFW_E_BADALIGN; + } + + /* Can't do this if already committed, there is an argument that says we + should not reject the SetProperties call if there are buffers still + active. However this is called by the source filter, which is the same + person who is holding the samples. Therefore it is not unreasonable + for them to free all their samples before changing the requirements */ + + if (m_bCommitted) { + return VFW_E_ALREADY_COMMITTED; + } + + /* Must be no outstanding buffers */ + + if (m_lAllocated != m_lFree.GetCount()) { + return VFW_E_BUFFERS_OUTSTANDING; + } + + /* There isn't any real need to check the parameters as they + will just be rejected when the user finally calls Commit */ + + pActual->cbBuffer = m_lSize = pRequest->cbBuffer; + pActual->cBuffers = m_lCount = pRequest->cBuffers; + pActual->cbAlign = m_lAlignment = pRequest->cbAlign; + pActual->cbPrefix = m_lPrefix = pRequest->cbPrefix; + + m_bChanged = TRUE; + return NOERROR; +} + +STDMETHODIMP +CBaseAllocator::GetProperties( + __out ALLOCATOR_PROPERTIES * pActual) +{ + CheckPointer(pActual,E_POINTER); + ValidateReadWritePtr(pActual,sizeof(ALLOCATOR_PROPERTIES)); + + CAutoLock cObjectLock(this); + pActual->cbBuffer = m_lSize; + pActual->cBuffers = m_lCount; + pActual->cbAlign = m_lAlignment; + pActual->cbPrefix = m_lPrefix; + return NOERROR; +} + +// get container for a sample. Blocking, synchronous call to get the +// next free buffer (as represented by an IMediaSample interface). +// on return, the time etc properties will be invalid, but the buffer +// pointer and size will be correct. + +HRESULT CBaseAllocator::GetBuffer(__deref_out IMediaSample **ppBuffer, + __in_opt REFERENCE_TIME *pStartTime, + __in_opt REFERENCE_TIME *pEndTime, + DWORD dwFlags + ) +{ + UNREFERENCED_PARAMETER(pStartTime); + UNREFERENCED_PARAMETER(pEndTime); + UNREFERENCED_PARAMETER(dwFlags); + CMediaSample *pSample; + + *ppBuffer = NULL; + for (;;) + { + { // scope for lock + CAutoLock cObjectLock(this); + + /* Check we are committed */ + if (!m_bCommitted) { + return VFW_E_NOT_COMMITTED; + } + pSample = (CMediaSample *) m_lFree.RemoveHead(); + if (pSample == NULL) { + SetWaiting(); + } + } + + /* If we didn't get a sample then wait for the list to signal */ + + if (pSample) { + break; + } + if (dwFlags & AM_GBF_NOWAIT) { + return VFW_E_TIMEOUT; + } + ASSERT(m_hSem != NULL); + WaitForSingleObject(m_hSem, INFINITE); + } + + /* Addref the buffer up to one. On release + back to zero instead of being deleted, it will requeue itself by + calling the ReleaseBuffer member function. NOTE the owner of a + media sample must always be derived from CBaseAllocator */ + + + ASSERT(pSample->m_cRef == 0); + pSample->m_cRef = 1; + *ppBuffer = pSample; + +#ifdef DXMPERF + PERFLOG_GETBUFFER( (IMemAllocator *) this, pSample ); +#endif // DXMPERF + + return NOERROR; +} + + +/* Final release of a CMediaSample will call this */ + +STDMETHODIMP +CBaseAllocator::ReleaseBuffer(IMediaSample * pSample) +{ + CheckPointer(pSample,E_POINTER); + ValidateReadPtr(pSample,sizeof(IMediaSample)); + +#ifdef DXMPERF + PERFLOG_RELBUFFER( (IMemAllocator *) this, pSample ); +#endif // DXMPERF + + + BOOL bRelease = FALSE; + { + CAutoLock cal(this); + + /* Put back on the free list */ + + m_lFree.Add((CMediaSample *)pSample); + if (m_lWaiting != 0) { + NotifySample(); + } + + // if there is a pending Decommit, then we need to complete it by + // calling Free() when the last buffer is placed on the free list + + LONG l1 = m_lFree.GetCount(); + if (m_bDecommitInProgress && (l1 == m_lAllocated)) { + Free(); + m_bDecommitInProgress = FALSE; + bRelease = TRUE; + } + } + + if (m_pNotify) { + + ASSERT(m_fEnableReleaseCallback); + + // + // Note that this is not synchronized with setting up a notification + // method. + // + m_pNotify->NotifyRelease(); + } + + /* For each buffer there is one AddRef, made in GetBuffer and released + here. This may cause the allocator and all samples to be deleted */ + + if (bRelease) { + Release(); + } + return NOERROR; +} + +STDMETHODIMP +CBaseAllocator::SetNotify( + IMemAllocatorNotifyCallbackTemp* pNotify + ) +{ + ASSERT(m_fEnableReleaseCallback); + CAutoLock lck(this); + if (pNotify) { + pNotify->AddRef(); + } + if (m_pNotify) { + m_pNotify->Release(); + } + m_pNotify = pNotify; + return S_OK; +} + +STDMETHODIMP +CBaseAllocator::GetFreeCount( + __out LONG* plBuffersFree + ) +{ + ASSERT(m_fEnableReleaseCallback); + CAutoLock cObjectLock(this); + *plBuffersFree = m_lCount - m_lAllocated + m_lFree.GetCount(); + return NOERROR; +} + +void +CBaseAllocator::NotifySample() +{ + if (m_lWaiting != 0) { + ASSERT(m_hSem != NULL); + ReleaseSemaphore(m_hSem, m_lWaiting, 0); + m_lWaiting = 0; + } +} + +STDMETHODIMP +CBaseAllocator::Commit() +{ + /* Check we are not decommitted */ + CAutoLock cObjectLock(this); + + // cannot need to alloc or re-alloc if we are committed + if (m_bCommitted) { + return NOERROR; + } + + /* Allow GetBuffer calls */ + + m_bCommitted = TRUE; + + // is there a pending decommit ? if so, just cancel it + if (m_bDecommitInProgress) { + m_bDecommitInProgress = FALSE; + + // don't call Alloc at this point. He cannot allow SetProperties + // between Decommit and the last free, so the buffer size cannot have + // changed. And because some of the buffers are not free yet, he + // cannot re-alloc anyway. + return NOERROR; + } + + DbgLog((LOG_MEMORY, 1, TEXT("Allocating: %ldx%ld"), m_lCount, m_lSize)); + + // actually need to allocate the samples + HRESULT hr = Alloc(); + if (FAILED(hr)) { + m_bCommitted = FALSE; + return hr; + } + AddRef(); + return NOERROR; +} + + +STDMETHODIMP +CBaseAllocator::Decommit() +{ + BOOL bRelease = FALSE; + { + /* Check we are not already decommitted */ + CAutoLock cObjectLock(this); + if (m_bCommitted == FALSE) { + if (m_bDecommitInProgress == FALSE) { + return NOERROR; + } + } + + /* No more GetBuffer calls will succeed */ + m_bCommitted = FALSE; + + // are any buffers outstanding? + if (m_lFree.GetCount() < m_lAllocated) { + // please complete the decommit when last buffer is freed + m_bDecommitInProgress = TRUE; + } else { + m_bDecommitInProgress = FALSE; + + // need to complete the decommit here as there are no + // outstanding buffers + + Free(); + bRelease = TRUE; + } + + // Tell anyone waiting that they can go now so we can + // reject their call +#pragma warning(push) +#ifndef _PREFAST_ +#pragma warning(disable:4068) +#endif +#pragma prefast(suppress:__WARNING_DEREF_NULL_PTR, "Suppress warning related to Free() invalidating 'this' which is no applicable to CBaseAllocator::Free()") + NotifySample(); + +#pragma warning(pop) + } + + if (bRelease) { + Release(); + } + return NOERROR; +} + + +/* Base definition of allocation which checks we are ok to go ahead and do + the full allocation. We return S_FALSE if the requirements are the same */ + +HRESULT +CBaseAllocator::Alloc(void) +{ + /* Error if he hasn't set the size yet */ + if (m_lCount <= 0 || m_lSize <= 0 || m_lAlignment <= 0) { + return VFW_E_SIZENOTSET; + } + + /* should never get here while buffers outstanding */ + ASSERT(m_lFree.GetCount() == m_lAllocated); + + /* If the requirements haven't changed then don't reallocate */ + if (m_bChanged == FALSE) { + return S_FALSE; + } + + return NOERROR; +} + +/* Implement CBaseAllocator::CSampleList::Remove(pSample) + Removes pSample from the list +*/ +void +CBaseAllocator::CSampleList::Remove(__inout CMediaSample * pSample) +{ + CMediaSample **pSearch; + for (pSearch = &m_List; + *pSearch != NULL; + pSearch = &(CBaseAllocator::NextSample(*pSearch))) { + if (*pSearch == pSample) { + *pSearch = CBaseAllocator::NextSample(pSample); + CBaseAllocator::NextSample(pSample) = NULL; + m_nOnList--; + return; + } + } + DbgBreak("Couldn't find sample in list"); +} + +//===================================================================== +//===================================================================== +// Implements CMemAllocator +//===================================================================== +//===================================================================== + + +/* This goes in the factory template table to create new instances */ +CUnknown *CMemAllocator::CreateInstance(__inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr) +{ + CUnknown *pUnkRet = new CMemAllocator(NAME("CMemAllocator"), pUnk, phr); + return pUnkRet; +} + +CMemAllocator::CMemAllocator( + __in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + __inout HRESULT *phr) + : CBaseAllocator(pName, pUnk, phr, TRUE, TRUE), + m_pBuffer(NULL) +{ +} + +#ifdef UNICODE +CMemAllocator::CMemAllocator( + __in_opt LPCSTR pName, + __inout_opt LPUNKNOWN pUnk, + __inout HRESULT *phr) + : CBaseAllocator(pName, pUnk, phr, TRUE, TRUE), + m_pBuffer(NULL) +{ +} +#endif + +/* This sets the size and count of the required samples. The memory isn't + actually allocated until Commit() is called, if memory has already been + allocated then assuming no samples are outstanding the user may call us + to change the buffering, the memory will be released in Commit() */ +STDMETHODIMP +CMemAllocator::SetProperties( + __in ALLOCATOR_PROPERTIES* pRequest, + __out ALLOCATOR_PROPERTIES* pActual) +{ + CheckPointer(pActual,E_POINTER); + ValidateReadWritePtr(pActual,sizeof(ALLOCATOR_PROPERTIES)); + CAutoLock cObjectLock(this); + + ZeroMemory(pActual, sizeof(ALLOCATOR_PROPERTIES)); + + ASSERT(pRequest->cbBuffer > 0); + + SYSTEM_INFO SysInfo; + GetSystemInfo(&SysInfo); + + /* Check the alignment request is a power of 2 */ + if ((-pRequest->cbAlign & pRequest->cbAlign) != pRequest->cbAlign) { + DbgLog((LOG_ERROR, 1, TEXT("Alignment requested 0x%x not a power of 2!"), + pRequest->cbAlign)); + } + /* Check the alignment requested */ + if (pRequest->cbAlign == 0 || + (SysInfo.dwAllocationGranularity & (pRequest->cbAlign - 1)) != 0) { + DbgLog((LOG_ERROR, 1, TEXT("Invalid alignment 0x%x requested - granularity = 0x%x"), + pRequest->cbAlign, SysInfo.dwAllocationGranularity)); + return VFW_E_BADALIGN; + } + + /* Can't do this if already committed, there is an argument that says we + should not reject the SetProperties call if there are buffers still + active. However this is called by the source filter, which is the same + person who is holding the samples. Therefore it is not unreasonable + for them to free all their samples before changing the requirements */ + + if (m_bCommitted == TRUE) { + return VFW_E_ALREADY_COMMITTED; + } + + /* Must be no outstanding buffers */ + + if (m_lFree.GetCount() < m_lAllocated) { + return VFW_E_BUFFERS_OUTSTANDING; + } + + /* There isn't any real need to check the parameters as they + will just be rejected when the user finally calls Commit */ + + // round length up to alignment - remember that prefix is included in + // the alignment + LONG lSize = pRequest->cbBuffer + pRequest->cbPrefix; + LONG lRemainder = lSize % pRequest->cbAlign; + if (lRemainder != 0) { + lSize = lSize - lRemainder + pRequest->cbAlign; + } + pActual->cbBuffer = m_lSize = (lSize - pRequest->cbPrefix); + + pActual->cBuffers = m_lCount = pRequest->cBuffers; + pActual->cbAlign = m_lAlignment = pRequest->cbAlign; + pActual->cbPrefix = m_lPrefix = pRequest->cbPrefix; + + m_bChanged = TRUE; + return NOERROR; +} + +// override this to allocate our resources when Commit is called. +// +// note that our resources may be already allocated when this is called, +// since we don't free them on Decommit. We will only be called when in +// decommit state with all buffers free. +// +// object locked by caller +HRESULT +CMemAllocator::Alloc(void) +{ + CAutoLock lck(this); + + /* Check he has called SetProperties */ + HRESULT hr = CBaseAllocator::Alloc(); + if (FAILED(hr)) { + return hr; + } + + /* If the requirements haven't changed then don't reallocate */ + if (hr == S_FALSE) { + ASSERT(m_pBuffer); + return NOERROR; + } + ASSERT(hr == S_OK); // we use this fact in the loop below + + /* Free the old resources */ + if (m_pBuffer) { + ReallyFree(); + } + + /* Make sure we've got reasonable values */ + if ( m_lSize < 0 || m_lPrefix < 0 || m_lCount < 0 ) { + return E_OUTOFMEMORY; + } + + /* Compute the aligned size */ + LONG lAlignedSize = m_lSize + m_lPrefix; + + /* Check overflow */ + if (lAlignedSize < m_lSize) { + return E_OUTOFMEMORY; + } + + if (m_lAlignment > 1) { + LONG lRemainder = lAlignedSize % m_lAlignment; + if (lRemainder != 0) { + LONG lNewSize = lAlignedSize + m_lAlignment - lRemainder; + if (lNewSize < lAlignedSize) { + return E_OUTOFMEMORY; + } + lAlignedSize = lNewSize; + } + } + + /* Create the contiguous memory block for the samples + making sure it's properly aligned (64K should be enough!) + */ + ASSERT(lAlignedSize % m_lAlignment == 0); + + LONGLONG lToAllocate = m_lCount * (LONGLONG)lAlignedSize; + + /* Check overflow */ + if (lToAllocate > MAXLONG) { + return E_OUTOFMEMORY; + } + + m_pBuffer = (PBYTE)VirtualAlloc(NULL, + (LONG)lToAllocate, + MEM_COMMIT, + PAGE_READWRITE); + + if (m_pBuffer == NULL) { + return E_OUTOFMEMORY; + } + + LPBYTE pNext = m_pBuffer; + CMediaSample *pSample; + + ASSERT(m_lAllocated == 0); + + // Create the new samples - we have allocated m_lSize bytes for each sample + // plus m_lPrefix bytes per sample as a prefix. We set the pointer to + // the memory after the prefix - so that GetPointer() will return a pointer + // to m_lSize bytes. + for (; m_lAllocated < m_lCount; m_lAllocated++, pNext += lAlignedSize) { + + + pSample = new CMediaSample( + NAME("Default memory media sample"), + this, + &hr, + pNext + m_lPrefix, // GetPointer() value + m_lSize); // not including prefix + + ASSERT(SUCCEEDED(hr)); + if (pSample == NULL) { + return E_OUTOFMEMORY; + } + + // This CANNOT fail + m_lFree.Add(pSample); + } + + m_bChanged = FALSE; + return NOERROR; +} + + +// override this to free up any resources we have allocated. +// called from the base class on Decommit when all buffers have been +// returned to the free list. +// +// caller has already locked the object. + +// in our case, we keep the memory until we are deleted, so +// we do nothing here. The memory is deleted in the destructor by +// calling ReallyFree() +void +CMemAllocator::Free(void) +{ + return; +} + + +// called from the destructor (and from Alloc if changing size/count) to +// actually free up the memory +void +CMemAllocator::ReallyFree(void) +{ + /* Should never be deleting this unless all buffers are freed */ + + ASSERT(m_lAllocated == m_lFree.GetCount()); + + /* Free up all the CMediaSamples */ + + CMediaSample *pSample; + for (;;) { + pSample = m_lFree.RemoveHead(); + if (pSample != NULL) { + delete pSample; + } else { + break; + } + } + + m_lAllocated = 0; + + // free the block of buffer memory + if (m_pBuffer) { + EXECUTE_ASSERT(VirtualFree(m_pBuffer, 0, MEM_RELEASE)); + m_pBuffer = NULL; + } +} + + +/* Destructor frees our memory resources */ + +CMemAllocator::~CMemAllocator() +{ + Decommit(); + ReallyFree(); +} + +// ------------------------------------------------------------------------ +// filter registration through IFilterMapper. used if IFilterMapper is +// not found (Quartz 1.0 install) + +STDAPI +AMovieSetupRegisterFilter( const AMOVIESETUP_FILTER * const psetupdata + , IFilterMapper * pIFM + , BOOL bRegister ) +{ + DbgLog((LOG_TRACE, 3, TEXT("= AMovieSetupRegisterFilter"))); + + // check we've got data + // + if( NULL == psetupdata ) return S_FALSE; + + + // unregister filter + // (as pins are subkeys of filter's CLSID key + // they do not need to be removed separately). + // + DbgLog((LOG_TRACE, 3, TEXT("= = unregister filter"))); + HRESULT hr = pIFM->UnregisterFilter( *(psetupdata->clsID) ); + + + if( bRegister ) + { + // register filter + // + DbgLog((LOG_TRACE, 3, TEXT("= = register filter"))); + hr = pIFM->RegisterFilter( *(psetupdata->clsID) + , psetupdata->strName + , psetupdata->dwMerit ); + if( SUCCEEDED(hr) ) + { + // all its pins + // + DbgLog((LOG_TRACE, 3, TEXT("= = register filter pins"))); + for( UINT m1=0; m1 < psetupdata->nPins; m1++ ) + { + hr = pIFM->RegisterPin( *(psetupdata->clsID) + , psetupdata->lpPin[m1].strName + , psetupdata->lpPin[m1].bRendered + , psetupdata->lpPin[m1].bOutput + , psetupdata->lpPin[m1].bZero + , psetupdata->lpPin[m1].bMany + , *(psetupdata->lpPin[m1].clsConnectsToFilter) + , psetupdata->lpPin[m1].strConnectsToPin ); + + if( SUCCEEDED(hr) ) + { + // and each pin's media types + // + DbgLog((LOG_TRACE, 3, TEXT("= = register filter pin types"))); + for( UINT m2=0; m2 < psetupdata->lpPin[m1].nMediaTypes; m2++ ) + { + hr = pIFM->RegisterPinType( *(psetupdata->clsID) + , psetupdata->lpPin[m1].strName + , *(psetupdata->lpPin[m1].lpMediaType[m2].clsMajorType) + , *(psetupdata->lpPin[m1].lpMediaType[m2].clsMinorType) ); + if( FAILED(hr) ) break; + } + if( FAILED(hr) ) break; + } + if( FAILED(hr) ) break; + } + } + } + + // handle one acceptable "error" - that + // of filter not being registered! + // (couldn't find a suitable #define'd + // name for the error!) + // + if( 0x80070002 == hr) + return NOERROR; + else + return hr; +} + +// Remove warnings about unreferenced inline functions +#pragma warning(disable:4514) + diff --git a/third_party/BaseClasses/amfilter.h b/third_party/BaseClasses/amfilter.h new file mode 100644 index 00000000..14f17cd4 --- /dev/null +++ b/third_party/BaseClasses/amfilter.h @@ -0,0 +1,1587 @@ +//------------------------------------------------------------------------------ +// File: AMFilter.h +// +// Desc: DirectShow base classes - efines class hierarchy for streams +// architecture. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __FILTER__ +#define __FILTER__ + +/* The following classes are declared in this header: */ + +class CBaseMediaFilter; // IMediaFilter support +class CBaseFilter; // IBaseFilter,IMediaFilter support +class CBasePin; // Abstract base class for IPin interface +class CEnumPins; // Enumerate input and output pins +class CEnumMediaTypes; // Enumerate the pin's preferred formats +class CBaseOutputPin; // Adds data provider member functions +class CBaseInputPin; // Implements IMemInputPin interface +class CMediaSample; // Basic transport unit for IMemInputPin +class CBaseAllocator; // General list guff for most allocators +class CMemAllocator; // Implements memory buffer allocation + + +//===================================================================== +//===================================================================== +// +// QueryFilterInfo and QueryPinInfo AddRef the interface pointers +// they return. You can use the macro below to release the interface. +// +//===================================================================== +//===================================================================== + +#define QueryFilterInfoReleaseGraph(fi) if ((fi).pGraph) (fi).pGraph->Release(); + +#define QueryPinInfoReleaseFilter(pi) if ((pi).pFilter) (pi).pFilter->Release(); + +//===================================================================== +//===================================================================== +// Defines CBaseMediaFilter +// +// Abstract base class implementing IMediaFilter. +// +// Typically you will derive your filter from CBaseFilter rather than +// this, unless you are implementing an object such as a plug-in +// distributor that needs to support IMediaFilter but not IBaseFilter. +// +// Note that IMediaFilter is derived from IPersist to allow query of +// class id. +//===================================================================== +//===================================================================== + +class AM_NOVTABLE CBaseMediaFilter : public CUnknown, + public IMediaFilter +{ + +protected: + + FILTER_STATE m_State; // current state: running, paused + IReferenceClock *m_pClock; // this filter's reference clock + // note: all filters in a filter graph use the same clock + + // offset from stream time to reference time + CRefTime m_tStart; + + CLSID m_clsid; // This filters clsid + // used for serialization + CCritSec *m_pLock; // Object we use for locking + +public: + + CBaseMediaFilter( + __in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + __in CCritSec *pLock, + REFCLSID clsid); + + virtual ~CBaseMediaFilter(); + + DECLARE_IUNKNOWN + + // override this to say what interfaces we support where + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv); + + // + // --- IPersist method --- + // + + STDMETHODIMP GetClassID(__out CLSID *pClsID); + + // --- IMediaFilter methods --- + + STDMETHODIMP GetState(DWORD dwMSecs, __out FILTER_STATE *State); + + STDMETHODIMP SetSyncSource(__inout_opt IReferenceClock *pClock); + + STDMETHODIMP GetSyncSource(__deref_out_opt IReferenceClock **pClock); + + // default implementation of Stop and Pause just record the + // state. Override to activate or de-activate your filter. + // Note that Run when called from Stopped state will call Pause + // to ensure activation, so if you are a source or transform + // you will probably not need to override Run. + STDMETHODIMP Stop(); + STDMETHODIMP Pause(); + + + // the start parameter is the difference to be added to the + // sample's stream time to get the reference time for + // its presentation + STDMETHODIMP Run(REFERENCE_TIME tStart); + + // --- helper methods --- + + // return the current stream time - ie find out what + // stream time should be appearing now + virtual HRESULT StreamTime(CRefTime& rtStream); + + // Is the filter currently active? (running or paused) + BOOL IsActive() { + CAutoLock cObjectLock(m_pLock); + return ((m_State == State_Paused) || (m_State == State_Running)); + }; +}; + +//===================================================================== +//===================================================================== +// Defines CBaseFilter +// +// An abstract class providing basic IBaseFilter support for pin +// enumeration and filter information reading. +// +// We cannot derive from CBaseMediaFilter since methods in IMediaFilter +// are also in IBaseFilter and would be ambiguous. Since much of the code +// assumes that they derive from a class that has m_State and other state +// directly available, we duplicate code from CBaseMediaFilter rather than +// having a member variable. +// +// Derive your filter from this, or from a derived object such as +// CTransformFilter. +//===================================================================== +//===================================================================== + + +class AM_NOVTABLE CBaseFilter : public CUnknown, // Handles an IUnknown + public IBaseFilter, // The Filter Interface + public IAMovieSetup // For un/registration +{ + +friend class CBasePin; + +protected: + FILTER_STATE m_State; // current state: running, paused + IReferenceClock *m_pClock; // this graph's ref clock + CRefTime m_tStart; // offset from stream time to reference time + CLSID m_clsid; // This filters clsid + // used for serialization + CCritSec *m_pLock; // Object we use for locking + + WCHAR *m_pName; // Full filter name + IFilterGraph *m_pGraph; // Graph we belong to + IMediaEventSink *m_pSink; // Called with notify events + LONG m_PinVersion; // Current pin version + +public: + + CBaseFilter( + __in_opt LPCTSTR pName, // Object description + __inout_opt LPUNKNOWN pUnk, // IUnknown of delegating object + __in CCritSec *pLock, // Object who maintains lock + REFCLSID clsid); // The clsid to be used to serialize this filter + + CBaseFilter( + __in_opt LPCTSTR pName, // Object description + __in_opt LPUNKNOWN pUnk, // IUnknown of delegating object + __in CCritSec *pLock, // Object who maintains lock + REFCLSID clsid, // The clsid to be used to serialize this filter + __inout HRESULT *phr); // General OLE return code +#ifdef UNICODE + CBaseFilter( + __in_opt LPCSTR pName, // Object description + __in_opt LPUNKNOWN pUnk, // IUnknown of delegating object + __in CCritSec *pLock, // Object who maintains lock + REFCLSID clsid); // The clsid to be used to serialize this filter + + CBaseFilter( + __in_opt LPCSTR pName, // Object description + __in_opt LPUNKNOWN pUnk, // IUnknown of delegating object + __in CCritSec *pLock, // Object who maintains lock + REFCLSID clsid, // The clsid to be used to serialize this filter + __inout HRESULT *phr); // General OLE return code +#endif + ~CBaseFilter(); + + DECLARE_IUNKNOWN + + // override this to say what interfaces we support where + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv); +#ifdef DEBUG + STDMETHODIMP_(ULONG) NonDelegatingRelease(); +#endif + + // + // --- IPersist method --- + // + + STDMETHODIMP GetClassID(__out CLSID *pClsID); + + // --- IMediaFilter methods --- + + STDMETHODIMP GetState(DWORD dwMSecs, __out FILTER_STATE *State); + + STDMETHODIMP SetSyncSource(__in_opt IReferenceClock *pClock); + + STDMETHODIMP GetSyncSource(__deref_out_opt IReferenceClock **pClock); + + + // override Stop and Pause so we can activate the pins. + // Note that Run will call Pause first if activation needed. + // Override these if you want to activate your filter rather than + // your pins. + STDMETHODIMP Stop(); + STDMETHODIMP Pause(); + + // the start parameter is the difference to be added to the + // sample's stream time to get the reference time for + // its presentation + STDMETHODIMP Run(REFERENCE_TIME tStart); + + // --- helper methods --- + + // return the current stream time - ie find out what + // stream time should be appearing now + virtual HRESULT StreamTime(CRefTime& rtStream); + + // Is the filter currently active? + BOOL IsActive() { + CAutoLock cObjectLock(m_pLock); + return ((m_State == State_Paused) || (m_State == State_Running)); + }; + + // Is this filter stopped (without locking) + BOOL IsStopped() { + return (m_State == State_Stopped); + }; + + // + // --- IBaseFilter methods --- + // + + // pin enumerator + STDMETHODIMP EnumPins( + __deref_out IEnumPins ** ppEnum); + + + // default behaviour of FindPin assumes pin ids are their names + STDMETHODIMP FindPin( + LPCWSTR Id, + __deref_out IPin ** ppPin + ); + + STDMETHODIMP QueryFilterInfo( + __out FILTER_INFO * pInfo); + + STDMETHODIMP JoinFilterGraph( + __inout_opt IFilterGraph * pGraph, + __in_opt LPCWSTR pName); + + // return a Vendor information string. Optional - may return E_NOTIMPL. + // memory returned should be freed using CoTaskMemFree + // default implementation returns E_NOTIMPL + STDMETHODIMP QueryVendorInfo( + __deref_out LPWSTR* pVendorInfo + ); + + // --- helper methods --- + + // send an event notification to the filter graph if we know about it. + // returns S_OK if delivered, S_FALSE if the filter graph does not sink + // events, or an error otherwise. + HRESULT NotifyEvent( + long EventCode, + LONG_PTR EventParam1, + LONG_PTR EventParam2); + + // return the filter graph we belong to + __out_opt IFilterGraph *GetFilterGraph() { + return m_pGraph; + } + + // Request reconnect + // pPin is the pin to reconnect + // pmt is the type to reconnect with - can be NULL + // Calls ReconnectEx on the filter graph + HRESULT ReconnectPin(IPin *pPin, __in_opt AM_MEDIA_TYPE const *pmt); + + // find out the current pin version (used by enumerators) + virtual LONG GetPinVersion(); + void IncrementPinVersion(); + + // you need to supply these to access the pins from the enumerator + // and for default Stop and Pause/Run activation. + virtual int GetPinCount() PURE; + virtual CBasePin *GetPin(int n) PURE; + + // --- IAMovieSetup methods --- + + STDMETHODIMP Register(); // ask filter to register itself + STDMETHODIMP Unregister(); // and unregister itself + + // --- setup helper methods --- + // (override to return filters setup data) + + virtual __out_opt LPAMOVIESETUP_FILTER GetSetupData(){ return NULL; } + +}; + + +//===================================================================== +//===================================================================== +// Defines CBasePin +// +// Abstract class that supports the basics of IPin +//===================================================================== +//===================================================================== + +class AM_NOVTABLE CBasePin : public CUnknown, public IPin, public IQualityControl +{ + +protected: + + WCHAR * m_pName; // This pin's name + IPin *m_Connected; // Pin we have connected to + PIN_DIRECTION m_dir; // Direction of this pin + CCritSec *m_pLock; // Object we use for locking + bool m_bRunTimeError; // Run time error generated + bool m_bCanReconnectWhenActive; // OK to reconnect when active + bool m_bTryMyTypesFirst; // When connecting enumerate + // this pin's types first + CBaseFilter *m_pFilter; // Filter we were created by + IQualityControl *m_pQSink; // Target for Quality messages + LONG m_TypeVersion; // Holds current type version + CMediaType m_mt; // Media type of connection + + CRefTime m_tStart; // time from NewSegment call + CRefTime m_tStop; // time from NewSegment + double m_dRate; // rate from NewSegment + +#ifdef DEBUG + LONG m_cRef; // Ref count tracing +#endif + + // displays pin connection information + +#ifdef DEBUG + void DisplayPinInfo(IPin *pReceivePin); + void DisplayTypeInfo(IPin *pPin, const CMediaType *pmt); +#else + void DisplayPinInfo(IPin *pReceivePin) {}; + void DisplayTypeInfo(IPin *pPin, const CMediaType *pmt) {}; +#endif + + // used to agree a media type for a pin connection + + // given a specific media type, attempt a connection (includes + // checking that the type is acceptable to this pin) + HRESULT + AttemptConnection( + IPin* pReceivePin, // connect to this pin + const CMediaType* pmt // using this type + ); + + // try all the media types in this enumerator - for each that + // we accept, try to connect using ReceiveConnection. + HRESULT TryMediaTypes( + IPin *pReceivePin, // connect to this pin + __in_opt const CMediaType *pmt, // proposed type from Connect + IEnumMediaTypes *pEnum); // try this enumerator + + // establish a connection with a suitable mediatype. Needs to + // propose a media type if the pmt pointer is null or partially + // specified - use TryMediaTypes on both our and then the other pin's + // enumerator until we find one that works. + HRESULT AgreeMediaType( + IPin *pReceivePin, // connect to this pin + const CMediaType *pmt); // proposed type from Connect + +public: + + CBasePin( + __in_opt LPCTSTR pObjectName, // Object description + __in CBaseFilter *pFilter, // Owning filter who knows about pins + __in CCritSec *pLock, // Object who implements the lock + __inout HRESULT *phr, // General OLE return code + __in_opt LPCWSTR pName, // Pin name for us + PIN_DIRECTION dir); // Either PINDIR_INPUT or PINDIR_OUTPUT +#ifdef UNICODE + CBasePin( + __in_opt LPCSTR pObjectName, // Object description + __in CBaseFilter *pFilter, // Owning filter who knows about pins + __in CCritSec *pLock, // Object who implements the lock + __inout HRESULT *phr, // General OLE return code + __in_opt LPCWSTR pName, // Pin name for us + PIN_DIRECTION dir); // Either PINDIR_INPUT or PINDIR_OUTPUT +#endif + virtual ~CBasePin(); + + DECLARE_IUNKNOWN + + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv); + STDMETHODIMP_(ULONG) NonDelegatingRelease(); + STDMETHODIMP_(ULONG) NonDelegatingAddRef(); + + // --- IPin methods --- + + // take lead role in establishing a connection. Media type pointer + // may be null, or may point to partially-specified mediatype + // (subtype or format type may be GUID_NULL). + STDMETHODIMP Connect( + IPin * pReceivePin, + __in_opt const AM_MEDIA_TYPE *pmt // optional media type + ); + + // (passive) accept a connection from another pin + STDMETHODIMP ReceiveConnection( + IPin * pConnector, // this is the initiating connecting pin + const AM_MEDIA_TYPE *pmt // this is the media type we will exchange + ); + + STDMETHODIMP Disconnect(); + + STDMETHODIMP ConnectedTo(__deref_out IPin **pPin); + + STDMETHODIMP ConnectionMediaType(__out AM_MEDIA_TYPE *pmt); + + STDMETHODIMP QueryPinInfo( + __out PIN_INFO * pInfo + ); + + STDMETHODIMP QueryDirection( + __out PIN_DIRECTION * pPinDir + ); + + STDMETHODIMP QueryId( + __deref_out LPWSTR * Id + ); + + // does the pin support this media type + STDMETHODIMP QueryAccept( + const AM_MEDIA_TYPE *pmt + ); + + // return an enumerator for this pins preferred media types + STDMETHODIMP EnumMediaTypes( + __deref_out IEnumMediaTypes **ppEnum + ); + + // return an array of IPin* - the pins that this pin internally connects to + // All pins put in the array must be AddReffed (but no others) + // Errors: "Can't say" - FAIL, not enough slots - return S_FALSE + // Default: return E_NOTIMPL + // The filter graph will interpret NOT_IMPL as any input pin connects to + // all visible output pins and vice versa. + // apPin can be NULL if nPin==0 (not otherwise). + STDMETHODIMP QueryInternalConnections( + __out_ecount_part(*nPin,*nPin) IPin* *apPin, // array of IPin* + __inout ULONG *nPin // on input, the number of slots + // on output the number of pins + ) { return E_NOTIMPL; } + + // Called when no more data will be sent + STDMETHODIMP EndOfStream(void); + + // Begin/EndFlush still PURE + + // NewSegment notifies of the start/stop/rate applying to the data + // about to be received. Default implementation records data and + // returns S_OK. + // Override this to pass downstream. + STDMETHODIMP NewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate); + + //================================================================================ + // IQualityControl methods + //================================================================================ + + STDMETHODIMP Notify(IBaseFilter * pSender, Quality q); + + STDMETHODIMP SetSink(IQualityControl * piqc); + + // --- helper methods --- + + // Returns true if the pin is connected. false otherwise. + BOOL IsConnected(void) {return (m_Connected != NULL); }; + // Return the pin this is connected to (if any) + IPin * GetConnected() { return m_Connected; }; + + // Check if our filter is currently stopped + BOOL IsStopped() { + return (m_pFilter->m_State == State_Stopped); + }; + + // find out the current type version (used by enumerators) + virtual LONG GetMediaTypeVersion(); + void IncrementTypeVersion(); + + // switch the pin to active (paused or running) mode + // not an error to call this if already active + virtual HRESULT Active(void); + + // switch the pin to inactive state - may already be inactive + virtual HRESULT Inactive(void); + + // Notify of Run() from filter + virtual HRESULT Run(REFERENCE_TIME tStart); + + // check if the pin can support this specific proposed type and format + virtual HRESULT CheckMediaType(const CMediaType *) PURE; + + // set the connection to use this format (previously agreed) + virtual HRESULT SetMediaType(const CMediaType *); + + // check that the connection is ok before verifying it + // can be overridden eg to check what interfaces will be supported. + virtual HRESULT CheckConnect(IPin *); + + // Set and release resources required for a connection + virtual HRESULT BreakConnect(); + virtual HRESULT CompleteConnect(IPin *pReceivePin); + + // returns the preferred formats for a pin + virtual HRESULT GetMediaType(int iPosition, __inout CMediaType *pMediaType); + + // access to NewSegment values + REFERENCE_TIME CurrentStopTime() { + return m_tStop; + } + REFERENCE_TIME CurrentStartTime() { + return m_tStart; + } + double CurrentRate() { + return m_dRate; + } + + // Access name + LPWSTR Name() { return m_pName; }; + + // Can reconnectwhen active? + void SetReconnectWhenActive(bool bCanReconnect) + { + m_bCanReconnectWhenActive = bCanReconnect; + } + + bool CanReconnectWhenActive() + { + return m_bCanReconnectWhenActive; + } + +protected: + STDMETHODIMP DisconnectInternal(); +}; + + +//===================================================================== +//===================================================================== +// Defines CEnumPins +// +// Pin enumerator class that works by calling CBaseFilter. This interface +// is provided by CBaseFilter::EnumPins and calls GetPinCount() and +// GetPin() to enumerate existing pins. Needs to be a separate object so +// that it can be cloned (creating an existing object at the same +// position in the enumeration) +// +//===================================================================== +//===================================================================== + +class CEnumPins : public IEnumPins // The interface we support +{ + int m_Position; // Current ordinal position + int m_PinCount; // Number of pins available + CBaseFilter *m_pFilter; // The filter who owns us + LONG m_Version; // Pin version information + LONG m_cRef; + + typedef CGenericList CPinList; + + CPinList m_PinCache; // These pointers have not been AddRef'ed and + // so they should not be dereferenced. They are + // merely kept to ID which pins have been enumerated. + +#ifdef DEBUG + DWORD m_dwCookie; +#endif + + /* If while we are retrieving a pin for example from the filter an error + occurs we assume that our internal state is stale with respect to the + filter (someone may have deleted all the pins). We can check before + starting whether or not the operation is likely to fail by asking the + filter what it's current version number is. If the filter has not + overriden the GetPinVersion method then this will always match */ + + BOOL AreWeOutOfSync() { + return (m_pFilter->GetPinVersion() == m_Version ? FALSE : TRUE); + }; + + /* This method performs the same operations as Reset, except is does not clear + the cache of pins already enumerated. */ + + STDMETHODIMP Refresh(); + +public: + + CEnumPins( + __in CBaseFilter *pFilter, + __in_opt CEnumPins *pEnumPins); + + virtual ~CEnumPins(); + + // IUnknown + STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv); + STDMETHODIMP_(ULONG) AddRef(); + STDMETHODIMP_(ULONG) Release(); + + // IEnumPins + STDMETHODIMP Next( + ULONG cPins, // place this many pins... + __out_ecount(cPins) IPin ** ppPins, // ...in this array of IPin* + __out_opt ULONG * pcFetched // actual count passed returned here + ); + + STDMETHODIMP Skip(ULONG cPins); + STDMETHODIMP Reset(); + STDMETHODIMP Clone(__deref_out IEnumPins **ppEnum); + + +}; + + +//===================================================================== +//===================================================================== +// Defines CEnumMediaTypes +// +// Enumerates the preferred formats for input and output pins +//===================================================================== +//===================================================================== + +class CEnumMediaTypes : public IEnumMediaTypes // The interface we support +{ + int m_Position; // Current ordinal position + CBasePin *m_pPin; // The pin who owns us + LONG m_Version; // Media type version value + LONG m_cRef; +#ifdef DEBUG + DWORD m_dwCookie; +#endif + + /* The media types a filter supports can be quite dynamic so we add to + the general IEnumXXXX interface the ability to be signaled when they + change via an event handle the connected filter supplies. Until the + Reset method is called after the state changes all further calls to + the enumerator (except Reset) will return E_UNEXPECTED error code */ + + BOOL AreWeOutOfSync() { + return (m_pPin->GetMediaTypeVersion() == m_Version ? FALSE : TRUE); + }; + +public: + + CEnumMediaTypes( + __in CBasePin *pPin, + __in_opt CEnumMediaTypes *pEnumMediaTypes); + + virtual ~CEnumMediaTypes(); + + // IUnknown + STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv); + STDMETHODIMP_(ULONG) AddRef(); + STDMETHODIMP_(ULONG) Release(); + + // IEnumMediaTypes + STDMETHODIMP Next( + ULONG cMediaTypes, // place this many pins... + __out_ecount(cMediaTypes) AM_MEDIA_TYPE ** ppMediaTypes, // ...in this array + __out_opt ULONG * pcFetched // actual count passed + ); + + STDMETHODIMP Skip(ULONG cMediaTypes); + STDMETHODIMP Reset(); + STDMETHODIMP Clone(__deref_out IEnumMediaTypes **ppEnum); +}; + + + + +//===================================================================== +//===================================================================== +// Defines CBaseOutputPin +// +// class derived from CBasePin that can pass buffers to a connected pin +// that supports IMemInputPin. Supports IPin. +// +// Derive your output pin from this. +// +//===================================================================== +//===================================================================== + +class AM_NOVTABLE CBaseOutputPin : public CBasePin +{ + +protected: + + IMemAllocator *m_pAllocator; + IMemInputPin *m_pInputPin; // interface on the downstreaminput pin + // set up in CheckConnect when we connect. + +public: + + CBaseOutputPin( + __in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); +#ifdef UNICODE + CBaseOutputPin( + __in_opt LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); +#endif + // override CompleteConnect() so we can negotiate an allocator + virtual HRESULT CompleteConnect(IPin *pReceivePin); + + // negotiate the allocator and its buffer size/count and other properties + // Calls DecideBufferSize to set properties + virtual HRESULT DecideAllocator(IMemInputPin * pPin, __deref_out IMemAllocator ** pAlloc); + + // override this to set the buffer size and count. Return an error + // if the size/count is not to your liking. + // The allocator properties passed in are those requested by the + // input pin - use eg the alignment and prefix members if you have + // no preference on these. + virtual HRESULT DecideBufferSize( + IMemAllocator * pAlloc, + __inout ALLOCATOR_PROPERTIES * ppropInputRequest + ) PURE; + + // returns an empty sample buffer from the allocator + virtual HRESULT GetDeliveryBuffer(__deref_out IMediaSample ** ppSample, + __in_opt REFERENCE_TIME * pStartTime, + __in_opt REFERENCE_TIME * pEndTime, + DWORD dwFlags); + + // deliver a filled-in sample to the connected input pin + // note - you need to release it after calling this. The receiving + // pin will addref the sample if it needs to hold it beyond the + // call. + virtual HRESULT Deliver(IMediaSample *); + + // override this to control the connection + virtual HRESULT InitAllocator(__deref_out IMemAllocator **ppAlloc); + HRESULT CheckConnect(IPin *pPin); + HRESULT BreakConnect(); + + // override to call Commit and Decommit + HRESULT Active(void); + HRESULT Inactive(void); + + // we have a default handling of EndOfStream which is to return + // an error, since this should be called on input pins only + STDMETHODIMP EndOfStream(void); + + // called from elsewhere in our filter to pass EOS downstream to + // our connected input pin + virtual HRESULT DeliverEndOfStream(void); + + // same for Begin/EndFlush - we handle Begin/EndFlush since it + // is an error on an output pin, and we have Deliver methods to + // call the methods on the connected pin + STDMETHODIMP BeginFlush(void); + STDMETHODIMP EndFlush(void); + virtual HRESULT DeliverBeginFlush(void); + virtual HRESULT DeliverEndFlush(void); + + // deliver NewSegment to connected pin - you will need to + // override this if you queue any data in your output pin. + virtual HRESULT DeliverNewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate); + + //================================================================================ + // IQualityControl methods + //================================================================================ + + // All inherited from CBasePin and not overridden here. + // STDMETHODIMP Notify(IBaseFilter * pSender, Quality q); + // STDMETHODIMP SetSink(IQualityControl * piqc); +}; + + +//===================================================================== +//===================================================================== +// Defines CBaseInputPin +// +// derive your standard input pin from this. +// you need to supply GetMediaType and CheckConnect etc (see CBasePin), +// and you need to supply Receive to do something more useful. +// +//===================================================================== +//===================================================================== + +class AM_NOVTABLE CBaseInputPin : public CBasePin, + public IMemInputPin +{ + +protected: + + IMemAllocator *m_pAllocator; // Default memory allocator + + // allocator is read-only, so received samples + // cannot be modified (probably only relevant to in-place + // transforms + BYTE m_bReadOnly; + + // in flushing state (between BeginFlush and EndFlush) + // if TRUE, all Receives are returned with S_FALSE + BYTE m_bFlushing; + + // Sample properties - initalized in Receive + AM_SAMPLE2_PROPERTIES m_SampleProps; + +public: + + CBaseInputPin( + __in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); +#ifdef UNICODE + CBaseInputPin( + __in_opt LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); +#endif + virtual ~CBaseInputPin(); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + // return the allocator interface that this input pin + // would like the output pin to use + STDMETHODIMP GetAllocator(__deref_out IMemAllocator ** ppAllocator); + + // tell the input pin which allocator the output pin is actually + // going to use. + STDMETHODIMP NotifyAllocator( + IMemAllocator * pAllocator, + BOOL bReadOnly); + + // do something with this media sample + STDMETHODIMP Receive(IMediaSample *pSample); + + // do something with these media samples + STDMETHODIMP ReceiveMultiple ( + __in_ecount(nSamples) IMediaSample **pSamples, + long nSamples, + __out long *nSamplesProcessed); + + // See if Receive() blocks + STDMETHODIMP ReceiveCanBlock(); + + // Default handling for BeginFlush - call at the beginning + // of your implementation (makes sure that all Receive calls + // fail). After calling this, you need to free any queued data + // and then call downstream. + STDMETHODIMP BeginFlush(void); + + // default handling for EndFlush - call at end of your implementation + // - before calling this, ensure that there is no queued data and no thread + // pushing any more without a further receive, then call downstream, + // then call this method to clear the m_bFlushing flag and re-enable + // receives + STDMETHODIMP EndFlush(void); + + // this method is optional (can return E_NOTIMPL). + // default implementation returns E_NOTIMPL. Override if you have + // specific alignment or prefix needs, but could use an upstream + // allocator + STDMETHODIMP GetAllocatorRequirements(__out ALLOCATOR_PROPERTIES*pProps); + + // Release the pin's allocator. + HRESULT BreakConnect(); + + // helper method to check the read-only flag + BOOL IsReadOnly() { + return m_bReadOnly; + }; + + // helper method to see if we are flushing + BOOL IsFlushing() { + return m_bFlushing; + }; + + // Override this for checking whether it's OK to process samples + // Also call this from EndOfStream. + virtual HRESULT CheckStreaming(); + + // Pass a Quality notification on to the appropriate sink + HRESULT PassNotify(Quality& q); + + + //================================================================================ + // IQualityControl methods (from CBasePin) + //================================================================================ + + STDMETHODIMP Notify(IBaseFilter * pSender, Quality q); + + // no need to override: + // STDMETHODIMP SetSink(IQualityControl * piqc); + + + // switch the pin to inactive state - may already be inactive + virtual HRESULT Inactive(void); + + // Return sample properties pointer + AM_SAMPLE2_PROPERTIES * SampleProps() { + ASSERT(m_SampleProps.cbData != 0); + return &m_SampleProps; + } + +}; + +/////////////////////////////////////////////////////////////////////////// +// CDynamicOutputPin +// + +class CDynamicOutputPin : public CBaseOutputPin, + public IPinFlowControl +{ +public: +#ifdef UNICODE + CDynamicOutputPin( + __in_opt LPCSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); +#endif + + CDynamicOutputPin( + __in_opt LPCTSTR pObjectName, + __in CBaseFilter *pFilter, + __in CCritSec *pLock, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); + + ~CDynamicOutputPin(); + + // IUnknown Methods + DECLARE_IUNKNOWN + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + // IPin Methods + STDMETHODIMP Disconnect(void); + + // IPinFlowControl Methods + STDMETHODIMP Block(DWORD dwBlockFlags, HANDLE hEvent); + + // Set graph config info + void SetConfigInfo(IGraphConfig *pGraphConfig, HANDLE hStopEvent); + + #ifdef DEBUG + virtual HRESULT Deliver(IMediaSample *pSample); + virtual HRESULT DeliverEndOfStream(void); + virtual HRESULT DeliverNewSegment(REFERENCE_TIME tStart, REFERENCE_TIME tStop, double dRate); + #endif // DEBUG + + HRESULT DeliverBeginFlush(void); + HRESULT DeliverEndFlush(void); + + HRESULT Inactive(void); + HRESULT Active(void); + virtual HRESULT CompleteConnect(IPin *pReceivePin); + + virtual HRESULT StartUsingOutputPin(void); + virtual void StopUsingOutputPin(void); + virtual bool StreamingThreadUsingOutputPin(void); + + HRESULT ChangeOutputFormat + ( + const AM_MEDIA_TYPE *pmt, + REFERENCE_TIME tSegmentStart, + REFERENCE_TIME tSegmentStop, + double dSegmentRate + ); + HRESULT ChangeMediaType(const CMediaType *pmt); + HRESULT DynamicReconnect(const CMediaType *pmt); + +protected: + HRESULT SynchronousBlockOutputPin(void); + HRESULT AsynchronousBlockOutputPin(HANDLE hNotifyCallerPinBlockedEvent); + HRESULT UnblockOutputPin(void); + + void BlockOutputPin(void); + void ResetBlockState(void); + + static HRESULT WaitEvent(HANDLE hEvent); + + enum BLOCK_STATE + { + NOT_BLOCKED, + PENDING, + BLOCKED + }; + + // This lock should be held when the following class members are + // being used: m_hNotifyCallerPinBlockedEvent, m_BlockState, + // m_dwBlockCallerThreadID and m_dwNumOutstandingOutputPinUsers. + CCritSec m_BlockStateLock; + + // This event should be signaled when the output pin is + // not blocked. This is a manual reset event. For more + // information on events, see the documentation for + // CreateEvent() in the Windows SDK. + HANDLE m_hUnblockOutputPinEvent; + + // This event will be signaled when block operation succeedes or + // when the user cancels the block operation. The block operation + // can be canceled by calling IPinFlowControl2::Block( 0, NULL ) + // while the block operation is pending. + HANDLE m_hNotifyCallerPinBlockedEvent; + + // The state of the current block operation. + BLOCK_STATE m_BlockState; + + // The ID of the thread which last called IPinFlowControl::Block(). + // For more information on thread IDs, see the documentation for + // GetCurrentThreadID() in the Windows SDK. + DWORD m_dwBlockCallerThreadID; + + // The number of times StartUsingOutputPin() has been sucessfully + // called and a corresponding call to StopUsingOutputPin() has not + // been made. When this variable is greater than 0, the streaming + // thread is calling IPin::NewSegment(), IPin::EndOfStream(), + // IMemInputPin::Receive() or IMemInputPin::ReceiveMultiple(). The + // streaming thread could also be calling: DynamicReconnect(), + // ChangeMediaType() or ChangeOutputFormat(). The output pin cannot + // be blocked while the output pin is being used. + DWORD m_dwNumOutstandingOutputPinUsers; + + // This event should be set when the IMediaFilter::Stop() is called. + // This is a manual reset event. It is also set when the output pin + // delivers a flush to the connected input pin. + HANDLE m_hStopEvent; + IGraphConfig* m_pGraphConfig; + + // TRUE if the output pin's allocator's samples are read only. + // Otherwise FALSE. For more information, see the documentation + // for IMemInputPin::NotifyAllocator(). + BOOL m_bPinUsesReadOnlyAllocator; + +private: + HRESULT Initialize(void); + HRESULT ChangeMediaTypeHelper(const CMediaType *pmt); + + #ifdef DEBUG + void AssertValid(void); + #endif // DEBUG +}; + +class CAutoUsingOutputPin +{ +public: + CAutoUsingOutputPin( __in CDynamicOutputPin* pOutputPin, __inout HRESULT* phr ); + ~CAutoUsingOutputPin(); + +private: + CDynamicOutputPin* m_pOutputPin; +}; + +inline CAutoUsingOutputPin::CAutoUsingOutputPin( __in CDynamicOutputPin* pOutputPin, __inout HRESULT* phr ) : + m_pOutputPin(NULL) +{ + // The caller should always pass in valid pointers. + ASSERT( NULL != pOutputPin ); + ASSERT( NULL != phr ); + + // Make sure the user initialized phr. + ASSERT( S_OK == *phr ); + + HRESULT hr = pOutputPin->StartUsingOutputPin(); + if( FAILED( hr ) ) + { + *phr = hr; + return; + } + + m_pOutputPin = pOutputPin; +} + +inline CAutoUsingOutputPin::~CAutoUsingOutputPin() +{ + if( NULL != m_pOutputPin ) + { + m_pOutputPin->StopUsingOutputPin(); + } +} + +#ifdef DEBUG + +inline HRESULT CDynamicOutputPin::Deliver(IMediaSample *pSample) +{ + // The caller should call StartUsingOutputPin() before calling this + // method. + ASSERT(StreamingThreadUsingOutputPin()); + + return CBaseOutputPin::Deliver(pSample); +} + +inline HRESULT CDynamicOutputPin::DeliverEndOfStream(void) +{ + // The caller should call StartUsingOutputPin() before calling this + // method. + ASSERT( StreamingThreadUsingOutputPin() ); + + return CBaseOutputPin::DeliverEndOfStream(); +} + +inline HRESULT CDynamicOutputPin::DeliverNewSegment(REFERENCE_TIME tStart, REFERENCE_TIME tStop, double dRate) +{ + // The caller should call StartUsingOutputPin() before calling this + // method. + ASSERT(StreamingThreadUsingOutputPin()); + + return CBaseOutputPin::DeliverNewSegment(tStart, tStop, dRate); +} + +#endif // DEBUG + +//===================================================================== +//===================================================================== +// Memory allocators +// +// the shared memory transport between pins requires the input pin +// to provide a memory allocator that can provide sample objects. A +// sample object supports the IMediaSample interface. +// +// CBaseAllocator handles the management of free and busy samples. It +// allocates CMediaSample objects. CBaseAllocator is an abstract class: +// in particular it has no method of initializing the list of free +// samples. CMemAllocator is derived from CBaseAllocator and initializes +// the list of samples using memory from the standard IMalloc interface. +// +// If you want your buffers to live in some special area of memory, +// derive your allocator object from CBaseAllocator. If you derive your +// IMemInputPin interface object from CBaseMemInputPin, you will get +// CMemAllocator-based allocation etc for free and will just need to +// supply the Receive handling, and media type / format negotiation. +//===================================================================== +//===================================================================== + + +//===================================================================== +//===================================================================== +// Defines CMediaSample +// +// an object of this class supports IMediaSample and represents a buffer +// for media data with some associated properties. Releasing it returns +// it to a freelist managed by a CBaseAllocator derived object. +//===================================================================== +//===================================================================== + +class CMediaSample : public IMediaSample2 // The interface we support +{ + +protected: + + friend class CBaseAllocator; + + /* Values for dwFlags - these are used for backward compatiblity + only now - use AM_SAMPLE_xxx + */ + enum { Sample_SyncPoint = 0x01, /* Is this a sync point */ + Sample_Preroll = 0x02, /* Is this a preroll sample */ + Sample_Discontinuity = 0x04, /* Set if start of new segment */ + Sample_TypeChanged = 0x08, /* Has the type changed */ + Sample_TimeValid = 0x10, /* Set if time is valid */ + Sample_MediaTimeValid = 0x20, /* Is the media time valid */ + Sample_TimeDiscontinuity = 0x40, /* Time discontinuity */ + Sample_StopValid = 0x100, /* Stop time valid */ + Sample_ValidFlags = 0x1FF + }; + + /* Properties, the media sample class can be a container for a format + change in which case we take a copy of a type through the SetMediaType + interface function and then return it when GetMediaType is called. As + we do no internal processing on it we leave it as a pointer */ + + DWORD m_dwFlags; /* Flags for this sample */ + /* Type specific flags are packed + into the top word + */ + DWORD m_dwTypeSpecificFlags; /* Media type specific flags */ + __field_ecount_opt(m_cbBuffer) LPBYTE m_pBuffer; /* Pointer to the complete buffer */ + LONG m_lActual; /* Length of data in this sample */ + LONG m_cbBuffer; /* Size of the buffer */ + CBaseAllocator *m_pAllocator; /* The allocator who owns us */ + CMediaSample *m_pNext; /* Chaining in free list */ + REFERENCE_TIME m_Start; /* Start sample time */ + REFERENCE_TIME m_End; /* End sample time */ + LONGLONG m_MediaStart; /* Real media start position */ + LONG m_MediaEnd; /* A difference to get the end */ + AM_MEDIA_TYPE *m_pMediaType; /* Media type change data */ + DWORD m_dwStreamId; /* Stream id */ +public: + LONG m_cRef; /* Reference count */ + + +public: + + CMediaSample( + __in_opt LPCTSTR pName, + __in_opt CBaseAllocator *pAllocator, + __inout_opt HRESULT *phr, + __in_bcount_opt(length) LPBYTE pBuffer = NULL, + LONG length = 0); +#ifdef UNICODE + CMediaSample( + __in_opt LPCSTR pName, + __in_opt CBaseAllocator *pAllocator, + __inout_opt HRESULT *phr, + __in_bcount_opt(length) LPBYTE pBuffer = NULL, + LONG length = 0); +#endif + + virtual ~CMediaSample(); + + /* Note the media sample does not delegate to its owner */ + + STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv); + STDMETHODIMP_(ULONG) AddRef(); + STDMETHODIMP_(ULONG) Release(); + + // set the buffer pointer and length. Used by allocators that + // want variable sized pointers or pointers into already-read data. + // This is only available through a CMediaSample* not an IMediaSample* + // and so cannot be changed by clients. + HRESULT SetPointer(__in_bcount(cBytes) BYTE * ptr, LONG cBytes); + + // Get me a read/write pointer to this buffer's memory. + STDMETHODIMP GetPointer(__deref_out BYTE ** ppBuffer); + + STDMETHODIMP_(LONG) GetSize(void); + + // get the stream time at which this sample should start and finish. + STDMETHODIMP GetTime( + __out REFERENCE_TIME * pTimeStart, // put time here + __out REFERENCE_TIME * pTimeEnd + ); + + // Set the stream time at which this sample should start and finish. + STDMETHODIMP SetTime( + __in_opt REFERENCE_TIME * pTimeStart, // put time here + __in_opt REFERENCE_TIME * pTimeEnd + ); + STDMETHODIMP IsSyncPoint(void); + STDMETHODIMP SetSyncPoint(BOOL bIsSyncPoint); + STDMETHODIMP IsPreroll(void); + STDMETHODIMP SetPreroll(BOOL bIsPreroll); + + STDMETHODIMP_(LONG) GetActualDataLength(void); + STDMETHODIMP SetActualDataLength(LONG lActual); + + // these allow for limited format changes in band + + STDMETHODIMP GetMediaType(__deref_out AM_MEDIA_TYPE **ppMediaType); + STDMETHODIMP SetMediaType(__in_opt AM_MEDIA_TYPE *pMediaType); + + // returns S_OK if there is a discontinuity in the data (this same is + // not a continuation of the previous stream of data + // - there has been a seek). + STDMETHODIMP IsDiscontinuity(void); + // set the discontinuity property - TRUE if this sample is not a + // continuation, but a new sample after a seek. + STDMETHODIMP SetDiscontinuity(BOOL bDiscontinuity); + + // get the media times for this sample + STDMETHODIMP GetMediaTime( + __out LONGLONG * pTimeStart, + __out LONGLONG * pTimeEnd + ); + + // Set the media times for this sample + STDMETHODIMP SetMediaTime( + __in_opt LONGLONG * pTimeStart, + __in_opt LONGLONG * pTimeEnd + ); + + // Set and get properties (IMediaSample2) + STDMETHODIMP GetProperties( + DWORD cbProperties, + __out_bcount(cbProperties) BYTE * pbProperties + ); + + STDMETHODIMP SetProperties( + DWORD cbProperties, + __in_bcount(cbProperties) const BYTE * pbProperties + ); +}; + + +//===================================================================== +//===================================================================== +// Defines CBaseAllocator +// +// Abstract base class that manages a list of media samples +// +// This class provides support for getting buffers from the free list, +// including handling of commit and (asynchronous) decommit. +// +// Derive from this class and override the Alloc and Free functions to +// allocate your CMediaSample (or derived) objects and add them to the +// free list, preparing them as necessary. +//===================================================================== +//===================================================================== + +class AM_NOVTABLE CBaseAllocator : public CUnknown,// A non delegating IUnknown + public IMemAllocatorCallbackTemp, // The interface we support + public CCritSec // Provides object locking +{ + class CSampleList; + friend class CSampleList; + + /* Trick to get at protected member in CMediaSample */ + static CMediaSample * &NextSample(__in CMediaSample *pSample) + { + return pSample->m_pNext; + }; + + /* Mini list class for the free list */ + class CSampleList + { + public: + CSampleList() : m_List(NULL), m_nOnList(0) {}; +#ifdef DEBUG + ~CSampleList() + { + ASSERT(m_nOnList == 0); + }; +#endif + CMediaSample *Head() const { return m_List; }; + CMediaSample *Next(__in CMediaSample *pSample) const { return CBaseAllocator::NextSample(pSample); }; + int GetCount() const { return m_nOnList; }; + void Add(__inout CMediaSample *pSample) + { + ASSERT(pSample != NULL); + CBaseAllocator::NextSample(pSample) = m_List; + m_List = pSample; + m_nOnList++; + }; + CMediaSample *RemoveHead() + { + CMediaSample *pSample = m_List; + if (pSample != NULL) { + m_List = CBaseAllocator::NextSample(m_List); + m_nOnList--; + } + return pSample; + }; + void Remove(__inout CMediaSample *pSample); + + public: + CMediaSample *m_List; + int m_nOnList; + }; +protected: + + CSampleList m_lFree; // Free list + + /* Note to overriders of CBaseAllocator. + + We use a lazy signalling mechanism for waiting for samples. + This means we don't call the OS if no waits occur. + + In order to implement this: + + 1. When a new sample is added to m_lFree call NotifySample() which + calls ReleaseSemaphore on m_hSem with a count of m_lWaiting and + sets m_lWaiting to 0. + This must all be done holding the allocator's critical section. + + 2. When waiting for a sample call SetWaiting() which increments + m_lWaiting BEFORE leaving the allocator's critical section. + + 3. Actually wait by calling WaitForSingleObject(m_hSem, INFINITE) + having left the allocator's critical section. The effect of + this is to remove 1 from the semaphore's count. You MUST call + this once having incremented m_lWaiting. + + The following are then true when the critical section is not held : + (let nWaiting = number about to wait or waiting) + + (1) if (m_lFree.GetCount() != 0) then (m_lWaiting == 0) + (2) m_lWaiting + Semaphore count == nWaiting + + We would deadlock if + nWaiting != 0 && + m_lFree.GetCount() != 0 && + Semaphore count == 0 + + But from (1) if m_lFree.GetCount() != 0 then m_lWaiting == 0 so + from (2) Semaphore count == nWaiting (which is non-0) so the + deadlock can't happen. + */ + + HANDLE m_hSem; // For signalling + long m_lWaiting; // Waiting for a free element + long m_lCount; // how many buffers we have agreed to provide + long m_lAllocated; // how many buffers are currently allocated + long m_lSize; // agreed size of each buffer + long m_lAlignment; // agreed alignment + long m_lPrefix; // agreed prefix (preceeds GetPointer() value) + BOOL m_bChanged; // Have the buffer requirements changed + + // if true, we are decommitted and can't allocate memory + BOOL m_bCommitted; + // if true, the decommit has happened, but we haven't called Free yet + // as there are still outstanding buffers + BOOL m_bDecommitInProgress; + + // Notification interface + IMemAllocatorNotifyCallbackTemp *m_pNotify; + + BOOL m_fEnableReleaseCallback; + + // called to decommit the memory when the last buffer is freed + // pure virtual - need to override this + virtual void Free(void) PURE; + + // override to allocate the memory when commit called + virtual HRESULT Alloc(void); + +public: + + CBaseAllocator( + __in_opt LPCTSTR , __inout_opt LPUNKNOWN, __inout HRESULT *, + BOOL bEvent = TRUE, BOOL fEnableReleaseCallback = FALSE); +#ifdef UNICODE + CBaseAllocator( + __in_opt LPCSTR , __inout_opt LPUNKNOWN, __inout HRESULT *, + BOOL bEvent = TRUE, BOOL fEnableReleaseCallback = FALSE); +#endif + virtual ~CBaseAllocator(); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + STDMETHODIMP SetProperties( + __in ALLOCATOR_PROPERTIES* pRequest, + __out ALLOCATOR_PROPERTIES* pActual); + + // return the properties actually being used on this allocator + STDMETHODIMP GetProperties( + __out ALLOCATOR_PROPERTIES* pProps); + + // override Commit to allocate memory. We handle the GetBuffer + //state changes + STDMETHODIMP Commit(); + + // override this to handle the memory freeing. We handle any outstanding + // GetBuffer calls + STDMETHODIMP Decommit(); + + // get container for a sample. Blocking, synchronous call to get the + // next free buffer (as represented by an IMediaSample interface). + // on return, the time etc properties will be invalid, but the buffer + // pointer and size will be correct. The two time parameters are + // optional and either may be NULL, they may alternatively be set to + // the start and end times the sample will have attached to it + // bPrevFramesSkipped is not used (used only by the video renderer's + // allocator where it affects quality management in direct draw). + + STDMETHODIMP GetBuffer(__deref_out IMediaSample **ppBuffer, + __in_opt REFERENCE_TIME * pStartTime, + __in_opt REFERENCE_TIME * pEndTime, + DWORD dwFlags); + + // final release of a CMediaSample will call this + STDMETHODIMP ReleaseBuffer(IMediaSample *pBuffer); + // obsolete:: virtual void PutOnFreeList(CMediaSample * pSample); + + STDMETHODIMP SetNotify(IMemAllocatorNotifyCallbackTemp *pNotify); + + STDMETHODIMP GetFreeCount(__out LONG *plBuffersFree); + + // Notify that a sample is available + void NotifySample(); + + // Notify that we're waiting for a sample + void SetWaiting() { m_lWaiting++; }; +}; + + +//===================================================================== +//===================================================================== +// Defines CMemAllocator +// +// this is an allocator based on CBaseAllocator that allocates sample +// buffers in main memory (from 'new'). You must call SetProperties +// before calling Commit. +// +// we don't free the memory when going into Decommit state. The simplest +// way to implement this without complicating CBaseAllocator is to +// have a Free() function, called to go into decommit state, that does +// nothing and a ReallyFree function called from our destructor that +// actually frees the memory. +//===================================================================== +//===================================================================== + +// Make me one from quartz.dll +STDAPI CreateMemoryAllocator(__deref_out IMemAllocator **ppAllocator); + +class CMemAllocator : public CBaseAllocator +{ + +protected: + + LPBYTE m_pBuffer; // combined memory for all buffers + + // override to free the memory when decommit completes + // - we actually do nothing, and save the memory until deletion. + void Free(void); + + // called from the destructor (and from Alloc if changing size/count) to + // actually free up the memory + void ReallyFree(void); + + // overriden to allocate the memory when commit called + HRESULT Alloc(void); + +public: + /* This goes in the factory template table to create new instances */ + static CUnknown *CreateInstance(__inout_opt LPUNKNOWN, __inout HRESULT *); + + STDMETHODIMP SetProperties( + __in ALLOCATOR_PROPERTIES* pRequest, + __out ALLOCATOR_PROPERTIES* pActual); + + CMemAllocator(__in_opt LPCTSTR , __inout_opt LPUNKNOWN, __inout HRESULT *); +#ifdef UNICODE + CMemAllocator(__in_opt LPCSTR , __inout_opt LPUNKNOWN, __inout HRESULT *); +#endif + ~CMemAllocator(); +}; + +// helper used by IAMovieSetup implementation +STDAPI +AMovieSetupRegisterFilter( const AMOVIESETUP_FILTER * const psetupdata + , IFilterMapper * pIFM + , BOOL bRegister ); + + +/////////////////////////////////////////////////////////////////////////// +// ------------------------------------------------------------------------ +// ------------------------------------------------------------------------ +// ------------------------------------------------------------------------ +// ------------------------------------------------------------------------ +/////////////////////////////////////////////////////////////////////////// + +#endif /* __FILTER__ */ + + + diff --git a/third_party/BaseClasses/amvideo.cpp b/third_party/BaseClasses/amvideo.cpp new file mode 100644 index 00000000..42fe446d --- /dev/null +++ b/third_party/BaseClasses/amvideo.cpp @@ -0,0 +1,275 @@ +//------------------------------------------------------------------------------ +// File: AMVideo.cpp +// +// Desc: DirectShow base classes - implements helper functions for +// bitmap formats. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include + +// These are bit field masks for true colour devices + +const DWORD bits555[] = {0x007C00,0x0003E0,0x00001F}; +const DWORD bits565[] = {0x00F800,0x0007E0,0x00001F}; +const DWORD bits888[] = {0xFF0000,0x00FF00,0x0000FF}; + +// This maps bitmap subtypes into a bits per pixel value and also a +// name. unicode and ansi versions are stored because we have to +// return a pointer to a static string. +const struct { + const GUID *pSubtype; + WORD BitCount; + CHAR *pName; + WCHAR *wszName; +} BitCountMap[] = { &MEDIASUBTYPE_RGB1, 1, "RGB Monochrome", L"RGB Monochrome", + &MEDIASUBTYPE_RGB4, 4, "RGB VGA", L"RGB VGA", + &MEDIASUBTYPE_RGB8, 8, "RGB 8", L"RGB 8", + &MEDIASUBTYPE_RGB565, 16, "RGB 565 (16 bit)", L"RGB 565 (16 bit)", + &MEDIASUBTYPE_RGB555, 16, "RGB 555 (16 bit)", L"RGB 555 (16 bit)", + &MEDIASUBTYPE_RGB24, 24, "RGB 24", L"RGB 24", + &MEDIASUBTYPE_RGB32, 32, "RGB 32", L"RGB 32", + &MEDIASUBTYPE_ARGB32, 32, "ARGB 32", L"ARGB 32", + &MEDIASUBTYPE_Overlay, 0, "Overlay", L"Overlay", + &GUID_NULL, 0, "UNKNOWN", L"UNKNOWN" +}; + +// Return the size of the bitmap as defined by this header + +STDAPI_(DWORD) GetBitmapSize(const BITMAPINFOHEADER *pHeader) +{ + return DIBSIZE(*pHeader); +} + + +// This is called if the header has a 16 bit colour depth and needs to work +// out the detailed type from the bit fields (either RGB 565 or RGB 555) + +STDAPI_(const GUID) GetTrueColorType(const BITMAPINFOHEADER *pbmiHeader) +{ + BITMAPINFO *pbmInfo = (BITMAPINFO *) pbmiHeader; + ASSERT(pbmiHeader->biBitCount == 16); + + // If its BI_RGB then it's RGB 555 by default + + if (pbmiHeader->biCompression == BI_RGB) { + return MEDIASUBTYPE_RGB555; + } + + // Compare the bit fields with RGB 555 + + DWORD *pMask = (DWORD *) pbmInfo->bmiColors; + if (pMask[0] == bits555[0]) { + if (pMask[1] == bits555[1]) { + if (pMask[2] == bits555[2]) { + return MEDIASUBTYPE_RGB555; + } + } + } + + // Compare the bit fields with RGB 565 + + pMask = (DWORD *) pbmInfo->bmiColors; + if (pMask[0] == bits565[0]) { + if (pMask[1] == bits565[1]) { + if (pMask[2] == bits565[2]) { + return MEDIASUBTYPE_RGB565; + } + } + } + return GUID_NULL; +} + + +// Given a BITMAPINFOHEADER structure this returns the GUID sub type that is +// used to describe it in format negotiations. For example a video codec fills +// in the format block with a VIDEOINFO structure, it also fills in the major +// type with MEDIATYPE_VIDEO and the subtype with a GUID that matches the bit +// count, for example if it is an eight bit image then MEDIASUBTYPE_RGB8 + +STDAPI_(const GUID) GetBitmapSubtype(const BITMAPINFOHEADER *pbmiHeader) +{ + ASSERT(pbmiHeader); + + // If it's not RGB then create a GUID from the compression type + + if (pbmiHeader->biCompression != BI_RGB) { + if (pbmiHeader->biCompression != BI_BITFIELDS) { + FOURCCMap FourCCMap(pbmiHeader->biCompression); + return (const GUID) FourCCMap; + } + } + + // Map the RGB DIB bit depth to a image GUID + + switch(pbmiHeader->biBitCount) { + case 1 : return MEDIASUBTYPE_RGB1; + case 4 : return MEDIASUBTYPE_RGB4; + case 8 : return MEDIASUBTYPE_RGB8; + case 16 : return GetTrueColorType(pbmiHeader); + case 24 : return MEDIASUBTYPE_RGB24; + case 32 : return MEDIASUBTYPE_RGB32; + } + return GUID_NULL; +} + + +// Given a video bitmap subtype we return the number of bits per pixel it uses +// We return a WORD bit count as thats what the BITMAPINFOHEADER uses. If the +// GUID subtype is not found in the table we return an invalid USHRT_MAX + +STDAPI_(WORD) GetBitCount(const GUID *pSubtype) +{ + ASSERT(pSubtype); + const GUID *pMediaSubtype; + INT iPosition = 0; + + // Scan the mapping list seeing if the source GUID matches any known + // bitmap subtypes, the list is terminated by a GUID_NULL entry + + while (TRUE) { + pMediaSubtype = BitCountMap[iPosition].pSubtype; + if (IsEqualGUID(*pMediaSubtype,GUID_NULL)) { + return USHRT_MAX; + } + if (IsEqualGUID(*pMediaSubtype,*pSubtype)) { + return BitCountMap[iPosition].BitCount; + } + iPosition++; + } +} + + +// Given a bitmap subtype we return a description name that can be used for +// debug purposes. In a retail build this function still returns the names +// If the subtype isn't found in the lookup table we return string UNKNOWN + +int LocateSubtype(const GUID *pSubtype) +{ + ASSERT(pSubtype); + const GUID *pMediaSubtype; + INT iPosition = 0; + + // Scan the mapping list seeing if the source GUID matches any known + // bitmap subtypes, the list is terminated by a GUID_NULL entry + + while (TRUE) { + pMediaSubtype = BitCountMap[iPosition].pSubtype; + if (IsEqualGUID(*pMediaSubtype,*pSubtype) || + IsEqualGUID(*pMediaSubtype,GUID_NULL) + ) + { + break; + } + + iPosition++; + } + + return iPosition; +} + + + +STDAPI_(WCHAR *) GetSubtypeNameW(const GUID *pSubtype) +{ + return BitCountMap[LocateSubtype(pSubtype)].wszName; +} + +STDAPI_(CHAR *) GetSubtypeNameA(const GUID *pSubtype) +{ + return BitCountMap[LocateSubtype(pSubtype)].pName; +} + +#ifndef GetSubtypeName +#error wxutil.h should have defined GetSubtypeName +#endif +#undef GetSubtypeName + +// this is here for people that linked to it directly; most people +// would use the header file that picks the A or W version. +STDAPI_(CHAR *) GetSubtypeName(const GUID *pSubtype) +{ + return GetSubtypeNameA(pSubtype); +} + + +// The mechanism for describing a bitmap format is with the BITMAPINFOHEADER +// This is really messy to deal with because it invariably has fields that +// follow it holding bit fields, palettes and the rest. This function gives +// the number of bytes required to hold a VIDEOINFO that represents it. This +// count includes the prefix information (like the rcSource rectangle) the +// BITMAPINFOHEADER field, and any other colour information on the end. +// +// WARNING If you want to copy a BITMAPINFOHEADER into a VIDEOINFO always make +// sure that you use the HEADER macro because the BITMAPINFOHEADER field isn't +// right at the start of the VIDEOINFO (there are a number of other fields), +// +// CopyMemory(HEADER(pVideoInfo),pbmi,sizeof(BITMAPINFOHEADER)); +// + +STDAPI_(LONG) GetBitmapFormatSize(const BITMAPINFOHEADER *pHeader) +{ + // Everyone has this to start with this + LONG Size = SIZE_PREHEADER + pHeader->biSize; + + ASSERT(pHeader->biSize >= sizeof(BITMAPINFOHEADER)); + + // Does this format use a palette, if the number of colours actually used + // is zero then it is set to the maximum that are allowed for that colour + // depth (an example is 256 for eight bits). Truecolour formats may also + // pass a palette with them in which case the used count is non zero + + // This would scare me. + ASSERT(pHeader->biBitCount <= iPALETTE || pHeader->biClrUsed == 0); + + if (pHeader->biBitCount <= iPALETTE || pHeader->biClrUsed) { + LONG Entries = (DWORD) 1 << pHeader->biBitCount; + if (pHeader->biClrUsed) { + Entries = pHeader->biClrUsed; + } + Size += Entries * sizeof(RGBQUAD); + } + + // Truecolour formats may have a BI_BITFIELDS specifier for compression + // type which means that room for three DWORDs should be allocated that + // specify where in each pixel the RGB colour components may be found + + if (pHeader->biCompression == BI_BITFIELDS) { + Size += SIZE_MASKS; + } + + // A BITMAPINFO for a palettised image may also contain a palette map that + // provides the information to map from a source palette to a destination + // palette during a BitBlt for example, because this information is only + // ever processed during drawing you don't normally store the palette map + // nor have any way of knowing if it is present in the data structure + + return Size; +} + + +// Returns TRUE if the VIDEOINFO contains a palette + +STDAPI_(BOOL) ContainsPalette(const VIDEOINFOHEADER *pVideoInfo) +{ + if (PALETTISED(pVideoInfo) == FALSE) { + if (pVideoInfo->bmiHeader.biClrUsed == 0) { + return FALSE; + } + } + return TRUE; +} + + +// Return a pointer to the first entry in a palette + +STDAPI_(const RGBQUAD *) GetBitmapPalette(const VIDEOINFOHEADER *pVideoInfo) +{ + if (pVideoInfo->bmiHeader.biCompression == BI_BITFIELDS) { + return TRUECOLOR(pVideoInfo)->bmiColors; + } + return COLORS(pVideoInfo); +} diff --git a/third_party/BaseClasses/arithutil.cpp b/third_party/BaseClasses/arithutil.cpp new file mode 100644 index 00000000..cd0d1271 --- /dev/null +++ b/third_party/BaseClasses/arithutil.cpp @@ -0,0 +1,360 @@ +//------------------------------------------------------------------------------ +// File: ArithUtil.cpp +// +// Desc: DirectShow base classes - implements helper classes for building +// multimedia filters. +// +// Copyright (c) 1992-2004 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + +#include + +// +// Declare function from largeint.h we need so that PPC can build +// + +// +// Enlarged integer divide - 64-bits / 32-bits > 32-bits +// + +#ifndef _X86_ + +#define LLtoU64(x) (*(unsigned __int64*)(void*)(&(x))) + +__inline +ULONG +WINAPI +EnlargedUnsignedDivide ( + IN ULARGE_INTEGER Dividend, + IN ULONG Divisor, + IN PULONG Remainder + ) +{ + // return remainder if necessary + if (Remainder != NULL) + *Remainder = (ULONG)(LLtoU64(Dividend) % Divisor); + return (ULONG)(LLtoU64(Dividend) / Divisor); +} + +#else +__inline +ULONG +WINAPI +EnlargedUnsignedDivide ( + IN ULARGE_INTEGER Dividend, + IN ULONG Divisor, + IN PULONG Remainder + ) +{ + ULONG ulResult; + _asm { + mov eax,Dividend.LowPart + mov edx,Dividend.HighPart + mov ecx,Remainder + div Divisor + or ecx,ecx + jz short label + mov [ecx],edx +label: + mov ulResult,eax + } + return ulResult; +} +#endif + + +/* Arithmetic functions to help with time format conversions +*/ + +#ifdef _M_ALPHA +// work around bug in version 12.00.8385 of the alpha compiler where +// UInt32x32To64 sign-extends its arguments (?) +#undef UInt32x32To64 +#define UInt32x32To64(a, b) (((ULONGLONG)((ULONG)(a)) & 0xffffffff) * ((ULONGLONG)((ULONG)(b)) & 0xffffffff)) +#endif + +/* Compute (a * b + d) / c */ +LONGLONG WINAPI llMulDiv(LONGLONG a, LONGLONG b, LONGLONG c, LONGLONG d) +{ + /* Compute the absolute values to avoid signed arithmetic problems */ + ULARGE_INTEGER ua, ub; + DWORDLONG uc; + + ua.QuadPart = (DWORDLONG)(a >= 0 ? a : -a); + ub.QuadPart = (DWORDLONG)(b >= 0 ? b : -b); + uc = (DWORDLONG)(c >= 0 ? c : -c); + BOOL bSign = (a < 0) ^ (b < 0); + + /* Do long multiplication */ + ULARGE_INTEGER p[2]; + p[0].QuadPart = UInt32x32To64(ua.LowPart, ub.LowPart); + + /* This next computation cannot overflow into p[1].HighPart because + the max number we can compute here is: + + (2 ** 32 - 1) * (2 ** 32 - 1) + // ua.LowPart * ub.LowPart + (2 ** 32) * (2 ** 31) * (2 ** 32 - 1) * 2 // x.LowPart * y.HighPart * 2 + + == 2 ** 96 - 2 ** 64 + (2 ** 64 - 2 ** 33 + 1) + == 2 ** 96 - 2 ** 33 + 1 + < 2 ** 96 + */ + + ULARGE_INTEGER x; + x.QuadPart = UInt32x32To64(ua.LowPart, ub.HighPart) + + UInt32x32To64(ua.HighPart, ub.LowPart) + + p[0].HighPart; + p[0].HighPart = x.LowPart; + p[1].QuadPart = UInt32x32To64(ua.HighPart, ub.HighPart) + x.HighPart; + + if (d != 0) { + ULARGE_INTEGER ud[2]; + if (bSign) { + ud[0].QuadPart = (DWORDLONG)(-d); + if (d > 0) { + /* -d < 0 */ + ud[1].QuadPart = (DWORDLONG)(LONGLONG)-1; + } else { + ud[1].QuadPart = (DWORDLONG)0; + } + } else { + ud[0].QuadPart = (DWORDLONG)d; + if (d < 0) { + ud[1].QuadPart = (DWORDLONG)(LONGLONG)-1; + } else { + ud[1].QuadPart = (DWORDLONG)0; + } + } + /* Now do extended addition */ + ULARGE_INTEGER uliTotal; + + /* Add ls DWORDs */ + uliTotal.QuadPart = (DWORDLONG)ud[0].LowPart + p[0].LowPart; + p[0].LowPart = uliTotal.LowPart; + + /* Propagate carry */ + uliTotal.LowPart = uliTotal.HighPart; + uliTotal.HighPart = 0; + + /* Add 2nd most ls DWORDs */ + uliTotal.QuadPart += (DWORDLONG)ud[0].HighPart + p[0].HighPart; + p[0].HighPart = uliTotal.LowPart; + + /* Propagate carry */ + uliTotal.LowPart = uliTotal.HighPart; + uliTotal.HighPart = 0; + + /* Add MS DWORDLONGs - no carry expected */ + p[1].QuadPart += ud[1].QuadPart + uliTotal.QuadPart; + + /* Now see if we got a sign change from the addition */ + if ((LONG)p[1].HighPart < 0) { + bSign = !bSign; + + /* Negate the current value (ugh!) */ + p[0].QuadPart = ~p[0].QuadPart; + p[1].QuadPart = ~p[1].QuadPart; + p[0].QuadPart += 1; + p[1].QuadPart += (p[0].QuadPart == 0); + } + } + + /* Now for the division */ + if (c < 0) { + bSign = !bSign; + } + + + /* This will catch c == 0 and overflow */ + if (uc <= p[1].QuadPart) { + return bSign ? (LONGLONG)0x8000000000000000 : + (LONGLONG)0x7FFFFFFFFFFFFFFF; + } + + DWORDLONG ullResult; + + /* Do the division */ + /* If the dividend is a DWORD_LONG use the compiler */ + if (p[1].QuadPart == 0) { + ullResult = p[0].QuadPart / uc; + return bSign ? -(LONGLONG)ullResult : (LONGLONG)ullResult; + } + + /* If the divisor is a DWORD then its simpler */ + ULARGE_INTEGER ulic; + ulic.QuadPart = uc; + if (ulic.HighPart == 0) { + ULARGE_INTEGER uliDividend; + ULARGE_INTEGER uliResult; + DWORD dwDivisor = (DWORD)uc; + // ASSERT(p[1].HighPart == 0 && p[1].LowPart < dwDivisor); + uliDividend.HighPart = p[1].LowPart; + uliDividend.LowPart = p[0].HighPart; +#ifndef USE_LARGEINT + uliResult.HighPart = (DWORD)(uliDividend.QuadPart / dwDivisor); + p[0].HighPart = (DWORD)(uliDividend.QuadPart % dwDivisor); + uliResult.LowPart = 0; + uliResult.QuadPart = p[0].QuadPart / dwDivisor + uliResult.QuadPart; +#else + /* NOTE - this routine will take exceptions if + the result does not fit in a DWORD + */ + if (uliDividend.QuadPart >= (DWORDLONG)dwDivisor) { + uliResult.HighPart = EnlargedUnsignedDivide( + uliDividend, + dwDivisor, + &p[0].HighPart); + } else { + uliResult.HighPart = 0; + } + uliResult.LowPart = EnlargedUnsignedDivide( + p[0], + dwDivisor, + NULL); +#endif + return bSign ? -(LONGLONG)uliResult.QuadPart : + (LONGLONG)uliResult.QuadPart; + } + + + ullResult = 0; + + /* OK - do long division */ + for (int i = 0; i < 64; i++) { + ullResult <<= 1; + + /* Shift 128 bit p left 1 */ + p[1].QuadPart <<= 1; + if ((p[0].HighPart & 0x80000000) != 0) { + p[1].LowPart++; + } + p[0].QuadPart <<= 1; + + /* Compare */ + if (uc <= p[1].QuadPart) { + p[1].QuadPart -= uc; + ullResult += 1; + } + } + + return bSign ? - (LONGLONG)ullResult : (LONGLONG)ullResult; +} + +LONGLONG WINAPI Int64x32Div32(LONGLONG a, LONG b, LONG c, LONG d) +{ + ULARGE_INTEGER ua; + DWORD ub; + DWORD uc; + + /* Compute the absolute values to avoid signed arithmetic problems */ + ua.QuadPart = (DWORDLONG)(a >= 0 ? a : -a); + ub = (DWORD)(b >= 0 ? b : -b); + uc = (DWORD)(c >= 0 ? c : -c); + BOOL bSign = (a < 0) ^ (b < 0); + + /* Do long multiplication */ + ULARGE_INTEGER p0; + DWORD p1; + p0.QuadPart = UInt32x32To64(ua.LowPart, ub); + + if (ua.HighPart != 0) { + ULARGE_INTEGER x; + x.QuadPart = UInt32x32To64(ua.HighPart, ub) + p0.HighPart; + p0.HighPart = x.LowPart; + p1 = x.HighPart; + } else { + p1 = 0; + } + + if (d != 0) { + ULARGE_INTEGER ud0; + DWORD ud1; + + if (bSign) { + // + // Cast d to LONGLONG first otherwise -0x80000000 sign extends + // incorrectly + // + ud0.QuadPart = (DWORDLONG)(-(LONGLONG)d); + if (d > 0) { + /* -d < 0 */ + ud1 = (DWORD)-1; + } else { + ud1 = (DWORD)0; + } + } else { + ud0.QuadPart = (DWORDLONG)d; + if (d < 0) { + ud1 = (DWORD)-1; + } else { + ud1 = (DWORD)0; + } + } + /* Now do extended addition */ + ULARGE_INTEGER uliTotal; + + /* Add ls DWORDs */ + uliTotal.QuadPart = (DWORDLONG)ud0.LowPart + p0.LowPart; + p0.LowPart = uliTotal.LowPart; + + /* Propagate carry */ + uliTotal.LowPart = uliTotal.HighPart; + uliTotal.HighPart = 0; + + /* Add 2nd most ls DWORDs */ + uliTotal.QuadPart += (DWORDLONG)ud0.HighPart + p0.HighPart; + p0.HighPart = uliTotal.LowPart; + + /* Add MS DWORDLONGs - no carry expected */ + p1 += ud1 + uliTotal.HighPart; + + /* Now see if we got a sign change from the addition */ + if ((LONG)p1 < 0) { + bSign = !bSign; + + /* Negate the current value (ugh!) */ + p0.QuadPart = ~p0.QuadPart; + p1 = ~p1; + p0.QuadPart += 1; + p1 += (p0.QuadPart == 0); + } + } + + /* Now for the division */ + if (c < 0) { + bSign = !bSign; + } + + + /* This will catch c == 0 and overflow */ + if (uc <= p1) { + return bSign ? (LONGLONG)0x8000000000000000 : + (LONGLONG)0x7FFFFFFFFFFFFFFF; + } + + /* Do the division */ + + /* If the divisor is a DWORD then its simpler */ + ULARGE_INTEGER uliDividend; + ULARGE_INTEGER uliResult; + DWORD dwDivisor = uc; + uliDividend.HighPart = p1; + uliDividend.LowPart = p0.HighPart; + /* NOTE - this routine will take exceptions if + the result does not fit in a DWORD + */ + if (uliDividend.QuadPart >= (DWORDLONG)dwDivisor) { + uliResult.HighPart = EnlargedUnsignedDivide( + uliDividend, + dwDivisor, + &p0.HighPart); + } else { + uliResult.HighPart = 0; + } + uliResult.LowPart = EnlargedUnsignedDivide( + p0, + dwDivisor, + NULL); + return bSign ? -(LONGLONG)uliResult.QuadPart : + (LONGLONG)uliResult.QuadPart; +} diff --git a/third_party/BaseClasses/baseclasses.sln b/third_party/BaseClasses/baseclasses.sln new file mode 100644 index 00000000..a93b581e --- /dev/null +++ b/third_party/BaseClasses/baseclasses.sln @@ -0,0 +1,38 @@ + +Microsoft Visual Studio Solution File, Format Version 9.00 +# Visual Studio 2005 +Project("{8BC9CEB8-8B4A-11D0-8D11-00A0C91BC942}") = "BaseClasses", "BaseClasses.vcproj", "{E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}" +EndProject +Global + GlobalSection(SolutionConfigurationPlatforms) = preSolution + Debug_MBCS|Win32 = Debug_MBCS|Win32 + Debug_MBCS|x64 = Debug_MBCS|x64 + Debug|Win32 = Debug|Win32 + Debug|x64 = Debug|x64 + Release_MBCS|Win32 = Release_MBCS|Win32 + Release_MBCS|x64 = Release_MBCS|x64 + Release|Win32 = Release|Win32 + Release|x64 = Release|x64 + EndGlobalSection + GlobalSection(ProjectConfigurationPlatforms) = postSolution + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug_MBCS|Win32.ActiveCfg = Debug_MBCS|Win32 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug_MBCS|Win32.Build.0 = Debug_MBCS|Win32 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug_MBCS|x64.ActiveCfg = Debug_MBCS|x64 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug_MBCS|x64.Build.0 = Debug_MBCS|x64 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug|Win32.ActiveCfg = Debug|Win32 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug|Win32.Build.0 = Debug|Win32 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug|x64.ActiveCfg = Debug|x64 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Debug|x64.Build.0 = Debug|x64 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release_MBCS|Win32.ActiveCfg = Release_MBCS|Win32 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release_MBCS|Win32.Build.0 = Release_MBCS|Win32 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release_MBCS|x64.ActiveCfg = Release_MBCS|x64 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release_MBCS|x64.Build.0 = Release_MBCS|x64 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release|Win32.ActiveCfg = Release|Win32 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release|Win32.Build.0 = Release|Win32 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release|x64.ActiveCfg = Release|x64 + {E8A3F6FA-AE1C-4C8E-A0B6-9C8480324EAA}.Release|x64.Build.0 = Release|x64 + EndGlobalSection + GlobalSection(SolutionProperties) = preSolution + HideSolutionNode = FALSE + EndGlobalSection +EndGlobal diff --git a/third_party/BaseClasses/baseclasses.vcproj b/third_party/BaseClasses/baseclasses.vcproj new file mode 100644 index 00000000..32373bad --- /dev/null +++ b/third_party/BaseClasses/baseclasses.vcproj @@ -0,0 +1,826 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/third_party/BaseClasses/cache.h b/third_party/BaseClasses/cache.h new file mode 100644 index 00000000..0a807c27 --- /dev/null +++ b/third_party/BaseClasses/cache.h @@ -0,0 +1,74 @@ +//------------------------------------------------------------------------------ +// File: Cache.h +// +// Desc: DirectShow base classes - efines a non-MFC generic cache class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +/* This class implements a simple cache. A cache object is instantiated + with the number of items it is to hold. An item is a pointer to an + object derived from CBaseObject (helps reduce memory leaks). The cache + can then have objects added to it and removed from it. The cache size + is fixed at construction time and may therefore run out or be flooded. + If it runs out it returns a NULL pointer, if it fills up it also returns + a NULL pointer instead of a pointer to the object just inserted */ + +/* Making these classes inherit from CBaseObject does nothing for their + functionality but it allows us to check there are no memory leaks */ + +/* WARNING Be very careful when using this class, what it lets you do is + store and retrieve objects so that you can minimise object creation + which in turns improves efficiency. However the object you store is + exactly the same as the object you get back which means that it short + circuits the constructor initialisation phase. This means any class + variables the object has (eg pointers) are highly likely to be invalid. + Therefore ensure you reinitialise the object before using it again */ + + +#ifndef __CACHE__ +#define __CACHE__ + + +class CCache : CBaseObject { + + /* Make copy constructor and assignment operator inaccessible */ + + CCache(const CCache &refCache); + CCache &operator=(const CCache &refCache); + +private: + + /* These are initialised in the constructor. The first variable points to + an array of pointers, each of which points to a CBaseObject derived + object. The m_iCacheSize is the static fixed size for the cache and the + m_iUsed defines the number of places filled with objects at any time. + We fill the array of pointers from the start (ie m_ppObjects[0] first) + and then only add and remove objects from the end position, so in this + respect the array of object pointers should be treated as a stack */ + + CBaseObject **m_ppObjects; + const INT m_iCacheSize; + INT m_iUsed; + +public: + + CCache(__in_opt LPCTSTR pName,INT iItems); + virtual ~CCache(); + + /* Add an item to the cache */ + CBaseObject *AddToCache(__in CBaseObject *pObject); + + /* Remove an item from the cache */ + CBaseObject *RemoveFromCache(); + + /* Delete all the objects held in the cache */ + void RemoveAll(void); + + /* Return the cache size which is set during construction */ + INT GetCacheSize(void) const {return m_iCacheSize;}; +}; + +#endif /* __CACHE__ */ + diff --git a/third_party/BaseClasses/checkbmi.h b/third_party/BaseClasses/checkbmi.h new file mode 100644 index 00000000..72879679 --- /dev/null +++ b/third_party/BaseClasses/checkbmi.h @@ -0,0 +1,120 @@ +// Copyright (c) 1992 - 1997 Microsoft Corporation. All Rights Reserved. + +#ifndef _CHECKBMI_H_ +#define _CHECKBMI_H_ + +#ifdef __cplusplus +extern "C" { +#endif + +// Helper +__inline BOOL MultiplyCheckOverflow(DWORD a, DWORD b, __deref_out_range(==, a * b) DWORD *pab) { + *pab = a * b; + if ((a == 0) || (((*pab) / a) == b)) { + return TRUE; + } + return FALSE; +} + + +// Checks if the fields in a BITMAPINFOHEADER won't generate +// overlows and buffer overruns +// This is not a complete check and does not guarantee code using this structure will be secure +// from attack +// Bugs this is guarding against: +// 1. Total structure size calculation overflowing +// 2. biClrUsed > 256 for 8-bit palettized content +// 3. Total bitmap size in bytes overflowing +// 4. biSize < size of the base structure leading to accessessing random memory +// 5. Total structure size exceeding know size of data +// + +__success(return != 0) __inline BOOL ValidateBitmapInfoHeader( + const BITMAPINFOHEADER *pbmi, // pointer to structure to check + __out_range(>=, sizeof(BITMAPINFOHEADER)) DWORD cbSize // size of memory block containing structure +) +{ + DWORD dwWidthInBytes; + DWORD dwBpp; + DWORD dwWidthInBits; + DWORD dwHeight; + DWORD dwSizeImage; + DWORD dwClrUsed; + + // Reject bad parameters - do the size check first to avoid reading bad memory + if (cbSize < sizeof(BITMAPINFOHEADER) || + pbmi->biSize < sizeof(BITMAPINFOHEADER) || + pbmi->biSize > 4096) { + return FALSE; + } + + // Reject 0 size + if (pbmi->biWidth == 0 || pbmi->biHeight == 0) { + return FALSE; + } + + // Use bpp of 200 for validating against further overflows if not set for compressed format + dwBpp = 200; + + if (pbmi->biBitCount > dwBpp) { + return FALSE; + } + + // Strictly speaking abs can overflow so cast explicitly to DWORD + dwHeight = (DWORD)abs(pbmi->biHeight); + + if (!MultiplyCheckOverflow(dwBpp, (DWORD)pbmi->biWidth, &dwWidthInBits)) { + return FALSE; + } + + // Compute correct width in bytes - rounding up to 4 bytes + dwWidthInBytes = (dwWidthInBits / 8 + 3) & ~3; + + if (!MultiplyCheckOverflow(dwWidthInBytes, dwHeight, &dwSizeImage)) { + return FALSE; + } + + // Fail if total size is 0 - this catches indivual quantities being 0 + // Also don't allow huge values > 1GB which might cause arithmetic + // errors for users + if (dwSizeImage > 0x40000000 || + pbmi->biSizeImage > 0x40000000) { + return FALSE; + } + + // Fail if biClrUsed looks bad + if (pbmi->biClrUsed > 256) { + return FALSE; + } + + if (pbmi->biClrUsed == 0 && pbmi->biBitCount <= 8 && pbmi->biBitCount > 0) { + dwClrUsed = (1 << pbmi->biBitCount); + } else { + dwClrUsed = pbmi->biClrUsed; + } + + // Check total size + if (cbSize < pbmi->biSize + dwClrUsed * sizeof(RGBQUAD) + + (pbmi->biCompression == BI_BITFIELDS ? 3 * sizeof(DWORD) : 0)) { + return FALSE; + } + + // If it is RGB validate biSizeImage - lots of code assumes the size is correct + if (pbmi->biCompression == BI_RGB || pbmi->biCompression == BI_BITFIELDS) { + if (pbmi->biSizeImage != 0) { + DWORD dwBits = (DWORD)pbmi->biWidth * (DWORD)pbmi->biBitCount; + DWORD dwWidthInBytes = ((DWORD)((dwBits+31) & (~31)) / 8); + DWORD dwTotalSize = (DWORD)abs(pbmi->biHeight) * dwWidthInBytes; + if (dwTotalSize > pbmi->biSizeImage) { + return FALSE; + } + } + } + return TRUE; +} + +#ifdef __cplusplus +} +#endif + +#endif // _CHECKBMI_H_ diff --git a/third_party/BaseClasses/combase.cpp b/third_party/BaseClasses/combase.cpp new file mode 100644 index 00000000..ec62a88c --- /dev/null +++ b/third_party/BaseClasses/combase.cpp @@ -0,0 +1,265 @@ +//------------------------------------------------------------------------------ +// File: ComBase.cpp +// +// Desc: DirectShow base classes - implements class hierarchy for creating +// COM objects. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#pragma warning( disable : 4514 ) // Disable warnings re unused inline functions + + +/* Define the static member variable */ + +LONG CBaseObject::m_cObjects = 0; + + +/* Constructor */ + +CBaseObject::CBaseObject(__in_opt LPCTSTR pName) +{ + /* Increment the number of active objects */ + InterlockedIncrement(&m_cObjects); + +#ifdef DEBUG + +#ifdef UNICODE + m_dwCookie = DbgRegisterObjectCreation(0, pName); +#else + m_dwCookie = DbgRegisterObjectCreation(pName, 0); +#endif + +#endif +} + +#ifdef UNICODE +CBaseObject::CBaseObject(const char *pName) +{ + /* Increment the number of active objects */ + InterlockedIncrement(&m_cObjects); + +#ifdef DEBUG + m_dwCookie = DbgRegisterObjectCreation(pName, 0); +#endif +} +#endif + +HINSTANCE hlibOLEAut32; + +/* Destructor */ + +CBaseObject::~CBaseObject() +{ + /* Decrement the number of objects active */ + if (InterlockedDecrement(&m_cObjects) == 0) { + if (hlibOLEAut32) { + FreeLibrary(hlibOLEAut32); + + hlibOLEAut32 = 0; + } + }; + + +#ifdef DEBUG + DbgRegisterObjectDestruction(m_dwCookie); +#endif +} + +static const TCHAR szOle32Aut[] = TEXT("OleAut32.dll"); + +HINSTANCE LoadOLEAut32() +{ + if (hlibOLEAut32 == 0) { + + hlibOLEAut32 = LoadLibrary(szOle32Aut); + } + + return hlibOLEAut32; +} + + +/* Constructor */ + +// We know we use "this" in the initialization list, we also know we don't modify *phr. +#pragma warning( disable : 4355 4100 ) +CUnknown::CUnknown(__in_opt LPCTSTR pName, __in_opt LPUNKNOWN pUnk) +: CBaseObject(pName) +/* Start the object with a reference count of zero - when the */ +/* object is queried for it's first interface this may be */ +/* incremented depending on whether or not this object is */ +/* currently being aggregated upon */ +, m_cRef(0) +/* Set our pointer to our IUnknown interface. */ +/* If we have an outer, use its, otherwise use ours. */ +/* This pointer effectivly points to the owner of */ +/* this object and can be accessed by the GetOwner() method. */ +, m_pUnknown( pUnk != 0 ? pUnk : reinterpret_cast( static_cast(this) ) ) + /* Why the double cast? Well, the inner cast is a type-safe cast */ + /* to pointer to a type from which we inherit. The second is */ + /* type-unsafe but works because INonDelegatingUnknown "behaves */ + /* like" IUnknown. (Only the names on the methods change.) */ +{ + // Everything we need to do has been done in the initializer list +} + +// This does the same as above except it has a useless HRESULT argument +// use the previous constructor, this is just left for compatibility... +CUnknown::CUnknown(__in_opt LPCTSTR pName, __in_opt LPUNKNOWN pUnk, __inout_opt HRESULT *phr) : + CBaseObject(pName), + m_cRef(0), + m_pUnknown( pUnk != 0 ? pUnk : reinterpret_cast( static_cast(this) ) ) +{ +} + +#ifdef UNICODE +CUnknown::CUnknown(__in_opt LPCSTR pName, __in_opt LPUNKNOWN pUnk) +: CBaseObject(pName), m_cRef(0), + m_pUnknown( pUnk != 0 ? pUnk : reinterpret_cast( static_cast(this) ) ) +{ } + +CUnknown::CUnknown(__in_opt LPCSTR pName, __in_opt LPUNKNOWN pUnk, __inout_opt HRESULT *phr) : + CBaseObject(pName), m_cRef(0), + m_pUnknown( pUnk != 0 ? pUnk : reinterpret_cast( static_cast(this) ) ) +{ } + +#endif + +#pragma warning( default : 4355 4100 ) + + +/* QueryInterface */ + +STDMETHODIMP CUnknown::NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv) +{ + CheckPointer(ppv,E_POINTER); + ValidateReadWritePtr(ppv,sizeof(PVOID)); + + /* We know only about IUnknown */ + + if (riid == IID_IUnknown) { + GetInterface((LPUNKNOWN) (PNDUNKNOWN) this, ppv); + return NOERROR; + } else { + *ppv = NULL; + return E_NOINTERFACE; + } +} + +/* We have to ensure that we DON'T use a max macro, since these will typically */ +/* lead to one of the parameters being evaluated twice. Since we are worried */ +/* about concurrency, we can't afford to access the m_cRef twice since we can't */ +/* afford to run the risk that its value having changed between accesses. */ + +template inline static T ourmax( const T & a, const T & b ) +{ + return a > b ? a : b; +} + +/* AddRef */ + +STDMETHODIMP_(ULONG) CUnknown::NonDelegatingAddRef() +{ + LONG lRef = InterlockedIncrement( &m_cRef ); + ASSERT(lRef > 0); + DbgLog((LOG_MEMORY,3,TEXT(" Obj %d ref++ = %d"), + m_dwCookie, m_cRef)); + return ourmax(ULONG(m_cRef), 1ul); +} + + +/* Release */ + +STDMETHODIMP_(ULONG) CUnknown::NonDelegatingRelease() +{ + /* If the reference count drops to zero delete ourselves */ + + LONG lRef = InterlockedDecrement( &m_cRef ); + ASSERT(lRef >= 0); + + DbgLog((LOG_MEMORY,3,TEXT(" Object %d ref-- = %d"), + m_dwCookie, m_cRef)); + if (lRef == 0) { + + // COM rules say we must protect against re-entrancy. + // If we are an aggregator and we hold our own interfaces + // on the aggregatee, the QI for these interfaces will + // addref ourselves. So after doing the QI we must release + // a ref count on ourselves. Then, before releasing the + // private interface, we must addref ourselves. When we do + // this from the destructor here it will result in the ref + // count going to 1 and then back to 0 causing us to + // re-enter the destructor. Hence we add an extra refcount here + // once we know we will delete the object. + // for an example aggregator see filgraph\distrib.cpp. + + m_cRef++; + + delete this; + return ULONG(0); + } else { + // Don't touch m_cRef again even in this leg as the object + // may have just been released on another thread too + return ourmax(ULONG(lRef), 1ul); + } +} + + +/* Return an interface pointer to a requesting client + performing a thread safe AddRef as necessary */ + +STDAPI GetInterface(LPUNKNOWN pUnk, __out void **ppv) +{ + CheckPointer(ppv, E_POINTER); + *ppv = pUnk; + pUnk->AddRef(); + return NOERROR; +} + + +/* Compares two interfaces and returns TRUE if they are on the same object */ + +BOOL WINAPI IsEqualObject(IUnknown *pFirst, IUnknown *pSecond) +{ + /* Different objects can't have the same interface pointer for + any interface + */ + if (pFirst == pSecond) { + return TRUE; + } + /* OK - do it the hard way - check if they have the same + IUnknown pointers - a single object can only have one of these + */ + LPUNKNOWN pUnknown1; // Retrieve the IUnknown interface + LPUNKNOWN pUnknown2; // Retrieve the other IUnknown interface + HRESULT hr; // General OLE return code + + ASSERT(pFirst); + ASSERT(pSecond); + + /* See if the IUnknown pointers match */ + + hr = pFirst->QueryInterface(IID_IUnknown,(void **) &pUnknown1); + if (FAILED(hr)) { + return FALSE; + } + ASSERT(pUnknown1); + + /* Release the extra interface we hold */ + + pUnknown1->Release(); + + hr = pSecond->QueryInterface(IID_IUnknown,(void **) &pUnknown2); + if (FAILED(hr)) { + return FALSE; + } + ASSERT(pUnknown2); + + /* Release the extra interface we hold */ + + pUnknown2->Release(); + return (pUnknown1 == pUnknown2); +} + diff --git a/third_party/BaseClasses/combase.h b/third_party/BaseClasses/combase.h new file mode 100644 index 00000000..f735ba92 --- /dev/null +++ b/third_party/BaseClasses/combase.h @@ -0,0 +1,305 @@ +//------------------------------------------------------------------------------ +// File: ComBase.h +// +// Desc: DirectShow base classes - defines a class hierarchy for creating +// COM objects. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +/* + +a. Derive your COM object from CUnknown + +b. Make a static CreateInstance function that takes an LPUNKNOWN, an HRESULT * + and a TCHAR *. The LPUNKNOWN defines the object to delegate IUnknown calls + to. The HRESULT * allows error codes to be passed around constructors and + the TCHAR * is a descriptive name that can be printed on the debugger. + + It is important that constructors only change the HRESULT * if they have + to set an ERROR code, if it was successful then leave it alone or you may + overwrite an error code from an object previously created. + + When you call a constructor the descriptive name should be in static store + as we do not copy the string. To stop large amounts of memory being used + in retail builds by all these static strings use the NAME macro, + + CMyFilter = new CImplFilter(NAME("My filter"),pUnknown,phr); + if (FAILED(hr)) { + return hr; + } + + In retail builds NAME(_x_) compiles to NULL, the base CBaseObject class + knows not to do anything with objects that don't have a name. + +c. Have a constructor for your object that passes the LPUNKNOWN, HRESULT * and + TCHAR * to the CUnknown constructor. You can set the HRESULT if you have an + error, or just simply pass it through to the constructor. + + The object creation will fail in the class factory if the HRESULT indicates + an error (ie FAILED(HRESULT) == TRUE) + +d. Create a FactoryTemplate with your object's class id and CreateInstance + function. + +Then (for each interface) either + +Multiple inheritance + +1. Also derive it from ISomeInterface +2. Include DECLARE_IUNKNOWN in your class definition to declare + implementations of QueryInterface, AddRef and Release that + call the outer unknown +3. Override NonDelegatingQueryInterface to expose ISomeInterface by + code something like + + if (riid == IID_ISomeInterface) { + return GetInterface((ISomeInterface *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } + +4. Declare and implement the member functions of ISomeInterface. + +or: Nested interfaces + +1. Declare a class derived from CUnknown +2. Include DECLARE_IUNKNOWN in your class definition +3. Override NonDelegatingQueryInterface to expose ISomeInterface by + code something like + + if (riid == IID_ISomeInterface) { + return GetInterface((ISomeInterface *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } + +4. Implement the member functions of ISomeInterface. Use GetOwner() to + access the COM object class. + +And in your COM object class: + +5. Make the nested class a friend of the COM object class, and declare + an instance of the nested class as a member of the COM object class. + + NOTE that because you must always pass the outer unknown and an hResult + to the CUnknown constructor you cannot use a default constructor, in + other words you will have to make the member variable a pointer to the + class and make a NEW call in your constructor to actually create it. + +6. override the NonDelegatingQueryInterface with code like this: + + if (riid == IID_ISomeInterface) { + return m_pImplFilter-> + NonDelegatingQueryInterface(IID_ISomeInterface, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } + +You can have mixed classes which support some interfaces via multiple +inheritance and some via nested classes + +*/ + +#ifndef __COMBASE__ +#define __COMBASE__ + +// Filter Setup data structures no defined in axextend.idl + +typedef REGPINTYPES +AMOVIESETUP_MEDIATYPE, * PAMOVIESETUP_MEDIATYPE, * FAR LPAMOVIESETUP_MEDIATYPE; + +typedef REGFILTERPINS +AMOVIESETUP_PIN, * PAMOVIESETUP_PIN, * FAR LPAMOVIESETUP_PIN; + +typedef struct _AMOVIESETUP_FILTER +{ + const CLSID * clsID; + const WCHAR * strName; + DWORD dwMerit; + UINT nPins; + const AMOVIESETUP_PIN * lpPin; +} +AMOVIESETUP_FILTER, * PAMOVIESETUP_FILTER, * FAR LPAMOVIESETUP_FILTER; + +/* The DLLENTRY module initialises the module handle on loading */ + +extern HINSTANCE g_hInst; + +/* On DLL load remember which platform we are running on */ + +extern DWORD g_amPlatform; +extern OSVERSIONINFO g_osInfo; // Filled in by GetVersionEx + +/* Version of IUnknown that is renamed to allow a class to support both + non delegating and delegating IUnknowns in the same COM object */ + +#ifndef INONDELEGATINGUNKNOWN_DEFINED +DECLARE_INTERFACE(INonDelegatingUnknown) +{ + STDMETHOD(NonDelegatingQueryInterface) (THIS_ REFIID, LPVOID *) PURE; + STDMETHOD_(ULONG, NonDelegatingAddRef)(THIS) PURE; + STDMETHOD_(ULONG, NonDelegatingRelease)(THIS) PURE; +}; +#define INONDELEGATINGUNKNOWN_DEFINED +#endif + +typedef INonDelegatingUnknown *PNDUNKNOWN; + + +/* This is the base object class that supports active object counting. As + part of the debug facilities we trace every time a C++ object is created + or destroyed. The name of the object has to be passed up through the class + derivation list during construction as you cannot call virtual functions + in the constructor. The downside of all this is that every single object + constructor has to take an object name parameter that describes it */ + +class CBaseObject +{ + +private: + + // Disable the copy constructor and assignment by default so you will get + // compiler errors instead of unexpected behaviour if you pass objects + // by value or assign objects. + CBaseObject(const CBaseObject& objectSrc); // no implementation + void operator=(const CBaseObject& objectSrc); // no implementation + +private: + static LONG m_cObjects; /* Total number of objects active */ + +protected: +#ifdef DEBUG + DWORD m_dwCookie; /* Cookie identifying this object */ +#endif + + +public: + + /* These increment and decrement the number of active objects */ + + CBaseObject(__in_opt LPCTSTR pName); +#ifdef UNICODE + CBaseObject(__in_opt LPCSTR pName); +#endif + ~CBaseObject(); + + /* Call this to find if there are any CUnknown derived objects active */ + + static LONG ObjectsActive() { + return m_cObjects; + }; +}; + + +/* An object that supports one or more COM interfaces will be based on + this class. It supports counting of total objects for DLLCanUnloadNow + support, and an implementation of the core non delegating IUnknown */ + +class AM_NOVTABLE CUnknown : public INonDelegatingUnknown, + public CBaseObject +{ +private: + const LPUNKNOWN m_pUnknown; /* Owner of this object */ + +protected: /* So we can override NonDelegatingRelease() */ + volatile LONG m_cRef; /* Number of reference counts */ + +public: + + CUnknown(__in_opt LPCTSTR pName, __in_opt LPUNKNOWN pUnk); + virtual ~CUnknown() {}; + + // This is redundant, just use the other constructor + // as we never touch the HRESULT in this anyway + CUnknown(__in_opt LPCTSTR Name, __in_opt LPUNKNOWN pUnk, __inout_opt HRESULT *phr); +#ifdef UNICODE + CUnknown(__in_opt LPCSTR pName, __in_opt LPUNKNOWN pUnk); + CUnknown(__in_opt LPCSTR pName, __in_opt LPUNKNOWN pUnk,__inout_opt HRESULT *phr); +#endif + + /* Return the owner of this object */ + + LPUNKNOWN GetOwner() const { + return m_pUnknown; + }; + + /* Called from the class factory to create a new instance, it is + pure virtual so it must be overriden in your derived class */ + + /* static CUnknown *CreateInstance(LPUNKNOWN, HRESULT *) */ + + /* Non delegating unknown implementation */ + + STDMETHODIMP NonDelegatingQueryInterface(REFIID, __deref_out void **); + STDMETHODIMP_(ULONG) NonDelegatingAddRef(); + STDMETHODIMP_(ULONG) NonDelegatingRelease(); +}; + +/* Return an interface pointer to a requesting client + performing a thread safe AddRef as necessary */ + +STDAPI GetInterface(LPUNKNOWN pUnk, __out void **ppv); + +/* A function that can create a new COM object */ + +typedef CUnknown *(CALLBACK *LPFNNewCOMObject)(__in_opt LPUNKNOWN pUnkOuter, __inout_opt HRESULT *phr); + +/* A function (can be NULL) which is called from the DLL entrypoint + routine for each factory template: + + bLoading - TRUE on DLL load, FALSE on DLL unload + rclsid - the m_ClsID of the entry +*/ +typedef void (CALLBACK *LPFNInitRoutine)(BOOL bLoading, const CLSID *rclsid); + +/* Create one of these per object class in an array so that + the default class factory code can create new instances */ + +class CFactoryTemplate { + +public: + + const WCHAR * m_Name; + const CLSID * m_ClsID; + LPFNNewCOMObject m_lpfnNew; + LPFNInitRoutine m_lpfnInit; + const AMOVIESETUP_FILTER * m_pAMovieSetup_Filter; + + BOOL IsClassID(REFCLSID rclsid) const { + return (IsEqualCLSID(*m_ClsID,rclsid)); + }; + + CUnknown *CreateInstance(__inout_opt LPUNKNOWN pUnk, __inout_opt HRESULT *phr) const { + CheckPointer(phr,NULL); + return m_lpfnNew(pUnk, phr); + }; +}; + + +/* You must override the (pure virtual) NonDelegatingQueryInterface to return + interface pointers (using GetInterface) to the interfaces your derived + class supports (the default implementation only supports IUnknown) */ + +#define DECLARE_IUNKNOWN \ + STDMETHODIMP QueryInterface(REFIID riid, __deref_out void **ppv) { \ + return GetOwner()->QueryInterface(riid,ppv); \ + }; \ + STDMETHODIMP_(ULONG) AddRef() { \ + return GetOwner()->AddRef(); \ + }; \ + STDMETHODIMP_(ULONG) Release() { \ + return GetOwner()->Release(); \ + }; + + + +HINSTANCE LoadOLEAut32(); + + +#endif /* __COMBASE__ */ + + + + diff --git a/third_party/BaseClasses/cprop.cpp b/third_party/BaseClasses/cprop.cpp new file mode 100644 index 00000000..7bd76b4e --- /dev/null +++ b/third_party/BaseClasses/cprop.cpp @@ -0,0 +1,383 @@ +//------------------------------------------------------------------------------ +// File: CProp.cpp +// +// Desc: DirectShow base classes - implements CBasePropertyPage class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include + +// Constructor for the base property page class. As described in the header +// file we must be initialised with dialog and title resource identifiers. +// The class supports IPropertyPage and overrides AddRef and Release calls +// to keep track of the reference counts. When the last count is released +// we call SetPageSite(NULL) and SetObjects(0,NULL) to release interfaces +// previously obtained by the property page when it had SetObjects called + +CBasePropertyPage::CBasePropertyPage(__in_opt LPCTSTR pName, // Debug only name + __inout_opt LPUNKNOWN pUnk, // COM Delegator + int DialogId, // Resource ID + int TitleId) : // To get tital + CUnknown(pName,pUnk), + m_DialogId(DialogId), + m_TitleId(TitleId), + m_hwnd(NULL), + m_Dlg(NULL), + m_pPageSite(NULL), + m_bObjectSet(FALSE), + m_bDirty(FALSE) +{ +} + +#ifdef UNICODE +CBasePropertyPage::CBasePropertyPage(__in_opt LPCSTR pName, // Debug only name + __inout_opt LPUNKNOWN pUnk, // COM Delegator + int DialogId, // Resource ID + int TitleId) : // To get tital + CUnknown(pName,pUnk), + m_DialogId(DialogId), + m_TitleId(TitleId), + m_hwnd(NULL), + m_Dlg(NULL), + m_pPageSite(NULL), + m_bObjectSet(FALSE), + m_bDirty(FALSE) +{ +} +#endif + +// Increment our reference count + +STDMETHODIMP_(ULONG) CBasePropertyPage::NonDelegatingAddRef() +{ + LONG lRef = InterlockedIncrement(&m_cRef); + ASSERT(lRef > 0); + return max(ULONG(m_cRef),1ul); +} + + +// Release a reference count and protect against reentrancy + +STDMETHODIMP_(ULONG) CBasePropertyPage::NonDelegatingRelease() +{ + // If the reference count drops to zero delete ourselves + + LONG lRef = InterlockedDecrement(&m_cRef); + if (lRef == 0) { + m_cRef++; + SetPageSite(NULL); + SetObjects(0,NULL); + delete this; + return ULONG(0); + } else { + // Don't touch m_cRef again here! + return max(ULONG(lRef),1ul); + } +} + + +// Expose our IPropertyPage interface + +STDMETHODIMP +CBasePropertyPage::NonDelegatingQueryInterface(REFIID riid,__deref_out void **ppv) +{ + if (riid == IID_IPropertyPage) { + return GetInterface((IPropertyPage *)this,ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid,ppv); + } +} + + +// Get the page info so that the page site can size itself + +STDMETHODIMP CBasePropertyPage::GetPageInfo(__out LPPROPPAGEINFO pPageInfo) +{ + CheckPointer(pPageInfo,E_POINTER); + WCHAR wszTitle[STR_MAX_LENGTH]; + WideStringFromResource(wszTitle,m_TitleId); + + // Allocate dynamic memory for the property page title + + LPOLESTR pszTitle; + HRESULT hr = AMGetWideString(wszTitle, &pszTitle); + if (FAILED(hr)) { + NOTE("No caption memory"); + return hr; + } + + pPageInfo->cb = sizeof(PROPPAGEINFO); + pPageInfo->pszTitle = pszTitle; + pPageInfo->pszDocString = NULL; + pPageInfo->pszHelpFile = NULL; + pPageInfo->dwHelpContext = 0; + + // Set defaults in case GetDialogSize fails + pPageInfo->size.cx = 340; + pPageInfo->size.cy = 150; + + GetDialogSize(m_DialogId, DialogProc,0L,&pPageInfo->size); + return NOERROR; +} + + +// Handles the messages for our property window + +INT_PTR CALLBACK CBasePropertyPage::DialogProc(HWND hwnd, + UINT uMsg, + WPARAM wParam, + LPARAM lParam) +{ + CBasePropertyPage *pPropertyPage; + + switch (uMsg) { + + case WM_INITDIALOG: + + _SetWindowLongPtr(hwnd, DWLP_USER, lParam); + + // This pointer may be NULL when calculating size + + pPropertyPage = (CBasePropertyPage *) lParam; + if (pPropertyPage == NULL) { + return (LRESULT) 1; + } + pPropertyPage->m_Dlg = hwnd; + } + + // This pointer may be NULL when calculating size + + pPropertyPage = _GetWindowLongPtr(hwnd, DWLP_USER); + if (pPropertyPage == NULL) { + return (LRESULT) 1; + } + return pPropertyPage->OnReceiveMessage(hwnd,uMsg,wParam,lParam); +} + + +// Tells us the object that should be informed of the property changes + +STDMETHODIMP CBasePropertyPage::SetObjects(ULONG cObjects,__in_ecount_opt(cObjects) LPUNKNOWN *ppUnk) +{ + if (cObjects == 1) { + + if ((ppUnk == NULL) || (*ppUnk == NULL)) { + return E_POINTER; + } + + // Set a flag to say that we have set the Object + m_bObjectSet = TRUE ; + return OnConnect(*ppUnk); + + } else if (cObjects == 0) { + + // Set a flag to say that we have not set the Object for the page + m_bObjectSet = FALSE ; + return OnDisconnect(); + } + + DbgBreak("No support for more than one object"); + return E_UNEXPECTED; +} + + +// Create the window we will use to edit properties + +STDMETHODIMP CBasePropertyPage::Activate(HWND hwndParent, + LPCRECT pRect, + BOOL fModal) +{ + CheckPointer(pRect,E_POINTER); + + // Return failure if SetObject has not been called. + if (m_bObjectSet == FALSE) { + return E_UNEXPECTED; + } + + if (m_hwnd) { + return E_UNEXPECTED; + } + + m_hwnd = CreateDialogParam(g_hInst, + MAKEINTRESOURCE(m_DialogId), + hwndParent, + DialogProc, + (LPARAM) this); + if (m_hwnd == NULL) { + return E_OUTOFMEMORY; + } + + OnActivate(); + Move(pRect); + return Show(SW_SHOWNORMAL); +} + + +// Set the position of the property page + +STDMETHODIMP CBasePropertyPage::Move(LPCRECT pRect) +{ + CheckPointer(pRect,E_POINTER); + + if (m_hwnd == NULL) { + return E_UNEXPECTED; + } + + MoveWindow(m_hwnd, // Property page handle + pRect->left, // x coordinate + pRect->top, // y coordinate + WIDTH(pRect), // Overall window width + HEIGHT(pRect), // And likewise height + TRUE); // Should we repaint it + + return NOERROR; +} + + +// Display the property dialog + +STDMETHODIMP CBasePropertyPage::Show(UINT nCmdShow) +{ + // Have we been activated yet + + if (m_hwnd == NULL) { + return E_UNEXPECTED; + } + + // Ignore wrong show flags + + if ((nCmdShow != SW_SHOW) && (nCmdShow != SW_SHOWNORMAL) && (nCmdShow != SW_HIDE)) { + return E_INVALIDARG; + } + + ShowWindow(m_hwnd,nCmdShow); + InvalidateRect(m_hwnd,NULL,TRUE); + return NOERROR; +} + + +// Destroy the property page dialog + +STDMETHODIMP CBasePropertyPage::Deactivate(void) +{ + if (m_hwnd == NULL) { + return E_UNEXPECTED; + } + + // Remove WS_EX_CONTROLPARENT before DestroyWindow call + + DWORD dwStyle = GetWindowLong(m_hwnd, GWL_EXSTYLE); + dwStyle = dwStyle & (~WS_EX_CONTROLPARENT); + + // Set m_hwnd to be NULL temporarily so the message handler + // for WM_STYLECHANGING doesn't add the WS_EX_CONTROLPARENT + // style back in + HWND hwnd = m_hwnd; + m_hwnd = NULL; + SetWindowLong(hwnd, GWL_EXSTYLE, dwStyle); + m_hwnd = hwnd; + + OnDeactivate(); + + // Destroy the dialog window + + DestroyWindow(m_hwnd); + m_hwnd = NULL; + return NOERROR; +} + + +// Tells the application property page site + +STDMETHODIMP CBasePropertyPage::SetPageSite(__in_opt LPPROPERTYPAGESITE pPageSite) +{ + if (pPageSite) { + + if (m_pPageSite) { + return E_UNEXPECTED; + } + + m_pPageSite = pPageSite; + m_pPageSite->AddRef(); + + } else { + + if (m_pPageSite == NULL) { + return E_UNEXPECTED; + } + + m_pPageSite->Release(); + m_pPageSite = NULL; + } + return NOERROR; +} + + +// Apply any changes so far made + +STDMETHODIMP CBasePropertyPage::Apply() +{ + // In ActiveMovie 1.0 we used to check whether we had been activated or + // not. This is too constrictive. Apply should be allowed as long as + // SetObject was called to set an object. So we will no longer check to + // see if we have been activated (ie., m_hWnd != NULL), but instead + // make sure that m_bObjectSet is TRUE (ie., SetObject has been called). + + if (m_bObjectSet == FALSE) { + return E_UNEXPECTED; + } + + // Must have had a site set + + if (m_pPageSite == NULL) { + return E_UNEXPECTED; + } + + // Has anything changed + + if (m_bDirty == FALSE) { + return NOERROR; + } + + // Commit derived class changes + + HRESULT hr = OnApplyChanges(); + if (SUCCEEDED(hr)) { + m_bDirty = FALSE; + } + return hr; +} + + +// Base class definition for message handling + +INT_PTR CBasePropertyPage::OnReceiveMessage(HWND hwnd,UINT uMsg,WPARAM wParam,LPARAM lParam) +{ + // we would like the TAB key to move around the tab stops in our property + // page, but for some reason OleCreatePropertyFrame clears the CONTROLPARENT + // style behind our back, so we need to switch it back on now behind its + // back. Otherwise the tab key will be useless in every page. + // + + CBasePropertyPage *pPropertyPage; + { + pPropertyPage = _GetWindowLongPtr(hwnd, DWLP_USER); + + if (pPropertyPage->m_hwnd == NULL) { + return 0; + } + switch (uMsg) { + case WM_STYLECHANGING: + if (wParam == GWL_EXSTYLE) { + LPSTYLESTRUCT lpss = (LPSTYLESTRUCT)lParam; + lpss->styleNew |= WS_EX_CONTROLPARENT; + return 0; + } + } + } + + return DefWindowProc(hwnd,uMsg,wParam,lParam); +} + diff --git a/third_party/BaseClasses/cprop.h b/third_party/BaseClasses/cprop.h new file mode 100644 index 00000000..db449406 --- /dev/null +++ b/third_party/BaseClasses/cprop.h @@ -0,0 +1,95 @@ +//------------------------------------------------------------------------------ +// File: CProp.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __CPROP__ +#define __CPROP__ + +// Base property page class. Filters typically expose custom properties by +// implementing special control interfaces, examples are IDirectDrawVideo +// and IQualProp on renderers. This allows property pages to be built that +// use the given interface. Applications such as the ActiveMovie OCX query +// filters for the property pages they support and expose them to the user +// +// This class provides all the framework for a property page. A property +// page is a COM object that supports IPropertyPage. We should be created +// with a resource ID for the dialog which we will load when required. We +// should also be given in the constructor a resource ID for a title string +// we will load from the DLLs STRINGTABLE. The property page titles must be +// stored in resource files so that they can be easily internationalised +// +// We have a number of virtual methods (not PURE) that may be overriden in +// derived classes to query for interfaces and so on. These functions have +// simple implementations here that just return NOERROR. Derived classes +// will almost definately have to override the message handler method called +// OnReceiveMessage. We have a static dialog procedure that calls the method +// so that derived classes don't have to fiddle around with the this pointer + +class AM_NOVTABLE CBasePropertyPage : public IPropertyPage, public CUnknown +{ +protected: + + LPPROPERTYPAGESITE m_pPageSite; // Details for our property site + HWND m_hwnd; // Window handle for the page + HWND m_Dlg; // Actual dialog window handle + BOOL m_bDirty; // Has anything been changed + int m_TitleId; // Resource identifier for title + int m_DialogId; // Dialog resource identifier + + static INT_PTR CALLBACK DialogProc(HWND hwnd, + UINT uMsg, + WPARAM wParam, + LPARAM lParam); + +private: + BOOL m_bObjectSet ; // SetObject has been called or not. +public: + + CBasePropertyPage(__in_opt LPCTSTR pName, // Debug only name + __inout_opt LPUNKNOWN pUnk, // COM Delegator + int DialogId, // Resource ID + int TitleId); // To get tital + +#ifdef UNICODE + CBasePropertyPage(__in_opt LPCSTR pName, + __inout_opt LPUNKNOWN pUnk, + int DialogId, + int TitleId); +#endif + virtual ~CBasePropertyPage() { }; + DECLARE_IUNKNOWN + + // Override these virtual methods + + virtual HRESULT OnConnect(IUnknown *pUnknown) { return NOERROR; }; + virtual HRESULT OnDisconnect() { return NOERROR; }; + virtual HRESULT OnActivate() { return NOERROR; }; + virtual HRESULT OnDeactivate() { return NOERROR; }; + virtual HRESULT OnApplyChanges() { return NOERROR; }; + virtual INT_PTR OnReceiveMessage(HWND hwnd,UINT uMsg,WPARAM wParam,LPARAM lParam); + + // These implement an IPropertyPage interface + + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + STDMETHODIMP_(ULONG) NonDelegatingRelease(); + STDMETHODIMP_(ULONG) NonDelegatingAddRef(); + STDMETHODIMP SetPageSite(__in_opt LPPROPERTYPAGESITE pPageSite); + STDMETHODIMP Activate(HWND hwndParent, LPCRECT prect,BOOL fModal); + STDMETHODIMP Deactivate(void); + STDMETHODIMP GetPageInfo(__out LPPROPPAGEINFO pPageInfo); + STDMETHODIMP SetObjects(ULONG cObjects, __in_ecount_opt(cObjects) LPUNKNOWN *ppUnk); + STDMETHODIMP Show(UINT nCmdShow); + STDMETHODIMP Move(LPCRECT prect); + STDMETHODIMP IsPageDirty(void) { return m_bDirty ? S_OK : S_FALSE; } + STDMETHODIMP Apply(void); + STDMETHODIMP Help(LPCWSTR lpszHelpDir) { return E_NOTIMPL; } + STDMETHODIMP TranslateAccelerator(__inout LPMSG lpMsg) { return E_NOTIMPL; } +}; + +#endif // __CPROP__ + diff --git a/third_party/BaseClasses/ctlutil.cpp b/third_party/BaseClasses/ctlutil.cpp new file mode 100644 index 00000000..8ccb9dc3 --- /dev/null +++ b/third_party/BaseClasses/ctlutil.cpp @@ -0,0 +1,2541 @@ +//------------------------------------------------------------------------------ +// File: CtlUtil.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// Base classes implementing IDispatch parsing for the basic control dual +// interfaces. Derive from these and implement just the custom method and +// property methods. We also implement CPosPassThru that can be used by +// renderers and transforms to pass by IMediaPosition and IMediaSeeking + + +#include +#include +#include "seekpt.h" + +// 'bool' non standard reserved word +#pragma warning(disable:4237) + + +// --- CBaseDispatch implementation ---------- +CBaseDispatch::~CBaseDispatch() +{ + if (m_pti) { + m_pti->Release(); + } +} + + +// return 1 if we support GetTypeInfo + +STDMETHODIMP +CBaseDispatch::GetTypeInfoCount(__out UINT * pctinfo) +{ + CheckPointer(pctinfo,E_POINTER); + ValidateReadWritePtr(pctinfo,sizeof(UINT *)); + *pctinfo = 1; + return S_OK; +} + + +typedef HRESULT (STDAPICALLTYPE *LPLOADTYPELIB)( + const OLECHAR FAR *szFile, + __deref_out ITypeLib FAR* FAR* pptlib); + +typedef HRESULT (STDAPICALLTYPE *LPLOADREGTYPELIB)(REFGUID rguid, + WORD wVerMajor, + WORD wVerMinor, + LCID lcid, + __deref_out ITypeLib FAR* FAR* pptlib); + +// attempt to find our type library + +STDMETHODIMP +CBaseDispatch::GetTypeInfo( + REFIID riid, + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo) +{ + CheckPointer(pptinfo,E_POINTER); + ValidateReadWritePtr(pptinfo,sizeof(ITypeInfo *)); + HRESULT hr; + + *pptinfo = NULL; + + // we only support one type element + if (0 != itinfo) { + return TYPE_E_ELEMENTNOTFOUND; + } + + if (NULL == pptinfo) { + return E_POINTER; + } + + // always look for neutral + if (NULL == m_pti) { + + LPLOADTYPELIB lpfnLoadTypeLib; + LPLOADREGTYPELIB lpfnLoadRegTypeLib; + ITypeLib *ptlib; + HINSTANCE hInst; + + static const char szTypeLib[] = "LoadTypeLib"; + static const char szRegTypeLib[] = "LoadRegTypeLib"; + static const WCHAR szControl[] = L"control.tlb"; + + // + // Try to get the Ole32Aut.dll module handle. + // + + hInst = LoadOLEAut32(); + if (hInst == NULL) { + DWORD dwError = GetLastError(); + return AmHresultFromWin32(dwError); + } + lpfnLoadRegTypeLib = (LPLOADREGTYPELIB)GetProcAddress(hInst, + szRegTypeLib); + if (lpfnLoadRegTypeLib == NULL) { + DWORD dwError = GetLastError(); + return AmHresultFromWin32(dwError); + } + + hr = (*lpfnLoadRegTypeLib)(LIBID_QuartzTypeLib, 1, 0, // version 1.0 + lcid, &ptlib); + + if (FAILED(hr)) { + + // attempt to load directly - this will fill the + // registry in if it finds it + + lpfnLoadTypeLib = (LPLOADTYPELIB)GetProcAddress(hInst, szTypeLib); + if (lpfnLoadTypeLib == NULL) { + DWORD dwError = GetLastError(); + return AmHresultFromWin32(dwError); + } + + hr = (*lpfnLoadTypeLib)(szControl, &ptlib); + if (FAILED(hr)) { + return hr; + } + } + + hr = ptlib->GetTypeInfoOfGuid( + riid, + &m_pti); + + ptlib->Release(); + + if (FAILED(hr)) { + return hr; + } + } + + *pptinfo = m_pti; + m_pti->AddRef(); + return S_OK; +} + + +STDMETHODIMP +CBaseDispatch::GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid) +{ + // although the IDispatch riid is dead, we use this to pass from + // the interface implementation class to us the iid we are talking about. + + ITypeInfo * pti; + HRESULT hr = GetTypeInfo(riid, 0, lcid, &pti); + + if (SUCCEEDED(hr)) { + hr = pti->GetIDsOfNames(rgszNames, cNames, rgdispid); + + pti->Release(); + } + return hr; +} + + +// --- CMediaControl implementation --------- + +CMediaControl::CMediaControl(const TCHAR * name,LPUNKNOWN pUnk) : + CUnknown(name, pUnk) +{ +} + +// expose our interfaces IMediaControl and IUnknown + +STDMETHODIMP +CMediaControl::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + ValidateReadWritePtr(ppv,sizeof(PVOID)); + if (riid == IID_IMediaControl) { + return GetInterface( (IMediaControl *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +// return 1 if we support GetTypeInfo + +STDMETHODIMP +CMediaControl::GetTypeInfoCount(__out UINT * pctinfo) +{ + return m_basedisp.GetTypeInfoCount(pctinfo); +} + + +// attempt to find our type library + +STDMETHODIMP +CMediaControl::GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo) +{ + return m_basedisp.GetTypeInfo( + IID_IMediaControl, + itinfo, + lcid, + pptinfo); +} + + +STDMETHODIMP +CMediaControl::GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid) +{ + return m_basedisp.GetIDsOfNames( + IID_IMediaControl, + rgszNames, + cNames, + lcid, + rgdispid); +} + + +STDMETHODIMP +CMediaControl::Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr) +{ + // this parameter is a dead leftover from an earlier interface + if (IID_NULL != riid) { + return DISP_E_UNKNOWNINTERFACE; + } + + ITypeInfo * pti; + HRESULT hr = GetTypeInfo(0, lcid, &pti); + + if (FAILED(hr)) { + return hr; + } + + hr = pti->Invoke( + (IMediaControl *)this, + dispidMember, + wFlags, + pdispparams, + pvarResult, + pexcepinfo, + puArgErr); + + pti->Release(); + return hr; +} + + +// --- CMediaEvent implementation ---------- + + +CMediaEvent::CMediaEvent(__in_opt LPCTSTR name,__in_opt LPUNKNOWN pUnk) : + CUnknown(name, pUnk) +{ +} + + +// expose our interfaces IMediaEvent and IUnknown + +STDMETHODIMP +CMediaEvent::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + ValidateReadWritePtr(ppv,sizeof(PVOID)); + if (riid == IID_IMediaEvent || riid == IID_IMediaEventEx) { + return GetInterface( (IMediaEventEx *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +// return 1 if we support GetTypeInfo + +STDMETHODIMP +CMediaEvent::GetTypeInfoCount(__out UINT * pctinfo) +{ + return m_basedisp.GetTypeInfoCount(pctinfo); +} + + +// attempt to find our type library + +STDMETHODIMP +CMediaEvent::GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo) +{ + return m_basedisp.GetTypeInfo( + IID_IMediaEvent, + itinfo, + lcid, + pptinfo); +} + + +STDMETHODIMP +CMediaEvent::GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid) +{ + return m_basedisp.GetIDsOfNames( + IID_IMediaEvent, + rgszNames, + cNames, + lcid, + rgdispid); +} + + +STDMETHODIMP +CMediaEvent::Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr) +{ + // this parameter is a dead leftover from an earlier interface + if (IID_NULL != riid) { + return DISP_E_UNKNOWNINTERFACE; + } + + ITypeInfo * pti; + HRESULT hr = GetTypeInfo(0, lcid, &pti); + + if (FAILED(hr)) { + return hr; + } + + hr = pti->Invoke( + (IMediaEvent *)this, + dispidMember, + wFlags, + pdispparams, + pvarResult, + pexcepinfo, + puArgErr); + + pti->Release(); + return hr; +} + + +// --- CMediaPosition implementation ---------- + + +CMediaPosition::CMediaPosition(__in_opt LPCTSTR name,__in_opt LPUNKNOWN pUnk) : + CUnknown(name, pUnk) +{ +} + +CMediaPosition::CMediaPosition(__in_opt LPCTSTR name, + __in_opt LPUNKNOWN pUnk, + __inout HRESULT * phr) : + CUnknown(name, pUnk) +{ + UNREFERENCED_PARAMETER(phr); +} + + +// expose our interfaces IMediaPosition and IUnknown + +STDMETHODIMP +CMediaPosition::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + ValidateReadWritePtr(ppv,sizeof(PVOID)); + if (riid == IID_IMediaPosition) { + return GetInterface( (IMediaPosition *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +// return 1 if we support GetTypeInfo + +STDMETHODIMP +CMediaPosition::GetTypeInfoCount(__out UINT * pctinfo) +{ + return m_basedisp.GetTypeInfoCount(pctinfo); +} + + +// attempt to find our type library + +STDMETHODIMP +CMediaPosition::GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo) +{ + return m_basedisp.GetTypeInfo( + IID_IMediaPosition, + itinfo, + lcid, + pptinfo); +} + + +STDMETHODIMP +CMediaPosition::GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid) +{ + return m_basedisp.GetIDsOfNames( + IID_IMediaPosition, + rgszNames, + cNames, + lcid, + rgdispid); +} + + +STDMETHODIMP +CMediaPosition::Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr) +{ + // this parameter is a dead leftover from an earlier interface + if (IID_NULL != riid) { + return DISP_E_UNKNOWNINTERFACE; + } + + ITypeInfo * pti; + HRESULT hr = GetTypeInfo(0, lcid, &pti); + + if (FAILED(hr)) { + return hr; + } + + hr = pti->Invoke( + (IMediaPosition *)this, + dispidMember, + wFlags, + pdispparams, + pvarResult, + pexcepinfo, + puArgErr); + + pti->Release(); + return hr; +} + + +// --- IMediaPosition and IMediaSeeking pass through class ---------- + + +CPosPassThru::CPosPassThru(__in_opt LPCTSTR pName, + __in_opt LPUNKNOWN pUnk, + __inout HRESULT *phr, + IPin *pPin) : + CMediaPosition(pName,pUnk), + m_pPin(pPin) +{ + if (pPin == NULL) { + *phr = E_POINTER; + return; + } +} + + +// Expose our IMediaSeeking and IMediaPosition interfaces + +STDMETHODIMP +CPosPassThru::NonDelegatingQueryInterface(REFIID riid,__deref_out void **ppv) +{ + CheckPointer(ppv,E_POINTER); + *ppv = NULL; + + if (riid == IID_IMediaSeeking) { + return GetInterface( static_cast(this), ppv); + } + return CMediaPosition::NonDelegatingQueryInterface(riid,ppv); +} + + +// Return the IMediaPosition interface from our peer + +HRESULT +CPosPassThru::GetPeer(IMediaPosition ** ppMP) +{ + *ppMP = NULL; + + IPin *pConnected; + HRESULT hr = m_pPin->ConnectedTo(&pConnected); + if (FAILED(hr)) { + return E_NOTIMPL; + } + IMediaPosition * pMP; + hr = pConnected->QueryInterface(IID_IMediaPosition, (void **) &pMP); + pConnected->Release(); + if (FAILED(hr)) { + return E_NOTIMPL; + } + + *ppMP = pMP; + return S_OK; +} + + +// Return the IMediaSeeking interface from our peer + +HRESULT +CPosPassThru::GetPeerSeeking(__deref_out IMediaSeeking ** ppMS) +{ + *ppMS = NULL; + + IPin *pConnected; + HRESULT hr = m_pPin->ConnectedTo(&pConnected); + if (FAILED(hr)) { + return E_NOTIMPL; + } + IMediaSeeking * pMS; + hr = pConnected->QueryInterface(IID_IMediaSeeking, (void **) &pMS); + pConnected->Release(); + if (FAILED(hr)) { + return E_NOTIMPL; + } + + *ppMS = pMS; + return S_OK; +} + + +// --- IMediaSeeking methods ---------- + + +STDMETHODIMP +CPosPassThru::GetCapabilities(__out DWORD * pCaps) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->GetCapabilities(pCaps); + pMS->Release(); + return hr; +} + +STDMETHODIMP +CPosPassThru::CheckCapabilities(__inout DWORD * pCaps) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->CheckCapabilities(pCaps); + pMS->Release(); + return hr; +} + +STDMETHODIMP +CPosPassThru::IsFormatSupported(const GUID * pFormat) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->IsFormatSupported(pFormat); + pMS->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::QueryPreferredFormat(__out GUID *pFormat) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->QueryPreferredFormat(pFormat); + pMS->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::SetTimeFormat(const GUID * pFormat) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->SetTimeFormat(pFormat); + pMS->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::GetTimeFormat(__out GUID *pFormat) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->GetTimeFormat(pFormat); + pMS->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::IsUsingTimeFormat(const GUID * pFormat) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->IsUsingTimeFormat(pFormat); + pMS->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::ConvertTimeFormat(__out LONGLONG * pTarget, + __in_opt const GUID * pTargetFormat, + LONGLONG Source, + __in_opt const GUID * pSourceFormat ) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->ConvertTimeFormat(pTarget, pTargetFormat, Source, pSourceFormat ); + pMS->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::SetPositions( __inout_opt LONGLONG * pCurrent, + DWORD CurrentFlags, + __inout_opt LONGLONG * pStop, + DWORD StopFlags ) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->SetPositions(pCurrent, CurrentFlags, pStop, StopFlags ); + pMS->Release(); + return hr; +} + +STDMETHODIMP +CPosPassThru::GetPositions(__out_opt LONGLONG *pCurrent, __out_opt LONGLONG * pStop) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->GetPositions(pCurrent,pStop); + pMS->Release(); + return hr; +} + +HRESULT +CPosPassThru::GetSeekingLongLong +( HRESULT (__stdcall IMediaSeeking::*pMethod)( __out LONGLONG * ) +, LONGLONG * pll +) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (SUCCEEDED(hr)) + { + hr = (pMS->*pMethod)(pll); + pMS->Release(); + } + return hr; +} + +// If we don't have a current position then ask upstream + +STDMETHODIMP +CPosPassThru::GetCurrentPosition(__out LONGLONG *pCurrent) +{ + // Can we report the current position + HRESULT hr = GetMediaTime(pCurrent,NULL); + if (SUCCEEDED(hr)) hr = NOERROR; + else hr = GetSeekingLongLong( &IMediaSeeking::GetCurrentPosition, pCurrent ); + return hr; +} + + +STDMETHODIMP +CPosPassThru::GetStopPosition(__out LONGLONG *pStop) +{ + return GetSeekingLongLong( &IMediaSeeking::GetStopPosition, pStop );; +} + +STDMETHODIMP +CPosPassThru::GetDuration(__out LONGLONG *pDuration) +{ + return GetSeekingLongLong( &IMediaSeeking::GetDuration, pDuration );; +} + + +STDMETHODIMP +CPosPassThru::GetPreroll(__out LONGLONG *pllPreroll) +{ + return GetSeekingLongLong( &IMediaSeeking::GetPreroll, pllPreroll );; +} + + +STDMETHODIMP +CPosPassThru::GetAvailable( __out_opt LONGLONG *pEarliest, __out_opt LONGLONG *pLatest ) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + + hr = pMS->GetAvailable( pEarliest, pLatest ); + pMS->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::GetRate(__out double * pdRate) +{ + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + hr = pMS->GetRate(pdRate); + pMS->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::SetRate(double dRate) +{ + if (0.0 == dRate) { + return E_INVALIDARG; + } + + IMediaSeeking* pMS; + HRESULT hr = GetPeerSeeking(&pMS); + if (FAILED(hr)) { + return hr; + } + hr = pMS->SetRate(dRate); + pMS->Release(); + return hr; +} + + + + +// --- IMediaPosition methods ---------- + + +STDMETHODIMP +CPosPassThru::get_Duration(__out REFTIME * plength) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + + hr = pMP->get_Duration(plength); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::get_CurrentPosition(__out REFTIME * pllTime) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->get_CurrentPosition(pllTime); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::put_CurrentPosition(REFTIME llTime) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->put_CurrentPosition(llTime); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::get_StopTime(__out REFTIME * pllTime) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->get_StopTime(pllTime); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::put_StopTime(REFTIME llTime) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->put_StopTime(llTime); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::get_PrerollTime(__out REFTIME * pllTime) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->get_PrerollTime(pllTime); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::put_PrerollTime(REFTIME llTime) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->put_PrerollTime(llTime); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::get_Rate(__out double * pdRate) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->get_Rate(pdRate); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::put_Rate(double dRate) +{ + if (0.0 == dRate) { + return E_INVALIDARG; + } + + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->put_Rate(dRate); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::CanSeekForward(__out LONG *pCanSeekForward) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->CanSeekForward(pCanSeekForward); + pMP->Release(); + return hr; +} + + +STDMETHODIMP +CPosPassThru::CanSeekBackward(__out LONG *pCanSeekBackward) +{ + IMediaPosition* pMP; + HRESULT hr = GetPeer(&pMP); + if (FAILED(hr)) { + return hr; + } + hr = pMP->CanSeekBackward(pCanSeekBackward); + pMP->Release(); + return hr; +} + + +// --- Implements the CRendererPosPassThru class ---------- + + +// Media times (eg current frame, field, sample etc) are passed through the +// filtergraph in media samples. When a renderer gets a sample with media +// times in it, it will call one of the RegisterMediaTime methods we expose +// (one takes an IMediaSample, the other takes the media times direct). We +// store the media times internally and return them in GetCurrentPosition. + +CRendererPosPassThru::CRendererPosPassThru(__in_opt LPCTSTR pName, + __in_opt LPUNKNOWN pUnk, + __inout HRESULT *phr, + IPin *pPin) : + CPosPassThru(pName,pUnk,phr,pPin), + m_StartMedia(0), + m_EndMedia(0), + m_bReset(TRUE) +{ +} + + +// Sets the media times the object should report + +HRESULT +CRendererPosPassThru::RegisterMediaTime(IMediaSample *pMediaSample) +{ + ASSERT(pMediaSample); + LONGLONG StartMedia; + LONGLONG EndMedia; + + CAutoLock cAutoLock(&m_PositionLock); + + // Get the media times from the sample + + HRESULT hr = pMediaSample->GetTime(&StartMedia,&EndMedia); + if (FAILED(hr)) + { + ASSERT(hr == VFW_E_SAMPLE_TIME_NOT_SET); + return hr; + } + + m_StartMedia = StartMedia; + m_EndMedia = EndMedia; + m_bReset = FALSE; + return NOERROR; +} + + +// Sets the media times the object should report + +HRESULT +CRendererPosPassThru::RegisterMediaTime(LONGLONG StartTime,LONGLONG EndTime) +{ + CAutoLock cAutoLock(&m_PositionLock); + m_StartMedia = StartTime; + m_EndMedia = EndTime; + m_bReset = FALSE; + return NOERROR; +} + + +// Return the current media times registered in the object + +HRESULT +CRendererPosPassThru::GetMediaTime(__out LONGLONG *pStartTime, __out_opt LONGLONG *pEndTime) +{ + ASSERT(pStartTime); + + CAutoLock cAutoLock(&m_PositionLock); + if (m_bReset == TRUE) { + return E_FAIL; + } + + // We don't have to return the end time + + HRESULT hr = ConvertTimeFormat( pStartTime, 0, m_StartMedia, &TIME_FORMAT_MEDIA_TIME ); + if (pEndTime && SUCCEEDED(hr)) { + hr = ConvertTimeFormat( pEndTime, 0, m_EndMedia, &TIME_FORMAT_MEDIA_TIME ); + } + return hr; +} + + +// Resets the media times we hold + +HRESULT +CRendererPosPassThru::ResetMediaTime() +{ + CAutoLock cAutoLock(&m_PositionLock); + m_StartMedia = 0; + m_EndMedia = 0; + m_bReset = TRUE; + return NOERROR; +} + +// Intended to be called by the owing filter during EOS processing so +// that the media times can be adjusted to the stop time. This ensures +// that the GetCurrentPosition will actully get to the stop position. +HRESULT +CRendererPosPassThru::EOS() +{ + HRESULT hr; + + if ( m_bReset == TRUE ) hr = E_FAIL; + else + { + LONGLONG llStop; + if SUCCEEDED(hr=GetStopPosition(&llStop)) + { + CAutoLock cAutoLock(&m_PositionLock); + m_StartMedia = + m_EndMedia = llStop; + } + } + return hr; +} + +// -- CSourceSeeking implementation ------------ + +CSourceSeeking::CSourceSeeking( + __in_opt LPCTSTR pName, + __in_opt LPUNKNOWN pUnk, + __inout HRESULT* phr, + __in CCritSec * pLock) : + CUnknown(pName, pUnk), + m_pLock(pLock), + m_rtStart((long)0) +{ + m_rtStop = _I64_MAX / 2; + m_rtDuration = m_rtStop; + m_dRateSeeking = 1.0; + + m_dwSeekingCaps = AM_SEEKING_CanSeekForwards + | AM_SEEKING_CanSeekBackwards + | AM_SEEKING_CanSeekAbsolute + | AM_SEEKING_CanGetStopPos + | AM_SEEKING_CanGetDuration; +} + +HRESULT CSourceSeeking::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + if(riid == IID_IMediaSeeking) { + CheckPointer(ppv, E_POINTER); + return GetInterface(static_cast(this), ppv); + } + else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +HRESULT CSourceSeeking::IsFormatSupported(const GUID * pFormat) +{ + CheckPointer(pFormat, E_POINTER); + // only seeking in time (REFERENCE_TIME units) is supported + return *pFormat == TIME_FORMAT_MEDIA_TIME ? S_OK : S_FALSE; +} + +HRESULT CSourceSeeking::QueryPreferredFormat(__out GUID *pFormat) +{ + CheckPointer(pFormat, E_POINTER); + *pFormat = TIME_FORMAT_MEDIA_TIME; + return S_OK; +} + +HRESULT CSourceSeeking::SetTimeFormat(const GUID * pFormat) +{ + CheckPointer(pFormat, E_POINTER); + + // nothing to set; just check that it's TIME_FORMAT_TIME + return *pFormat == TIME_FORMAT_MEDIA_TIME ? S_OK : E_INVALIDARG; +} + +HRESULT CSourceSeeking::IsUsingTimeFormat(const GUID * pFormat) +{ + CheckPointer(pFormat, E_POINTER); + return *pFormat == TIME_FORMAT_MEDIA_TIME ? S_OK : S_FALSE; +} + +HRESULT CSourceSeeking::GetTimeFormat(__out GUID *pFormat) +{ + CheckPointer(pFormat, E_POINTER); + *pFormat = TIME_FORMAT_MEDIA_TIME; + return S_OK; +} + +HRESULT CSourceSeeking::GetDuration(__out LONGLONG *pDuration) +{ + CheckPointer(pDuration, E_POINTER); + CAutoLock lock(m_pLock); + *pDuration = m_rtDuration; + return S_OK; +} + +HRESULT CSourceSeeking::GetStopPosition(__out LONGLONG *pStop) +{ + CheckPointer(pStop, E_POINTER); + CAutoLock lock(m_pLock); + *pStop = m_rtStop; + return S_OK; +} + +HRESULT CSourceSeeking::GetCurrentPosition(__out LONGLONG *pCurrent) +{ + // GetCurrentPosition is typically supported only in renderers and + // not in source filters. + return E_NOTIMPL; +} + +HRESULT CSourceSeeking::GetCapabilities( __out DWORD * pCapabilities ) +{ + CheckPointer(pCapabilities, E_POINTER); + *pCapabilities = m_dwSeekingCaps; + return S_OK; +} + +HRESULT CSourceSeeking::CheckCapabilities( __inout DWORD * pCapabilities ) +{ + CheckPointer(pCapabilities, E_POINTER); + + // make sure all requested capabilities are in our mask + return (~m_dwSeekingCaps & *pCapabilities) ? S_FALSE : S_OK; +} + +HRESULT CSourceSeeking::ConvertTimeFormat( __out LONGLONG * pTarget, + __in_opt const GUID * pTargetFormat, + LONGLONG Source, + __in_opt const GUID * pSourceFormat ) +{ + CheckPointer(pTarget, E_POINTER); + // format guids can be null to indicate current format + + // since we only support TIME_FORMAT_MEDIA_TIME, we don't really + // offer any conversions. + if(pTargetFormat == 0 || *pTargetFormat == TIME_FORMAT_MEDIA_TIME) + { + if(pSourceFormat == 0 || *pSourceFormat == TIME_FORMAT_MEDIA_TIME) + { + *pTarget = Source; + return S_OK; + } + } + + return E_INVALIDARG; +} + + +HRESULT CSourceSeeking::SetPositions( __inout_opt LONGLONG * pCurrent, + DWORD CurrentFlags, + __inout_opt LONGLONG * pStop, + DWORD StopFlags ) +{ + DWORD StopPosBits = StopFlags & AM_SEEKING_PositioningBitsMask; + DWORD StartPosBits = CurrentFlags & AM_SEEKING_PositioningBitsMask; + + if(StopFlags) { + CheckPointer(pStop, E_POINTER); + + // accept only relative, incremental, or absolute positioning + if(StopPosBits != StopFlags) { + return E_INVALIDARG; + } + } + + if(CurrentFlags) { + CheckPointer(pCurrent, E_POINTER); + if(StartPosBits != AM_SEEKING_AbsolutePositioning && + StartPosBits != AM_SEEKING_RelativePositioning) { + return E_INVALIDARG; + } + } + + + // scope for autolock + { + CAutoLock lock(m_pLock); + + // set start position + if(StartPosBits == AM_SEEKING_AbsolutePositioning) + { + m_rtStart = *pCurrent; + } + else if(StartPosBits == AM_SEEKING_RelativePositioning) + { + m_rtStart += *pCurrent; + } + + // set stop position + if(StopPosBits == AM_SEEKING_AbsolutePositioning) + { + m_rtStop = *pStop; + } + else if(StopPosBits == AM_SEEKING_IncrementalPositioning) + { + m_rtStop = m_rtStart + *pStop; + } + else if(StopPosBits == AM_SEEKING_RelativePositioning) + { + m_rtStop = m_rtStop + *pStop; + } + } + + + HRESULT hr = S_OK; + if(SUCCEEDED(hr) && StopPosBits) { + hr = ChangeStop(); + } + if(StartPosBits) { + hr = ChangeStart(); + } + + return hr; +} + + +HRESULT CSourceSeeking::GetPositions( __out_opt LONGLONG * pCurrent, __out_opt LONGLONG * pStop ) +{ + if(pCurrent) { + *pCurrent = m_rtStart; + } + if(pStop) { + *pStop = m_rtStop; + } + + return S_OK;; +} + + +HRESULT CSourceSeeking::GetAvailable( __out_opt LONGLONG * pEarliest, __out_opt LONGLONG * pLatest ) +{ + if(pEarliest) { + *pEarliest = 0; + } + if(pLatest) { + CAutoLock lock(m_pLock); + *pLatest = m_rtDuration; + } + return S_OK; +} + +HRESULT CSourceSeeking::SetRate( double dRate) +{ + { + CAutoLock lock(m_pLock); + m_dRateSeeking = dRate; + } + return ChangeRate(); +} + +HRESULT CSourceSeeking::GetRate( __out double * pdRate) +{ + CheckPointer(pdRate, E_POINTER); + CAutoLock lock(m_pLock); + *pdRate = m_dRateSeeking; + return S_OK; +} + +HRESULT CSourceSeeking::GetPreroll(__out LONGLONG *pPreroll) +{ + CheckPointer(pPreroll, E_POINTER); + *pPreroll = 0; + return S_OK; +} + + + + + +// --- CSourcePosition implementation ---------- + + +CSourcePosition::CSourcePosition(__in_opt LPCTSTR pName, + __in_opt LPUNKNOWN pUnk, + __inout HRESULT* phr, + __in CCritSec * pLock) : + CMediaPosition(pName, pUnk), + m_pLock(pLock), + m_Start(CRefTime((LONGLONG)0)) +{ + m_Stop = _I64_MAX; + m_Rate = 1.0; +} + + +STDMETHODIMP +CSourcePosition::get_Duration(__out REFTIME * plength) +{ + CheckPointer(plength,E_POINTER); + ValidateReadWritePtr(plength,sizeof(REFTIME)); + CAutoLock lock(m_pLock); + + *plength = m_Duration; + return S_OK; +} + + +STDMETHODIMP +CSourcePosition::put_CurrentPosition(REFTIME llTime) +{ + m_pLock->Lock(); + m_Start = llTime; + m_pLock->Unlock(); + + return ChangeStart(); +} + + +STDMETHODIMP +CSourcePosition::get_StopTime(__out REFTIME * pllTime) +{ + CheckPointer(pllTime,E_POINTER); + ValidateReadWritePtr(pllTime,sizeof(REFTIME)); + CAutoLock lock(m_pLock); + + *pllTime = m_Stop; + return S_OK; +} + + +STDMETHODIMP +CSourcePosition::put_StopTime(REFTIME llTime) +{ + m_pLock->Lock(); + m_Stop = llTime; + m_pLock->Unlock(); + + return ChangeStop(); +} + + +STDMETHODIMP +CSourcePosition::get_PrerollTime(__out REFTIME * pllTime) +{ + CheckPointer(pllTime,E_POINTER); + ValidateReadWritePtr(pllTime,sizeof(REFTIME)); + return E_NOTIMPL; +} + + +STDMETHODIMP +CSourcePosition::put_PrerollTime(REFTIME llTime) +{ + return E_NOTIMPL; +} + + +STDMETHODIMP +CSourcePosition::get_Rate(__out double * pdRate) +{ + CheckPointer(pdRate,E_POINTER); + ValidateReadWritePtr(pdRate,sizeof(double)); + CAutoLock lock(m_pLock); + + *pdRate = m_Rate; + return S_OK; +} + + +STDMETHODIMP +CSourcePosition::put_Rate(double dRate) +{ + m_pLock->Lock(); + m_Rate = dRate; + m_pLock->Unlock(); + + return ChangeRate(); +} + + +// By default we can seek forwards + +STDMETHODIMP +CSourcePosition::CanSeekForward(__out LONG *pCanSeekForward) +{ + CheckPointer(pCanSeekForward,E_POINTER); + *pCanSeekForward = OATRUE; + return S_OK; +} + + +// By default we can seek backwards + +STDMETHODIMP +CSourcePosition::CanSeekBackward(__out LONG *pCanSeekBackward) +{ + CheckPointer(pCanSeekBackward,E_POINTER); + *pCanSeekBackward = OATRUE; + return S_OK; +} + + +// --- Implementation of CBasicAudio class ---------- + + +CBasicAudio::CBasicAudio(__in_opt LPCTSTR pName,__in_opt LPUNKNOWN punk) : + CUnknown(pName, punk) +{ +} + +// overriden to publicise our interfaces + +STDMETHODIMP +CBasicAudio::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + ValidateReadWritePtr(ppv,sizeof(PVOID)); + if (riid == IID_IBasicAudio) { + return GetInterface( (IBasicAudio *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +STDMETHODIMP +CBasicAudio::GetTypeInfoCount(__out UINT * pctinfo) +{ + return m_basedisp.GetTypeInfoCount(pctinfo); +} + + +STDMETHODIMP +CBasicAudio::GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo) +{ + return m_basedisp.GetTypeInfo( + IID_IBasicAudio, + itinfo, + lcid, + pptinfo); +} + + +STDMETHODIMP +CBasicAudio::GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid) +{ + return m_basedisp.GetIDsOfNames( + IID_IBasicAudio, + rgszNames, + cNames, + lcid, + rgdispid); +} + + +STDMETHODIMP +CBasicAudio::Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr) +{ + // this parameter is a dead leftover from an earlier interface + if (IID_NULL != riid) { + return DISP_E_UNKNOWNINTERFACE; + } + + ITypeInfo * pti; + HRESULT hr = GetTypeInfo(0, lcid, &pti); + + if (FAILED(hr)) { + return hr; + } + + hr = pti->Invoke( + (IBasicAudio *)this, + dispidMember, + wFlags, + pdispparams, + pvarResult, + pexcepinfo, + puArgErr); + + pti->Release(); + return hr; +} + + +// --- IVideoWindow implementation ---------- + +CBaseVideoWindow::CBaseVideoWindow(__in_opt LPCTSTR pName,__in_opt LPUNKNOWN punk) : + CUnknown(pName, punk) +{ +} + + +// overriden to publicise our interfaces + +STDMETHODIMP +CBaseVideoWindow::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + ValidateReadWritePtr(ppv,sizeof(PVOID)); + if (riid == IID_IVideoWindow) { + return GetInterface( (IVideoWindow *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +STDMETHODIMP +CBaseVideoWindow::GetTypeInfoCount(__out UINT * pctinfo) +{ + return m_basedisp.GetTypeInfoCount(pctinfo); +} + + +STDMETHODIMP +CBaseVideoWindow::GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo) +{ + return m_basedisp.GetTypeInfo( + IID_IVideoWindow, + itinfo, + lcid, + pptinfo); +} + + +STDMETHODIMP +CBaseVideoWindow::GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid) +{ + return m_basedisp.GetIDsOfNames( + IID_IVideoWindow, + rgszNames, + cNames, + lcid, + rgdispid); +} + + +STDMETHODIMP +CBaseVideoWindow::Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr) +{ + // this parameter is a dead leftover from an earlier interface + if (IID_NULL != riid) { + return DISP_E_UNKNOWNINTERFACE; + } + + ITypeInfo * pti; + HRESULT hr = GetTypeInfo(0, lcid, &pti); + + if (FAILED(hr)) { + return hr; + } + + hr = pti->Invoke( + (IVideoWindow *)this, + dispidMember, + wFlags, + pdispparams, + pvarResult, + pexcepinfo, + puArgErr); + + pti->Release(); + return hr; +} + + +// --- IBasicVideo implementation ---------- + + +CBaseBasicVideo::CBaseBasicVideo(__in_opt LPCTSTR pName,__in_opt LPUNKNOWN punk) : + CUnknown(pName, punk) +{ +} + + +// overriden to publicise our interfaces + +STDMETHODIMP +CBaseBasicVideo::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + ValidateReadWritePtr(ppv,sizeof(PVOID)); + if (riid == IID_IBasicVideo || riid == IID_IBasicVideo2) { + return GetInterface( static_cast(this), ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +STDMETHODIMP +CBaseBasicVideo::GetTypeInfoCount(__out UINT * pctinfo) +{ + return m_basedisp.GetTypeInfoCount(pctinfo); +} + + +STDMETHODIMP +CBaseBasicVideo::GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo) +{ + return m_basedisp.GetTypeInfo( + IID_IBasicVideo, + itinfo, + lcid, + pptinfo); +} + + +STDMETHODIMP +CBaseBasicVideo::GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid) +{ + return m_basedisp.GetIDsOfNames( + IID_IBasicVideo, + rgszNames, + cNames, + lcid, + rgdispid); +} + + +STDMETHODIMP +CBaseBasicVideo::Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr) +{ + // this parameter is a dead leftover from an earlier interface + if (IID_NULL != riid) { + return DISP_E_UNKNOWNINTERFACE; + } + + ITypeInfo * pti; + HRESULT hr = GetTypeInfo(0, lcid, &pti); + + if (FAILED(hr)) { + return hr; + } + + hr = pti->Invoke( + (IBasicVideo *)this, + dispidMember, + wFlags, + pdispparams, + pvarResult, + pexcepinfo, + puArgErr); + + pti->Release(); + return hr; +} + + +// --- Implementation of Deferred Commands ---------- + + +CDispParams::CDispParams(UINT nArgs, __in_ecount(nArgs) VARIANT* pArgs, __inout_opt HRESULT *phr) +{ + cNamedArgs = 0; + rgdispidNamedArgs = NULL; + cArgs = nArgs; + + if (cArgs) { + rgvarg = new VARIANT[cArgs]; + if (NULL == rgvarg) { + cArgs = 0; + if (phr) { + *phr = E_OUTOFMEMORY; + } + return; + } + + for (UINT i = 0; i < cArgs; i++) { + + // Why aren't we using VariantCopy? + + VARIANT * pDest = &rgvarg[i]; + VARIANT * pSrc = &pArgs[i]; + + pDest->vt = pSrc->vt; + switch(pDest->vt) { + + case VT_I4: + pDest->lVal = pSrc->lVal; + break; + + case VT_UI1: + pDest->bVal = pSrc->bVal; + break; + + case VT_I2: + pDest->iVal = pSrc->iVal; + break; + + case VT_R4: + pDest->fltVal = pSrc->fltVal; + break; + + case VT_R8: + pDest->dblVal = pSrc->dblVal; + break; + + case VT_BOOL: + pDest->boolVal = pSrc->boolVal; + break; + + case VT_ERROR: + pDest->scode = pSrc->scode; + break; + + case VT_CY: + pDest->cyVal = pSrc->cyVal; + break; + + case VT_DATE: + pDest->date = pSrc->date; + break; + + case VT_BSTR: + if ((PVOID)pSrc->bstrVal == NULL) { + pDest->bstrVal = NULL; + } else { + + // a BSTR is a WORD followed by a UNICODE string. + // the pointer points just after the WORD + + WORD len = * (WORD*) (pSrc->bstrVal - (sizeof(WORD) / sizeof(OLECHAR))); + OLECHAR* pch = new OLECHAR[len + (sizeof(WORD)/sizeof(OLECHAR))]; + if (pch) { + WORD *pui = (WORD*)pch; + *pui = len; + pDest->bstrVal = pch + (sizeof(WORD)/sizeof(OLECHAR)); + CopyMemory(pDest->bstrVal, pSrc->bstrVal, len*sizeof(OLECHAR)); + } else { + cArgs = i; + if (phr) { + *phr = E_OUTOFMEMORY; + } + } + } + break; + + case VT_UNKNOWN: + pDest->punkVal = pSrc->punkVal; + pDest->punkVal->AddRef(); + break; + + case VT_DISPATCH: + pDest->pdispVal = pSrc->pdispVal; + pDest->pdispVal->AddRef(); + break; + + default: + // a type we haven't got round to adding yet! + ASSERT(0); + break; + } + } + + } else { + rgvarg = NULL; + } + +} + + +CDispParams::~CDispParams() +{ + for (UINT i = 0; i < cArgs; i++) { + switch(rgvarg[i].vt) { + case VT_BSTR: + // Explicitly cast BSTR to PVOID to tell code scanning tools we really mean to test the pointer + if ((PVOID)rgvarg[i].bstrVal != NULL) { + OLECHAR * pch = rgvarg[i].bstrVal - (sizeof(WORD)/sizeof(OLECHAR)); + delete pch; + } + break; + + case VT_UNKNOWN: + rgvarg[i].punkVal->Release(); + break; + + case VT_DISPATCH: + rgvarg[i].pdispVal->Release(); + break; + } + } + delete[] rgvarg; +} + + +// lifetime is controlled by refcounts (see defer.h) + +CDeferredCommand::CDeferredCommand( + __inout CCmdQueue * pQ, + __in_opt LPUNKNOWN pUnk, + __inout HRESULT * phr, + __in LPUNKNOWN pUnkExecutor, + REFTIME time, + __in GUID* iid, + long dispidMethod, + short wFlags, + long nArgs, + __in_ecount(nArgs) VARIANT* pDispParams, + __out VARIANT* pvarResult, + __out short* puArgErr, + BOOL bStream + ) : + CUnknown(NAME("DeferredCommand"), pUnk), + m_pQueue(pQ), + m_pUnk(pUnkExecutor), + m_iid(iid), + m_dispidMethod(dispidMethod), + m_wFlags(wFlags), + m_DispParams(nArgs, pDispParams, phr), + m_pvarResult(pvarResult), + m_bStream(bStream), + m_hrResult(E_ABORT) + +{ + // convert REFTIME to REFERENCE_TIME + COARefTime convertor(time); + m_time = convertor; + + // no check of time validity - it's ok to queue a command that's + // already late + + // check iid is supportable on pUnk by QueryInterface for it + IUnknown * pInterface; + HRESULT hr = m_pUnk->QueryInterface(GetIID(), (void**) &pInterface); + if (FAILED(hr)) { + *phr = hr; + return; + } + pInterface->Release(); + + + // !!! check dispidMethod and param/return types using typelib + ITypeInfo *pti; + hr = m_Dispatch.GetTypeInfo(*iid, 0, 0, &pti); + if (FAILED(hr)) { + *phr = hr; + return; + } + // !!! some sort of ITypeInfo validity check here + pti->Release(); + + + // Fix up the dispid for put and get + if (wFlags == DISPATCH_PROPERTYPUT) { + m_DispParams.cNamedArgs = 1; + m_DispId = DISPID_PROPERTYPUT; + m_DispParams.rgdispidNamedArgs = &m_DispId; + } + + // all checks ok - add to queue + hr = pQ->Insert(this); + if (FAILED(hr)) { + *phr = hr; + } +} + + +// refcounts are held by caller of InvokeAt... and by list. So if +// we get here, we can't be on the list + +#if 0 +CDeferredCommand::~CDeferredCommand() +{ + // this assert is invalid since if the queue is deleted while we are + // still on the queue, we will have been removed by the queue and this + // m_pQueue will not have been modified. + // ASSERT(m_pQueue == NULL); + + // we don't hold a ref count on pUnk, which is the object that should + // execute the command. + // This is because there would otherwise be a circular refcount problem + // since pUnk probably owns the CmdQueue object that has a refcount + // on us. + // The lifetime of pUnk is guaranteed by it being part of, or lifetime + // controlled by, our parent object. As long as we are on the list, pUnk + // must be valid. Once we are off the list, we do not use pUnk. + +} +#endif + + +// overriden to publicise our interfaces + +STDMETHODIMP +CDeferredCommand::NonDelegatingQueryInterface(REFIID riid, __out void **ppv) +{ + ValidateReadWritePtr(ppv,sizeof(PVOID)); + if (riid == IID_IDeferredCommand) { + return GetInterface( (IDeferredCommand *) this, ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} + + +// remove from q. this will reduce the refcount by one (since the q +// holds a count) but can't make us go away since he must have a +// refcount in order to call this method. + +STDMETHODIMP +CDeferredCommand::Cancel() +{ + if (m_pQueue == NULL) { + return VFW_E_ALREADY_CANCELLED; + } + + HRESULT hr = m_pQueue->Remove(this); + if (FAILED(hr)) { + return hr; + } + + m_pQueue = NULL; + return S_OK; +} + + +STDMETHODIMP +CDeferredCommand::Confidence(__out LONG* pConfidence) +{ + return E_NOTIMPL; +} + + +STDMETHODIMP +CDeferredCommand::GetHResult(__out HRESULT * phrResult) +{ + CheckPointer(phrResult,E_POINTER); + ValidateReadWritePtr(phrResult,sizeof(HRESULT)); + + if (m_pQueue != NULL) { + return E_ABORT; + } + *phrResult = m_hrResult; + return S_OK; +} + + +// set the time to be a new time (checking that it is valid) and +// then requeue + +STDMETHODIMP +CDeferredCommand::Postpone(REFTIME newtime) +{ + + // check that this time is not past + // convert REFTIME to REFERENCE_TIME + COARefTime convertor(newtime); + + // check that the time has not passed + if (m_pQueue->CheckTime(convertor, IsStreamTime())) { + return VFW_E_TIME_ALREADY_PASSED; + } + + // extract from list + HRESULT hr = m_pQueue->Remove(this); + if (FAILED(hr)) { + return hr; + } + + // change time + m_time = convertor; + + // requeue + hr = m_pQueue->Insert(this); + + return hr; +} + + +HRESULT +CDeferredCommand::Invoke() +{ + // check that we are still outstanding + if (m_pQueue == NULL) { + return VFW_E_ALREADY_CANCELLED; + } + + // get the type info + ITypeInfo* pti; + HRESULT hr = m_Dispatch.GetTypeInfo(GetIID(), 0, 0, &pti); + if (FAILED(hr)) { + return hr; + } + + // qi for the expected interface and then invoke it. Note that we have to + // treat the returned interface as IUnknown since we don't know its type. + IUnknown* pInterface; + + hr = m_pUnk->QueryInterface(GetIID(), (void**) &pInterface); + if (FAILED(hr)) { + pti->Release(); + return hr; + } + + EXCEPINFO expinfo; + UINT uArgErr; + m_hrResult = pti->Invoke( + pInterface, + GetMethod(), + GetFlags(), + GetParams(), + GetResult(), + &expinfo, + &uArgErr); + + // release the interface we QI'd for + pInterface->Release(); + pti->Release(); + + + // remove from list whether or not successful + // or we loop indefinitely + hr = m_pQueue->Remove(this); + m_pQueue = NULL; + return hr; +} + + + +// --- CCmdQueue methods ---------- + + +CCmdQueue::CCmdQueue(__inout_opt HRESULT *phr) : + m_listPresentation(NAME("Presentation time command list")), + m_listStream(NAME("Stream time command list")), + m_evDue(TRUE, phr), // manual reset + m_dwAdvise(0), + m_pClock(NULL), + m_bRunning(FALSE) +{ +} + + +CCmdQueue::~CCmdQueue() +{ + // empty all our lists + + // we hold a refcount on each, so traverse and Release each + // entry then RemoveAll to empty the list + POSITION pos = m_listPresentation.GetHeadPosition(); + + while(pos) { + CDeferredCommand* pCmd = m_listPresentation.GetNext(pos); + pCmd->Release(); + } + m_listPresentation.RemoveAll(); + + pos = m_listStream.GetHeadPosition(); + + while(pos) { + CDeferredCommand* pCmd = m_listStream.GetNext(pos); + pCmd->Release(); + } + m_listStream.RemoveAll(); + + if (m_pClock) { + if (m_dwAdvise) { + m_pClock->Unadvise(m_dwAdvise); + m_dwAdvise = 0; + } + m_pClock->Release(); + } +} + + +// returns a new CDeferredCommand object that will be initialised with +// the parameters and will be added to the queue during construction. +// returns S_OK if successfully created otherwise an error and +// no object has been queued. + +HRESULT +CCmdQueue::New( + __out CDeferredCommand **ppCmd, + __in LPUNKNOWN pUnk, // this object will execute command + REFTIME time, + __in GUID* iid, + long dispidMethod, + short wFlags, + long cArgs, + __in_ecount(cArgs) VARIANT* pDispParams, + __out VARIANT* pvarResult, + __out short* puArgErr, + BOOL bStream +) +{ + CAutoLock lock(&m_Lock); + + HRESULT hr = S_OK; + *ppCmd = NULL; + + CDeferredCommand* pCmd; + pCmd = new CDeferredCommand( + this, + NULL, // not aggregated + &hr, + pUnk, // this guy will execute + time, + iid, + dispidMethod, + wFlags, + cArgs, + pDispParams, + pvarResult, + puArgErr, + bStream); + + if (pCmd == NULL) { + hr = E_OUTOFMEMORY; + } else { + *ppCmd = pCmd; + } + return hr; +} + + +HRESULT +CCmdQueue::Insert(__in CDeferredCommand* pCmd) +{ + CAutoLock lock(&m_Lock); + + // addref the item + pCmd->AddRef(); + + CGenericList * pList; + if (pCmd->IsStreamTime()) { + pList = &m_listStream; + } else { + pList = &m_listPresentation; + } + POSITION pos = pList->GetHeadPosition(); + + // seek past all items that are before us + while (pos && + (pList->GetValid(pos)->GetTime() <= pCmd->GetTime())) { + + pList->GetNext(pos); + } + + // now at end of list or in front of items that come later + if (!pos) { + pList->AddTail(pCmd); + } else { + pList->AddBefore(pos, pCmd); + } + + SetTimeAdvise(); + return S_OK; +} + + +HRESULT +CCmdQueue::Remove(__in CDeferredCommand* pCmd) +{ + CAutoLock lock(&m_Lock); + HRESULT hr = S_OK; + + CGenericList * pList; + if (pCmd->IsStreamTime()) { + pList = &m_listStream; + } else { + pList = &m_listPresentation; + } + POSITION pos = pList->GetHeadPosition(); + + // traverse the list + while (pos && (pList->GetValid(pos) != pCmd)) { + pList->GetNext(pos); + } + + // did we drop off the end? + if (!pos) { + hr = VFW_E_NOT_FOUND; + } else { + + // found it - now take off list + pList->Remove(pos); + + // Insert did an AddRef, so release it + pCmd->Release(); + + // check that timer request is still for earliest time + SetTimeAdvise(); + } + return hr; +} + + +// set the clock used for timing + +HRESULT +CCmdQueue::SetSyncSource(__in_opt IReferenceClock* pClock) +{ + CAutoLock lock(&m_Lock); + + // addref the new clock first in case they are the same + if (pClock) { + pClock->AddRef(); + } + + // kill any advise on the old clock + if (m_pClock) { + if (m_dwAdvise) { + m_pClock->Unadvise(m_dwAdvise); + m_dwAdvise = 0; + } + m_pClock->Release(); + } + m_pClock = pClock; + + // set up a new advise + SetTimeAdvise(); + return S_OK; +} + + +// set up a timer event with the reference clock + +void +CCmdQueue::SetTimeAdvise(void) +{ + // make sure we have a clock to use + if (!m_pClock) { + return; + } + + // reset the event whenever we are requesting a new signal + m_evDue.Reset(); + + // time 0 is earliest + CRefTime current; + + // find the earliest presentation time + POSITION pos = m_listPresentation.GetHeadPosition(); + if (pos != NULL) { + current = m_listPresentation.GetValid(pos)->GetTime(); + } + + // if we're running, check the stream times too + if (m_bRunning) { + + CRefTime t; + pos = m_listStream.GetHeadPosition(); + if (NULL != pos) { + t = m_listStream.GetValid(pos)->GetTime(); + + // add on stream time offset to get presentation time + t += m_StreamTimeOffset; + + // is this earlier? + if ((current == TimeZero) || (t < current)) { + current = t; + } + } + } + + // need to change? + if ((current > TimeZero) && (current != m_tCurrentAdvise)) { + if (m_dwAdvise) { + m_pClock->Unadvise(m_dwAdvise); + // reset the event whenever we are requesting a new signal + m_evDue.Reset(); + } + + // ask for time advice - the first two params are either + // stream time offset and stream time or + // presentation time and 0. we always use the latter + HRESULT hr = m_pClock->AdviseTime( + (REFERENCE_TIME)current, + TimeZero, + (HEVENT) HANDLE(m_evDue), + &m_dwAdvise); + + ASSERT(SUCCEEDED(hr)); + m_tCurrentAdvise = current; + } +} + + +// switch to run mode. Streamtime to Presentation time mapping known. + +HRESULT +CCmdQueue::Run(REFERENCE_TIME tStreamTimeOffset) +{ + CAutoLock lock(&m_Lock); + + m_StreamTimeOffset = tStreamTimeOffset; + m_bRunning = TRUE; + + // ensure advise is accurate + SetTimeAdvise(); + return S_OK; +} + + +// switch to Stopped or Paused mode. Time mapping not known. + +HRESULT +CCmdQueue::EndRun() +{ + CAutoLock lock(&m_Lock); + + m_bRunning = FALSE; + + // check timer setting - stream times + SetTimeAdvise(); + return S_OK; +} + + +// return a pointer to the next due command. Blocks for msTimeout +// milliseconds until there is a due command. +// Stream-time commands will only become due between Run and Endrun calls. +// The command remains queued until invoked or cancelled. +// Returns E_ABORT if timeout occurs, otherwise S_OK (or other error). +// +// returns an AddRef'd object + +HRESULT +CCmdQueue::GetDueCommand(__out CDeferredCommand ** ppCmd, long msTimeout) +{ + // loop until we timeout or find a due command + for (;;) { + + { + CAutoLock lock(&m_Lock); + + + // find the earliest command + CDeferredCommand * pCmd = NULL; + + // check the presentation time and the + // stream time list to find the earliest + + POSITION pos = m_listPresentation.GetHeadPosition(); + + if (NULL != pos) { + pCmd = m_listPresentation.GetValid(pos); + } + + if (m_bRunning) { + pos = m_listStream.GetHeadPosition(); + if (NULL != pos) { + CDeferredCommand* pStrm = m_listStream.GetValid(pos); + + CRefTime t = pStrm->GetTime() + m_StreamTimeOffset; + if (!pCmd || (t < pCmd->GetTime())) { + pCmd = pStrm; + } + } + } + + // if we have found one, is it due? + if (pCmd) { + if (CheckTime(pCmd->GetTime(), pCmd->IsStreamTime())) { + + // yes it's due - addref it + pCmd->AddRef(); + *ppCmd = pCmd; + return S_OK; + } + } + } + + // block until the advise is signalled + if (WaitForSingleObject(m_evDue, msTimeout) != WAIT_OBJECT_0) { + return E_ABORT; + } + } +} + + +// return a pointer to a command that will be due for a given time. +// Pass in a stream time here. The stream time offset will be passed +// in via the Run method. +// Commands remain queued until invoked or cancelled. +// This method will not block. It will report E_ABORT if there are no +// commands due yet. +// +// returns an AddRef'd object + +HRESULT +CCmdQueue::GetCommandDueFor(REFERENCE_TIME rtStream, __out CDeferredCommand**ppCmd) +{ + CAutoLock lock(&m_Lock); + + CRefTime tStream(rtStream); + + // find the earliest stream and presentation time commands + CDeferredCommand* pStream = NULL; + POSITION pos = m_listStream.GetHeadPosition(); + if (NULL != pos) { + pStream = m_listStream.GetValid(pos); + } + CDeferredCommand* pPresent = NULL; + pos = m_listPresentation.GetHeadPosition(); + if (NULL != pos) { + pPresent = m_listPresentation.GetValid(pos); + } + + // is there a presentation time that has passed already + if (pPresent && CheckTime(pPresent->GetTime(), FALSE)) { + pPresent->AddRef(); + *ppCmd = pPresent; + return S_OK; + } + + // is there a stream time command due before this stream time + if (pStream && (pStream->GetTime() <= tStream)) { + pStream->AddRef(); + *ppCmd = pStream; + return S_OK; + } + + // if we are running, we can map presentation times to + // stream time. In this case, is there a presentation time command + // that will be due before this stream time is presented? + if (m_bRunning && pPresent) { + + // this stream time will appear at... + tStream += m_StreamTimeOffset; + + // due before that? + if (pPresent->GetTime() <= tStream) { + *ppCmd = pPresent; + return S_OK; + } + } + + // no commands due yet + return VFW_E_NOT_FOUND; +} + diff --git a/third_party/BaseClasses/ctlutil.h b/third_party/BaseClasses/ctlutil.h new file mode 100644 index 00000000..7e4719ce --- /dev/null +++ b/third_party/BaseClasses/ctlutil.h @@ -0,0 +1,923 @@ +//------------------------------------------------------------------------------ +// File: CtlUtil.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// Base classes implementing IDispatch parsing for the basic control dual +// interfaces. Derive from these and implement just the custom method and +// property methods. We also implement CPosPassThru that can be used by +// renderers and transforms to pass by IMediaPosition and IMediaSeeking + +#ifndef __CTLUTIL__ +#define __CTLUTIL__ + +// OLE Automation has different ideas of TRUE and FALSE + +#define OATRUE (-1) +#define OAFALSE (0) + + +// It's possible that we could replace this class with CreateStdDispatch + +class CBaseDispatch +{ + ITypeInfo * m_pti; + +public: + + CBaseDispatch() : m_pti(NULL) {} + ~CBaseDispatch(); + + /* IDispatch methods */ + STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo); + + STDMETHODIMP GetTypeInfo( + REFIID riid, + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo); + + STDMETHODIMP GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid); +}; + + +class AM_NOVTABLE CMediaControl : + public IMediaControl, + public CUnknown +{ + CBaseDispatch m_basedisp; + +public: + + CMediaControl(const TCHAR *, LPUNKNOWN); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + /* IDispatch methods */ + STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo); + + STDMETHODIMP GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo); + + STDMETHODIMP GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid); + + STDMETHODIMP Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr); +}; + + +class AM_NOVTABLE CMediaEvent : + public IMediaEventEx, + public CUnknown +{ + CBaseDispatch m_basedisp; + +public: + + CMediaEvent(__in_opt LPCTSTR, __in_opt LPUNKNOWN); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + /* IDispatch methods */ + STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo); + + STDMETHODIMP GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo); + + STDMETHODIMP GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid); + + STDMETHODIMP Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr); +}; + + +class AM_NOVTABLE CMediaPosition : + public IMediaPosition, + public CUnknown +{ + CBaseDispatch m_basedisp; + + +public: + + CMediaPosition(__in_opt LPCTSTR, __in_opt LPUNKNOWN); + CMediaPosition(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT *phr); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + /* IDispatch methods */ + STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo); + + STDMETHODIMP GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo); + + STDMETHODIMP GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid); + + STDMETHODIMP Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr); + +}; + + +// OA-compatibility means that we must use double as the RefTime value, +// and REFERENCE_TIME (essentially a LONGLONG) within filters. +// this class converts between the two + +class COARefTime : public CRefTime { +public: + + COARefTime() { + }; + + COARefTime(CRefTime t) + : CRefTime(t) + { + }; + + COARefTime(REFERENCE_TIME t) + : CRefTime(t) + { + }; + + COARefTime(double d) { + m_time = (LONGLONG) (d * 10000000); + }; + + operator double() { + return double(m_time) / 10000000; + }; + + operator REFERENCE_TIME() { + return m_time; + }; + + COARefTime& operator=(const double& rd) { + m_time = (LONGLONG) (rd * 10000000); + return *this; + } + + COARefTime& operator=(const REFERENCE_TIME& rt) { + m_time = rt; + return *this; + } + + inline BOOL operator==(const COARefTime& rt) + { + return m_time == rt.m_time; + }; + + inline BOOL operator!=(const COARefTime& rt) + { + return m_time != rt.m_time; + }; + + inline BOOL operator < (const COARefTime& rt) + { + return m_time < rt.m_time; + }; + + inline BOOL operator > (const COARefTime& rt) + { + return m_time > rt.m_time; + }; + + inline BOOL operator >= (const COARefTime& rt) + { + return m_time >= rt.m_time; + }; + + inline BOOL operator <= (const COARefTime& rt) + { + return m_time <= rt.m_time; + }; + + inline COARefTime operator+(const COARefTime& rt) + { + return COARefTime(m_time + rt.m_time); + }; + + inline COARefTime operator-(const COARefTime& rt) + { + return COARefTime(m_time - rt.m_time); + }; + + inline COARefTime operator*(LONG l) + { + return COARefTime(m_time * l); + }; + + inline COARefTime operator/(LONG l) + { + return COARefTime(m_time / l); + }; + +private: + // Prevent bugs from constructing from LONG (which gets + // converted to double and then multiplied by 10000000 + COARefTime(LONG); + LONG operator=(LONG); +}; + + +// A utility class that handles IMediaPosition and IMediaSeeking on behalf +// of single-input pin renderers, or transform filters. +// +// Renderers will expose this from the filter; transform filters will +// expose it from the output pin and not the renderer. +// +// Create one of these, giving it your IPin* for your input pin, and delegate +// all IMediaPosition methods to it. It will query the input pin for +// IMediaPosition and respond appropriately. +// +// Call ForceRefresh if the pin connection changes. +// +// This class no longer caches the upstream IMediaPosition or IMediaSeeking +// it acquires it on each method call. This means ForceRefresh is not needed. +// The method is kept for source compatibility and to minimise the changes +// if we need to put it back later for performance reasons. + +class CPosPassThru : public IMediaSeeking, public CMediaPosition +{ + IPin *m_pPin; + + HRESULT GetPeer(__deref_out IMediaPosition **ppMP); + HRESULT GetPeerSeeking(__deref_out IMediaSeeking **ppMS); + +public: + + CPosPassThru(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT*, IPin *); + DECLARE_IUNKNOWN + + HRESULT ForceRefresh() { + return S_OK; + }; + + // override to return an accurate current position + virtual HRESULT GetMediaTime(__out LONGLONG *pStartTime, __out_opt LONGLONG *pEndTime) { + return E_FAIL; + } + + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid,__deref_out void **ppv); + + // IMediaSeeking methods + STDMETHODIMP GetCapabilities( __out DWORD * pCapabilities ); + STDMETHODIMP CheckCapabilities( __inout DWORD * pCapabilities ); + STDMETHODIMP SetTimeFormat(const GUID * pFormat); + STDMETHODIMP GetTimeFormat(__out GUID *pFormat); + STDMETHODIMP IsUsingTimeFormat(const GUID * pFormat); + STDMETHODIMP IsFormatSupported( const GUID * pFormat); + STDMETHODIMP QueryPreferredFormat( __out GUID *pFormat); + STDMETHODIMP ConvertTimeFormat(__out LONGLONG * pTarget, + __in_opt const GUID * pTargetFormat, + LONGLONG Source, + __in_opt const GUID * pSourceFormat ); + STDMETHODIMP SetPositions( __inout_opt LONGLONG * pCurrent, DWORD CurrentFlags + , __inout_opt LONGLONG * pStop, DWORD StopFlags ); + + STDMETHODIMP GetPositions( __out_opt LONGLONG * pCurrent, __out_opt LONGLONG * pStop ); + STDMETHODIMP GetCurrentPosition( __out LONGLONG * pCurrent ); + STDMETHODIMP GetStopPosition( __out LONGLONG * pStop ); + STDMETHODIMP SetRate( double dRate); + STDMETHODIMP GetRate( __out double * pdRate); + STDMETHODIMP GetDuration( __out LONGLONG *pDuration); + STDMETHODIMP GetAvailable( __out_opt LONGLONG *pEarliest, __out_opt LONGLONG *pLatest ); + STDMETHODIMP GetPreroll( __out LONGLONG *pllPreroll ); + + // IMediaPosition properties + STDMETHODIMP get_Duration(__out REFTIME * plength); + STDMETHODIMP put_CurrentPosition(REFTIME llTime); + STDMETHODIMP get_StopTime(__out REFTIME * pllTime); + STDMETHODIMP put_StopTime(REFTIME llTime); + STDMETHODIMP get_PrerollTime(__out REFTIME * pllTime); + STDMETHODIMP put_PrerollTime(REFTIME llTime); + STDMETHODIMP get_Rate(__out double * pdRate); + STDMETHODIMP put_Rate(double dRate); + STDMETHODIMP get_CurrentPosition(__out REFTIME * pllTime); + STDMETHODIMP CanSeekForward(__out LONG *pCanSeekForward); + STDMETHODIMP CanSeekBackward(__out LONG *pCanSeekBackward); + +private: + HRESULT GetSeekingLongLong( HRESULT (__stdcall IMediaSeeking::*pMethod)( LONGLONG * ), + __out LONGLONG * pll ); +}; + + +// Adds the ability to return a current position + +class CRendererPosPassThru : public CPosPassThru +{ + CCritSec m_PositionLock; // Locks access to our position + LONGLONG m_StartMedia; // Start media time last seen + LONGLONG m_EndMedia; // And likewise the end media + BOOL m_bReset; // Have media times been set + +public: + + // Used to help with passing media times through graph + + CRendererPosPassThru(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT*, IPin *); + HRESULT RegisterMediaTime(IMediaSample *pMediaSample); + HRESULT RegisterMediaTime(LONGLONG StartTime,LONGLONG EndTime); + HRESULT GetMediaTime(__out LONGLONG *pStartTime,__out_opt LONGLONG *pEndTime); + HRESULT ResetMediaTime(); + HRESULT EOS(); +}; + +STDAPI CreatePosPassThru( + __in_opt LPUNKNOWN pAgg, + BOOL bRenderer, + IPin *pPin, + __deref_out IUnknown **ppPassThru +); + +// A class that handles the IDispatch part of IBasicAudio and leaves the +// properties and methods themselves pure virtual. + +class AM_NOVTABLE CBasicAudio : public IBasicAudio, public CUnknown +{ + CBaseDispatch m_basedisp; + +public: + + CBasicAudio(__in_opt LPCTSTR, __in_opt LPUNKNOWN); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + /* IDispatch methods */ + STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo); + + STDMETHODIMP GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo); + + STDMETHODIMP GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid); + + STDMETHODIMP Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr); +}; + + +// A class that handles the IDispatch part of IBasicVideo and leaves the +// properties and methods themselves pure virtual. + +class AM_NOVTABLE CBaseBasicVideo : public IBasicVideo2, public CUnknown +{ + CBaseDispatch m_basedisp; + +public: + + CBaseBasicVideo(__in_opt LPCTSTR, __in_opt LPUNKNOWN); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + /* IDispatch methods */ + STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo); + + STDMETHODIMP GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo); + + STDMETHODIMP GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid); + + STDMETHODIMP Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr); + + STDMETHODIMP GetPreferredAspectRatio( + __out long *plAspectX, + __out long *plAspectY) + { + return E_NOTIMPL; + } +}; + + +// A class that handles the IDispatch part of IVideoWindow and leaves the +// properties and methods themselves pure virtual. + +class AM_NOVTABLE CBaseVideoWindow : public IVideoWindow, public CUnknown +{ + CBaseDispatch m_basedisp; + +public: + + CBaseVideoWindow(__in_opt LPCTSTR, __in_opt LPUNKNOWN); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + /* IDispatch methods */ + STDMETHODIMP GetTypeInfoCount(__out UINT * pctinfo); + + STDMETHODIMP GetTypeInfo( + UINT itinfo, + LCID lcid, + __deref_out ITypeInfo ** pptinfo); + + STDMETHODIMP GetIDsOfNames( + REFIID riid, + __in_ecount(cNames) LPOLESTR * rgszNames, + UINT cNames, + LCID lcid, + __out_ecount(cNames) DISPID * rgdispid); + + STDMETHODIMP Invoke( + DISPID dispidMember, + REFIID riid, + LCID lcid, + WORD wFlags, + __in DISPPARAMS * pdispparams, + __out_opt VARIANT * pvarResult, + __out_opt EXCEPINFO * pexcepinfo, + __out_opt UINT * puArgErr); +}; + + +// abstract class to help source filters with their implementation +// of IMediaPosition. Derive from this and set the duration (and stop +// position). Also override NotifyChange to do something when the properties +// change. + +class AM_NOVTABLE CSourcePosition : public CMediaPosition +{ + +public: + CSourcePosition(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT*, __in CCritSec *); + + // IMediaPosition methods + STDMETHODIMP get_Duration(__out REFTIME * plength); + STDMETHODIMP put_CurrentPosition(REFTIME llTime); + STDMETHODIMP get_StopTime(__out REFTIME * pllTime); + STDMETHODIMP put_StopTime(REFTIME llTime); + STDMETHODIMP get_PrerollTime(__out REFTIME * pllTime); + STDMETHODIMP put_PrerollTime(REFTIME llTime); + STDMETHODIMP get_Rate(__out double * pdRate); + STDMETHODIMP put_Rate(double dRate); + STDMETHODIMP CanSeekForward(__out LONG *pCanSeekForward); + STDMETHODIMP CanSeekBackward(__out LONG *pCanSeekBackward); + + // override if you can return the data you are actually working on + STDMETHODIMP get_CurrentPosition(__out REFTIME * pllTime) { + return E_NOTIMPL; + }; + +protected: + + // we call this to notify changes. Override to handle them + virtual HRESULT ChangeStart() PURE; + virtual HRESULT ChangeStop() PURE; + virtual HRESULT ChangeRate() PURE; + + COARefTime m_Duration; + COARefTime m_Start; + COARefTime m_Stop; + double m_Rate; + + CCritSec * m_pLock; +}; + +class AM_NOVTABLE CSourceSeeking : + public IMediaSeeking, + public CUnknown +{ + +public: + + DECLARE_IUNKNOWN; + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + // IMediaSeeking methods + + STDMETHODIMP IsFormatSupported(const GUID * pFormat); + STDMETHODIMP QueryPreferredFormat(__out GUID *pFormat); + STDMETHODIMP SetTimeFormat(const GUID * pFormat); + STDMETHODIMP IsUsingTimeFormat(const GUID * pFormat); + STDMETHODIMP GetTimeFormat(__out GUID *pFormat); + STDMETHODIMP GetDuration(__out LONGLONG *pDuration); + STDMETHODIMP GetStopPosition(__out LONGLONG *pStop); + STDMETHODIMP GetCurrentPosition(__out LONGLONG *pCurrent); + STDMETHODIMP GetCapabilities( __out DWORD * pCapabilities ); + STDMETHODIMP CheckCapabilities( __inout DWORD * pCapabilities ); + STDMETHODIMP ConvertTimeFormat( __out LONGLONG * pTarget, + __in_opt const GUID * pTargetFormat, + LONGLONG Source, + __in_opt const GUID * pSourceFormat ); + + STDMETHODIMP SetPositions( __inout_opt LONGLONG * pCurrent, DWORD CurrentFlags + , __inout_opt LONGLONG * pStop, DWORD StopFlags ); + + STDMETHODIMP GetPositions( __out_opt LONGLONG * pCurrent, __out_opt LONGLONG * pStop ); + + STDMETHODIMP GetAvailable( __out_opt LONGLONG * pEarliest, __out_opt LONGLONG * pLatest ); + STDMETHODIMP SetRate( double dRate); + STDMETHODIMP GetRate( __out double * pdRate); + STDMETHODIMP GetPreroll(__out LONGLONG *pPreroll); + + +protected: + + // ctor + CSourceSeeking(__in_opt LPCTSTR, __in_opt LPUNKNOWN, __inout HRESULT*, __in CCritSec *); + + // we call this to notify changes. Override to handle them + virtual HRESULT ChangeStart() PURE; + virtual HRESULT ChangeStop() PURE; + virtual HRESULT ChangeRate() PURE; + + CRefTime m_rtDuration; // length of stream + CRefTime m_rtStart; // source will start here + CRefTime m_rtStop; // source will stop here + double m_dRateSeeking; + + // seeking capabilities + DWORD m_dwSeekingCaps; + + CCritSec * m_pLock; +}; + + +// Base classes supporting Deferred commands. + +// Deferred commands are queued by calls to methods on the IQueueCommand +// interface, exposed by the filtergraph and by some filters. A successful +// call to one of these methods will return an IDeferredCommand interface +// representing the queued command. +// +// A CDeferredCommand object represents a single deferred command, and exposes +// the IDeferredCommand interface as well as other methods permitting time +// checks and actual execution. It contains a reference to the CCommandQueue +// object on which it is queued. +// +// CCommandQueue is a base class providing a queue of CDeferredCommand +// objects, and methods to add, remove, check status and invoke the queued +// commands. A CCommandQueue object would be part of an object that +// implemented IQueueCommand. + +class CCmdQueue; + +// take a copy of the params and store them. Release any allocated +// memory in destructor + +class CDispParams : public DISPPARAMS +{ +public: + CDispParams(UINT nArgs, __in_ecount(nArgs) VARIANT* pArgs, __inout_opt HRESULT *phr = NULL); + ~CDispParams(); +}; + + +// CDeferredCommand lifetime is controlled by refcounts. Caller of +// InvokeAt.. gets a refcounted interface pointer, and the CCmdQueue +// object also holds a refcount on us. Calling Cancel or Invoke takes +// us off the CCmdQueue and thus reduces the refcount by 1. Once taken +// off the queue we cannot be put back on the queue. + +class CDeferredCommand + : public CUnknown, + public IDeferredCommand +{ +public: + + CDeferredCommand( + __inout CCmdQueue * pQ, + __in_opt LPUNKNOWN pUnk, // aggregation outer unk + __inout HRESULT * phr, + __in LPUNKNOWN pUnkExecutor, // object that will execute this cmd + REFTIME time, + __in GUID* iid, + long dispidMethod, + short wFlags, + long cArgs, + __in_ecount(cArgs) VARIANT* pDispParams, + __out VARIANT* pvarResult, + __out short* puArgErr, + BOOL bStream + ); + + DECLARE_IUNKNOWN + + // override this to publicise our interfaces + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __out void **ppv); + + // IDeferredCommand methods + STDMETHODIMP Cancel(); + STDMETHODIMP Confidence( + __out LONG* pConfidence); + STDMETHODIMP Postpone( + REFTIME newtime); + STDMETHODIMP GetHResult( + __out HRESULT* phrResult); + + // other public methods + + HRESULT Invoke(); + + // access methods + + // returns TRUE if streamtime, FALSE if presentation time + BOOL IsStreamTime() { + return m_bStream; + }; + + CRefTime GetTime() { + return m_time; + }; + + REFIID GetIID() { + return *m_iid; + }; + + long GetMethod() { + return m_dispidMethod; + }; + + short GetFlags() { + return m_wFlags; + }; + + DISPPARAMS* GetParams() { + return &m_DispParams; + }; + + VARIANT* GetResult() { + return m_pvarResult; + }; + +protected: + + CCmdQueue* m_pQueue; + + // pUnk for the interface that we will execute the command on + LPUNKNOWN m_pUnk; + + // stored command data + REFERENCE_TIME m_time; + GUID* m_iid; + long m_dispidMethod; + short m_wFlags; + VARIANT* m_pvarResult; + BOOL m_bStream; + CDispParams m_DispParams; + DISPID m_DispId; // For get and put + + // we use this for ITypeInfo access + CBaseDispatch m_Dispatch; + + // save retval here + HRESULT m_hrResult; +}; + + +// a list of CDeferredCommand objects. this is a base class providing +// the basics of access to the list. If you want to use CDeferredCommand +// objects then your queue needs to be derived from this class. + +class AM_NOVTABLE CCmdQueue +{ +public: + CCmdQueue(__inout_opt HRESULT *phr = NULL); + virtual ~CCmdQueue(); + + // returns a new CDeferredCommand object that will be initialised with + // the parameters and will be added to the queue during construction. + // returns S_OK if successfully created otherwise an error and + // no object has been queued. + virtual HRESULT New( + __out CDeferredCommand **ppCmd, + __in LPUNKNOWN pUnk, + REFTIME time, + __in GUID* iid, + long dispidMethod, + short wFlags, + long cArgs, + __in_ecount(cArgs) VARIANT* pDispParams, + __out VARIANT* pvarResult, + __out short* puArgErr, + BOOL bStream + ); + + // called by the CDeferredCommand object to add and remove itself + // from the queue + virtual HRESULT Insert(__in CDeferredCommand* pCmd); + virtual HRESULT Remove(__in CDeferredCommand* pCmd); + + // Command-Due Checking + // + // There are two schemes of synchronisation: coarse and accurate. In + // coarse mode, you wait till the time arrives and then execute the cmd. + // In accurate mode, you wait until you are processing the sample that + // will appear at the time, and then execute the command. It's up to the + // filter which one it will implement. The filtergraph will always + // implement coarse mode for commands queued at the filtergraph. + // + // If you want coarse sync, you probably want to wait until there is a + // command due, and then execute it. You can do this by calling + // GetDueCommand. If you have several things to wait for, get the + // event handle from GetDueHandle() and when this is signalled then call + // GetDueCommand. Stream time will only advance between calls to Run and + // EndRun. Note that to avoid an extra thread there is no guarantee that + // if the handle is set there will be a command ready. Each time the + // event is signalled, call GetDueCommand (probably with a 0 timeout); + // This may return E_ABORT. + // + // If you want accurate sync, you must call GetCommandDueFor, passing + // as a parameter the stream time of the samples you are about to process. + // This will return: + // -- a stream-time command due at or before that stream time + // -- a presentation-time command due at or before the + // time that stream time will be presented (only between Run + // and EndRun calls, since outside of this, the mapping from + // stream time to presentation time is not known. + // -- any presentation-time command due now. + // This means that if you want accurate synchronisation on samples that + // might be processed during Paused mode, you need to use + // stream-time commands. + // + // In all cases, commands remain queued until Invoked or Cancelled. The + // setting and resetting of the event handle is managed entirely by this + // queue object. + + // set the clock used for timing + virtual HRESULT SetSyncSource(__in_opt IReferenceClock*); + + // switch to run mode. Streamtime to Presentation time mapping known. + virtual HRESULT Run(REFERENCE_TIME tStreamTimeOffset); + + // switch to Stopped or Paused mode. Time mapping not known. + virtual HRESULT EndRun(); + + // return a pointer to the next due command. Blocks for msTimeout + // milliseconds until there is a due command. + // Stream-time commands will only become due between Run and Endrun calls. + // The command remains queued until invoked or cancelled. + // Returns E_ABORT if timeout occurs, otherwise S_OK (or other error). + // Returns an AddRef-ed object + virtual HRESULT GetDueCommand(__out CDeferredCommand ** ppCmd, long msTimeout); + + // return the event handle that will be signalled whenever + // there are deferred commands due for execution (when GetDueCommand + // will not block). + HANDLE GetDueHandle() { + return HANDLE(m_evDue); + }; + + // return a pointer to a command that will be due for a given time. + // Pass in a stream time here. The stream time offset will be passed + // in via the Run method. + // Commands remain queued until invoked or cancelled. + // This method will not block. It will report VFW_E_NOT_FOUND if there + // are no commands due yet. + // Returns an AddRef-ed object + virtual HRESULT GetCommandDueFor(REFERENCE_TIME tStream, __out CDeferredCommand**ppCmd); + + // check if a given time is due (TRUE if it is due yet) + BOOL CheckTime(CRefTime time, BOOL bStream) { + + // if no clock, nothing is due! + if (!m_pClock) { + return FALSE; + } + + // stream time + if (bStream) { + + // not valid if not running + if (!m_bRunning) { + return FALSE; + } + // add on known stream time offset to get presentation time + time += m_StreamTimeOffset; + } + + CRefTime Now; + m_pClock->GetTime((REFERENCE_TIME*)&Now); + return (time <= Now); + }; + +protected: + + // protect access to lists etc + CCritSec m_Lock; + + // commands queued in presentation time are stored here + CGenericList m_listPresentation; + + // commands queued in stream time are stored here + CGenericList m_listStream; + + // set when any commands are due + CAMEvent m_evDue; + + // creates an advise for the earliest time required, if any + void SetTimeAdvise(void); + + // advise id from reference clock (0 if no outstanding advise) + DWORD_PTR m_dwAdvise; + + // advise time is for this presentation time + CRefTime m_tCurrentAdvise; + + // the reference clock we are using (addrefed) + IReferenceClock* m_pClock; + + // true when running + BOOL m_bRunning; + + // contains stream time offset when m_bRunning is true + CRefTime m_StreamTimeOffset; +}; + +#endif // __CTLUTIL__ diff --git a/third_party/BaseClasses/ddmm.cpp b/third_party/BaseClasses/ddmm.cpp new file mode 100644 index 00000000..bfa700cb --- /dev/null +++ b/third_party/BaseClasses/ddmm.cpp @@ -0,0 +1,129 @@ +//------------------------------------------------------------------------------ +// File: DDMM.cpp +// +// Desc: DirectShow base classes - implements routines for using DirectDraw +// on a multimonitor system. +// +// Copyright (c) 1995-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include +#include "ddmm.h" + +/* + * FindDeviceCallback + */ +typedef struct { + LPSTR szDevice; + GUID* lpGUID; + GUID GUID; + BOOL fFound; +} FindDeviceData; + +BOOL CALLBACK FindDeviceCallback(__in_opt GUID* lpGUID, __in LPSTR szName, __in LPSTR szDevice, __in LPVOID lParam) +{ + FindDeviceData *p = (FindDeviceData*)lParam; + + if (lstrcmpiA(p->szDevice, szDevice) == 0) { + if (lpGUID) { + p->GUID = *lpGUID; + p->lpGUID = &p->GUID; + } else { + p->lpGUID = NULL; + } + p->fFound = TRUE; + return FALSE; + } + return TRUE; +} + + +BOOL CALLBACK FindDeviceCallbackEx(__in_opt GUID* lpGUID, __in LPSTR szName, __in LPSTR szDevice, __in LPVOID lParam, HMONITOR hMonitor) +{ + FindDeviceData *p = (FindDeviceData*)lParam; + + if (lstrcmpiA(p->szDevice, szDevice) == 0) { + if (lpGUID) { + p->GUID = *lpGUID; + p->lpGUID = &p->GUID; + } else { + p->lpGUID = NULL; + } + p->fFound = TRUE; + return FALSE; + } + return TRUE; +} + + +/* + * DirectDrawCreateFromDevice + * + * create a DirectDraw object for a particular device + */ +IDirectDraw * DirectDrawCreateFromDevice(__in_opt LPSTR szDevice, PDRAWCREATE DirectDrawCreateP, PDRAWENUM DirectDrawEnumerateP) +{ + IDirectDraw* pdd = NULL; + FindDeviceData find; + + if (szDevice == NULL) { + DirectDrawCreateP(NULL, &pdd, NULL); + return pdd; + } + + find.szDevice = szDevice; + find.fFound = FALSE; + DirectDrawEnumerateP(FindDeviceCallback, (LPVOID)&find); + + if (find.fFound) + { + // + // In 4bpp mode the following DDraw call causes a message box to be popped + // up by DDraw (!?!). It's DDraw's fault, but we don't like it. So we + // make sure it doesn't happen. + // + UINT ErrorMode = SetErrorMode(SEM_FAILCRITICALERRORS); + DirectDrawCreateP(find.lpGUID, &pdd, NULL); + SetErrorMode(ErrorMode); + } + + return pdd; +} + + +/* + * DirectDrawCreateFromDeviceEx + * + * create a DirectDraw object for a particular device + */ +IDirectDraw * DirectDrawCreateFromDeviceEx(__in_opt LPSTR szDevice, PDRAWCREATE DirectDrawCreateP, LPDIRECTDRAWENUMERATEEXA DirectDrawEnumerateExP) +{ + IDirectDraw* pdd = NULL; + FindDeviceData find; + + if (szDevice == NULL) { + DirectDrawCreateP(NULL, &pdd, NULL); + return pdd; + } + + find.szDevice = szDevice; + find.fFound = FALSE; + DirectDrawEnumerateExP(FindDeviceCallbackEx, (LPVOID)&find, + DDENUM_ATTACHEDSECONDARYDEVICES); + + if (find.fFound) + { + // + // In 4bpp mode the following DDraw call causes a message box to be popped + // up by DDraw (!?!). It's DDraw's fault, but we don't like it. So we + // make sure it doesn't happen. + // + UINT ErrorMode = SetErrorMode(SEM_FAILCRITICALERRORS); + DirectDrawCreateP(find.lpGUID, &pdd, NULL); + SetErrorMode(ErrorMode); + } + + return pdd; +} diff --git a/third_party/BaseClasses/ddmm.h b/third_party/BaseClasses/ddmm.h new file mode 100644 index 00000000..7b311bc1 --- /dev/null +++ b/third_party/BaseClasses/ddmm.h @@ -0,0 +1,28 @@ +//------------------------------------------------------------------------------ +// File: DDMM.h +// +// Desc: DirectShow base classes - efines routines for using DirectDraw +// on a multimonitor system. +// +// Copyright (c) 1995-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifdef __cplusplus +extern "C" { /* Assume C declarations for C++ */ +#endif /* __cplusplus */ + +// DDRAW.H might not include these +#ifndef DDENUM_ATTACHEDSECONDARYDEVICES +#define DDENUM_ATTACHEDSECONDARYDEVICES 0x00000001L +#endif + +typedef HRESULT (*PDRAWCREATE)(IID *,LPDIRECTDRAW *,LPUNKNOWN); +typedef HRESULT (*PDRAWENUM)(LPDDENUMCALLBACKA, LPVOID); + +IDirectDraw * DirectDrawCreateFromDevice(__in_opt LPSTR, PDRAWCREATE, PDRAWENUM); +IDirectDraw * DirectDrawCreateFromDeviceEx(__in_opt LPSTR, PDRAWCREATE, LPDIRECTDRAWENUMERATEEXA); + +#ifdef __cplusplus +} +#endif /* __cplusplus */ diff --git a/third_party/BaseClasses/dllentry.cpp b/third_party/BaseClasses/dllentry.cpp new file mode 100644 index 00000000..130aad6a --- /dev/null +++ b/third_party/BaseClasses/dllentry.cpp @@ -0,0 +1,367 @@ +//------------------------------------------------------------------------------ +// File: DlleEntry.cpp +// +// Desc: DirectShow base classes - implements classes used to support dll +// entry points for COM objects. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include + +#ifdef DEBUG +#ifdef UNICODE +#ifndef _UNICODE +#define _UNICODE +#endif // _UNICODE +#endif // UNICODE + +#include +#endif // DEBUG +#include + +extern CFactoryTemplate g_Templates[]; +extern int g_cTemplates; + +HINSTANCE g_hInst; +DWORD g_amPlatform; // VER_PLATFORM_WIN32_WINDOWS etc... (from GetVersionEx) +OSVERSIONINFO g_osInfo; + +// +// an instance of this is created by the DLLGetClassObject entrypoint +// it uses the CFactoryTemplate object it is given to support the +// IClassFactory interface + +class CClassFactory : public IClassFactory, public CBaseObject +{ + +private: + const CFactoryTemplate *const m_pTemplate; + + ULONG m_cRef; + + static int m_cLocked; +public: + CClassFactory(const CFactoryTemplate *); + + // IUnknown + STDMETHODIMP QueryInterface(REFIID riid, __deref_out void ** ppv); + STDMETHODIMP_(ULONG)AddRef(); + STDMETHODIMP_(ULONG)Release(); + + // IClassFactory + STDMETHODIMP CreateInstance(LPUNKNOWN pUnkOuter, REFIID riid, __deref_out void **pv); + STDMETHODIMP LockServer(BOOL fLock); + + // allow DLLGetClassObject to know about global server lock status + static BOOL IsLocked() { + return (m_cLocked > 0); + }; +}; + +// process-wide dll locked state +int CClassFactory::m_cLocked = 0; + +CClassFactory::CClassFactory(const CFactoryTemplate *pTemplate) +: CBaseObject(NAME("Class Factory")) +, m_cRef(0) +, m_pTemplate(pTemplate) +{ +} + + +STDMETHODIMP +CClassFactory::QueryInterface(REFIID riid,__deref_out void **ppv) +{ + CheckPointer(ppv,E_POINTER) + ValidateReadWritePtr(ppv,sizeof(PVOID)); + *ppv = NULL; + + // any interface on this object is the object pointer. + if ((riid == IID_IUnknown) || (riid == IID_IClassFactory)) { + *ppv = (LPVOID) this; + // AddRef returned interface pointer + ((LPUNKNOWN) *ppv)->AddRef(); + return NOERROR; + } + + return ResultFromScode(E_NOINTERFACE); +} + + +STDMETHODIMP_(ULONG) +CClassFactory::AddRef() +{ + return ++m_cRef; +} + +STDMETHODIMP_(ULONG) +CClassFactory::Release() +{ + LONG lRef = InterlockedDecrement((volatile LONG *)&m_cRef); + if (lRef == 0) { + delete this; + return 0; + } else { + return lRef; + } +} + +STDMETHODIMP +CClassFactory::CreateInstance( + LPUNKNOWN pUnkOuter, + REFIID riid, + __deref_out void **pv) +{ + CheckPointer(pv,E_POINTER) + ValidateReadWritePtr(pv,sizeof(void *)); + *pv = NULL; + + /* Enforce the normal OLE rules regarding interfaces and delegation */ + + if (pUnkOuter != NULL) { + if (IsEqualIID(riid,IID_IUnknown) == FALSE) { + *pv = NULL; + return ResultFromScode(E_NOINTERFACE); + } + } + + /* Create the new object through the derived class's create function */ + + HRESULT hr = NOERROR; + CUnknown *pObj = m_pTemplate->CreateInstance(pUnkOuter, &hr); + + if (pObj == NULL) { + *pv = NULL; + if (SUCCEEDED(hr)) { + hr = E_OUTOFMEMORY; + } + return hr; + } + + /* Delete the object if we got a construction error */ + + if (FAILED(hr)) { + delete pObj; + *pv = NULL; + return hr; + } + + /* Get a reference counted interface on the object */ + + /* We wrap the non-delegating QI with NDAddRef & NDRelease. */ + /* This protects any outer object from being prematurely */ + /* released by an inner object that may have to be created */ + /* in order to supply the requested interface. */ + pObj->NonDelegatingAddRef(); + hr = pObj->NonDelegatingQueryInterface(riid, pv); + pObj->NonDelegatingRelease(); + /* Note that if NonDelegatingQueryInterface fails, it will */ + /* not increment the ref count, so the NonDelegatingRelease */ + /* will drop the ref back to zero and the object will "self-*/ + /* destruct". Hence we don't need additional tidy-up code */ + /* to cope with NonDelegatingQueryInterface failing. */ + + if (SUCCEEDED(hr)) { + ASSERT(*pv); + } + + return hr; +} + +STDMETHODIMP +CClassFactory::LockServer(BOOL fLock) +{ + if (fLock) { + m_cLocked++; + } else { + m_cLocked--; + } + return NOERROR; +} + + +// --- COM entrypoints ----------------------------------------- + +//called by COM to get the class factory object for a given class +__control_entrypoint(DllExport) STDAPI +DllGetClassObject( + __in REFCLSID rClsID, + __in REFIID riid, + __deref_out void **pv) +{ + *pv = NULL; + if (!(riid == IID_IUnknown) && !(riid == IID_IClassFactory)) { + return E_NOINTERFACE; + } + + // traverse the array of templates looking for one with this + // class id + for (int i = 0; i < g_cTemplates; i++) { + const CFactoryTemplate * pT = &g_Templates[i]; + if (pT->IsClassID(rClsID)) { + + // found a template - make a class factory based on this + // template + + *pv = (LPVOID) (LPUNKNOWN) new CClassFactory(pT); + if (*pv == NULL) { + return E_OUTOFMEMORY; + } + ((LPUNKNOWN)*pv)->AddRef(); + return NOERROR; + } + } + return CLASS_E_CLASSNOTAVAILABLE; +} + +// +// Call any initialization routines +// +void +DllInitClasses(BOOL bLoading) +{ + int i; + + // traverse the array of templates calling the init routine + // if they have one + for (i = 0; i < g_cTemplates; i++) { + const CFactoryTemplate * pT = &g_Templates[i]; + if (pT->m_lpfnInit != NULL) { + (*pT->m_lpfnInit)(bLoading, pT->m_ClsID); + } + } + +} + +// called by COM to determine if this dll can be unloaded +// return ok unless there are outstanding objects or a lock requested +// by IClassFactory::LockServer +// +// CClassFactory has a static function that can tell us about the locks, +// and CCOMObject has a static function that can tell us about the active +// object count +STDAPI +DllCanUnloadNow() +{ + DbgLog((LOG_MEMORY,2,TEXT("DLLCanUnloadNow called - IsLocked = %d, Active objects = %d"), + CClassFactory::IsLocked(), + CBaseObject::ObjectsActive())); + + if (CClassFactory::IsLocked() || CBaseObject::ObjectsActive()) { + return S_FALSE; + } else { + return S_OK; + } +} + + +// --- standard WIN32 entrypoints -------------------------------------- + + +extern "C" void __cdecl __security_init_cookie(void); +extern "C" BOOL WINAPI _DllEntryPoint(HINSTANCE, ULONG, __inout_opt LPVOID); +#pragma comment(linker, "/merge:.CRT=.rdata") + +extern "C" +DECLSPEC_NOINLINE +BOOL +WINAPI +DllEntryPoint( + HINSTANCE hInstance, + ULONG ulReason, + __inout_opt LPVOID pv + ) +{ + if ( ulReason == DLL_PROCESS_ATTACH ) { + // Must happen before any other code is executed. Thankfully - it's re-entrant + __security_init_cookie(); + } + return _DllEntryPoint(hInstance, ulReason, pv); +} + + +DECLSPEC_NOINLINE +BOOL +WINAPI +_DllEntryPoint( + HINSTANCE hInstance, + ULONG ulReason, + __inout_opt LPVOID pv + ) +{ +#ifdef DEBUG + extern bool g_fDbgInDllEntryPoint; + g_fDbgInDllEntryPoint = true; +#endif + + switch (ulReason) + { + + case DLL_PROCESS_ATTACH: + DisableThreadLibraryCalls(hInstance); + DbgInitialise(hInstance); + + { + // The platform identifier is used to work out whether + // full unicode support is available or not. Hence the + // default will be the lowest common denominator - i.e. N/A + g_amPlatform = VER_PLATFORM_WIN32_WINDOWS; // win95 assumed in case GetVersionEx fails + + g_osInfo.dwOSVersionInfoSize = sizeof(g_osInfo); + if (GetVersionEx(&g_osInfo)) { + g_amPlatform = g_osInfo.dwPlatformId; + } else { + DbgLog((LOG_ERROR, 1, TEXT("Failed to get the OS platform, assuming Win95"))); + } + } + + g_hInst = hInstance; + DllInitClasses(TRUE); + break; + + case DLL_PROCESS_DETACH: + DllInitClasses(FALSE); + +#ifdef DEBUG + if (CBaseObject::ObjectsActive()) { + DbgSetModuleLevel(LOG_MEMORY, 2); + TCHAR szInfo[512]; + extern TCHAR m_ModuleName[]; // Cut down module name + + TCHAR FullName[_MAX_PATH]; // Load the full path and module name + TCHAR *pName; // Searches from the end for a backslash + + GetModuleFileName(NULL,FullName,_MAX_PATH); + pName = _tcsrchr(FullName,'\\'); + if (pName == NULL) { + pName = FullName; + } else { + pName++; + } + + (void)StringCchPrintf(szInfo, NUMELMS(szInfo), TEXT("Executable: %s Pid %x Tid %x. "), + pName, GetCurrentProcessId(), GetCurrentThreadId()); + + (void)StringCchPrintf(szInfo+lstrlen(szInfo), NUMELMS(szInfo) - lstrlen(szInfo), TEXT("Module %s, %d objects left active!"), + m_ModuleName, CBaseObject::ObjectsActive()); + DbgAssert(szInfo, TEXT(__FILE__),__LINE__); + + // If running remotely wait for the Assert to be acknowledged + // before dumping out the object register + DbgDumpObjectRegister(); + } + DbgTerminate(); +#endif + break; + } + +#ifdef DEBUG + g_fDbgInDllEntryPoint = false; +#endif + return TRUE; +} + + diff --git a/third_party/BaseClasses/dllsetup.cpp b/third_party/BaseClasses/dllsetup.cpp new file mode 100644 index 00000000..ede9c3fd --- /dev/null +++ b/third_party/BaseClasses/dllsetup.cpp @@ -0,0 +1,693 @@ +//------------------------------------------------------------------------------ +// File: DllSetup.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include + +//--------------------------------------------------------------------------- +// defines + +#define MAX_KEY_LEN 260 + + +//--------------------------------------------------------------------------- +// externally defined functions/variable + +extern int g_cTemplates; +extern CFactoryTemplate g_Templates[]; + +//--------------------------------------------------------------------------- +// +// EliminateSubKey +// +// Try to enumerate all keys under this one. +// if we find anything, delete it completely. +// Otherwise just delete it. +// +// note - this was pinched/duplicated from +// Filgraph\Mapper.cpp - so should it be in +// a lib somewhere? +// +//--------------------------------------------------------------------------- + +STDAPI +EliminateSubKey( HKEY hkey, LPCTSTR strSubKey ) +{ + HKEY hk; + if (0 == lstrlen(strSubKey) ) { + // defensive approach + return E_FAIL; + } + + LONG lreturn = RegOpenKeyEx( hkey + , strSubKey + , 0 + , MAXIMUM_ALLOWED + , &hk ); + + ASSERT( lreturn == ERROR_SUCCESS + || lreturn == ERROR_FILE_NOT_FOUND + || lreturn == ERROR_INVALID_HANDLE ); + + if( ERROR_SUCCESS == lreturn ) + { + // Keep on enumerating the first (zero-th) + // key and deleting that + + for( ; ; ) + { + TCHAR Buffer[MAX_KEY_LEN]; + DWORD dw = MAX_KEY_LEN; + FILETIME ft; + + lreturn = RegEnumKeyEx( hk + , 0 + , Buffer + , &dw + , NULL + , NULL + , NULL + , &ft); + + ASSERT( lreturn == ERROR_SUCCESS + || lreturn == ERROR_NO_MORE_ITEMS ); + + if( ERROR_SUCCESS == lreturn ) + { + EliminateSubKey(hk, Buffer); + } + else + { + break; + } + } + + RegCloseKey(hk); + RegDeleteKey(hkey, strSubKey); + } + + return NOERROR; +} + + +//--------------------------------------------------------------------------- +// +// AMovieSetupRegisterServer() +// +// registers specfied file "szFileName" as server for +// CLSID "clsServer". A description is also required. +// The ThreadingModel and ServerType are optional, as +// they default to InprocServer32 (i.e. dll) and Both. +// +//--------------------------------------------------------------------------- + +STDAPI +AMovieSetupRegisterServer( CLSID clsServer + , LPCWSTR szDescription + , LPCWSTR szFileName + , LPCWSTR szThreadingModel = L"Both" + , LPCWSTR szServerType = L"InprocServer32" ) +{ + // temp buffer + // + TCHAR achTemp[MAX_PATH]; + + // convert CLSID uuid to string and write + // out subkey as string - CLSID\{} + // + OLECHAR szCLSID[CHARS_IN_GUID]; + HRESULT hr = StringFromGUID2( clsServer + , szCLSID + , CHARS_IN_GUID ); + ASSERT( SUCCEEDED(hr) ); + + // create key + // + HKEY hkey; + (void)StringCchPrintf( achTemp, NUMELMS(achTemp), TEXT("CLSID\\%ls"), szCLSID ); + LONG lreturn = RegCreateKey( HKEY_CLASSES_ROOT + , (LPCTSTR)achTemp + , &hkey ); + if( ERROR_SUCCESS != lreturn ) + { + return AmHresultFromWin32(lreturn); + } + + // set description string + // + + (void)StringCchPrintf( achTemp, NUMELMS(achTemp), TEXT("%ls"), szDescription ); + lreturn = RegSetValue( hkey + , (LPCTSTR)NULL + , REG_SZ + , achTemp + , sizeof(achTemp) ); + if( ERROR_SUCCESS != lreturn ) + { + RegCloseKey( hkey ); + return AmHresultFromWin32(lreturn); + } + + // create CLSID\\{"CLSID"}\\"ServerType" key, + // using key to CLSID\\{"CLSID"} passed back by + // last call to RegCreateKey(). + // + HKEY hsubkey; + + (void)StringCchPrintf( achTemp, NUMELMS(achTemp), TEXT("%ls"), szServerType ); + lreturn = RegCreateKey( hkey + , achTemp + , &hsubkey ); + if( ERROR_SUCCESS != lreturn ) + { + RegCloseKey( hkey ); + return AmHresultFromWin32(lreturn); + } + + // set Server string + // + (void)StringCchPrintf( achTemp, NUMELMS(achTemp), TEXT("%ls"), szFileName ); + lreturn = RegSetValue( hsubkey + , (LPCTSTR)NULL + , REG_SZ + , (LPCTSTR)achTemp + , sizeof(TCHAR) * (lstrlen(achTemp)+1) ); + if( ERROR_SUCCESS != lreturn ) + { + RegCloseKey( hkey ); + RegCloseKey( hsubkey ); + return AmHresultFromWin32(lreturn); + } + + (void)StringCchPrintf( achTemp, NUMELMS(achTemp), TEXT("%ls"), szThreadingModel ); + lreturn = RegSetValueEx( hsubkey + , TEXT("ThreadingModel") + , 0L + , REG_SZ + , (CONST BYTE *)achTemp + , sizeof(TCHAR) * (lstrlen(achTemp)+1) ); + + // close hkeys + // + RegCloseKey( hkey ); + RegCloseKey( hsubkey ); + + // and return + // + return HRESULT_FROM_WIN32(lreturn); + +} + + +//--------------------------------------------------------------------------- +// +// AMovieSetupUnregisterServer() +// +// default ActiveMovie dll setup function +// - to use must be called from an exported +// function named DllRegisterServer() +// +//--------------------------------------------------------------------------- + +STDAPI +AMovieSetupUnregisterServer( CLSID clsServer ) +{ + // convert CLSID uuid to string and write + // out subkey CLSID\{} + // + OLECHAR szCLSID[CHARS_IN_GUID]; + HRESULT hr = StringFromGUID2( clsServer + , szCLSID + , CHARS_IN_GUID ); + ASSERT( SUCCEEDED(hr) ); + + TCHAR achBuffer[MAX_KEY_LEN]; + (void)StringCchPrintf( achBuffer, NUMELMS(achBuffer), TEXT("CLSID\\%ls"), szCLSID ); + + // delete subkey + // + + hr = EliminateSubKey( HKEY_CLASSES_ROOT, achBuffer ); + ASSERT( SUCCEEDED(hr) ); + + // return + // + return NOERROR; +} + + +//--------------------------------------------------------------------------- +// +// AMovieSetupRegisterFilter through IFilterMapper2 +// +//--------------------------------------------------------------------------- + +STDAPI +AMovieSetupRegisterFilter2( const AMOVIESETUP_FILTER * const psetupdata + , IFilterMapper2 * pIFM2 + , BOOL bRegister ) +{ + DbgLog((LOG_TRACE, 3, TEXT("= AMovieSetupRegisterFilter"))); + + // check we've got data + // + if( NULL == psetupdata ) return S_FALSE; + + + // unregister filter + // (as pins are subkeys of filter's CLSID key + // they do not need to be removed separately). + // + DbgLog((LOG_TRACE, 3, TEXT("= = unregister filter"))); + HRESULT hr = pIFM2->UnregisterFilter( + 0, // default category + 0, // default instance name + *psetupdata->clsID ); + + + if( bRegister ) + { + REGFILTER2 rf2; + rf2.dwVersion = 1; + rf2.dwMerit = psetupdata->dwMerit; + rf2.cPins = psetupdata->nPins; + rf2.rgPins = psetupdata->lpPin; + + // register filter + // + DbgLog((LOG_TRACE, 3, TEXT("= = register filter"))); + hr = pIFM2->RegisterFilter(*psetupdata->clsID + , psetupdata->strName + , 0 // moniker + , 0 // category + , NULL // instance + , &rf2); + } + + // handle one acceptable "error" - that + // of filter not being registered! + // (couldn't find a suitable #define'd + // name for the error!) + // + if( 0x80070002 == hr) + return NOERROR; + else + return hr; +} + + +//--------------------------------------------------------------------------- +// +// RegisterAllServers() +// +//--------------------------------------------------------------------------- + +STDAPI +RegisterAllServers( LPCWSTR szFileName, BOOL bRegister ) +{ + HRESULT hr = NOERROR; + + for( int i = 0; i < g_cTemplates; i++ ) + { + // get i'th template + // + const CFactoryTemplate *pT = &g_Templates[i]; + + DbgLog((LOG_TRACE, 2, TEXT("- - register %ls"), + (LPCWSTR)pT->m_Name )); + + // register CLSID and InprocServer32 + // + if( bRegister ) + { + hr = AMovieSetupRegisterServer( *(pT->m_ClsID) + , (LPCWSTR)pT->m_Name + , szFileName ); + } + else + { + hr = AMovieSetupUnregisterServer( *(pT->m_ClsID) ); + } + + // check final error for this pass + // and break loop if we failed + // + if( FAILED(hr) ) + break; + } + + return hr; +} + + +//--------------------------------------------------------------------------- +// +// AMovieDllRegisterServer2() +// +// default ActiveMovie dll setup function +// - to use must be called from an exported +// function named DllRegisterServer() +// +// this function is table driven using the +// static members of the CFactoryTemplate +// class defined in the dll. +// +// it registers the Dll as the InprocServer32 +// and then calls the IAMovieSetup.Register +// method. +// +//--------------------------------------------------------------------------- + +STDAPI +AMovieDllRegisterServer2( BOOL bRegister ) +{ + HRESULT hr = NOERROR; + + DbgLog((LOG_TRACE, 2, TEXT("AMovieDllRegisterServer2()"))); + + // get file name (where g_hInst is the + // instance handle of the filter dll) + // + WCHAR achFileName[MAX_PATH]; + + // WIN95 doesn't support GetModuleFileNameW + // + { + char achTemp[MAX_PATH]; + + DbgLog((LOG_TRACE, 2, TEXT("- get module file name"))); + + // g_hInst handle is set in our dll entry point. Make sure + // DllEntryPoint in dllentry.cpp is called + ASSERT(g_hInst != 0); + + if( 0 == GetModuleFileNameA( g_hInst + , achTemp + , sizeof(achTemp) ) ) + { + // we've failed! + DWORD dwerr = GetLastError(); + return AmHresultFromWin32(dwerr); + } + + MultiByteToWideChar( CP_ACP + , 0L + , achTemp + , lstrlenA(achTemp) + 1 + , achFileName + , NUMELMS(achFileName) ); + } + + // + // first registering, register all OLE servers + // + if( bRegister ) + { + DbgLog((LOG_TRACE, 2, TEXT("- register OLE Servers"))); + hr = RegisterAllServers( achFileName, TRUE ); + } + + // + // next, register/unregister all filters + // + + if( SUCCEEDED(hr) ) + { + // init is ref counted so call just in case + // we're being called cold. + // + DbgLog((LOG_TRACE, 2, TEXT("- CoInitialize"))); + hr = CoInitialize( (LPVOID)NULL ); + ASSERT( SUCCEEDED(hr) ); + + // get hold of IFilterMapper2 + // + DbgLog((LOG_TRACE, 2, TEXT("- obtain IFilterMapper2"))); + IFilterMapper2 *pIFM2 = 0; + IFilterMapper *pIFM = 0; + hr = CoCreateInstance( CLSID_FilterMapper2 + , NULL + , CLSCTX_INPROC_SERVER + , IID_IFilterMapper2 + , (void **)&pIFM2 ); + if(FAILED(hr)) + { + DbgLog((LOG_TRACE, 2, TEXT("- trying IFilterMapper instead"))); + + hr = CoCreateInstance( + CLSID_FilterMapper, + NULL, + CLSCTX_INPROC_SERVER, + IID_IFilterMapper, + (void **)&pIFM); + } + if( SUCCEEDED(hr) ) + { + // scan through array of CFactoryTemplates + // registering servers and filters. + // + DbgLog((LOG_TRACE, 2, TEXT("- register Filters"))); + for( int i = 0; i < g_cTemplates; i++ ) + { + // get i'th template + // + const CFactoryTemplate *pT = &g_Templates[i]; + + if( NULL != pT->m_pAMovieSetup_Filter ) + { + DbgLog((LOG_TRACE, 2, TEXT("- - register %ls"), (LPCWSTR)pT->m_Name )); + + if(pIFM2) + { + hr = AMovieSetupRegisterFilter2( pT->m_pAMovieSetup_Filter, pIFM2, bRegister ); + } + else + { + hr = AMovieSetupRegisterFilter( pT->m_pAMovieSetup_Filter, pIFM, bRegister ); + } + } + + // check final error for this pass + // and break loop if we failed + // + if( FAILED(hr) ) + break; + } + + // release interface + // + if(pIFM2) + pIFM2->Release(); + else + pIFM->Release(); + + } + + // and clear up + // + CoFreeUnusedLibraries(); + CoUninitialize(); + } + + // + // if unregistering, unregister all OLE servers + // + if( SUCCEEDED(hr) && !bRegister ) + { + DbgLog((LOG_TRACE, 2, TEXT("- register OLE Servers"))); + hr = RegisterAllServers( achFileName, FALSE ); + } + + DbgLog((LOG_TRACE, 2, TEXT("- return %0x"), hr)); + return hr; +} + + +//--------------------------------------------------------------------------- +// +// AMovieDllRegisterServer() +// +// default ActiveMovie dll setup function +// - to use must be called from an exported +// function named DllRegisterServer() +// +// this function is table driven using the +// static members of the CFactoryTemplate +// class defined in the dll. +// +// it registers the Dll as the InprocServer32 +// and then calls the IAMovieSetup.Register +// method. +// +//--------------------------------------------------------------------------- + + +STDAPI +AMovieDllRegisterServer( void ) +{ + HRESULT hr = NOERROR; + + // get file name (where g_hInst is the + // instance handle of the filter dll) + // + WCHAR achFileName[MAX_PATH]; + + { + // WIN95 doesn't support GetModuleFileNameW + // + char achTemp[MAX_PATH]; + + if( 0 == GetModuleFileNameA( g_hInst + , achTemp + , sizeof(achTemp) ) ) + { + // we've failed! + DWORD dwerr = GetLastError(); + return AmHresultFromWin32(dwerr); + } + + MultiByteToWideChar( CP_ACP + , 0L + , achTemp + , lstrlenA(achTemp) + 1 + , achFileName + , NUMELMS(achFileName) ); + } + + // scan through array of CFactoryTemplates + // registering servers and filters. + // + for( int i = 0; i < g_cTemplates; i++ ) + { + // get i'th template + // + const CFactoryTemplate *pT = &g_Templates[i]; + + // register CLSID and InprocServer32 + // + hr = AMovieSetupRegisterServer( *(pT->m_ClsID) + , (LPCWSTR)pT->m_Name + , achFileName ); + + // instantiate all servers and get hold of + // IAMovieSetup, if implemented, and call + // IAMovieSetup.Register() method + // + if( SUCCEEDED(hr) && (NULL != pT->m_lpfnNew) ) + { + // instantiate object + // + PAMOVIESETUP psetup; + hr = CoCreateInstance( *(pT->m_ClsID) + , 0 + , CLSCTX_INPROC_SERVER + , IID_IAMovieSetup + , reinterpret_cast(&psetup) ); + if( SUCCEEDED(hr) ) + { + hr = psetup->Unregister(); + if( SUCCEEDED(hr) ) + hr = psetup->Register(); + psetup->Release(); + } + else + { + if( (E_NOINTERFACE == hr ) + || (VFW_E_NEED_OWNER == hr ) ) + hr = NOERROR; + } + } + + // check final error for this pass + // and break loop if we failed + // + if( FAILED(hr) ) + break; + + } // end-for + + return hr; +} + + +//--------------------------------------------------------------------------- +// +// AMovieDllUnregisterServer() +// +// default ActiveMovie dll uninstall function +// - to use must be called from an exported +// function named DllRegisterServer() +// +// this function is table driven using the +// static members of the CFactoryTemplate +// class defined in the dll. +// +// it calls the IAMovieSetup.Unregister +// method and then unregisters the Dll +// as the InprocServer32 +// +//--------------------------------------------------------------------------- + +STDAPI +AMovieDllUnregisterServer() +{ + // initialize return code + // + HRESULT hr = NOERROR; + + // scan through CFactory template and unregister + // all OLE servers and filters. + // + for( int i = g_cTemplates; i--; ) + { + // get i'th template + // + const CFactoryTemplate *pT = &g_Templates[i]; + + // check method exists + // + if( NULL != pT->m_lpfnNew ) + { + // instantiate object + // + PAMOVIESETUP psetup; + hr = CoCreateInstance( *(pT->m_ClsID) + , 0 + , CLSCTX_INPROC_SERVER + , IID_IAMovieSetup + , reinterpret_cast(&psetup) ); + if( SUCCEEDED(hr) ) + { + hr = psetup->Unregister(); + psetup->Release(); + } + else + { + if( (E_NOINTERFACE == hr ) + || (VFW_E_NEED_OWNER == hr ) ) + hr = NOERROR; + } + } + + // unregister CLSID and InprocServer32 + // + if( SUCCEEDED(hr) ) + { + hr = AMovieSetupUnregisterServer( *(pT->m_ClsID) ); + } + + // check final error for this pass + // and break loop if we failed + // + if( FAILED(hr) ) + break; + } + + return hr; +} diff --git a/third_party/BaseClasses/dllsetup.h b/third_party/BaseClasses/dllsetup.h new file mode 100644 index 00000000..e363b8b6 --- /dev/null +++ b/third_party/BaseClasses/dllsetup.h @@ -0,0 +1,46 @@ +//------------------------------------------------------------------------------ +// File: DllSetup.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// To be self registering, OLE servers must +// export functions named DllRegisterServer +// and DllUnregisterServer. To allow use of +// custom and default implementations the +// defaults are named AMovieDllRegisterServer +// and AMovieDllUnregisterServer. +// +// To the use the default implementation you +// must provide stub functions. +// +// i.e. STDAPI DllRegisterServer() +// { +// return AMovieDllRegisterServer(); +// } +// +// STDAPI DllUnregisterServer() +// { +// return AMovieDllUnregisterServer(); +// } +// +// +// AMovieDllRegisterServer calls IAMovieSetup.Register(), and +// AMovieDllUnregisterServer calls IAMovieSetup.Unregister(). + +STDAPI AMovieDllRegisterServer2( BOOL ); +STDAPI AMovieDllRegisterServer(); +STDAPI AMovieDllUnregisterServer(); + +// helper functions +STDAPI EliminateSubKey( HKEY, LPCTSTR ); + + +STDAPI +AMovieSetupRegisterFilter2( const AMOVIESETUP_FILTER * const psetupdata + , IFilterMapper2 * pIFM2 + , BOOL bRegister ); + diff --git a/third_party/BaseClasses/dxmperf.h b/third_party/BaseClasses/dxmperf.h new file mode 100644 index 00000000..54a21203 --- /dev/null +++ b/third_party/BaseClasses/dxmperf.h @@ -0,0 +1,250 @@ +//------------------------------------------------------------------------------ +// File: DXMPerf.h +// +// Desc: Macros for DirectShow performance logging. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef _DXMPERF_H_ +#define _DXMPERF_H_ + +#include +#include "perflog.h" + +#ifdef _IA64_ +extern "C" unsigned __int64 __getReg( int whichReg ); +#pragma intrinsic(__getReg) +#endif // _IA64_ + + +inline ULONGLONG _RDTSC( void ) { +#ifdef _X86_ + LARGE_INTEGER li; + __asm { + _emit 0x0F + _emit 0x31 + mov li.LowPart,eax + mov li.HighPart,edx + } + return li.QuadPart; + +#if 0 // This isn't tested yet + +#elif defined (_IA64_) + +#define INL_REGID_APITC 3116 + return __getReg( INL_REGID_APITC ); + +#endif // 0 + +#else // unsupported platform + // not implemented on non x86/IA64 platforms + return 0; +#endif // _X86_/_IA64_ +} + +#define DXMPERF_VIDEOREND 0x00000001 +#define DXMPERF_AUDIOGLITCH 0x00000002 +//#define GETTIME_BIT 0x00000001 +//#define AUDIOREND_BIT 0x00000004 +//#define FRAMEDROP_BIT 0x00000008 +#define AUDIOBREAK_BIT 0x00000010 +#define DXMPERF_AUDIORECV 0x00000020 +#define DXMPERF_AUDIOSLAVE 0x00000040 +#define DXMPERF_AUDIOBREAK 0x00000080 + +#define PERFLOG_CTOR( name, iface ) +#define PERFLOG_DTOR( name, iface ) +#define PERFLOG_DELIVER( name, source, dest, sample, pmt ) +#define PERFLOG_RECEIVE( name, source, dest, sample, pmt ) +#define PERFLOG_RUN( name, iface, time, oldstate ) +#define PERFLOG_PAUSE( name, iface, oldstate ) +#define PERFLOG_STOP( name, iface, oldstate ) +#define PERFLOG_JOINGRAPH( name, iface, graph ) +#define PERFLOG_GETBUFFER( allocator, sample ) +#define PERFLOG_RELBUFFER( allocator, sample ) +#define PERFLOG_CONNECT( connector, connectee, status, pmt ) +#define PERFLOG_RXCONNECT( connector, connectee, status, pmt ) +#define PERFLOG_DISCONNECT( disconnector, disconnectee, status ) + +#define PERFLOG_GETTIME( clock, time ) /*{ \ + PERFINFO_WMI_GETTIME perfData; \ + if (NULL != g_pTraceEvent) { \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_GETTIME; \ + perfData.data.cycleCounter = _RDTSC(); \ + perfData.data.dshowClock = (ULONGLONG) (time); \ + if (g_perfMasks[GETTIME_INDEX] & GETTIME_BIT) \ + (*g_pTraceEvent)( g_traceHandle, (PEVENT_TRACE_HEADER) &perfData ); \ + } \ + }*/ + +#define PERFLOG_AUDIOREND( clocktime, sampletime, psample, bytetime, cbytes ) /*{ \ + PERFINFO_WMI_AVREND perfData; \ + if (NULL != g_pTraceEvent) { \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_AUDIOREND; \ + perfData.data.cycleCounter = _RDTSC(); \ + perfData.data.dshowClock = (clocktime); \ + perfData.data.sampleTime = (sampletime); \ + if (g_perfMasks[AUDIOREND_INDEX] & AUDIOREND_BIT) \ + (*g_pTraceEvent)( g_traceHandle, (PEVENT_TRACE_HEADER) &perfData ); \ + } \ + }*/ + +#define PERFLOG_AUDIORECV(StreamTime,SampleStart,SampleStop,Discontinuity,Duration) \ + if (PerflogEnableFlags & DXMPERF_AUDIORECV) { \ + PERFINFO_WMI_AUDIORECV perfData; \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_AUDIORECV; \ + perfData.data.streamTime = StreamTime; \ + perfData.data.sampleStart = SampleStart; \ + perfData.data.sampleStop = SampleStop; \ + perfData.data.discontinuity = Discontinuity; \ + perfData.data.hwduration = Duration; \ + PerflogTraceEvent((PEVENT_TRACE_HEADER) &perfData); \ + } + +#define PERFLOG_AUDIOSLAVE(MasterClock,SlaveClock,ErrorAccum,LastHighErrorSeen,LastLowErrorSeen) \ + if (PerflogEnableFlags & DXMPERF_AUDIOSLAVE) { \ + PERFINFO_WMI_AUDIOSLAVE perfData; \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_AUDIOSLAVE; \ + perfData.data.masterClock = MasterClock; \ + perfData.data.slaveClock = SlaveClock; \ + perfData.data.errorAccum = ErrorAccum; \ + perfData.data.lastHighErrorSeen = LastHighErrorSeen;\ + perfData.data.lastLowErrorSeen = LastLowErrorSeen; \ + PerflogTraceEvent((PEVENT_TRACE_HEADER) &perfData); \ + } + +#define PERFLOG_AUDIOADDBREAK(IterNextWrite,OffsetNextWrite,IterWrite,OffsetWrite) \ + if (PerflogEnableFlags & DXMPERF_AUDIOBREAK) { \ + PERFINFO_WMI_AUDIOADDBREAK perfData; \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_AUDIOADDBREAK; \ + perfData.data.iterNextWrite = IterNextWrite; \ + perfData.data.offsetNextWrite = OffsetNextWrite; \ + perfData.data.iterWrite = IterWrite; \ + perfData.data.offsetWrite = OffsetWrite; \ + PerflogTraceEvent((PEVENT_TRACE_HEADER) &perfData); \ + } + +#define PERFLOG_VIDEOREND( sampletime, clocktime, psample ) \ + if (PerflogEnableFlags & DXMPERF_VIDEOREND) { \ + PERFINFO_WMI_AVREND perfData; \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_VIDEOREND; \ + perfData.data.cycleCounter = _RDTSC(); \ + perfData.data.dshowClock = (clocktime); \ + perfData.data.sampleTime = (sampletime); \ + PerflogTraceEvent ((PEVENT_TRACE_HEADER) &perfData); \ + } + +#define PERFLOG_AUDIOGLITCH( instance, glitchtype, currenttime, previoustime ) \ + if (PerflogEnableFlags & DXMPERF_AUDIOGLITCH) { \ + PERFINFO_WMI_AUDIOGLITCH perfData; \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_DSOUNDGLITCH; \ + perfData.data.cycleCounter = _RDTSC(); \ + perfData.data.glitchType = (glitchtype); \ + perfData.data.sampleTime = (currenttime); \ + perfData.data.previousTime = (previoustime); \ + perfData.data.instanceId = (instance); \ + PerflogTraceEvent ((PEVENT_TRACE_HEADER) &perfData); \ + } + +#define PERFLOG_FRAMEDROP( sampletime, clocktime, psample, renderer ) /*{ \ + PERFINFO_WMI_FRAMEDROP perfData; \ + if (NULL != g_pTraceEvent) { \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_FRAMEDROP; \ + perfData.data.cycleCounter = _RDTSC(); \ + perfData.data.dshowClock = (clocktime); \ + perfData.data.frameTime = (sampletime); \ + if (g_perfMasks[FRAMEDROP_INDEX] & FRAMEDROP_BIT) \ + (*g_pTraceEvent)( g_traceHandle, (PEVENT_TRACE_HEADER) &perfData ); \ + } \ + }*/ + +/* +#define PERFLOG_AUDIOBREAK( nextwrite, writepos, msecs ) { \ + PERFINFO_WMI_AUDIOBREAK perfData; \ + if (NULL != g_pTraceEvent) { \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_AUDIOBREAK; \ + perfData.data.cycleCounter = _RDTSC(); \ + perfData.data.dshowClock = (writepos); \ + perfData.data.sampleTime = (nextwrite); \ + perfData.data.sampleDuration = (msecs); \ + if (g_perfMasks[AUDIOBREAK_INDEX] & AUDIOBREAK_BIT) \ + (*g_pTraceEvent)( g_traceHandle, (PEVENT_TRACE_HEADER) &perfData ); \ + } \ + } +*/ + +#define PERFLOG_AUDIOBREAK( nextwrite, writepos, msecs ) \ + if (PerflogEnableFlags & AUDIOBREAK_BIT) { \ + PERFINFO_WMI_AUDIOBREAK perfData; \ + memset( &perfData, 0, sizeof( perfData ) ); \ + perfData.header.Size = sizeof( perfData ); \ + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; \ + perfData.header.Guid = GUID_AUDIOBREAK; \ + perfData.data.cycleCounter = _RDTSC(); \ + perfData.data.dshowClock = (writepos); \ + perfData.data.sampleTime = (nextwrite); \ + perfData.data.sampleDuration = (msecs); \ + PerflogTraceEvent ((PEVENT_TRACE_HEADER) &perfData); \ + } \ + + +inline +VOID PERFLOG_STREAMTRACE( + ULONG Level, + ULONG Id, + ULONGLONG DShowClock, + ULONGLONG Data1, + ULONGLONG Data2, + ULONGLONG Data3, + ULONGLONG Data4 + ) +{ + if (Level <= PerflogModuleLevel) + { + PERFINFO_WMI_STREAMTRACE perfData; + memset( &perfData, 0, sizeof( perfData ) ); + perfData.header.Size = sizeof( perfData ); + perfData.header.Flags = WNODE_FLAG_TRACED_GUID; + perfData.header.Guid = GUID_STREAMTRACE; + perfData.data.dshowClock = DShowClock; + perfData.data.id = Id; + perfData.data.data[0] = Data1; + perfData.data.data[1] = Data2; + perfData.data.data[2] = Data3; + perfData.data.data[3] = Data4; + PerflogTraceEvent((PEVENT_TRACE_HEADER) &perfData); + } +} + + +#endif // _DXMPERF_H_ diff --git a/third_party/BaseClasses/fourcc.h b/third_party/BaseClasses/fourcc.h new file mode 100644 index 00000000..19c0fcdb --- /dev/null +++ b/third_party/BaseClasses/fourcc.h @@ -0,0 +1,101 @@ +//------------------------------------------------------------------------------ +// File: FourCC.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// FOURCCMap +// +// provides a mapping between old-style multimedia format DWORDs +// and new-style GUIDs. +// +// A range of 4 billion GUIDs has been allocated to ensure that this +// mapping can be done straightforwardly one-to-one in both directions. +// +// January 95 + + +#ifndef __FOURCC__ +#define __FOURCC__ + + +// Multimedia format types are marked with DWORDs built from four 8-bit +// chars and known as FOURCCs. New multimedia AM_MEDIA_TYPE definitions include +// a subtype GUID. In order to simplify the mapping, GUIDs in the range: +// XXXXXXXX-0000-0010-8000-00AA00389B71 +// are reserved for FOURCCs. + +class FOURCCMap : public GUID +{ + +public: + FOURCCMap(); + FOURCCMap(DWORD Fourcc); + FOURCCMap(const GUID *); + + + DWORD GetFOURCC(void); + void SetFOURCC(DWORD fourcc); + void SetFOURCC(const GUID *); + +private: + void InitGUID(); +}; + +#define GUID_Data2 0 +#define GUID_Data3 0x10 +#define GUID_Data4_1 0xaa000080 +#define GUID_Data4_2 0x719b3800 + +inline void +FOURCCMap::InitGUID() { + Data2 = GUID_Data2; + Data3 = GUID_Data3; + ((DWORD *)Data4)[0] = GUID_Data4_1; + ((DWORD *)Data4)[1] = GUID_Data4_2; +} + +inline +FOURCCMap::FOURCCMap() { + InitGUID(); + SetFOURCC( DWORD(0)); +} + +inline +FOURCCMap::FOURCCMap(DWORD fourcc) +{ + InitGUID(); + SetFOURCC(fourcc); +} + +inline +FOURCCMap::FOURCCMap(const GUID * pGuid) +{ + InitGUID(); + SetFOURCC(pGuid); +} + +inline void +FOURCCMap::SetFOURCC(const GUID * pGuid) +{ + FOURCCMap * p = (FOURCCMap*) pGuid; + SetFOURCC(p->GetFOURCC()); +} + +inline void +FOURCCMap::SetFOURCC(DWORD fourcc) +{ + Data1 = fourcc; +} + +inline DWORD +FOURCCMap::GetFOURCC(void) +{ + return Data1; +} + +#endif /* __FOURCC__ */ + diff --git a/third_party/BaseClasses/measure.h b/third_party/BaseClasses/measure.h new file mode 100644 index 00000000..a71a0753 --- /dev/null +++ b/third_party/BaseClasses/measure.h @@ -0,0 +1,222 @@ +//------------------------------------------------------------------------------ +// File: Measure.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +/* + The idea is to pepper the source code with interesting measurements and + have the last few thousand of these recorded in a circular buffer that + can be post-processed to give interesting numbers. + + WHAT THE LOG LOOKS LIKE: + + Time (sec) Type Delta Incident_Name + 0.055,41 NOTE -. Incident Nine - Another note + 0.055,42 NOTE 0.000,01 Incident Nine - Another note + 0.055,44 NOTE 0.000,02 Incident Nine - Another note + 0.055,45 STOP -. Incident Eight - Also random + 0.055,47 START -. Incident Seven - Random + 0.055,49 NOTE 0.000,05 Incident Nine - Another note + ------- ---------------- + 0.125,60 STOP 0.000,03 Msr_Stop + 0.125,62 START -. Msr_Start + 0.125,63 START -. Incident Two - Start/Stop + 0.125,65 STOP 0.000,03 Msr_Start + 0.125,66 START -. Msr_Stop + 0.125,68 STOP 0.000,05 Incident Two - Start/Stop + 0.125,70 STOP 0.000,04 Msr_Stop + 0.125,72 START -. Msr_Start + 0.125,73 START -. Incident Two - Start/Stop + 0.125,75 STOP 0.000,03 Msr_Start + 0.125,77 START -. Msr_Stop + 0.125,78 STOP 0.000,05 Incident Two - Start/Stop + 0.125,80 STOP 0.000,03 Msr_Stop + 0.125,81 NOTE -. Incident Three - single Note + 0.125,83 START -. Incident Four - Start, no stop + 0.125,85 START -. Incident Five - Single Start/Stop + 0.125,87 STOP 0.000,02 Incident Five - Single Start/Stop + +Number Average StdDev Smallest Largest Incident_Name + 10 0.000,58 0.000,10 0.000,55 0.000,85 Incident One - Note + 50 0.000,05 0.000,00 0.000,05 0.000,05 Incident Two - Start/Stop + 1 -. -. -. -. Incident Three - single Note + 0 -. -. -. -. Incident Four - Start, no stop + 1 0.000,02 -. 0.000,02 0.000,02 Incident Five - Single Start/Stop + 0 -. -. -. -. Incident Six - zero occurrences + 100 0.000,25 0.000,12 0.000,02 0.000,62 Incident Seven - Random + 100 0.000,79 0.000,48 0.000,02 0.001,92 Incident Eight - Also random + 5895 0.000,01 0.000,01 0.000,01 0.000,56 Incident Nine - Another note + 10 0.000,03 0.000,00 0.000,03 0.000,04 Msr_Note + 50 0.000,03 0.000,00 0.000,03 0.000,04 Msr_Start + 50 0.000,04 0.000,03 0.000,03 0.000,31 Msr_Stop + + WHAT IT MEANS: + The log shows what happened and when. Each line shows the time at which + something happened (see WHAT YOU CODE below) what it was that happened + and (if approporate) the time since the corresponding previous event + (that's the delta column). + + The statistics show how many times each event occurred, what the average + delta time was, also the standard deviation, largest and smalles delta. + + WHAT YOU CODE: + + Before anything else executes: - register your ids + + int id1 = Msr_Register("Incident One - Note"); + int id2 = Msr_Register("Incident Two - Start/Stop"); + int id3 = Msr_Register("Incident Three - single Note"); + etc. + + At interesting moments: + + // To measure a repetitive event - e.g. end of bitblt to screen + Msr_Note(Id9); // e.g. "video frame hiting the screen NOW!" + + or + + // To measure an elapsed time e.g. time taken to decode an MPEG B-frame + Msr_Start(Id2); // e.g. "Starting to decode MPEG B-frame" + . . . + MsrStop(Id2); // "Finished MPEG decode" + + At the end: + + HANDLE hFile; + hFile = CreateFile("Perf.log", GENERIC_WRITE, 0, NULL, CREATE_ALWAYS, 0, NULL); + Msr_Dump(hFile); // This writes the log out to the file + CloseHandle(hFile); + + or + + Msr_Dump(NULL); // This writes it to DbgLog((LOG_TRACE,0, ... )); + // but if you are writing it out to the debugger + // then the times are probably all garbage because + // the debugger can make things run awfully slow. + + A given id should be used either for start / stop or Note calls. If Notes + are mixed in with Starts and Stops their statistics will be gibberish. + + If you code the calls in upper case i.e. MSR_START(idMunge); then you get + macros which will turn into nothing unless PERF is defined. + + You can reset the statistical counts for a given id by calling Reset(Id). + They are reset by default at the start. + It logs Reset as a special incident, so you can see it in the log. + + The log is a circular buffer in storage (to try to minimise disk I/O). + It overwrites the oldest entries once full. The statistics include ALL + incidents since the last Reset, whether still visible in the log or not. +*/ + +#ifndef __MEASURE__ +#define __MEASURE__ + +#ifdef PERF +#define MSR_INIT() Msr_Init() +#define MSR_TERMINATE() Msr_Terminate() +#define MSR_REGISTER(a) Msr_Register(a) +#define MSR_RESET(a) Msr_Reset(a) +#define MSR_CONTROL(a) Msr_Control(a) +#define MSR_START(a) Msr_Start(a) +#define MSR_STOP(a) Msr_Stop(a) +#define MSR_NOTE(a) Msr_Note(a) +#define MSR_INTEGER(a,b) Msr_Integer(a,b) +#define MSR_DUMP(a) Msr_Dump(a) +#define MSR_DUMPSTATS(a) Msr_DumpStats(a) +#else +#define MSR_INIT() ((void)0) +#define MSR_TERMINATE() ((void)0) +#define MSR_REGISTER(a) 0 +#define MSR_RESET(a) ((void)0) +#define MSR_CONTROL(a) ((void)0) +#define MSR_START(a) ((void)0) +#define MSR_STOP(a) ((void)0) +#define MSR_NOTE(a) ((void)0) +#define MSR_INTEGER(a,b) ((void)0) +#define MSR_DUMP(a) ((void)0) +#define MSR_DUMPSTATS(a) ((void)0) +#endif + +#ifdef __cplusplus +extern "C" { +#endif + +// This must be called first - (called by the DllEntry) + +void WINAPI Msr_Init(void); + + +// Call this last to clean up (or just let it fall off the end - who cares?) + +void WINAPI Msr_Terminate(void); + + +// Call this to get an Id for an "incident" that you can pass to Start, Stop or Note +// everything that's logged is called an "incident". + +int WINAPI Msr_Register(__in LPTSTR Incident); + + +// Reset the statistical counts for an incident + +void WINAPI Msr_Reset(int Id); + + +// Reset all the counts for all incidents +#define MSR_RESET_ALL 0 +#define MSR_PAUSE 1 +#define MSR_RUN 2 + +void WINAPI Msr_Control(int iAction); + + +// log the start of an operation + +void WINAPI Msr_Start(int Id); + + +// log the end of an operation + +void WINAPI Msr_Stop(int Id); + + +// log a one-off or repetitive operation + +void WINAPI Msr_Note(int Id); + + +// log an integer (on which we can see statistics later) +void WINAPI Msr_Integer(int Id, int n); + + +// print out all the vaialable log (it may have wrapped) and then the statistics. +// When the log wraps you lose log but the statistics are still complete. +// hFIle==NULL => use DbgLog +// otherwise hFile must have come from CreateFile or OpenFile. + +void WINAPI Msr_Dump(HANDLE hFile); + + +// just dump the statistics - never mind the log + +void WINAPI Msr_DumpStats(HANDLE hFile); + +// Type definitions in case you want to declare a pointer to the dump functions +// (makes it a trifle easier to do dynamic linking +// i.e. LoadModule, GetProcAddress and call that) + +// Typedefs so can declare MSR_DUMPPROC *MsrDumpStats; or whatever +typedef void WINAPI MSR_DUMPPROC(HANDLE hFile); +typedef void WINAPI MSR_CONTROLPROC(int iAction); + + +#ifdef __cplusplus +} +#endif + +#endif // __MEASURE__ diff --git a/third_party/BaseClasses/msgthrd.h b/third_party/BaseClasses/msgthrd.h new file mode 100644 index 00000000..45adc01c --- /dev/null +++ b/third_party/BaseClasses/msgthrd.h @@ -0,0 +1,120 @@ +//------------------------------------------------------------------------------ +// File: MsgThrd.h +// +// Desc: DirectShow base classes - provides support for a worker thread +// class to which one can asynchronously post messages. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// Message class - really just a structure. +// +class CMsg { +public: + UINT uMsg; + DWORD dwFlags; + LPVOID lpParam; + CAMEvent *pEvent; + + CMsg(UINT u, DWORD dw, __inout_opt LPVOID lp, __in_opt CAMEvent *pEvnt) + : uMsg(u), dwFlags(dw), lpParam(lp), pEvent(pEvnt) {} + + CMsg() + : uMsg(0), dwFlags(0L), lpParam(NULL), pEvent(NULL) {} +}; + +// This is the actual thread class. It exports all the usual thread control +// functions. The created thread is different from a normal WIN32 thread in +// that it is prompted to perform particaular tasks by responding to messages +// posted to its message queue. +// +class AM_NOVTABLE CMsgThread { +private: + static DWORD WINAPI DefaultThreadProc(__inout LPVOID lpParam); + DWORD m_ThreadId; + HANDLE m_hThread; + +protected: + + // if you want to override GetThreadMsg to block on other things + // as well as this queue, you need access to this + CGenericList m_ThreadQueue; + CCritSec m_Lock; + HANDLE m_hSem; + LONG m_lWaiting; + +public: + CMsgThread() + : m_ThreadId(0), + m_hThread(NULL), + m_lWaiting(0), + m_hSem(NULL), + // make a list with a cache of 5 items + m_ThreadQueue(NAME("MsgThread list"), 5) + { + } + + ~CMsgThread(); + // override this if you want to block on other things as well + // as the message loop + void virtual GetThreadMsg(__out CMsg *msg); + + // override this if you want to do something on thread startup + virtual void OnThreadInit() { + }; + + BOOL CreateThread(); + + BOOL WaitForThreadExit(__out LPDWORD lpdwExitCode) { + if (m_hThread != NULL) { + WaitForSingleObject(m_hThread, INFINITE); + return GetExitCodeThread(m_hThread, lpdwExitCode); + } + return FALSE; + } + + DWORD ResumeThread() { + return ::ResumeThread(m_hThread); + } + + DWORD SuspendThread() { + return ::SuspendThread(m_hThread); + } + + int GetThreadPriority() { + return ::GetThreadPriority(m_hThread); + } + + BOOL SetThreadPriority(int nPriority) { + return ::SetThreadPriority(m_hThread, nPriority); + } + + HANDLE GetThreadHandle() { + return m_hThread; + } + + DWORD GetThreadId() { + return m_ThreadId; + } + + + void PutThreadMsg(UINT uMsg, DWORD dwMsgFlags, + __in_opt LPVOID lpMsgParam, __in_opt CAMEvent *pEvent = NULL) { + CAutoLock lck(&m_Lock); + CMsg* pMsg = new CMsg(uMsg, dwMsgFlags, lpMsgParam, pEvent); + m_ThreadQueue.AddTail(pMsg); + if (m_lWaiting != 0) { + ReleaseSemaphore(m_hSem, m_lWaiting, 0); + m_lWaiting = 0; + } + } + + // This is the function prototype of the function that the client + // supplies. It is always called on the created thread, never on + // the creator thread. + // + virtual LRESULT ThreadMessageProc( + UINT uMsg, DWORD dwFlags, __inout_opt LPVOID lpParam, __in_opt CAMEvent *pEvent) = 0; +}; + diff --git a/third_party/BaseClasses/mtype.cpp b/third_party/BaseClasses/mtype.cpp new file mode 100644 index 00000000..fffbcf79 --- /dev/null +++ b/third_party/BaseClasses/mtype.cpp @@ -0,0 +1,478 @@ +//------------------------------------------------------------------------------ +// File: MType.cpp +// +// Desc: DirectShow base classes - implements a class that holds and +// manages media type information. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// helper class that derived pin objects can use to compare media +// types etc. Has same data members as the struct AM_MEDIA_TYPE defined +// in the streams IDL file, but also has (non-virtual) functions + +#include +#include + +CMediaType::~CMediaType(){ + FreeMediaType(*this); +} + + +CMediaType::CMediaType() +{ + InitMediaType(); +} + + +CMediaType::CMediaType(const GUID * type) +{ + InitMediaType(); + majortype = *type; +} + + +// copy constructor does a deep copy of the format block + +CMediaType::CMediaType(const AM_MEDIA_TYPE& rt, __out_opt HRESULT* phr) +{ + HRESULT hr = CopyMediaType(this, &rt); + if (FAILED(hr) && (NULL != phr)) { + *phr = hr; + } +} + + +CMediaType::CMediaType(const CMediaType& rt, __out_opt HRESULT* phr) +{ + HRESULT hr = CopyMediaType(this, &rt); + if (FAILED(hr) && (NULL != phr)) { + *phr = hr; + } +} + + +// this class inherits publicly from AM_MEDIA_TYPE so the compiler could generate +// the following assignment operator itself, however it could introduce some +// memory conflicts and leaks in the process because the structure contains +// a dynamically allocated block (pbFormat) which it will not copy correctly + +CMediaType& +CMediaType::operator=(const AM_MEDIA_TYPE& rt) +{ + Set(rt); + return *this; +} + +CMediaType& +CMediaType::operator=(const CMediaType& rt) +{ + *this = (AM_MEDIA_TYPE &) rt; + return *this; +} + +BOOL +CMediaType::operator == (const CMediaType& rt) const +{ + // I don't believe we need to check sample size or + // temporal compression flags, since I think these must + // be represented in the type, subtype and format somehow. They + // are pulled out as separate flags so that people who don't understand + // the particular format representation can still see them, but + // they should duplicate information in the format block. + + return ((IsEqualGUID(majortype,rt.majortype) == TRUE) && + (IsEqualGUID(subtype,rt.subtype) == TRUE) && + (IsEqualGUID(formattype,rt.formattype) == TRUE) && + (cbFormat == rt.cbFormat) && + ( (cbFormat == 0) || + pbFormat != NULL && rt.pbFormat != NULL && + (memcmp(pbFormat, rt.pbFormat, cbFormat) == 0))); +} + + +BOOL +CMediaType::operator != (const CMediaType& rt) const +{ + /* Check to see if they are equal */ + + if (*this == rt) { + return FALSE; + } + return TRUE; +} + + +HRESULT +CMediaType::Set(const CMediaType& rt) +{ + return Set((AM_MEDIA_TYPE &) rt); +} + + +HRESULT +CMediaType::Set(const AM_MEDIA_TYPE& rt) +{ + if (&rt != this) { + FreeMediaType(*this); + HRESULT hr = CopyMediaType(this, &rt); + if (FAILED(hr)) { + return E_OUTOFMEMORY; + } + } + + return S_OK; +} + + +BOOL +CMediaType::IsValid() const +{ + return (!IsEqualGUID(majortype,GUID_NULL)); +} + + +void +CMediaType::SetType(const GUID* ptype) +{ + majortype = *ptype; +} + + +void +CMediaType::SetSubtype(const GUID* ptype) +{ + subtype = *ptype; +} + + +ULONG +CMediaType::GetSampleSize() const { + if (IsFixedSize()) { + return lSampleSize; + } else { + return 0; + } +} + + +void +CMediaType::SetSampleSize(ULONG sz) { + if (sz == 0) { + SetVariableSize(); + } else { + bFixedSizeSamples = TRUE; + lSampleSize = sz; + } +} + + +void +CMediaType::SetVariableSize() { + bFixedSizeSamples = FALSE; +} + + +void +CMediaType::SetTemporalCompression(BOOL bCompressed) { + bTemporalCompression = bCompressed; +} + +BOOL +CMediaType::SetFormat(__in_bcount(cb) BYTE * pformat, ULONG cb) +{ + if (NULL == AllocFormatBuffer(cb)) + return(FALSE); + + ASSERT(pbFormat); + memcpy(pbFormat, pformat, cb); + return(TRUE); +} + + +// set the type of the media type format block, this type defines what you +// will actually find in the format pointer. For example FORMAT_VideoInfo or +// FORMAT_WaveFormatEx. In the future this may be an interface pointer to a +// property set. Before sending out media types this should be filled in. + +void +CMediaType::SetFormatType(const GUID *pformattype) +{ + formattype = *pformattype; +} + + +// reset the format buffer + +void CMediaType::ResetFormatBuffer() +{ + if (cbFormat) { + CoTaskMemFree((PVOID)pbFormat); + } + cbFormat = 0; + pbFormat = NULL; +} + + +// allocate length bytes for the format and return a read/write pointer +// If we cannot allocate the new block of memory we return NULL leaving +// the original block of memory untouched (as does ReallocFormatBuffer) + +BYTE* +CMediaType::AllocFormatBuffer(ULONG length) +{ + ASSERT(length); + + // do the types have the same buffer size + + if (cbFormat == length) { + return pbFormat; + } + + // allocate the new format buffer + + BYTE *pNewFormat = (PBYTE)CoTaskMemAlloc(length); + if (pNewFormat == NULL) { + if (length <= cbFormat) return pbFormat; //reuse the old block anyway. + return NULL; + } + + // delete the old format + + if (cbFormat != 0) { + ASSERT(pbFormat); + CoTaskMemFree((PVOID)pbFormat); + } + + cbFormat = length; + pbFormat = pNewFormat; + return pbFormat; +} + + +// reallocate length bytes for the format and return a read/write pointer +// to it. We keep as much information as we can given the new buffer size +// if this fails the original format buffer is left untouched. The caller +// is responsible for ensuring the size of memory required is non zero + +BYTE* +CMediaType::ReallocFormatBuffer(ULONG length) +{ + ASSERT(length); + + // do the types have the same buffer size + + if (cbFormat == length) { + return pbFormat; + } + + // allocate the new format buffer + + BYTE *pNewFormat = (PBYTE)CoTaskMemAlloc(length); + if (pNewFormat == NULL) { + if (length <= cbFormat) return pbFormat; //reuse the old block anyway. + return NULL; + } + + // copy any previous format (or part of if new is smaller) + // delete the old format and replace with the new one + + if (cbFormat != 0) { + ASSERT(pbFormat); + memcpy(pNewFormat,pbFormat,min(length,cbFormat)); + CoTaskMemFree((PVOID)pbFormat); + } + + cbFormat = length; + pbFormat = pNewFormat; + return pNewFormat; +} + +// initialise a media type structure + +void CMediaType::InitMediaType() +{ + ZeroMemory((PVOID)this, sizeof(*this)); + lSampleSize = 1; + bFixedSizeSamples = TRUE; +} + + +// a partially specified media type can be passed to IPin::Connect +// as a constraint on the media type used in the connection. +// the type, subtype or format type can be null. +BOOL +CMediaType::IsPartiallySpecified(void) const +{ + if ((majortype == GUID_NULL) || + (formattype == GUID_NULL)) { + return TRUE; + } else { + return FALSE; + } +} + +BOOL +CMediaType::MatchesPartial(const CMediaType* ppartial) const +{ + if ((ppartial->majortype != GUID_NULL) && + (majortype != ppartial->majortype)) { + return FALSE; + } + if ((ppartial->subtype != GUID_NULL) && + (subtype != ppartial->subtype)) { + return FALSE; + } + + if (ppartial->formattype != GUID_NULL) { + // if the format block is specified then it must match exactly + if (formattype != ppartial->formattype) { + return FALSE; + } + if (cbFormat != ppartial->cbFormat) { + return FALSE; + } + if ((cbFormat != 0) && + (memcmp(pbFormat, ppartial->pbFormat, cbFormat) != 0)) { + return FALSE; + } + } + + return TRUE; + +} + + + +// general purpose function to delete a heap allocated AM_MEDIA_TYPE structure +// which is useful when calling IEnumMediaTypes::Next as the interface +// implementation allocates the structures which you must later delete +// the format block may also be a pointer to an interface to release + +void WINAPI DeleteMediaType(__inout_opt AM_MEDIA_TYPE *pmt) +{ + // allow NULL pointers for coding simplicity + + if (pmt == NULL) { + return; + } + + FreeMediaType(*pmt); + CoTaskMemFree((PVOID)pmt); +} + + +// this also comes in useful when using the IEnumMediaTypes interface so +// that you can copy a media type, you can do nearly the same by creating +// a CMediaType object but as soon as it goes out of scope the destructor +// will delete the memory it allocated (this takes a copy of the memory) + +AM_MEDIA_TYPE * WINAPI CreateMediaType(AM_MEDIA_TYPE const *pSrc) +{ + ASSERT(pSrc); + + // Allocate a block of memory for the media type + + AM_MEDIA_TYPE *pMediaType = + (AM_MEDIA_TYPE *)CoTaskMemAlloc(sizeof(AM_MEDIA_TYPE)); + + if (pMediaType == NULL) { + return NULL; + } + // Copy the variable length format block + + HRESULT hr = CopyMediaType(pMediaType,pSrc); + if (FAILED(hr)) { + CoTaskMemFree((PVOID)pMediaType); + return NULL; + } + + return pMediaType; +} + + +// Copy 1 media type to another + +HRESULT WINAPI CopyMediaType(__out AM_MEDIA_TYPE *pmtTarget, const AM_MEDIA_TYPE *pmtSource) +{ + // We'll leak if we copy onto one that already exists - there's one + // case we can check like that - copying to itself. + ASSERT(pmtSource != pmtTarget); + *pmtTarget = *pmtSource; + if (pmtSource->cbFormat != 0) { + ASSERT(pmtSource->pbFormat != NULL); + pmtTarget->pbFormat = (PBYTE)CoTaskMemAlloc(pmtSource->cbFormat); + if (pmtTarget->pbFormat == NULL) { + pmtTarget->cbFormat = 0; + return E_OUTOFMEMORY; + } else { + CopyMemory((PVOID)pmtTarget->pbFormat, (PVOID)pmtSource->pbFormat, + pmtTarget->cbFormat); + } + } + if (pmtTarget->pUnk != NULL) { + pmtTarget->pUnk->AddRef(); + } + + return S_OK; +} + +// Free an existing media type (ie free resources it holds) + +void WINAPI FreeMediaType(__inout AM_MEDIA_TYPE& mt) +{ + if (mt.cbFormat != 0) { + CoTaskMemFree((PVOID)mt.pbFormat); + + // Strictly unnecessary but tidier + mt.cbFormat = 0; + mt.pbFormat = NULL; + } + if (mt.pUnk != NULL) { + mt.pUnk->Release(); + mt.pUnk = NULL; + } +} + +// Initialize a media type from a WAVEFORMATEX + +STDAPI CreateAudioMediaType( + const WAVEFORMATEX *pwfx, + __out AM_MEDIA_TYPE *pmt, + BOOL bSetFormat +) +{ + pmt->majortype = MEDIATYPE_Audio; + if (pwfx->wFormatTag == WAVE_FORMAT_EXTENSIBLE) { + pmt->subtype = ((PWAVEFORMATEXTENSIBLE)pwfx)->SubFormat; + } else { + pmt->subtype = FOURCCMap(pwfx->wFormatTag); + } + pmt->formattype = FORMAT_WaveFormatEx; + pmt->bFixedSizeSamples = TRUE; + pmt->bTemporalCompression = FALSE; + pmt->lSampleSize = pwfx->nBlockAlign; + pmt->pUnk = NULL; + if (bSetFormat) { + if (pwfx->wFormatTag == WAVE_FORMAT_PCM) { + pmt->cbFormat = sizeof(WAVEFORMATEX); + } else { + pmt->cbFormat = sizeof(WAVEFORMATEX) + pwfx->cbSize; + } + pmt->pbFormat = (PBYTE)CoTaskMemAlloc(pmt->cbFormat); + if (pmt->pbFormat == NULL) { + return E_OUTOFMEMORY; + } + if (pwfx->wFormatTag == WAVE_FORMAT_PCM) { + CopyMemory(pmt->pbFormat, pwfx, sizeof(PCMWAVEFORMAT)); + ((WAVEFORMATEX *)pmt->pbFormat)->cbSize = 0; + } else { + CopyMemory(pmt->pbFormat, pwfx, pmt->cbFormat); + } + } + return S_OK; +} + +// eliminate very many spurious warnings from MS compiler +#pragma warning(disable:4514) diff --git a/third_party/BaseClasses/mtype.h b/third_party/BaseClasses/mtype.h new file mode 100644 index 00000000..fc2fe53e --- /dev/null +++ b/third_party/BaseClasses/mtype.h @@ -0,0 +1,89 @@ +//------------------------------------------------------------------------------ +// File: MtType.h +// +// Desc: DirectShow base classes - defines a class that holds and manages +// media type information. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __MTYPE__ +#define __MTYPE__ + +/* Helper class that derived pin objects can use to compare media + types etc. Has same data members as the struct AM_MEDIA_TYPE defined + in the streams IDL file, but also has (non-virtual) functions */ + +class CMediaType : public _AMMediaType { + +public: + + ~CMediaType(); + CMediaType(); + CMediaType(const GUID * majortype); + CMediaType(const AM_MEDIA_TYPE&, __out_opt HRESULT* phr = NULL); + CMediaType(const CMediaType&, __out_opt HRESULT* phr = NULL); + + CMediaType& operator=(const CMediaType&); + CMediaType& operator=(const AM_MEDIA_TYPE&); + + BOOL operator == (const CMediaType&) const; + BOOL operator != (const CMediaType&) const; + + HRESULT Set(const CMediaType& rt); + HRESULT Set(const AM_MEDIA_TYPE& rt); + + BOOL IsValid() const; + + const GUID *Type() const { return &majortype;} ; + void SetType(const GUID *); + const GUID *Subtype() const { return &subtype;} ; + void SetSubtype(const GUID *); + + BOOL IsFixedSize() const {return bFixedSizeSamples; }; + BOOL IsTemporalCompressed() const {return bTemporalCompression; }; + ULONG GetSampleSize() const; + + void SetSampleSize(ULONG sz); + void SetVariableSize(); + void SetTemporalCompression(BOOL bCompressed); + + // read/write pointer to format - can't change length without + // calling SetFormat, AllocFormatBuffer or ReallocFormatBuffer + + BYTE* Format() const {return pbFormat; }; + ULONG FormatLength() const { return cbFormat; }; + + void SetFormatType(const GUID *); + const GUID *FormatType() const {return &formattype; }; + BOOL SetFormat(__in_bcount(length) BYTE *pFormat, ULONG length); + void ResetFormatBuffer(); + BYTE* AllocFormatBuffer(ULONG length); + BYTE* ReallocFormatBuffer(ULONG length); + + void InitMediaType(); + + BOOL MatchesPartial(const CMediaType* ppartial) const; + BOOL IsPartiallySpecified(void) const; +}; + + +/* General purpose functions to copy and delete a task allocated AM_MEDIA_TYPE + structure which is useful when using the IEnumMediaFormats interface as + the implementation allocates the structures which you must later delete */ + +void WINAPI DeleteMediaType(__inout_opt AM_MEDIA_TYPE *pmt); +AM_MEDIA_TYPE * WINAPI CreateMediaType(AM_MEDIA_TYPE const *pSrc); +HRESULT WINAPI CopyMediaType(__out AM_MEDIA_TYPE *pmtTarget, const AM_MEDIA_TYPE *pmtSource); +void WINAPI FreeMediaType(__inout AM_MEDIA_TYPE& mt); + +// Initialize a media type from a WAVEFORMATEX + +STDAPI CreateAudioMediaType( + const WAVEFORMATEX *pwfx, + __out AM_MEDIA_TYPE *pmt, + BOOL bSetFormat); + +#endif /* __MTYPE__ */ + diff --git a/third_party/BaseClasses/outputq.cpp b/third_party/BaseClasses/outputq.cpp new file mode 100644 index 00000000..d3ab6175 --- /dev/null +++ b/third_party/BaseClasses/outputq.cpp @@ -0,0 +1,801 @@ +//------------------------------------------------------------------------------ +// File: OutputQ.cpp +// +// Desc: DirectShow base classes - implements COutputQueue class used by an +// output pin which may sometimes want to queue output samples on a +// separate thread and sometimes call Receive() directly on the input +// pin. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include + + +// +// COutputQueue Constructor : +// +// Determines if a thread is to be created and creates resources +// +// pInputPin - the downstream input pin we're queueing samples to +// +// phr - changed to a failure code if this function fails +// (otherwise unchanges) +// +// bAuto - Ask pInputPin if it can block in Receive by calling +// its ReceiveCanBlock method and create a thread if +// it can block, otherwise not. +// +// bQueue - if bAuto == FALSE then we create a thread if and only +// if bQueue == TRUE +// +// lBatchSize - work in batches of lBatchSize +// +// bBatchEact - Use exact batch sizes so don't send until the +// batch is full or SendAnyway() is called +// +// lListSize - If we create a thread make the list of samples queued +// to the thread have this size cache +// +// dwPriority - If we create a thread set its priority to this +// +COutputQueue::COutputQueue( + IPin *pInputPin, // Pin to send stuff to + __inout HRESULT *phr, // 'Return code' + BOOL bAuto, // Ask pin if queue or not + BOOL bQueue, // Send through queue + LONG lBatchSize, // Batch + BOOL bBatchExact, // Batch exactly to BatchSize + LONG lListSize, + DWORD dwPriority, + bool bFlushingOpt // flushing optimization + ) : m_lBatchSize(lBatchSize), + m_bBatchExact(bBatchExact && (lBatchSize > 1)), + m_hThread(NULL), + m_hSem(NULL), + m_List(NULL), + m_pPin(pInputPin), + m_ppSamples(NULL), + m_lWaiting(0), + m_evFlushComplete(FALSE, phr), + m_pInputPin(NULL), + m_bSendAnyway(FALSE), + m_nBatched(0), + m_bFlushing(FALSE), + m_bFlushed(TRUE), + m_bFlushingOpt(bFlushingOpt), + m_bTerminate(FALSE), + m_hEventPop(NULL), + m_hr(S_OK) +{ + ASSERT(m_lBatchSize > 0); + + + if (FAILED(*phr)) { + return; + } + + // Check the input pin is OK and cache its IMemInputPin interface + + *phr = pInputPin->QueryInterface(IID_IMemInputPin, (void **)&m_pInputPin); + if (FAILED(*phr)) { + return; + } + + // See if we should ask the downstream pin + + if (bAuto) { + HRESULT hr = m_pInputPin->ReceiveCanBlock(); + if (SUCCEEDED(hr)) { + bQueue = hr == S_OK; + } + } + + // Create our sample batch + + m_ppSamples = new PMEDIASAMPLE[m_lBatchSize]; + if (m_ppSamples == NULL) { + *phr = E_OUTOFMEMORY; + return; + } + + // If we're queueing allocate resources + + if (bQueue) { + DbgLog((LOG_TRACE, 2, TEXT("Creating thread for output pin"))); + m_hSem = CreateSemaphore(NULL, 0, 0x7FFFFFFF, NULL); + if (m_hSem == NULL) { + DWORD dwError = GetLastError(); + *phr = AmHresultFromWin32(dwError); + return; + } + m_List = new CSampleList(NAME("Sample Queue List"), + lListSize, + FALSE // No lock + ); + if (m_List == NULL) { + *phr = E_OUTOFMEMORY; + return; + } + + + DWORD dwThreadId; + m_hThread = CreateThread(NULL, + 0, + InitialThreadProc, + (LPVOID)this, + 0, + &dwThreadId); + if (m_hThread == NULL) { + DWORD dwError = GetLastError(); + *phr = AmHresultFromWin32(dwError); + return; + } + SetThreadPriority(m_hThread, dwPriority); + } else { + DbgLog((LOG_TRACE, 2, TEXT("Calling input pin directly - no thread"))); + } +} + +// +// COutputQueuee Destructor : +// +// Free all resources - +// +// Thread, +// Batched samples +// +COutputQueue::~COutputQueue() +{ + DbgLog((LOG_TRACE, 3, TEXT("COutputQueue::~COutputQueue"))); + /* Free our pointer */ + if (m_pInputPin != NULL) { + m_pInputPin->Release(); + } + if (m_hThread != NULL) { + { + CAutoLock lck(this); + m_bTerminate = TRUE; + m_hr = S_FALSE; + NotifyThread(); + } + DbgWaitForSingleObject(m_hThread); + EXECUTE_ASSERT(CloseHandle(m_hThread)); + + // The thread frees the samples when asked to terminate + + ASSERT(m_List->GetCount() == 0); + delete m_List; + } else { + FreeSamples(); + } + if (m_hSem != NULL) { + EXECUTE_ASSERT(CloseHandle(m_hSem)); + } + delete [] m_ppSamples; +} + +// +// Call the real thread proc as a member function +// +DWORD WINAPI COutputQueue::InitialThreadProc(__in LPVOID pv) +{ + HRESULT hrCoInit = CAMThread::CoInitializeHelper(); + + COutputQueue *pSampleQueue = (COutputQueue *)pv; + DWORD dwReturn = pSampleQueue->ThreadProc(); + + if(hrCoInit == S_OK) { + CoUninitialize(); + } + + return dwReturn; +} + +// +// Thread sending the samples downstream : +// +// When there is nothing to do the thread sets m_lWaiting (while +// holding the critical section) and then waits for m_hSem to be +// set (not holding the critical section) +// +DWORD COutputQueue::ThreadProc() +{ + while (TRUE) { + BOOL bWait = FALSE; + IMediaSample *pSample; + LONG lNumberToSend; // Local copy + NewSegmentPacket* ppacket; + + // + // Get a batch of samples and send it if possible + // In any case exit the loop if there is a control action + // requested + // + { + CAutoLock lck(this); + while (TRUE) { + + if (m_bTerminate) { + FreeSamples(); + return 0; + } + if (m_bFlushing) { + FreeSamples(); + SetEvent(m_evFlushComplete); + } + + // Get a sample off the list + + pSample = m_List->RemoveHead(); + // inform derived class we took something off the queue + if (m_hEventPop) { + //DbgLog((LOG_TRACE,3,TEXT("Queue: Delivered SET EVENT"))); + SetEvent(m_hEventPop); + } + + if (pSample != NULL && + !IsSpecialSample(pSample)) { + + // If its just a regular sample just add it to the batch + // and exit the loop if the batch is full + + m_ppSamples[m_nBatched++] = pSample; + if (m_nBatched == m_lBatchSize) { + break; + } + } else { + + // If there was nothing in the queue and there's nothing + // to send (either because there's nothing or the batch + // isn't full) then prepare to wait + + if (pSample == NULL && + (m_bBatchExact || m_nBatched == 0)) { + + // Tell other thread to set the event when there's + // something do to + + ASSERT(m_lWaiting == 0); + m_lWaiting++; + bWait = TRUE; + } else { + + // We break out of the loop on SEND_PACKET unless + // there's nothing to send + + if (pSample == SEND_PACKET && m_nBatched == 0) { + continue; + } + + if (pSample == NEW_SEGMENT) { + // now we need the parameters - we are + // guaranteed that the next packet contains them + ppacket = (NewSegmentPacket *) m_List->RemoveHead(); + // we took something off the queue + if (m_hEventPop) { + //DbgLog((LOG_TRACE,3,TEXT("Queue: Delivered SET EVENT"))); + SetEvent(m_hEventPop); + } + + ASSERT(ppacket); + } + // EOS_PACKET falls through here and we exit the loop + // In this way it acts like SEND_PACKET + } + break; + } + } + if (!bWait) { + // We look at m_nBatched from the client side so keep + // it up to date inside the critical section + lNumberToSend = m_nBatched; // Local copy + m_nBatched = 0; + } + } + + // Wait for some more data + + if (bWait) { + DbgWaitForSingleObject(m_hSem); + continue; + } + + + + // OK - send it if there's anything to send + // We DON'T check m_bBatchExact here because either we've got + // a full batch or we dropped through because we got + // SEND_PACKET or EOS_PACKET - both of which imply we should + // flush our batch + + if (lNumberToSend != 0) { + long nProcessed; + if (m_hr == S_OK) { + ASSERT(!m_bFlushed); + HRESULT hr = m_pInputPin->ReceiveMultiple(m_ppSamples, + lNumberToSend, + &nProcessed); + /* Don't overwrite a flushing state HRESULT */ + CAutoLock lck(this); + if (m_hr == S_OK) { + m_hr = hr; + } + ASSERT(!m_bFlushed); + } + while (lNumberToSend != 0) { + m_ppSamples[--lNumberToSend]->Release(); + } + if (m_hr != S_OK) { + + // In any case wait for more data - S_OK just + // means there wasn't an error + + DbgLog((LOG_ERROR, 2, TEXT("ReceiveMultiple returned %8.8X"), + m_hr)); + } + } + + // Check for end of stream + + if (pSample == EOS_PACKET) { + + // We don't send even end of stream on if we've previously + // returned something other than S_OK + // This is because in that case the pin which returned + // something other than S_OK should have either sent + // EndOfStream() or notified the filter graph + + if (m_hr == S_OK) { + DbgLog((LOG_TRACE, 2, TEXT("COutputQueue sending EndOfStream()"))); + HRESULT hr = m_pPin->EndOfStream(); + if (FAILED(hr)) { + DbgLog((LOG_ERROR, 2, TEXT("COutputQueue got code 0x%8.8X from EndOfStream()"))); + } + } + } + + // Data from a new source + + if (pSample == RESET_PACKET) { + m_hr = S_OK; + SetEvent(m_evFlushComplete); + } + + if (pSample == NEW_SEGMENT) { + m_pPin->NewSegment(ppacket->tStart, ppacket->tStop, ppacket->dRate); + delete ppacket; + } + } +} + +// Send batched stuff anyway +void COutputQueue::SendAnyway() +{ + if (!IsQueued()) { + + // m_bSendAnyway is a private parameter checked in ReceiveMultiple + + m_bSendAnyway = TRUE; + LONG nProcessed; + ReceiveMultiple(NULL, 0, &nProcessed); + m_bSendAnyway = FALSE; + + } else { + CAutoLock lck(this); + QueueSample(SEND_PACKET); + NotifyThread(); + } +} + +void +COutputQueue::NewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate) +{ + if (!IsQueued()) { + if (S_OK == m_hr) { + if (m_bBatchExact) { + SendAnyway(); + } + m_pPin->NewSegment(tStart, tStop, dRate); + } + } else { + if (m_hr == S_OK) { + // + // we need to queue the new segment to appear in order in the + // data, but we need to pass parameters to it. Rather than + // take the hit of wrapping every single sample so we can tell + // special ones apart, we queue special pointers to indicate + // special packets, and we guarantee (by holding the + // critical section) that the packet immediately following a + // NEW_SEGMENT value is a NewSegmentPacket containing the + // parameters. + NewSegmentPacket * ppack = new NewSegmentPacket; + if (ppack == NULL) { + return; + } + ppack->tStart = tStart; + ppack->tStop = tStop; + ppack->dRate = dRate; + + CAutoLock lck(this); + QueueSample(NEW_SEGMENT); + QueueSample( (IMediaSample*) ppack); + NotifyThread(); + } + } +} + + +// +// End of Stream is queued to output device +// +void COutputQueue::EOS() +{ + CAutoLock lck(this); + if (!IsQueued()) { + if (m_bBatchExact) { + SendAnyway(); + } + if (m_hr == S_OK) { + DbgLog((LOG_TRACE, 2, TEXT("COutputQueue sending EndOfStream()"))); + m_bFlushed = FALSE; + HRESULT hr = m_pPin->EndOfStream(); + if (FAILED(hr)) { + DbgLog((LOG_ERROR, 2, TEXT("COutputQueue got code 0x%8.8X from EndOfStream()"))); + } + } + } else { + if (m_hr == S_OK) { + m_bFlushed = FALSE; + QueueSample(EOS_PACKET); + NotifyThread(); + } + } +} + +// +// Flush all the samples in the queue +// +void COutputQueue::BeginFlush() +{ + if (IsQueued()) { + { + CAutoLock lck(this); + + // block receives -- we assume this is done by the + // filter in which we are a component + + // discard all queued data + + m_bFlushing = TRUE; + + // Make sure we discard all samples from now on + + if (m_hr == S_OK) { + m_hr = S_FALSE; + } + + // Optimize so we don't keep calling downstream all the time + + if (m_bFlushed && m_bFlushingOpt) { + return; + } + + // Make sure we really wait for the flush to complete + m_evFlushComplete.Reset(); + + NotifyThread(); + } + + // pass this downstream + + m_pPin->BeginFlush(); + } else { + // pass downstream first to avoid deadlocks + m_pPin->BeginFlush(); + CAutoLock lck(this); + // discard all queued data + + m_bFlushing = TRUE; + + // Make sure we discard all samples from now on + + if (m_hr == S_OK) { + m_hr = S_FALSE; + } + } + +} + +// +// leave flush mode - pass this downstream +void COutputQueue::EndFlush() +{ + { + CAutoLock lck(this); + ASSERT(m_bFlushing); + if (m_bFlushingOpt && m_bFlushed && IsQueued()) { + m_bFlushing = FALSE; + m_hr = S_OK; + return; + } + } + + // sync with pushing thread -- done in BeginFlush + // ensure no more data to go downstream -- done in BeginFlush + // + // Because we are synching here there is no need to hold the critical + // section (in fact we'd deadlock if we did!) + + if (IsQueued()) { + m_evFlushComplete.Wait(); + } else { + FreeSamples(); + } + + // Be daring - the caller has guaranteed no samples will arrive + // before EndFlush() returns + + m_bFlushing = FALSE; + m_bFlushed = TRUE; + + // call EndFlush on downstream pins + + m_pPin->EndFlush(); + + m_hr = S_OK; +} + +// COutputQueue::QueueSample +// +// private method to Send a sample to the output queue +// The critical section MUST be held when this is called + +void COutputQueue::QueueSample(IMediaSample *pSample) +{ + if (NULL == m_List->AddTail(pSample)) { + if (!IsSpecialSample(pSample)) { + pSample->Release(); + } + } +} + +// +// COutputQueue::Receive() +// +// Send a single sample by the multiple sample route +// (NOTE - this could be optimized if necessary) +// +// On return the sample will have been Release()'d +// + +HRESULT COutputQueue::Receive(IMediaSample *pSample) +{ + LONG nProcessed; + return ReceiveMultiple(&pSample, 1, &nProcessed); +} + +// +// COutputQueue::ReceiveMultiple() +// +// Send a set of samples to the downstream pin +// +// ppSamples - array of samples +// nSamples - how many +// nSamplesProcessed - How many were processed +// +// On return all samples will have been Release()'d +// + +HRESULT COutputQueue::ReceiveMultiple ( + __in_ecount(nSamples) IMediaSample **ppSamples, + long nSamples, + __out long *nSamplesProcessed) +{ + if (nSamples < 0) { + return E_INVALIDARG; + } + + CAutoLock lck(this); + // Either call directly or queue up the samples + + if (!IsQueued()) { + + // If we already had a bad return code then just return + + if (S_OK != m_hr) { + + // If we've never received anything since the last Flush() + // and the sticky return code is not S_OK we must be + // flushing + // ((!A || B) is equivalent to A implies B) + ASSERT(!m_bFlushed || m_bFlushing); + + // We're supposed to Release() them anyway! + *nSamplesProcessed = 0; + for (int i = 0; i < nSamples; i++) { + DbgLog((LOG_TRACE, 3, TEXT("COutputQueue (direct) : Discarding %d samples code 0x%8.8X"), + nSamples, m_hr)); + ppSamples[i]->Release(); + } + + return m_hr; + } + // + // If we're flushing the sticky return code should be S_FALSE + // + ASSERT(!m_bFlushing); + m_bFlushed = FALSE; + + ASSERT(m_nBatched < m_lBatchSize); + ASSERT(m_nBatched == 0 || m_bBatchExact); + + // Loop processing the samples in batches + + LONG iLost = 0; + long iDone = 0; + for (iDone = 0; + iDone < nSamples || (m_nBatched != 0 && m_bSendAnyway); + ) { + +//pragma message (REMIND("Implement threshold scheme")) + ASSERT(m_nBatched < m_lBatchSize); + if (iDone < nSamples) { + m_ppSamples[m_nBatched++] = ppSamples[iDone++]; + } + if (m_nBatched == m_lBatchSize || + nSamples == 0 && (m_bSendAnyway || !m_bBatchExact)) { + LONG nDone; + DbgLog((LOG_TRACE, 4, TEXT("Batching %d samples"), + m_nBatched)); + + if (m_hr == S_OK) { + m_hr = m_pInputPin->ReceiveMultiple(m_ppSamples, + m_nBatched, + &nDone); + } else { + nDone = 0; + } + iLost += m_nBatched - nDone; + for (LONG i = 0; i < m_nBatched; i++) { + m_ppSamples[i]->Release(); + } + m_nBatched = 0; + } + } + *nSamplesProcessed = iDone - iLost; + if (*nSamplesProcessed < 0) { + *nSamplesProcessed = 0; + } + return m_hr; + } else { + /* We're sending to our thread */ + + if (m_hr != S_OK) { + *nSamplesProcessed = 0; + DbgLog((LOG_TRACE, 3, TEXT("COutputQueue (queued) : Discarding %d samples code 0x%8.8X"), + nSamples, m_hr)); + for (int i = 0; i < nSamples; i++) { + ppSamples[i]->Release(); + } + return m_hr; + } + m_bFlushed = FALSE; + for (long i = 0; i < nSamples; i++) { + QueueSample(ppSamples[i]); + } + *nSamplesProcessed = nSamples; + if (!m_bBatchExact || + m_nBatched + m_List->GetCount() >= m_lBatchSize) { + NotifyThread(); + } + return S_OK; + } +} + +// Get ready for new data - cancels sticky m_hr +void COutputQueue::Reset() +{ + if (!IsQueued()) { + m_hr = S_OK; + } else { + { + CAutoLock lck(this); + QueueSample(RESET_PACKET); + NotifyThread(); + } + m_evFlushComplete.Wait(); + } +} + +// Remove and Release() all queued and Batched samples +void COutputQueue::FreeSamples() +{ + CAutoLock lck(this); + if (IsQueued()) { + while (TRUE) { + IMediaSample *pSample = m_List->RemoveHead(); + // inform derived class we took something off the queue + if (m_hEventPop) { + //DbgLog((LOG_TRACE,3,TEXT("Queue: Delivered SET EVENT"))); + SetEvent(m_hEventPop); + } + + if (pSample == NULL) { + break; + } + if (!IsSpecialSample(pSample)) { + pSample->Release(); + } else { + if (pSample == NEW_SEGMENT) { + // Free NEW_SEGMENT packet + NewSegmentPacket *ppacket = + (NewSegmentPacket *) m_List->RemoveHead(); + // inform derived class we took something off the queue + if (m_hEventPop) { + //DbgLog((LOG_TRACE,3,TEXT("Queue: Delivered SET EVENT"))); + SetEvent(m_hEventPop); + } + + ASSERT(ppacket != NULL); + delete ppacket; + } + } + } + } + for (int i = 0; i < m_nBatched; i++) { + m_ppSamples[i]->Release(); + } + m_nBatched = 0; +} + +// Notify the thread if there is something to do +// +// The critical section MUST be held when this is called +void COutputQueue::NotifyThread() +{ + // Optimize - no need to signal if it's not waiting + ASSERT(IsQueued()); + if (m_lWaiting) { + ReleaseSemaphore(m_hSem, m_lWaiting, NULL); + m_lWaiting = 0; + } +} + +// See if there's any work to do +// Returns +// TRUE if there is nothing on the queue and nothing in the batch +// and all data has been sent +// FALSE otherwise +// +BOOL COutputQueue::IsIdle() +{ + CAutoLock lck(this); + + // We're idle if + // there is no thread (!IsQueued()) OR + // the thread is waiting for more work (m_lWaiting != 0) + // AND + // there's nothing in the current batch (m_nBatched == 0) + + if (IsQueued() && m_lWaiting == 0 || m_nBatched != 0) { + return FALSE; + } else { + + // If we're idle it shouldn't be possible for there + // to be anything on the work queue + + ASSERT(!IsQueued() || m_List->GetCount() == 0); + return TRUE; + } +} + + +void COutputQueue::SetPopEvent(HANDLE hEvent) +{ + m_hEventPop = hEvent; +} diff --git a/third_party/BaseClasses/outputq.h b/third_party/BaseClasses/outputq.h new file mode 100644 index 00000000..db3d4243 --- /dev/null +++ b/third_party/BaseClasses/outputq.h @@ -0,0 +1,137 @@ +//------------------------------------------------------------------------------ +// File: OutputQ.h +// +// Desc: DirectShow base classes - defines the COutputQueue class, which +// makes a queue of samples and sends them to an output pin. The +// class will optionally send the samples to the pin directly. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +typedef CGenericList CSampleList; + +class COutputQueue : public CCritSec +{ +public: + // Constructor + COutputQueue(IPin *pInputPin, // Pin to send stuff to + __inout HRESULT *phr, // 'Return code' + BOOL bAuto = TRUE, // Ask pin if blocks + BOOL bQueue = TRUE, // Send through queue (ignored if + // bAuto set) + LONG lBatchSize = 1, // Batch + BOOL bBatchExact = FALSE,// Batch exactly to BatchSize + LONG lListSize = // Likely number in the list + DEFAULTCACHE, + DWORD dwPriority = // Priority of thread to create + THREAD_PRIORITY_NORMAL, + bool bFlushingOpt = false // flushing optimization + ); + ~COutputQueue(); + + // enter flush state - discard all data + void BeginFlush(); // Begin flushing samples + + // re-enable receives (pass this downstream) + void EndFlush(); // Complete flush of samples - downstream + // pin guaranteed not to block at this stage + + void EOS(); // Call this on End of stream + + void SendAnyway(); // Send batched samples anyway (if bBatchExact set) + + void NewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate); + + HRESULT Receive(IMediaSample *pSample); + + // do something with these media samples + HRESULT ReceiveMultiple ( + __in_ecount(nSamples) IMediaSample **pSamples, + long nSamples, + __out long *nSamplesProcessed); + + void Reset(); // Reset m_hr ready for more data + + // See if its idle or not + BOOL IsIdle(); + + // give the class an event to fire after everything removed from the queue + void SetPopEvent(HANDLE hEvent); + +protected: + static DWORD WINAPI InitialThreadProc(__in LPVOID pv); + DWORD ThreadProc(); + BOOL IsQueued() + { + return m_List != NULL; + }; + + // The critical section MUST be held when this is called + void QueueSample(IMediaSample *pSample); + + BOOL IsSpecialSample(IMediaSample *pSample) + { + return (DWORD_PTR)pSample > (DWORD_PTR)(LONG_PTR)(-16); + }; + + // Remove and Release() batched and queued samples + void FreeSamples(); + + // Notify the thread there is something to do + void NotifyThread(); + + +protected: + // Queue 'messages' + #define SEND_PACKET ((IMediaSample *)(LONG_PTR)(-2)) // Send batch + #define EOS_PACKET ((IMediaSample *)(LONG_PTR)(-3)) // End of stream + #define RESET_PACKET ((IMediaSample *)(LONG_PTR)(-4)) // Reset m_hr + #define NEW_SEGMENT ((IMediaSample *)(LONG_PTR)(-5)) // send NewSegment + + // new segment packet is always followed by one of these + struct NewSegmentPacket { + REFERENCE_TIME tStart; + REFERENCE_TIME tStop; + double dRate; + }; + + // Remember input stuff + IPin * const m_pPin; + IMemInputPin * m_pInputPin; + BOOL const m_bBatchExact; + LONG const m_lBatchSize; + + CSampleList * m_List; + HANDLE m_hSem; + CAMEvent m_evFlushComplete; + HANDLE m_hThread; + __field_ecount_opt(m_lBatchSize) IMediaSample ** m_ppSamples; + __range(0, m_lBatchSize) LONG m_nBatched; + + // Wait optimization + LONG m_lWaiting; + // Flush synchronization + BOOL m_bFlushing; + + // flushing optimization. some downstream filters have trouble + // with the queue's flushing optimization. other rely on it + BOOL m_bFlushed; + bool m_bFlushingOpt; + + // Terminate now + BOOL m_bTerminate; + + // Send anyway flag for batching + BOOL m_bSendAnyway; + + // Deferred 'return code' + HRESULT volatile m_hr; + + // an event that can be fired after every deliver + HANDLE m_hEventPop; +}; + diff --git a/third_party/BaseClasses/perflog.cpp b/third_party/BaseClasses/perflog.cpp new file mode 100644 index 00000000..e6425387 --- /dev/null +++ b/third_party/BaseClasses/perflog.cpp @@ -0,0 +1,347 @@ +//------------------------------------------------------------------------------ +// File: perflog.cpp +// +// Desc: Macros for DirectShow performance logging. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + +#pragma warning (disable:4201) + +#include +#include +#include +#include +#include +#include +#include +#include "perflog.h" + +// +// Local function prototypes. +// + +ULONG +WINAPI +PerflogCallback ( + WMIDPREQUESTCODE RequestCode, + __in PVOID Context, + __out ULONG* BufferSize, + __in PVOID Buffer + ); + +// +// Event tracing function pointers. +// We have to do this to run on down-level platforms. +// + +#ifdef UNICODE + +ULONG +(__stdcall * _RegisterTraceGuids) ( + __in IN WMIDPREQUEST RequestAddress, + __in IN PVOID RequestContext, + IN LPCGUID ControlGuid, + IN ULONG GuidCount, + __in IN PTRACE_GUID_REGISTRATION TraceGuidReg, + IN LPCWSTR MofImagePath, + IN LPCWSTR MofResourceName, + OUT PTRACEHANDLE RegistrationHandle + ); + +#define REGISTERTRACEGUIDS_NAME "RegisterTraceGuidsW" + +#else + +ULONG +(__stdcall * _RegisterTraceGuids) ( + __in IN WMIDPREQUEST RequestAddress, + __in IN PVOID RequestContext, + IN LPCGUID ControlGuid, + IN ULONG GuidCount, + __in IN PTRACE_GUID_REGISTRATION TraceGuidReg, + IN LPCSTR MofImagePath, + IN LPCSTR MofResourceName, + __out OUT PTRACEHANDLE RegistrationHandle + ); + +#define REGISTERTRACEGUIDS_NAME "RegisterTraceGuidsA" + +#endif + +ULONG +(__stdcall * _UnregisterTraceGuids) ( + TRACEHANDLE RegistrationHandle + ); + +TRACEHANDLE +(__stdcall * _GetTraceLoggerHandle) ( + __in PVOID Buffer + ); + +UCHAR +(__stdcall * _GetTraceEnableLevel) ( + TRACEHANDLE TraceHandle + ); + +ULONG +(__stdcall * _GetTraceEnableFlags) ( + TRACEHANDLE TraceHandle + ); + +ULONG +(__stdcall * _TraceEvent) ( + TRACEHANDLE TraceHandle, + __in PEVENT_TRACE_HEADER EventTrace + ); + +HINSTANCE _Advapi32; + +// +// Global variables. +// + +BOOL EventTracingAvailable=FALSE; +ULONG PerflogEnableFlags; +UCHAR PerflogEnableLevel; +ULONG PerflogModuleLevel = 0; +void (*OnStateChanged)(void); +TRACEHANDLE PerflogTraceHandle=NULL; +TRACEHANDLE PerflogRegHandle; + +// The Win32 wsprintf() function writes a maximum of 1024 characters to it's output buffer. +// See the documentation for wsprintf()'s lpOut parameter for more information. +const INT iDEBUGINFO = 1024; // Used to format strings + +// +// This routine initializes performance logging. +// It should be called from DllMain(). +// + + +VOID +PerflogReadModuleLevel( + HINSTANCE hInstance + ) +{ + LONG lReturn; // Create key return value + TCHAR szInfo[iDEBUGINFO]; // Constructs key names + TCHAR szFullName[iDEBUGINFO]; // Load the full path and module name + HKEY hModuleKey; // Module key handle + LPTSTR pName; // Searches from the end for a backslash + DWORD dwKeySize, dwKeyType, dwKeyValue; + + DWORD dwSize = GetModuleFileName( + (hInstance ? hInstance : GetModuleHandle( NULL )), + szFullName, + iDEBUGINFO ); + + if (0 == dwSize || iDEBUGINFO == dwSize) { + return; + } + + pName = _tcsrchr(szFullName,'\\'); + if (pName == NULL) { + pName = szFullName; + } else { + pName++; + } + + /* Construct the base key name */ + (void)StringCchPrintf(szInfo,NUMELMS(szInfo),TEXT("SOFTWARE\\Debug\\%s"),pName); + + /* Open the key for this module */ + lReturn = + RegOpenKeyEx( + HKEY_LOCAL_MACHINE, // Handle of an open key + szInfo, // Address of subkey name + (DWORD) 0, // Reserved value + KEY_QUERY_VALUE, // Desired security access + &hModuleKey ); // Opened handle buffer + + if (lReturn != ERROR_SUCCESS) { + return; + } + + dwKeySize = sizeof(DWORD); + lReturn = RegQueryValueEx( + hModuleKey, // Handle to an open key + TEXT("PERFLOG"), + NULL, // Reserved field + &dwKeyType, // Returns the field type + (LPBYTE) &dwKeyValue, // Returns the field's value + &dwKeySize ); // Number of bytes transferred + + if ((lReturn == ERROR_SUCCESS) && (dwKeyType == REG_DWORD)) + { + PerflogModuleLevel = dwKeyValue; + } + + RegCloseKey(hModuleKey); +} + +BOOL PerflogInitIfEnabled( + IN HINSTANCE hInstance, + __in IN PPERFLOG_LOGGING_PARAMS LogParams + ) +{ + PerflogReadModuleLevel( hInstance ); + if (PerflogModuleLevel) + { + return PerflogInitialize( LogParams ); + } + else + { + return FALSE; + } +} + +BOOL +PerflogInitialize ( + __in IN PPERFLOG_LOGGING_PARAMS LogParams + ) +{ + ULONG status; + + // + // If we're running on a recent-enough platform, this will get + // pointers to the event tracing routines. + // + + _Advapi32 = GetModuleHandle (_T("ADVAPI32.DLL")); + if (_Advapi32 == NULL) { + return FALSE; + } + + *((FARPROC*) &_RegisterTraceGuids) = GetProcAddress (_Advapi32, REGISTERTRACEGUIDS_NAME); + *((FARPROC*) &_UnregisterTraceGuids) = GetProcAddress (_Advapi32, "UnregisterTraceGuids"); + *((FARPROC*) &_GetTraceLoggerHandle) = GetProcAddress (_Advapi32, "GetTraceLoggerHandle"); + *((FARPROC*) &_GetTraceEnableLevel) = GetProcAddress (_Advapi32, "GetTraceEnableLevel"); + *((FARPROC*) &_GetTraceEnableFlags) = GetProcAddress (_Advapi32, "GetTraceEnableFlags"); + *((FARPROC*) &_TraceEvent) = GetProcAddress (_Advapi32, "TraceEvent"); + + if (_RegisterTraceGuids == NULL || + _UnregisterTraceGuids == NULL || + _GetTraceEnableLevel == NULL || + _GetTraceEnableFlags == NULL || + _TraceEvent == NULL) { + + return FALSE; + } + + EventTracingAvailable = TRUE; + + OnStateChanged = LogParams->OnStateChanged; + + // + // Register our GUIDs. + // + + status = _RegisterTraceGuids (PerflogCallback, + LogParams, + &LogParams->ControlGuid, + LogParams->NumberOfTraceGuids, + LogParams->TraceGuids, + NULL, + NULL, + &PerflogRegHandle); + + return (status == ERROR_SUCCESS); +} + +// +// This routine shuts down performance logging. +// + +VOID +PerflogShutdown ( + VOID + ) +{ + if (!EventTracingAvailable) { + return; + } + + _UnregisterTraceGuids (PerflogRegHandle); + PerflogRegHandle = NULL; + PerflogTraceHandle = NULL; +} + +// +// Event tracing callback routine. +// It's called when controllers call event tracing control functions. +// + +ULONG +WINAPI +PerflogCallback ( + WMIDPREQUESTCODE RequestCode, + __in PVOID Context, + __out ULONG* BufferSize, + __in PVOID Buffer + ) +{ + ULONG status; + + UNREFERENCED_PARAMETER (Context); + + ASSERT (EventTracingAvailable); + + status = ERROR_SUCCESS; + + switch (RequestCode) { + + case WMI_ENABLE_EVENTS: + PerflogTraceHandle = _GetTraceLoggerHandle (Buffer); + PerflogEnableFlags = _GetTraceEnableFlags (PerflogTraceHandle); + PerflogEnableLevel = _GetTraceEnableLevel (PerflogTraceHandle); + break; + + case WMI_DISABLE_EVENTS: + PerflogTraceHandle = NULL; + PerflogEnableFlags = 0; + PerflogEnableLevel = 0; + break; + + default: + status = ERROR_INVALID_PARAMETER; + } + + if (OnStateChanged != NULL) { + OnStateChanged(); + } + + *BufferSize = 0; + return status; +} + +// +// Logging routine. +// + +VOID +PerflogTraceEvent ( + __in PEVENT_TRACE_HEADER Event + ) +{ + if (!EventTracingAvailable) { + return; + } + + _TraceEvent (PerflogTraceHandle, Event); +} + +VOID +PerflogTraceEventLevel( + ULONG Level, + __in PEVENT_TRACE_HEADER Event + ) +{ + if ((!EventTracingAvailable) || (Level <= PerflogModuleLevel)) { + return; + } + + _TraceEvent (PerflogTraceHandle, Event); +} + + diff --git a/third_party/BaseClasses/perflog.h b/third_party/BaseClasses/perflog.h new file mode 100644 index 00000000..503a1304 --- /dev/null +++ b/third_party/BaseClasses/perflog.h @@ -0,0 +1,56 @@ +//------------------------------------------------------------------------------ +// File: perflog.h +// +// Desc: Performance logging framework. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + +typedef struct _PERFLOG_LOGGING_PARAMS { + GUID ControlGuid; + void (*OnStateChanged)(void); + ULONG NumberOfTraceGuids; + TRACE_GUID_REGISTRATION TraceGuids[ANYSIZE_ARRAY]; +} PERFLOG_LOGGING_PARAMS, *PPERFLOG_LOGGING_PARAMS; + +BOOL +PerflogInitIfEnabled( + IN HINSTANCE hInstance, + __in PPERFLOG_LOGGING_PARAMS LogParams + ); + +BOOL +PerflogInitialize ( + __in PPERFLOG_LOGGING_PARAMS LogParams + ); + +VOID +PerflogShutdown ( + VOID + ); + +VOID +PerflogTraceEvent ( + __in PEVENT_TRACE_HEADER Event + ); + +extern ULONG PerflogEnableFlags; +extern UCHAR PerflogEnableLevel; +extern ULONG PerflogModuleLevel; +extern TRACEHANDLE PerflogTraceHandle; +extern TRACEHANDLE PerflogRegHandle; + +#define PerflogTracingEnabled() (PerflogTraceHandle != 0) + +#define PerflogEvent( _x_ ) PerflogTraceEventLevel _x_ + +VOID +PerflogTraceEventLevel( + ULONG Level, + __in PEVENT_TRACE_HEADER Event + ); + +VOID +PerflogTraceEvent ( + __in PEVENT_TRACE_HEADER Event + ); diff --git a/third_party/BaseClasses/perfstruct.h b/third_party/BaseClasses/perfstruct.h new file mode 100644 index 00000000..9c67b738 --- /dev/null +++ b/third_party/BaseClasses/perfstruct.h @@ -0,0 +1,194 @@ +//------------------------------------------------------------------------------ +// File: PerfStruct.h +// +// Desc: Structures for DirectShow performance logging. +// +// Copyright (c) 2000-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef _PERFSTRUCT_H_ +#define _PERFSTRUCT_H_ + +#include +#include + +// {28CF047A-2437-4b24-B653-B9446A419A69} +DEFINE_GUID(GUID_DSHOW_CTL, +0x28cf047a, 0x2437, 0x4b24, 0xb6, 0x53, 0xb9, 0x44, 0x6a, 0x41, 0x9a, 0x69); + +// {D0DA7AD6-AE80-4de5-AAFC-C126711E7593} +DEFINE_GUID(GUID_VIDEOREND, +0xd0da7ad6, 0xae80, 0x4de5, 0xaa, 0xfc, 0xc1, 0x26, 0x71, 0x1e, 0x75, 0x93); + +// {DC70AC3E-93E5-48db-88AB-E42064EC276A} +DEFINE_GUID(GUID_DSOUNDGLITCH, +0xdc70ac3e, 0x93e5, 0x48db, 0x88, 0xab, 0xe4, 0x20, 0x64, 0xec, 0x27, 0x6a); + +// {3d7e7d93-2fc8-4a07-a719-e0922ff2899} +DEFINE_GUID(GUID_STREAMTRACE, +0x3d7e7d93, 0x2fc8, 0x4a07, 0xa7, 0x19, 0xe0, 0x92, 0x2f, 0xf2, 0x89, 0x9e); + +// AZFIX: the following GUIDs aren't useful right now. + +// {3C33F7F5-EE54-493c-BA25-1656539C05AC} +DEFINE_GUID(GUID_GETTIME, +0x3c33f7f5, 0xee54, 0x493c, 0xba, 0x25, 0x16, 0x56, 0x53, 0x9c, 0x5, 0xac); + +// {CC44B44D-8169-4952-9E4A-A4E13295E492} +DEFINE_GUID(GUID_AUDIOREND, +0xcc44b44d, 0x8169, 0x4952, 0x9e, 0x4a, 0xa4, 0xe1, 0x32, 0x95, 0xe4, 0x92); + +// {775D19BF-4D8B-4de6-8DC9-66BAC7B310A2} +DEFINE_GUID(GUID_FRAMEDROP, +0x775d19bf, 0x4d8b, 0x4de6, 0x8d, 0xc9, 0x66, 0xba, 0xc7, 0xb3, 0x10, 0xa2); + +// {56D29065-EFBE-42dc-8C29-E325DC9C27D5} +DEFINE_GUID(GUID_AUDIOBREAK, +0x56d29065, 0xefbe, 0x42dc, 0x8c, 0x29, 0xe3, 0x25, 0xdc, 0x9c, 0x27, 0xd5); + +// {E1E6EA87-95A8-497e-BFBA-0295AEBCC707} +DEFINE_GUID(GUID_AUDIORECV, +0xe1e6ea87, 0x95a8, 0x497e, 0xbf, 0xba, 0x2, 0x95, 0xae, 0xbc, 0xc7, 0x7); + +// {10F7768A-B1E7-4242-AD90-A2D44683D9F0} +DEFINE_GUID(GUID_AUDIOSLAVE, +0x10f7768a, 0xb1e7, 0x4242, 0xad, 0x90, 0xa2, 0xd4, 0x46, 0x83, 0xd9, 0xf0); + +// {8983803D-691A-49bc-8FF6-962A39C0198F} +DEFINE_GUID(GUID_AUDIOADDBREAK, +0x8983803d, 0x691a, 0x49bc, 0x8f, 0xf6, 0x96, 0x2a, 0x39, 0xc0, 0x19, 0x8f); + +#define GLITCHTYPE_DSOUNDFIRSTGOOD 0 +#define GLITCHTYPE_DSOUNDFIRSTBAD 1 + +typedef struct PERFINFO_DSHOW_AUDIOGLITCH { + ULONGLONG cycleCounter; + DWORD glitchType; + LONGLONG sampleTime; + LONGLONG previousTime; + ULONG_PTR instanceId; +} PERFINFO_DSHOW_AUDIOGLITCH, *PPERFINFO_DSHOW_AUDIOGLITCH; + +typedef struct PERFINFO_WMI_AUDIOGLITCH { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_AUDIOGLITCH data; +} PERFINFO_WMI_AUDIO_GLITCH, *PPERFINFO_WMI_AUDIOGLITCH; + +typedef struct PERFINFO_DSHOW_GETTIME { + ULONGLONG cycleCounter; + ULONGLONG dshowClock; +} PERFINFO_DSHOW_GETTIME, *PPERFINFO_DSHOW_GETTIME; + +typedef struct PERFINFO_WMI_GETTIME { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_GETTIME data; +} PERFINFO_WMI_GETTIME, *PPERFINFO_WMI_GETTIME; + +typedef struct PERFINFO_DSHOW_AVREND { + ULONGLONG cycleCounter; + ULONGLONG dshowClock; + ULONGLONG sampleTime; +} PERFINFO_DSHOW_AVREND, *PPERFINFO_DSHOW_AVREND; + +typedef struct PERFINFO_WMI_AVREND { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_AVREND data; +} PERFINFO_WMI_AVREND, *PPERFINFO_WMI_AVREND; + +typedef struct PERFINFO_DSHOW_AUDIOBREAK { + ULONGLONG cycleCounter; + ULONGLONG dshowClock; + ULONGLONG sampleTime; + ULONGLONG sampleDuration; +} PERFINFO_DSHOW_AUDIOBREAK, *PPERFINFO_DSHOW_AUDIOBREAK; + +typedef struct PERFINFO_WMI_AUDIOBREAK { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_AUDIOBREAK data; +} PERFINFO_WMI_AUDIOBREAK, *PPERFINFO_WMI_AUDIOBREAK; + +typedef struct PERFINFO_DSHOW_FRAMEDROP { + ULONGLONG cycleCounter; + ULONGLONG dshowClock; + ULONGLONG frameTime; +} PERFINFO_DSHOW_FRAMEDROP, *PPERFINFO_DSHOW_FRAMEDROP; + +typedef struct PERFINFO_WMI_FRAMEDROP { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_FRAMEDROP data; +} PERFINFO_WMI_FRAMEDROP, *PPERFINFO_WMI_FRAMEDROP; + +#define PERFINFO_STREAMTRACE_MPEG2DEMUX_PTS_TRANSLATION 1 +#define PERFINFO_STREAMTRACE_MPEG2DEMUX_SAMPLE_RECEIVED 2 +#define PERFINFO_STREAMTRACE_VMR_BEGIN_ADVISE 3 +#define PERFINFO_STREAMTRACE_VMR_END_ADVISE 4 +#define PERFINFO_STREAMTRACE_VMR_RECEIVE 5 +#define PERFINFO_STREAMTRACE_VMR_BEGIN_DEINTERLACE 6 +#define PERFINFO_STREAMTRACE_VMR_END_DEINTERLACE 7 +#define PERFINFO_STREAMTRACE_VMR_BEGIN_DECODE 8 +#define PERFINFO_STREAMTRACE_VMR_END_DECODE 9 +#define PERFINFO_STREAMTRACE_VMR_DROPPED_FRAME 10 +#define PERFINFO_STREAMTRACE_ENCDEC_DTFILTERINPUT 11 +#define PERFINFO_STREAMTRACE_ENCDEC_DTFILTEROUTPUT 12 +#define PERFINFO_STREAMTRACE_ENCDEC_ETFILTERINPUT 13 +#define PERFINFO_STREAMTRACE_ENCDEC_ETFILTEROUTPUT 14 +#define PERFINFO_STREAMTRACE_ENCDEC_XDSCODECINPUT 15 +#define PERFINFO_STREAMTRACE_SBE_DVRANALYSISINPUT_RECEIVE 16 +#define PERFINFO_STREAMTRACE_SBE_DVRANALYSISINPUT_DELIVER 17 +#define PERFINFO_STREAMTRACE_SBE_DVRINPUTPIN_RECEIVE 18 +#define PERFINFO_STREAMTRACE_SBE_DVROUTPUTPIN_RECEIVE 19 +#define PERFINFO_STREAMTRACE_VMR_RENDER_TIME 20 + +typedef struct _PERFINFO_DSHOW_STREAMTRACE { + ULONG id; + ULONG reserved; + ULONGLONG dshowClock; + ULONGLONG data[ 4 ]; +} PERFINFO_DSHOW_STREAMTRACE, *PPERFINFO_DSHOW_STREAMTRACE; + +typedef struct _PERFINFO_WMI_STREAMTRACE { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_STREAMTRACE data; +} PERFINFO_WMI_STREAMTRACE, *PPERFINFO_WMI_STREAMTRACE; + + +typedef struct PERFINFO_DSHOW_AUDIORECV { + LONGLONG streamTime ; + LONGLONG sampleStart ; + LONGLONG sampleStop ; + LONGLONG hwduration ; + BOOL discontinuity ; +} PERFINFO_DSHOW_AUDIORECV, *PPERFINFO_DSHOW_AUDIORECV; + +typedef struct PERFINFO_WMI_AUDIORECV { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_AUDIORECV data; +} PERFINFO_WMI_AUDIORECV, *PPERFINFO_WMI_AUDIORECV; + +typedef struct PERFINFO_DSHOW_AUDIOSLAVE { + LONGLONG masterClock ; + LONGLONG slaveClock ; + LONGLONG errorAccum ; + LONGLONG lastHighErrorSeen ; + LONGLONG lastLowErrorSeen ; +} PERFINFO_DSHOW_AUDIOSLAVE, *PPERFINFO_DSHOW_AUDIOSLAVE; + +typedef struct PERFINFO_WMI_AUDIOSLAVE { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_AUDIOSLAVE data; +} PERFINFO_WMI_AUDIOSLAVE, *PPERFINFO_WMI_AUDIOSLAVE; + +typedef struct PERFINFO_DSHOW_AUDIOADDBREAK { + DWORD iterNextWrite ; + DWORD offsetNextWrite ; + DWORD iterWrite ; + DWORD offsetWrite ; +} PERFINFO_DSHOW_AUDIOADDBREAK, *PPERFINFO_DSHOW_AUDIOADDBREAK; + +typedef struct PERFINFO_WMI_AUDIOADDBREAK { + EVENT_TRACE_HEADER header; + PERFINFO_DSHOW_AUDIOADDBREAK data; +} PERFINFO_WMI_AUDIOADDBREAK, *PPERFINFO_WMI_AUDIOADDBREAK; + +#endif // _PREFSTRUCT_H_ diff --git a/third_party/BaseClasses/pstream.cpp b/third_party/BaseClasses/pstream.cpp new file mode 100644 index 00000000..d20171f5 --- /dev/null +++ b/third_party/BaseClasses/pstream.cpp @@ -0,0 +1,197 @@ +//------------------------------------------------------------------------------ +// File: PStream.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include + +#ifdef PERF +#include +#endif +// #include "pstream.h" in streams.h + +// +// Constructor +// +CPersistStream::CPersistStream(IUnknown *punk, __inout HRESULT *phr) + : mPS_fDirty(FALSE) +{ + mPS_dwFileVersion = GetSoftwareVersion(); +} + + +// +// Destructor +// +CPersistStream::~CPersistStream() { + // Nothing to do +} + +#if 0 +SAMPLE CODE TO COPY - not active at the moment + +// +// NonDelegatingQueryInterface +// +// This object supports IPersist & IPersistStream +STDMETHODIMP CPersistStream::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + if (riid == IID_IPersist) { + return GetInterface((IPersist *) this, ppv); // ??? + } + else if (riid == IID_IPersistStream) { + return GetInterface((IPersistStream *) this, ppv); + } + else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } +} +#endif + + +// +// WriteToStream +// +// Writes to the stream (default action is to write nothing) +HRESULT CPersistStream::WriteToStream(IStream *pStream) +{ + // You can override this to do things like + // hr = pStream->Write(MyStructure, sizeof(MyStructure), NULL); + + return NOERROR; +} + + + +HRESULT CPersistStream::ReadFromStream(IStream * pStream) +{ + // You can override this to do things like + // hr = pStream->Read(MyStructure, sizeof(MyStructure), NULL); + + return NOERROR; +} + + +// +// Load +// +// Load all the data from the given stream +STDMETHODIMP CPersistStream::Load(LPSTREAM pStm) +{ + HRESULT hr; + // Load the version number then the data + mPS_dwFileVersion = ReadInt(pStm, hr); + if (FAILED(hr)) { + return hr; + } + + return ReadFromStream(pStm); +} // Load + + + +// +// Save +// +// Save the contents of this Stream. +STDMETHODIMP CPersistStream::Save(LPSTREAM pStm, BOOL fClearDirty) +{ + + HRESULT hr = WriteInt(pStm, GetSoftwareVersion()); + if (FAILED(hr)) { + return hr; + } + + hr = WriteToStream(pStm); + if (FAILED(hr)) { + return hr; + } + + mPS_fDirty = !fClearDirty; + + return hr; +} // Save + + +// WriteInt +// +// Writes an integer to an IStream as 11 UNICODE characters followed by one space. +// You could use this for shorts or unsigneds or anything (up to 32 bits) +// where the value isn't actually truncated by squeezing it into 32 bits. +// Values such as (unsigned) 0x80000000 would come out as -2147483648 +// but would then load as 0x80000000 through ReadInt. Cast as you please. + +STDAPI WriteInt(IStream *pIStream, int n) +{ + WCHAR Buff[13]; // Allows for trailing null that we don't write + (void)StringCchPrintfW(Buff, NUMELMS(Buff),L"%011d ",n); + return pIStream->Write(&(Buff[0]), 12*sizeof(WCHAR), NULL); +} // WriteInt + + +// ReadInt +// +// Reads an integer from an IStream. +// Read as 4 bytes. You could use this for shorts or unsigneds or anything +// where the value isn't actually truncated by squeezing it into 32 bits +// Striped down subset of what sscanf can do (without dragging in the C runtime) + +STDAPI_(int) ReadInt(IStream *pIStream, __out HRESULT &hr) +{ + + int Sign = 1; + unsigned int n = 0; // result wil be n*Sign + WCHAR wch; + + hr = pIStream->Read( &wch, sizeof(wch), NULL); + if (FAILED(hr)) { + return 0; + } + + if (wch==L'-'){ + Sign = -1; + hr = pIStream->Read( &wch, sizeof(wch), NULL); + if (FAILED(hr)) { + return 0; + } + } + + for( ; ; ) { + if (wch>=L'0' && wch<=L'9') { + n = 10*n+(int)(wch-L'0'); + } else if ( wch == L' ' + || wch == L'\t' + || wch == L'\r' + || wch == L'\n' + || wch == L'\0' + ) { + break; + } else { + hr = VFW_E_INVALID_FILE_FORMAT; + return 0; + } + + hr = pIStream->Read( &wch, sizeof(wch), NULL); + if (FAILED(hr)) { + return 0; + } + } + + if (n==0x80000000 && Sign==-1) { + // This is the negative number that has no positive version! + return (int)n; + } + else return (int)n * Sign; +} // ReadInt + + +// The microsoft C/C++ compile generates level 4 warnings to the effect that +// a particular inline function (from some base class) was not needed. +// This line gets rid of hundreds of such unwanted messages and makes +// -W4 compilation feasible: +#pragma warning(disable: 4514) diff --git a/third_party/BaseClasses/pstream.h b/third_party/BaseClasses/pstream.h new file mode 100644 index 00000000..04b6af62 --- /dev/null +++ b/third_party/BaseClasses/pstream.h @@ -0,0 +1,114 @@ +//------------------------------------------------------------------------------ +// File: PStream.h +// +// Desc: DirectShow base classes - defines a class for persistent properties +// of filters. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __PSTREAM__ +#define __PSTREAM__ + +// Base class for persistent properties of filters +// (i.e. filter properties in saved graphs) + +// The simplest way to use this is: +// 1. Arrange for your filter to inherit this class +// 2. Implement in your class WriteToStream and ReadFromStream +// These will override the "do nothing" functions here. +// 3. Change your NonDelegatingQueryInterface to handle IPersistStream +// 4. Implement SizeMax to return the number of bytes of data you save. +// If you save UNICODE data, don't forget a char is 2 bytes. +// 5. Whenever your data changes, call SetDirty() +// +// At some point you may decide to alter, or extend the format of your data. +// At that point you will wish that you had a version number in all the old +// saved graphs, so that you can tell, when you read them, whether they +// represent the old or new form. To assist you in this, this class +// writes and reads a version number. +// When it writes, it calls GetSoftwareVersion() to enquire what version +// of the software we have at the moment. (In effect this is a version number +// of the data layout in the file). It writes this as the first thing in the data. +// If you want to change the version, implement (override) GetSoftwareVersion(). +// It reads this from the file into mPS_dwFileVersion before calling ReadFromStream, +// so in ReadFromStream you can check mPS_dwFileVersion to see if you are reading +// an old version file. +// Normally you should accept files whose version is no newer than the software +// version that's reading them. + + +// CPersistStream +// +// Implements IPersistStream. +// See 'OLE Programmers Reference (Vol 1):Structured Storage Overview' for +// more implementation information. +class CPersistStream : public IPersistStream { + private: + + // Internal state: + + protected: + DWORD mPS_dwFileVersion; // version number of file (being read) + BOOL mPS_fDirty; + + public: + + // IPersistStream methods + + STDMETHODIMP IsDirty() + {return (mPS_fDirty ? S_OK : S_FALSE);} // note FALSE means clean + STDMETHODIMP Load(LPSTREAM pStm); + STDMETHODIMP Save(LPSTREAM pStm, BOOL fClearDirty); + STDMETHODIMP GetSizeMax(__out ULARGE_INTEGER * pcbSize) + // Allow 24 bytes for version. + { pcbSize->QuadPart = 12*sizeof(WCHAR)+SizeMax(); return NOERROR; } + + // implementation + + CPersistStream(IUnknown *punk, __inout HRESULT *phr); + ~CPersistStream(); + + HRESULT SetDirty(BOOL fDirty) + { mPS_fDirty = fDirty; return NOERROR;} + + + // override to reveal IPersist & IPersistStream + // STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, void **ppv); + + // --- IPersist --- + + // You must override this to provide your own class id + STDMETHODIMP GetClassID(__out CLSID *pClsid) PURE; + + // overrideable if you want + // file version number. Override it if you ever change format + virtual DWORD GetSoftwareVersion(void) { return 0; } + + + //========================================================================= + // OVERRIDE THESE to read and write your data + // OVERRIDE THESE to read and write your data + // OVERRIDE THESE to read and write your data + + virtual int SizeMax() {return 0;} + virtual HRESULT WriteToStream(IStream *pStream); + virtual HRESULT ReadFromStream(IStream *pStream); + //========================================================================= + + private: + +}; + + +// --- Useful helpers --- + + +// Writes an int to an IStream as UNICODE. +STDAPI WriteInt(IStream *pIStream, int n); + +// inverse of WriteInt +STDAPI_(int) ReadInt(IStream *pIStream, __out HRESULT &hr); + +#endif // __PSTREAM__ diff --git a/third_party/BaseClasses/pullpin.cpp b/third_party/BaseClasses/pullpin.cpp new file mode 100644 index 00000000..a197ba58 --- /dev/null +++ b/third_party/BaseClasses/pullpin.cpp @@ -0,0 +1,588 @@ +//------------------------------------------------------------------------------ +// File: PullPin.cpp +// +// Desc: DirectShow base classes - implements CPullPin class that pulls data +// from IAsyncReader. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include "pullpin.h" + +#ifdef DXMPERF +#include "dxmperf.h" +#endif // DXMPERF + + +CPullPin::CPullPin() + : m_pReader(NULL), + m_pAlloc(NULL), + m_State(TM_Exit) +{ +#ifdef DXMPERF + PERFLOG_CTOR( L"CPullPin", this ); +#endif // DXMPERF + +} + +CPullPin::~CPullPin() +{ + Disconnect(); + +#ifdef DXMPERF + PERFLOG_DTOR( L"CPullPin", this ); +#endif // DXMPERF + +} + +// returns S_OK if successfully connected to an IAsyncReader interface +// from this object +// Optional allocator should be proposed as a preferred allocator if +// necessary +HRESULT +CPullPin::Connect(IUnknown* pUnk, IMemAllocator* pAlloc, BOOL bSync) +{ + CAutoLock lock(&m_AccessLock); + + if (m_pReader) { + return VFW_E_ALREADY_CONNECTED; + } + + HRESULT hr = pUnk->QueryInterface(IID_IAsyncReader, (void**)&m_pReader); + if (FAILED(hr)) { + +#ifdef DXMPERF + { + AM_MEDIA_TYPE * pmt = NULL; + PERFLOG_CONNECT( this, pUnk, hr, pmt ); + } +#endif // DXMPERF + + return(hr); + } + + hr = DecideAllocator(pAlloc, NULL); + if (FAILED(hr)) { + Disconnect(); + +#ifdef DXMPERF + { + AM_MEDIA_TYPE * pmt = NULL; + PERFLOG_CONNECT( this, pUnk, hr, pmt ); + } +#endif // DXMPERF + + return hr; + } + + LONGLONG llTotal, llAvail; + hr = m_pReader->Length(&llTotal, &llAvail); + if (FAILED(hr)) { + Disconnect(); + +#ifdef DXMPERF + { + AM_MEDIA_TYPE * pmt = NULL; + PERFLOG_CONNECT( this, pUnk, hr, pmt ); + } +#endif + + return hr; + } + + // convert from file position to reference time + m_tDuration = llTotal * UNITS; + m_tStop = m_tDuration; + m_tStart = 0; + + m_bSync = bSync; + +#ifdef DXMPERF + { + AM_MEDIA_TYPE * pmt = NULL; + PERFLOG_CONNECT( this, pUnk, S_OK, pmt ); + } +#endif // DXMPERF + + + return S_OK; +} + +// disconnect any connection made in Connect +HRESULT +CPullPin::Disconnect() +{ + CAutoLock lock(&m_AccessLock); + + StopThread(); + + +#ifdef DXMPERF + PERFLOG_DISCONNECT( this, m_pReader, S_OK ); +#endif // DXMPERF + + + if (m_pReader) { + m_pReader->Release(); + m_pReader = NULL; + } + + if (m_pAlloc) { + m_pAlloc->Release(); + m_pAlloc = NULL; + } + + return S_OK; +} + +// agree an allocator using RequestAllocator - optional +// props param specifies your requirements (non-zero fields). +// returns an error code if fail to match requirements. +// optional IMemAllocator interface is offered as a preferred allocator +// but no error occurs if it can't be met. +HRESULT +CPullPin::DecideAllocator( + IMemAllocator * pAlloc, + __inout_opt ALLOCATOR_PROPERTIES * pProps) +{ + ALLOCATOR_PROPERTIES *pRequest; + ALLOCATOR_PROPERTIES Request; + if (pProps == NULL) { + Request.cBuffers = 3; + Request.cbBuffer = 64*1024; + Request.cbAlign = 0; + Request.cbPrefix = 0; + pRequest = &Request; + } else { + pRequest = pProps; + } + HRESULT hr = m_pReader->RequestAllocator( + pAlloc, + pRequest, + &m_pAlloc); + return hr; +} + +// start pulling data +HRESULT +CPullPin::Active(void) +{ + ASSERT(!ThreadExists()); + return StartThread(); +} + +// stop pulling data +HRESULT +CPullPin::Inactive(void) +{ + StopThread(); + + return S_OK; +} + +HRESULT +CPullPin::Seek(REFERENCE_TIME tStart, REFERENCE_TIME tStop) +{ + CAutoLock lock(&m_AccessLock); + + ThreadMsg AtStart = m_State; + + if (AtStart == TM_Start) { + BeginFlush(); + PauseThread(); + EndFlush(); + } + + m_tStart = tStart; + m_tStop = tStop; + + HRESULT hr = S_OK; + if (AtStart == TM_Start) { + hr = StartThread(); + } + + return hr; +} + +HRESULT +CPullPin::Duration(__out REFERENCE_TIME* ptDuration) +{ + *ptDuration = m_tDuration; + return S_OK; +} + + +HRESULT +CPullPin::StartThread() +{ + CAutoLock lock(&m_AccessLock); + + if (!m_pAlloc || !m_pReader) { + return E_UNEXPECTED; + } + + HRESULT hr; + if (!ThreadExists()) { + + // commit allocator + hr = m_pAlloc->Commit(); + if (FAILED(hr)) { + return hr; + } + + // start thread + if (!Create()) { + return E_FAIL; + } + } + + m_State = TM_Start; + hr = (HRESULT) CallWorker(m_State); + return hr; +} + +HRESULT +CPullPin::PauseThread() +{ + CAutoLock lock(&m_AccessLock); + + if (!ThreadExists()) { + return E_UNEXPECTED; + } + + // need to flush to ensure the thread is not blocked + // in WaitForNext + HRESULT hr = m_pReader->BeginFlush(); + if (FAILED(hr)) { + return hr; + } + + m_State = TM_Pause; + hr = CallWorker(TM_Pause); + + m_pReader->EndFlush(); + return hr; +} + +HRESULT +CPullPin::StopThread() +{ + CAutoLock lock(&m_AccessLock); + + if (!ThreadExists()) { + return S_FALSE; + } + + // need to flush to ensure the thread is not blocked + // in WaitForNext + HRESULT hr = m_pReader->BeginFlush(); + if (FAILED(hr)) { + return hr; + } + + m_State = TM_Exit; + hr = CallWorker(TM_Exit); + + m_pReader->EndFlush(); + + // wait for thread to completely exit + Close(); + + // decommit allocator + if (m_pAlloc) { + m_pAlloc->Decommit(); + } + + return S_OK; +} + + +DWORD +CPullPin::ThreadProc(void) +{ + while(1) { + DWORD cmd = GetRequest(); + switch(cmd) { + case TM_Exit: + Reply(S_OK); + return 0; + + case TM_Pause: + // we are paused already + Reply(S_OK); + break; + + case TM_Start: + Reply(S_OK); + Process(); + break; + } + + // at this point, there should be no outstanding requests on the + // upstream filter. + // We should force begin/endflush to ensure that this is true. + // !!!Note that we may currently be inside a BeginFlush/EndFlush pair + // on another thread, but the premature EndFlush will do no harm now + // that we are idle. + m_pReader->BeginFlush(); + CleanupCancelled(); + m_pReader->EndFlush(); + } +} + +HRESULT +CPullPin::QueueSample( + __inout REFERENCE_TIME& tCurrent, + REFERENCE_TIME tAlignStop, + BOOL bDiscontinuity + ) +{ + IMediaSample* pSample; + + HRESULT hr = m_pAlloc->GetBuffer(&pSample, NULL, NULL, 0); + if (FAILED(hr)) { + return hr; + } + + LONGLONG tStopThis = tCurrent + (pSample->GetSize() * UNITS); + if (tStopThis > tAlignStop) { + tStopThis = tAlignStop; + } + pSample->SetTime(&tCurrent, &tStopThis); + tCurrent = tStopThis; + + pSample->SetDiscontinuity(bDiscontinuity); + + hr = m_pReader->Request( + pSample, + 0); + if (FAILED(hr)) { + pSample->Release(); + + CleanupCancelled(); + OnError(hr); + } + return hr; +} + +HRESULT +CPullPin::CollectAndDeliver( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop) +{ + IMediaSample* pSample = NULL; // better be sure pSample is set + DWORD_PTR dwUnused; + HRESULT hr = m_pReader->WaitForNext( + INFINITE, + &pSample, + &dwUnused); + if (FAILED(hr)) { + if (pSample) { + pSample->Release(); + } + } else { + hr = DeliverSample(pSample, tStart, tStop); + } + if (FAILED(hr)) { + CleanupCancelled(); + OnError(hr); + } + return hr; + +} + +HRESULT +CPullPin::DeliverSample( + IMediaSample* pSample, + REFERENCE_TIME tStart, + REFERENCE_TIME tStop + ) +{ + // fix up sample if past actual stop (for sector alignment) + REFERENCE_TIME t1, t2; + if (S_OK == pSample->GetTime(&t1, &t2)) { + if (t2 > tStop) { + t2 = tStop; + } + + // adjust times to be relative to (aligned) start time + t1 -= tStart; + t2 -= tStart; + HRESULT hr = pSample->SetTime(&t1, &t2); + if (FAILED(hr)) { + return hr; + } + } + +#ifdef DXMPERF + { + AM_MEDIA_TYPE * pmt = NULL; + pSample->GetMediaType( &pmt ); + PERFLOG_RECEIVE( L"CPullPin", m_pReader, this, pSample, pmt ); + } +#endif + + HRESULT hr = Receive(pSample); + pSample->Release(); + return hr; +} + +void +CPullPin::Process(void) +{ + // is there anything to do? + if (m_tStop <= m_tStart) { + EndOfStream(); + return; + } + + BOOL bDiscontinuity = TRUE; + + // if there is more than one sample at the allocator, + // then try to queue 2 at once in order to overlap. + // -- get buffer count and required alignment + ALLOCATOR_PROPERTIES Actual; + HRESULT hr = m_pAlloc->GetProperties(&Actual); + + // align the start position downwards + REFERENCE_TIME tStart = AlignDown(m_tStart / UNITS, Actual.cbAlign) * UNITS; + REFERENCE_TIME tCurrent = tStart; + + REFERENCE_TIME tStop = m_tStop; + if (tStop > m_tDuration) { + tStop = m_tDuration; + } + + // align the stop position - may be past stop, but that + // doesn't matter + REFERENCE_TIME tAlignStop = AlignUp(tStop / UNITS, Actual.cbAlign) * UNITS; + + + DWORD dwRequest; + + if (!m_bSync) { + + // Break out of the loop either if we get to the end or we're asked + // to do something else + while (tCurrent < tAlignStop) { + + // Break out without calling EndOfStream if we're asked to + // do something different + if (CheckRequest(&dwRequest)) { + return; + } + + // queue a first sample + if (Actual.cBuffers > 1) { + + hr = QueueSample(tCurrent, tAlignStop, TRUE); + bDiscontinuity = FALSE; + + if (FAILED(hr)) { + return; + } + } + + + + // loop queueing second and waiting for first.. + while (tCurrent < tAlignStop) { + + hr = QueueSample(tCurrent, tAlignStop, bDiscontinuity); + bDiscontinuity = FALSE; + + if (FAILED(hr)) { + return; + } + + hr = CollectAndDeliver(tStart, tStop); + if (S_OK != hr) { + + // stop if error, or if downstream filter said + // to stop. + return; + } + } + + if (Actual.cBuffers > 1) { + hr = CollectAndDeliver(tStart, tStop); + if (FAILED(hr)) { + return; + } + } + } + } else { + + // sync version of above loop + while (tCurrent < tAlignStop) { + + // Break out without calling EndOfStream if we're asked to + // do something different + if (CheckRequest(&dwRequest)) { + return; + } + + IMediaSample* pSample; + + hr = m_pAlloc->GetBuffer(&pSample, NULL, NULL, 0); + if (FAILED(hr)) { + OnError(hr); + return; + } + + LONGLONG tStopThis = tCurrent + (pSample->GetSize() * UNITS); + if (tStopThis > tAlignStop) { + tStopThis = tAlignStop; + } + pSample->SetTime(&tCurrent, &tStopThis); + tCurrent = tStopThis; + + if (bDiscontinuity) { + pSample->SetDiscontinuity(TRUE); + bDiscontinuity = FALSE; + } + + hr = m_pReader->SyncReadAligned(pSample); + + if (FAILED(hr)) { + pSample->Release(); + OnError(hr); + return; + } + + hr = DeliverSample(pSample, tStart, tStop); + if (hr != S_OK) { + if (FAILED(hr)) { + OnError(hr); + } + return; + } + } + } + + EndOfStream(); +} + +// after a flush, cancelled i/o will be waiting for collection +// and release +void +CPullPin::CleanupCancelled(void) +{ + while (1) { + IMediaSample * pSample; + DWORD_PTR dwUnused; + + HRESULT hr = m_pReader->WaitForNext( + 0, // no wait + &pSample, + &dwUnused); + if(pSample) { + pSample->Release(); + } else { + // no more samples + return; + } + } +} diff --git a/third_party/BaseClasses/pullpin.h b/third_party/BaseClasses/pullpin.h new file mode 100644 index 00000000..03ad40ec --- /dev/null +++ b/third_party/BaseClasses/pullpin.h @@ -0,0 +1,152 @@ +//------------------------------------------------------------------------------ +// File: PullPin.h +// +// Desc: DirectShow base classes - defines CPullPin class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __PULLPIN_H__ +#define __PULLPIN_H__ + +// +// CPullPin +// +// object supporting pulling data from an IAsyncReader interface. +// Given a start/stop position, calls a pure Receive method with each +// IMediaSample received. +// +// This is essentially for use in a MemInputPin when it finds itself +// connected to an IAsyncReader pin instead of a pushing pin. +// + +class CPullPin : public CAMThread +{ + IAsyncReader* m_pReader; + REFERENCE_TIME m_tStart; + REFERENCE_TIME m_tStop; + REFERENCE_TIME m_tDuration; + BOOL m_bSync; + + enum ThreadMsg { + TM_Pause, // stop pulling and wait for next message + TM_Start, // start pulling + TM_Exit, // stop and exit + }; + + ThreadMsg m_State; + + // override pure thread proc from CAMThread + DWORD ThreadProc(void); + + // running pull method (check m_bSync) + void Process(void); + + // clean up any cancelled i/o after a flush + void CleanupCancelled(void); + + // suspend thread from pulling, eg during seek + HRESULT PauseThread(); + + // start thread pulling - create thread if necy + HRESULT StartThread(); + + // stop and close thread + HRESULT StopThread(); + + // called from ProcessAsync to queue and collect requests + HRESULT QueueSample( + __inout REFERENCE_TIME& tCurrent, + REFERENCE_TIME tAlignStop, + BOOL bDiscontinuity); + + HRESULT CollectAndDeliver( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop); + + HRESULT DeliverSample( + IMediaSample* pSample, + REFERENCE_TIME tStart, + REFERENCE_TIME tStop); + +protected: + IMemAllocator * m_pAlloc; + +public: + CPullPin(); + virtual ~CPullPin(); + + // returns S_OK if successfully connected to an IAsyncReader interface + // from this object + // Optional allocator should be proposed as a preferred allocator if + // necessary + // bSync is TRUE if we are to use sync reads instead of the + // async methods. + HRESULT Connect(IUnknown* pUnk, IMemAllocator* pAlloc, BOOL bSync); + + // disconnect any connection made in Connect + HRESULT Disconnect(); + + // agree an allocator using RequestAllocator - optional + // props param specifies your requirements (non-zero fields). + // returns an error code if fail to match requirements. + // optional IMemAllocator interface is offered as a preferred allocator + // but no error occurs if it can't be met. + virtual HRESULT DecideAllocator( + IMemAllocator* pAlloc, + __inout_opt ALLOCATOR_PROPERTIES * pProps); + + // set start and stop position. if active, will start immediately at + // the new position. Default is 0 to duration + HRESULT Seek(REFERENCE_TIME tStart, REFERENCE_TIME tStop); + + // return the total duration + HRESULT Duration(__out REFERENCE_TIME* ptDuration); + + // start pulling data + HRESULT Active(void); + + // stop pulling data + HRESULT Inactive(void); + + // helper functions + LONGLONG AlignDown(LONGLONG ll, LONG lAlign) { + // aligning downwards is just truncation + return ll & ~(lAlign-1); + }; + + LONGLONG AlignUp(LONGLONG ll, LONG lAlign) { + // align up: round up to next boundary + return (ll + (lAlign -1)) & ~(lAlign -1); + }; + + // GetReader returns the (addrefed) IAsyncReader interface + // for SyncRead etc + IAsyncReader* GetReader() { + m_pReader->AddRef(); + return m_pReader; + }; + + // -- pure -- + + // override this to handle data arrival + // return value other than S_OK will stop data + virtual HRESULT Receive(IMediaSample*) PURE; + + // override this to handle end-of-stream + virtual HRESULT EndOfStream(void) PURE; + + // called on runtime errors that will have caused pulling + // to stop + // these errors are all returned from the upstream filter, who + // will have already reported any errors to the filtergraph. + virtual void OnError(HRESULT hr) PURE; + + // flush this pin and all downstream + virtual HRESULT BeginFlush() PURE; + virtual HRESULT EndFlush() PURE; + +}; + +#endif //__PULLPIN_H__ diff --git a/third_party/BaseClasses/refclock.cpp b/third_party/BaseClasses/refclock.cpp new file mode 100644 index 00000000..8ae25f44 --- /dev/null +++ b/third_party/BaseClasses/refclock.cpp @@ -0,0 +1,402 @@ +//------------------------------------------------------------------------------ +// File: RefClock.cpp +// +// Desc: DirectShow base classes - implements the IReferenceClock interface. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include + +#ifdef DXMPERF +#include "dxmperf.h" +#endif // DXMPERF + + +// 'this' used in constructor list +#pragma warning(disable:4355) + + +STDMETHODIMP CBaseReferenceClock::NonDelegatingQueryInterface( + REFIID riid, + __deref_out void ** ppv) +{ + HRESULT hr; + + if (riid == IID_IReferenceClock) + { + hr = GetInterface((IReferenceClock *) this, ppv); + } + else if (riid == IID_IReferenceClockTimerControl) + { + hr = GetInterface((IReferenceClockTimerControl *) this, ppv); + } + else + { + hr = CUnknown::NonDelegatingQueryInterface(riid, ppv); + } + return hr; +} + +CBaseReferenceClock::~CBaseReferenceClock() +{ +#ifdef DXMPERF + PERFLOG_DTOR( L"CBaseReferenceClock", (IReferenceClock *) this ); +#endif // DXMPERF + + if (m_TimerResolution) timeEndPeriod(m_TimerResolution); + + if (m_pSchedule) + { + m_pSchedule->DumpLinkedList(); + } + + if (m_hThread) + { + m_bAbort = TRUE; + TriggerThread(); + WaitForSingleObject( m_hThread, INFINITE ); + EXECUTE_ASSERT( CloseHandle(m_hThread) ); + m_hThread = 0; + EXECUTE_ASSERT( CloseHandle(m_pSchedule->GetEvent()) ); + delete m_pSchedule; + } +} + +// A derived class may supply a hThreadEvent if it has its own thread that will take care +// of calling the schedulers Advise method. (Refere to CBaseReferenceClock::AdviseThread() +// to see what such a thread has to do.) +CBaseReferenceClock::CBaseReferenceClock( __in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + __inout HRESULT *phr, + __inout_opt CAMSchedule * pShed ) +: CUnknown( pName, pUnk ) +, m_rtLastGotTime(0) +, m_TimerResolution(0) +, m_bAbort( FALSE ) +, m_pSchedule( pShed ? pShed : new CAMSchedule(CreateEvent(NULL, FALSE, FALSE, NULL)) ) +, m_hThread(0) +{ + +#ifdef DXMPERF + PERFLOG_CTOR( pName ? pName : L"CBaseReferenceClock", (IReferenceClock *) this ); +#endif // DXMPERF + + ASSERT(m_pSchedule); + if (!m_pSchedule) + { + *phr = E_OUTOFMEMORY; + } + else + { + // Set up the highest resolution timer we can manage + TIMECAPS tc; + m_TimerResolution = (TIMERR_NOERROR == timeGetDevCaps(&tc, sizeof(tc))) + ? tc.wPeriodMin + : 1; + + timeBeginPeriod(m_TimerResolution); + + /* Initialise our system times - the derived clock should set the right values */ + m_dwPrevSystemTime = timeGetTime(); + m_rtPrivateTime = (UNITS / MILLISECONDS) * m_dwPrevSystemTime; + + #ifdef PERF + m_idGetSystemTime = MSR_REGISTER(TEXT("CBaseReferenceClock::GetTime")); + #endif + + if ( !pShed ) + { + DWORD ThreadID; + m_hThread = ::CreateThread(NULL, // Security attributes + (DWORD) 0, // Initial stack size + AdviseThreadFunction, // Thread start address + (LPVOID) this, // Thread parameter + (DWORD) 0, // Creation flags + &ThreadID); // Thread identifier + + if (m_hThread) + { + SetThreadPriority( m_hThread, THREAD_PRIORITY_TIME_CRITICAL ); + } + else + { + *phr = E_FAIL; + EXECUTE_ASSERT( CloseHandle(m_pSchedule->GetEvent()) ); + delete m_pSchedule; + m_pSchedule = NULL; + } + } + } +} + +void CBaseReferenceClock::Restart (IN REFERENCE_TIME rtMinTime) +{ + Lock(); + m_rtLastGotTime = rtMinTime ; + Unlock(); +} + +STDMETHODIMP CBaseReferenceClock::GetTime(__out REFERENCE_TIME *pTime) +{ + HRESULT hr; + if (pTime) + { + REFERENCE_TIME rtNow; + Lock(); + rtNow = GetPrivateTime(); + if (rtNow > m_rtLastGotTime) + { + m_rtLastGotTime = rtNow; + hr = S_OK; + } + else + { + hr = S_FALSE; + } + *pTime = m_rtLastGotTime; + Unlock(); + MSR_INTEGER(m_idGetSystemTime, LONG((*pTime) / (UNITS/MILLISECONDS)) ); + +#ifdef DXMPERF + PERFLOG_GETTIME( (IReferenceClock *) this, *pTime ); +#endif // DXMPERF + + } + else hr = E_POINTER; + + return hr; +} + +/* Ask for an async notification that a time has elapsed */ + +STDMETHODIMP CBaseReferenceClock::AdviseTime( + REFERENCE_TIME baseTime, // base reference time + REFERENCE_TIME streamTime, // stream offset time + HEVENT hEvent, // advise via this event + __out DWORD_PTR *pdwAdviseCookie)// where your cookie goes +{ + CheckPointer(pdwAdviseCookie, E_POINTER); + *pdwAdviseCookie = 0; + + // Check that the event is not already set + ASSERT(WAIT_TIMEOUT == WaitForSingleObject(HANDLE(hEvent),0)); + + HRESULT hr; + + const REFERENCE_TIME lRefTime = baseTime + streamTime; + if ( lRefTime <= 0 || lRefTime == MAX_TIME ) + { + hr = E_INVALIDARG; + } + else + { + *pdwAdviseCookie = m_pSchedule->AddAdvisePacket( lRefTime, 0, HANDLE(hEvent), FALSE ); + hr = *pdwAdviseCookie ? NOERROR : E_OUTOFMEMORY; + } + return hr; +} + + +/* Ask for an asynchronous periodic notification that a time has elapsed */ + +STDMETHODIMP CBaseReferenceClock::AdvisePeriodic( + REFERENCE_TIME StartTime, // starting at this time + REFERENCE_TIME PeriodTime, // time between notifications + HSEMAPHORE hSemaphore, // advise via a semaphore + __out DWORD_PTR *pdwAdviseCookie) // where your cookie goes +{ + CheckPointer(pdwAdviseCookie, E_POINTER); + *pdwAdviseCookie = 0; + + HRESULT hr; + if (StartTime > 0 && PeriodTime > 0 && StartTime != MAX_TIME ) + { + *pdwAdviseCookie = m_pSchedule->AddAdvisePacket( StartTime, PeriodTime, HANDLE(hSemaphore), TRUE ); + hr = *pdwAdviseCookie ? NOERROR : E_OUTOFMEMORY; + } + else hr = E_INVALIDARG; + + return hr; +} + + +STDMETHODIMP CBaseReferenceClock::Unadvise(DWORD_PTR dwAdviseCookie) +{ + return m_pSchedule->Unadvise(dwAdviseCookie); +} + + +REFERENCE_TIME CBaseReferenceClock::GetPrivateTime() +{ + CAutoLock cObjectLock(this); + + + /* If the clock has wrapped then the current time will be less than + * the last time we were notified so add on the extra milliseconds + * + * The time period is long enough so that the likelihood of + * successive calls spanning the clock cycle is not considered. + */ + + DWORD dwTime = timeGetTime(); + { + m_rtPrivateTime += Int32x32To64(UNITS / MILLISECONDS, (DWORD)(dwTime - m_dwPrevSystemTime)); + m_dwPrevSystemTime = dwTime; + } + + return m_rtPrivateTime; +} + + +/* Adjust the current time by the input value. This allows an + external time source to work out some of the latency of the clock + system and adjust the "current" time accordingly. The intent is + that the time returned to the user is synchronised to a clock + source and allows drift to be catered for. + + For example: if the clock source detects a drift it can pass a delta + to the current time rather than having to set an explicit time. +*/ + +STDMETHODIMP CBaseReferenceClock::SetTimeDelta(const REFERENCE_TIME & TimeDelta) +{ +#ifdef DEBUG + + // Just break if passed an improper time delta value + LONGLONG llDelta = TimeDelta > 0 ? TimeDelta : -TimeDelta; + if (llDelta > UNITS * 1000) { + DbgLog((LOG_TRACE, 0, TEXT("Bad Time Delta"))); + //DebugBreak(); + } + + // We're going to calculate a "severity" for the time change. Max -1 + // min 8. We'll then use this as the debug logging level for a + // debug log message. + const LONG usDelta = LONG(TimeDelta/10); // Delta in micro-secs + + DWORD delta = abs(usDelta); // varying delta + // Severity == 8 - ceil(log(abs( micro-secs delta))) + int Severity = 8; + while ( delta > 0 ) + { + delta >>= 3; // div 8 + Severity--; + } + + // Sev == 0 => > 2 second delta! + DbgLog((LOG_TIMING, Severity < 0 ? 0 : Severity, + TEXT("Sev %2i: CSystemClock::SetTimeDelta(%8ld us) %lu -> %lu ms."), + Severity, usDelta, DWORD(ConvertToMilliseconds(m_rtPrivateTime)), + DWORD(ConvertToMilliseconds(TimeDelta+m_rtPrivateTime)) )); + + // Don't want the DbgBreak to fire when running stress on debug-builds. + #ifdef BREAK_ON_SEVERE_TIME_DELTA + if (Severity < 0) + DbgBreakPoint(TEXT("SetTimeDelta > 16 seconds!"), + TEXT(__FILE__),__LINE__); + #endif + +#endif + + CAutoLock cObjectLock(this); + m_rtPrivateTime += TimeDelta; + // If time goes forwards, and we have advises, then we need to + // trigger the thread so that it can re-evaluate its wait time. + // Since we don't want the cost of the thread switches if the change + // is really small, only do it if clock goes forward by more than + // 0.5 millisecond. If the time goes backwards, the thread will + // wake up "early" (relativly speaking) and will re-evaluate at + // that time. + if ( TimeDelta > 5000 && m_pSchedule->GetAdviseCount() > 0 ) TriggerThread(); + return NOERROR; +} + +// Thread stuff + +DWORD __stdcall CBaseReferenceClock::AdviseThreadFunction(__in LPVOID p) +{ + return DWORD(reinterpret_cast(p)->AdviseThread()); +} + +HRESULT CBaseReferenceClock::AdviseThread() +{ + DWORD dwWait = INFINITE; + + // The first thing we do is wait until something interesting happens + // (meaning a first advise or shutdown). This prevents us calling + // GetPrivateTime immediately which is goodness as that is a virtual + // routine and the derived class may not yet be constructed. (This + // thread is created in the base class constructor.) + + while ( !m_bAbort ) + { + // Wait for an interesting event to happen + DbgLog((LOG_TIMING, 3, TEXT("CBaseRefClock::AdviseThread() Delay: %lu ms"), dwWait )); + WaitForSingleObject(m_pSchedule->GetEvent(), dwWait); + if (m_bAbort) break; + + // There are several reasons why we need to work from the internal + // time, mainly to do with what happens when time goes backwards. + // Mainly, it stop us looping madly if an event is just about to + // expire when the clock goes backward (i.e. GetTime stop for a + // while). + const REFERENCE_TIME rtNow = GetPrivateTime(); + + DbgLog((LOG_TIMING, 3, + TEXT("CBaseRefClock::AdviseThread() Woke at = %lu ms"), + ConvertToMilliseconds(rtNow) )); + + // We must add in a millisecond, since this is the resolution of our + // WaitForSingleObject timer. Failure to do so will cause us to loop + // franticly for (approx) 1 a millisecond. + m_rtNextAdvise = m_pSchedule->Advise( 10000 + rtNow ); + LONGLONG llWait = m_rtNextAdvise - rtNow; + + ASSERT( llWait > 0 ); + + llWait = ConvertToMilliseconds(llWait); + // DON'T replace this with a max!! (The type's of these things is VERY important) + dwWait = (llWait > REFERENCE_TIME(UINT_MAX)) ? UINT_MAX : DWORD(llWait); + }; + return NOERROR; +} + +HRESULT CBaseReferenceClock::SetDefaultTimerResolution( + REFERENCE_TIME timerResolution // in 100ns + ) +{ + CAutoLock cObjectLock(this); + if( 0 == timerResolution ) { + if( m_TimerResolution ) { + timeEndPeriod( m_TimerResolution ); + m_TimerResolution = 0; + } + } else { + TIMECAPS tc; + DWORD dwMinResolution = (TIMERR_NOERROR == timeGetDevCaps(&tc, sizeof(tc))) + ? tc.wPeriodMin + : 1; + DWORD dwResolution = max( dwMinResolution, DWORD(timerResolution / 10000) ); + if( dwResolution != m_TimerResolution ) { + timeEndPeriod(m_TimerResolution); + m_TimerResolution = dwResolution; + timeBeginPeriod( m_TimerResolution ); + } + } + return S_OK; +} + +HRESULT CBaseReferenceClock::GetDefaultTimerResolution( + __out REFERENCE_TIME* pTimerResolution // in 100ns + ) +{ + if( !pTimerResolution ) { + return E_POINTER; + } + CAutoLock cObjectLock(this); + *pTimerResolution = m_TimerResolution * 10000; + return S_OK; +} diff --git a/third_party/BaseClasses/refclock.h b/third_party/BaseClasses/refclock.h new file mode 100644 index 00000000..d2b0bb15 --- /dev/null +++ b/third_party/BaseClasses/refclock.h @@ -0,0 +1,184 @@ +//------------------------------------------------------------------------------ +// File: RefClock.h +// +// Desc: DirectShow base classes - defines the IReferenceClock interface. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __BASEREFCLOCK__ +#define __BASEREFCLOCK__ + +#include + +const UINT RESOLUTION = 1; /* High resolution timer */ +const INT ADVISE_CACHE = 4; /* Default cache size */ +const LONGLONG MAX_TIME = 0x7FFFFFFFFFFFFFFF; /* Maximum LONGLONG value */ + +inline LONGLONG WINAPI ConvertToMilliseconds(const REFERENCE_TIME& RT) +{ + /* This converts an arbitrary value representing a reference time + into a MILLISECONDS value for use in subsequent system calls */ + + return (RT / (UNITS / MILLISECONDS)); +} + +/* This class hierarchy will support an IReferenceClock interface so + that an audio card (or other externally driven clock) can update the + system wide clock that everyone uses. + + The interface will be pretty thin with probably just one update method + This interface has not yet been defined. + */ + +/* This abstract base class implements the IReferenceClock + * interface. Classes that actually provide clock signals (from + * whatever source) have to be derived from this class. + * + * The abstract class provides implementations for: + * CUnknown support + * locking support (CCritSec) + * client advise code (creates a thread) + * + * Question: what can we do about quality? Change the timer + * resolution to lower the system load? Up the priority of the + * timer thread to force more responsive signals? + * + * During class construction we create a worker thread that is destroyed during + * destuction. This thread executes a series of WaitForSingleObject calls, + * waking up when a command is given to the thread or the next wake up point + * is reached. The wakeup points are determined by clients making Advise + * calls. + * + * Each advise call defines a point in time when they wish to be notified. A + * periodic advise is a series of these such events. We maintain a list of + * advise links and calculate when the nearest event notification is due for. + * We then call WaitForSingleObject with a timeout equal to this time. The + * handle we wait on is used by the class to signal that something has changed + * and that we must reschedule the next event. This typically happens when + * someone comes in and asks for an advise link while we are waiting for an + * event to timeout. + * + * While we are modifying the list of advise requests we + * are protected from interference through a critical section. Clients are NOT + * advised through callbacks. One shot clients have an event set, while + * periodic clients have a semaphore released for each event notification. A + * semaphore allows a client to be kept up to date with the number of events + * actually triggered and be assured that they can't miss multiple events being + * set. + * + * Keeping track of advises is taken care of by the CAMSchedule class. + */ + +class CBaseReferenceClock +: public CUnknown, public IReferenceClock, public CCritSec, public IReferenceClockTimerControl +{ +protected: + virtual ~CBaseReferenceClock(); // Don't let me be created on the stack! +public: + CBaseReferenceClock(__in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + __inout HRESULT *phr, + __inout_opt CAMSchedule * pSched = 0 ); + + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv); + + DECLARE_IUNKNOWN + + /* IReferenceClock methods */ + // Derived classes must implement GetPrivateTime(). All our GetTime + // does is call GetPrivateTime and then check so that time does not + // go backwards. A return code of S_FALSE implies that the internal + // clock has gone backwards and GetTime time has halted until internal + // time has caught up. (Don't know if this will be much use to folk, + // but it seems odd not to use the return code for something useful.) + STDMETHODIMP GetTime(__out REFERENCE_TIME *pTime); + // When this is called, it sets m_rtLastGotTime to the time it returns. + + /* Provide standard mechanisms for scheduling events */ + + /* Ask for an async notification that a time has elapsed */ + STDMETHODIMP AdviseTime( + REFERENCE_TIME baseTime, // base reference time + REFERENCE_TIME streamTime, // stream offset time + HEVENT hEvent, // advise via this event + __out DWORD_PTR *pdwAdviseCookie// where your cookie goes + ); + + /* Ask for an asynchronous periodic notification that a time has elapsed */ + STDMETHODIMP AdvisePeriodic( + REFERENCE_TIME StartTime, // starting at this time + REFERENCE_TIME PeriodTime, // time between notifications + HSEMAPHORE hSemaphore, // advise via a semaphore + __out DWORD_PTR *pdwAdviseCookie// where your cookie goes + ); + + /* Cancel a request for notification(s) - if the notification was + * a one shot timer then this function doesn't need to be called + * as the advise is automatically cancelled, however it does no + * harm to explicitly cancel a one-shot advise. It is REQUIRED that + * clients call Unadvise to clear a Periodic advise setting. + */ + + STDMETHODIMP Unadvise(DWORD_PTR dwAdviseCookie); + + /* Methods for the benefit of derived classes or outer objects */ + + // GetPrivateTime() is the REAL clock. GetTime is just a cover for + // it. Derived classes will probably override this method but not + // GetTime() itself. + // The important point about GetPrivateTime() is it's allowed to go + // backwards. Our GetTime() will keep returning the LastGotTime + // until GetPrivateTime() catches up. + virtual REFERENCE_TIME GetPrivateTime(); + + /* Provide a method for correcting drift */ + STDMETHODIMP SetTimeDelta( const REFERENCE_TIME& TimeDelta ); + + CAMSchedule * GetSchedule() const { return m_pSchedule; } + + // IReferenceClockTimerControl methods + // + // Setting a default of 0 disables the default of 1ms + STDMETHODIMP SetDefaultTimerResolution( + REFERENCE_TIME timerResolution // in 100ns + ); + STDMETHODIMP GetDefaultTimerResolution( + __out REFERENCE_TIME* pTimerResolution // in 100ns + ); + +private: + REFERENCE_TIME m_rtPrivateTime; // Current best estimate of time + DWORD m_dwPrevSystemTime; // Last vaule we got from timeGetTime + REFERENCE_TIME m_rtLastGotTime; // Last time returned by GetTime + REFERENCE_TIME m_rtNextAdvise; // Time of next advise + UINT m_TimerResolution; + +#ifdef PERF + int m_idGetSystemTime; +#endif + +// Thread stuff +public: + void TriggerThread() // Wakes thread up. Need to do this if + { // time to next advise needs reevaluating. + EXECUTE_ASSERT(SetEvent(m_pSchedule->GetEvent())); + } + + +private: + BOOL m_bAbort; // Flag used for thread shutdown + HANDLE m_hThread; // Thread handle + + HRESULT AdviseThread(); // Method in which the advise thread runs + static DWORD __stdcall AdviseThreadFunction(__in LPVOID); // Function used to get there + +protected: + CAMSchedule * m_pSchedule; + + void Restart (IN REFERENCE_TIME rtMinTime = 0I64) ; +}; + +#endif + diff --git a/third_party/BaseClasses/reftime.h b/third_party/BaseClasses/reftime.h new file mode 100644 index 00000000..5bc99a69 --- /dev/null +++ b/third_party/BaseClasses/reftime.h @@ -0,0 +1,116 @@ +//------------------------------------------------------------------------------ +// File: RefTime.h +// +// Desc: DirectShow base classes - defines CRefTime, a class that manages +// reference times. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// +// CRefTime +// +// Manage reference times. +// Shares same data layout as REFERENCE_TIME, but adds some (nonvirtual) +// functions providing simple comparison, conversion and arithmetic. +// +// A reference time (at the moment) is a unit of seconds represented in +// 100ns units as is used in the Win32 FILETIME structure. BUT the time +// a REFERENCE_TIME represents is NOT the time elapsed since 1/1/1601 it +// will either be stream time or reference time depending upon context +// +// This class provides simple arithmetic operations on reference times +// +// keep non-virtual otherwise the data layout will not be the same as +// REFERENCE_TIME + + +// ----- +// note that you are safe to cast a CRefTime* to a REFERENCE_TIME*, but +// you will need to do so explicitly +// ----- + + +#ifndef __REFTIME__ +#define __REFTIME__ + + +const LONGLONG MILLISECONDS = (1000); // 10 ^ 3 +const LONGLONG NANOSECONDS = (1000000000); // 10 ^ 9 +const LONGLONG UNITS = (NANOSECONDS / 100); // 10 ^ 7 + +/* Unfortunately an inline function here generates a call to __allmul + - even for constants! +*/ +#define MILLISECONDS_TO_100NS_UNITS(lMs) \ + Int32x32To64((lMs), (UNITS / MILLISECONDS)) + +class CRefTime +{ +public: + + // *MUST* be the only data member so that this class is exactly + // equivalent to a REFERENCE_TIME. + // Also, must be *no virtual functions* + + REFERENCE_TIME m_time; + + inline CRefTime() + { + // default to 0 time + m_time = 0; + }; + + inline CRefTime(LONG msecs) + { + m_time = MILLISECONDS_TO_100NS_UNITS(msecs); + }; + + inline CRefTime(REFERENCE_TIME rt) + { + m_time = rt; + }; + + inline operator REFERENCE_TIME() const + { + return m_time; + }; + + inline CRefTime& operator=(const CRefTime& rt) + { + m_time = rt.m_time; + return *this; + }; + + inline CRefTime& operator=(const LONGLONG ll) + { + m_time = ll; + return *this; + }; + + inline CRefTime& operator+=(const CRefTime& rt) + { + return (*this = *this + rt); + }; + + inline CRefTime& operator-=(const CRefTime& rt) + { + return (*this = *this - rt); + }; + + inline LONG Millisecs(void) + { + return (LONG)(m_time / (UNITS / MILLISECONDS)); + }; + + inline LONGLONG GetUnits(void) + { + return m_time; + }; +}; + +const LONGLONG TimeZero = 0; + +#endif /* __REFTIME__ */ + diff --git a/third_party/BaseClasses/renbase.cpp b/third_party/BaseClasses/renbase.cpp new file mode 100644 index 00000000..c6e19627 --- /dev/null +++ b/third_party/BaseClasses/renbase.cpp @@ -0,0 +1,2858 @@ +//------------------------------------------------------------------------------ +// File: RenBase.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include // DirectShow base class definitions +#include // Needed for definition of timeGetTime +#include // Standard data type limit definitions +#include // Used for time critical log functions + +#pragma warning(disable:4355) + +// Helper function for clamping time differences +int inline TimeDiff(REFERENCE_TIME rt) +{ + if (rt < - (50 * UNITS)) { + return -(50 * UNITS); + } else + if (rt > 50 * UNITS) { + return 50 * UNITS; + } else return (int)rt; +} + +// Implements the CBaseRenderer class + +CBaseRenderer::CBaseRenderer(REFCLSID RenderClass, // CLSID for this renderer + __in_opt LPCTSTR pName, // Debug ONLY description + __inout_opt LPUNKNOWN pUnk, // Aggregated owner object + __inout HRESULT *phr) : // General OLE return code + + CBaseFilter(pName,pUnk,&m_InterfaceLock,RenderClass), + m_evComplete(TRUE, phr), + m_RenderEvent(FALSE, phr), + m_bAbort(FALSE), + m_pPosition(NULL), + m_ThreadSignal(TRUE, phr), + m_bStreaming(FALSE), + m_bEOS(FALSE), + m_bEOSDelivered(FALSE), + m_pMediaSample(NULL), + m_dwAdvise(0), + m_pQSink(NULL), + m_pInputPin(NULL), + m_bRepaintStatus(TRUE), + m_SignalTime(0), + m_bInReceive(FALSE), + m_EndOfStreamTimer(0) +{ + if (SUCCEEDED(*phr)) { + Ready(); +#ifdef PERF + m_idBaseStamp = MSR_REGISTER(TEXT("BaseRenderer: sample time stamp")); + m_idBaseRenderTime = MSR_REGISTER(TEXT("BaseRenderer: draw time (msec)")); + m_idBaseAccuracy = MSR_REGISTER(TEXT("BaseRenderer: Accuracy (msec)")); +#endif + } +} + + +// Delete the dynamically allocated IMediaPosition and IMediaSeeking helper +// object. The object is created when somebody queries us. These are standard +// control interfaces for seeking and setting start/stop positions and rates. +// We will probably also have made an input pin based on CRendererInputPin +// that has to be deleted, it's created when an enumerator calls our GetPin + +CBaseRenderer::~CBaseRenderer() +{ + ASSERT(m_bStreaming == FALSE); + ASSERT(m_EndOfStreamTimer == 0); + StopStreaming(); + ClearPendingSample(); + + // Delete any IMediaPosition implementation + + if (m_pPosition) { + delete m_pPosition; + m_pPosition = NULL; + } + + // Delete any input pin created + + if (m_pInputPin) { + delete m_pInputPin; + m_pInputPin = NULL; + } + + // Release any Quality sink + + ASSERT(m_pQSink == NULL); +} + + +// This returns the IMediaPosition and IMediaSeeking interfaces + +HRESULT CBaseRenderer::GetMediaPositionInterface(REFIID riid, __deref_out void **ppv) +{ + CAutoLock cObjectCreationLock(&m_ObjectCreationLock); + if (m_pPosition) { + return m_pPosition->NonDelegatingQueryInterface(riid,ppv); + } + + CBasePin *pPin = GetPin(0); + if (NULL == pPin) { + return E_OUTOFMEMORY; + } + + HRESULT hr = NOERROR; + + // Create implementation of this dynamically since sometimes we may + // never try and do a seek. The helper object implements a position + // control interface (IMediaPosition) which in fact simply takes the + // calls normally from the filter graph and passes them upstream + + m_pPosition = new CRendererPosPassThru(NAME("Renderer CPosPassThru"), + CBaseFilter::GetOwner(), + (HRESULT *) &hr, + pPin); + if (m_pPosition == NULL) { + return E_OUTOFMEMORY; + } + + if (FAILED(hr)) { + delete m_pPosition; + m_pPosition = NULL; + return E_NOINTERFACE; + } + return GetMediaPositionInterface(riid,ppv); +} + + +// Overriden to say what interfaces we support and where + +STDMETHODIMP CBaseRenderer::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + // Do we have this interface + + if (riid == IID_IMediaPosition || riid == IID_IMediaSeeking) { + return GetMediaPositionInterface(riid,ppv); + } else { + return CBaseFilter::NonDelegatingQueryInterface(riid,ppv); + } +} + + +// This is called whenever we change states, we have a manual reset event that +// is signalled whenever we don't won't the source filter thread to wait in us +// (such as in a stopped state) and likewise is not signalled whenever it can +// wait (during paused and running) this function sets or resets the thread +// event. The event is used to stop source filter threads waiting in Receive + +HRESULT CBaseRenderer::SourceThreadCanWait(BOOL bCanWait) +{ + if (bCanWait == TRUE) { + m_ThreadSignal.Reset(); + } else { + m_ThreadSignal.Set(); + } + return NOERROR; +} + + +#ifdef DEBUG +// Dump the current renderer state to the debug terminal. The hardest part of +// the renderer is the window where we unlock everything to wait for a clock +// to signal it is time to draw or for the application to cancel everything +// by stopping the filter. If we get things wrong we can leave the thread in +// WaitForRenderTime with no way for it to ever get out and we will deadlock + +void CBaseRenderer::DisplayRendererState() +{ + DbgLog((LOG_TIMING, 1, TEXT("\nTimed out in WaitForRenderTime"))); + + // No way should this be signalled at this point + + BOOL bSignalled = m_ThreadSignal.Check(); + DbgLog((LOG_TIMING, 1, TEXT("Signal sanity check %d"),bSignalled)); + + // Now output the current renderer state variables + + DbgLog((LOG_TIMING, 1, TEXT("Filter state %d"),m_State)); + + DbgLog((LOG_TIMING, 1, TEXT("Abort flag %d"),m_bAbort)); + + DbgLog((LOG_TIMING, 1, TEXT("Streaming flag %d"),m_bStreaming)); + + DbgLog((LOG_TIMING, 1, TEXT("Clock advise link %d"),m_dwAdvise)); + + DbgLog((LOG_TIMING, 1, TEXT("Current media sample %x"),m_pMediaSample)); + + DbgLog((LOG_TIMING, 1, TEXT("EOS signalled %d"),m_bEOS)); + + DbgLog((LOG_TIMING, 1, TEXT("EOS delivered %d"),m_bEOSDelivered)); + + DbgLog((LOG_TIMING, 1, TEXT("Repaint status %d"),m_bRepaintStatus)); + + + // Output the delayed end of stream timer information + + DbgLog((LOG_TIMING, 1, TEXT("End of stream timer %x"),m_EndOfStreamTimer)); + + DbgLog((LOG_TIMING, 1, TEXT("Deliver time %s"),CDisp((LONGLONG)m_SignalTime))); + + + // Should never timeout during a flushing state + + BOOL bFlushing = m_pInputPin->IsFlushing(); + DbgLog((LOG_TIMING, 1, TEXT("Flushing sanity check %d"),bFlushing)); + + // Display the time we were told to start at + DbgLog((LOG_TIMING, 1, TEXT("Last run time %s"),CDisp((LONGLONG)m_tStart.m_time))); + + // Have we got a reference clock + if (m_pClock == NULL) return; + + // Get the current time from the wall clock + + CRefTime CurrentTime,StartTime,EndTime; + m_pClock->GetTime((REFERENCE_TIME*) &CurrentTime); + CRefTime Offset = CurrentTime - m_tStart; + + // Display the current time from the clock + + DbgLog((LOG_TIMING, 1, TEXT("Clock time %s"),CDisp((LONGLONG)CurrentTime.m_time))); + + DbgLog((LOG_TIMING, 1, TEXT("Time difference %dms"),Offset.Millisecs())); + + + // Do we have a sample ready to render + if (m_pMediaSample == NULL) return; + + m_pMediaSample->GetTime((REFERENCE_TIME*)&StartTime, (REFERENCE_TIME*)&EndTime); + DbgLog((LOG_TIMING, 1, TEXT("Next sample stream times (Start %d End %d ms)"), + StartTime.Millisecs(),EndTime.Millisecs())); + + // Calculate how long it is until it is due for rendering + CRefTime Wait = (m_tStart + StartTime) - CurrentTime; + DbgLog((LOG_TIMING, 1, TEXT("Wait required %d ms"),Wait.Millisecs())); +} +#endif + + +// Wait until the clock sets the timer event or we're otherwise signalled. We +// set an arbitrary timeout for this wait and if it fires then we display the +// current renderer state on the debugger. It will often fire if the filter's +// left paused in an application however it may also fire during stress tests +// if the synchronisation with application seeks and state changes is faulty + +#define RENDER_TIMEOUT 10000 + +HRESULT CBaseRenderer::WaitForRenderTime() +{ + HANDLE WaitObjects[] = { m_ThreadSignal, m_RenderEvent }; + DWORD Result = WAIT_TIMEOUT; + + // Wait for either the time to arrive or for us to be stopped + + OnWaitStart(); + while (Result == WAIT_TIMEOUT) { + Result = WaitForMultipleObjects(2,WaitObjects,FALSE,RENDER_TIMEOUT); + +#ifdef DEBUG + if (Result == WAIT_TIMEOUT) DisplayRendererState(); +#endif + + } + OnWaitEnd(); + + // We may have been awoken without the timer firing + + if (Result == WAIT_OBJECT_0) { + return VFW_E_STATE_CHANGED; + } + + SignalTimerFired(); + return NOERROR; +} + + +// Poll waiting for Receive to complete. This really matters when +// Receive may set the palette and cause window messages +// The problem is that if we don't really wait for a renderer to +// stop processing we can deadlock waiting for a transform which +// is calling the renderer's Receive() method because the transform's +// Stop method doesn't know to process window messages to unblock +// the renderer's Receive processing +void CBaseRenderer::WaitForReceiveToComplete() +{ + for (;;) { + if (!m_bInReceive) { + break; + } + + MSG msg; + // Receive all interthread snedmessages + PeekMessage(&msg, NULL, WM_NULL, WM_NULL, PM_NOREMOVE); + + Sleep(1); + } + + // If the wakebit for QS_POSTMESSAGE is set, the PeekMessage call + // above just cleared the changebit which will cause some messaging + // calls to block (waitMessage, MsgWaitFor...) now. + // Post a dummy message to set the QS_POSTMESSAGE bit again + if (HIWORD(GetQueueStatus(QS_POSTMESSAGE)) & QS_POSTMESSAGE) { + // Send dummy message + PostThreadMessage(GetCurrentThreadId(), WM_NULL, 0, 0); + } +} + +// A filter can have four discrete states, namely Stopped, Running, Paused, +// Intermediate. We are in an intermediate state if we are currently trying +// to pause but haven't yet got the first sample (or if we have been flushed +// in paused state and therefore still have to wait for a sample to arrive) + +// This class contains an event called m_evComplete which is signalled when +// the current state is completed and is not signalled when we are waiting to +// complete the last state transition. As mentioned above the only time we +// use this at the moment is when we wait for a media sample in paused state +// If while we are waiting we receive an end of stream notification from the +// source filter then we know no data is imminent so we can reset the event +// This means that when we transition to paused the source filter must call +// end of stream on us or send us an image otherwise we'll hang indefinately + + +// Simple internal way of getting the real state + +FILTER_STATE CBaseRenderer::GetRealState() { + return m_State; +} + + +// The renderer doesn't complete the full transition to paused states until +// it has got one media sample to render. If you ask it for its state while +// it's waiting it will return the state along with VFW_S_STATE_INTERMEDIATE + +STDMETHODIMP CBaseRenderer::GetState(DWORD dwMSecs,FILTER_STATE *State) +{ + CheckPointer(State,E_POINTER); + + if (WaitDispatchingMessages(m_evComplete, dwMSecs) == WAIT_TIMEOUT) { + *State = m_State; + return VFW_S_STATE_INTERMEDIATE; + } + *State = m_State; + return NOERROR; +} + + +// If we're pausing and we have no samples we don't complete the transition +// to State_Paused and we return S_FALSE. However if the m_bAbort flag has +// been set then all samples are rejected so there is no point waiting for +// one. If we do have a sample then return NOERROR. We will only ever return +// VFW_S_STATE_INTERMEDIATE from GetState after being paused with no sample +// (calling GetState after either being stopped or Run will NOT return this) + +HRESULT CBaseRenderer::CompleteStateChange(FILTER_STATE OldState) +{ + // Allow us to be paused when disconnected + + if (m_pInputPin->IsConnected() == FALSE) { + Ready(); + return S_OK; + } + + // Have we run off the end of stream + + if (IsEndOfStream() == TRUE) { + Ready(); + return S_OK; + } + + // Make sure we get fresh data after being stopped + + if (HaveCurrentSample() == TRUE) { + if (OldState != State_Stopped) { + Ready(); + return S_OK; + } + } + NotReady(); + return S_FALSE; +} + + +// When we stop the filter the things we do are:- + +// Decommit the allocator being used in the connection +// Release the source filter if it's waiting in Receive +// Cancel any advise link we set up with the clock +// Any end of stream signalled is now obsolete so reset +// Allow us to be stopped when we are not connected + +STDMETHODIMP CBaseRenderer::Stop() +{ + CAutoLock cRendererLock(&m_InterfaceLock); + + // Make sure there really is a state change + + if (m_State == State_Stopped) { + return NOERROR; + } + + // Is our input pin connected + + if (m_pInputPin->IsConnected() == FALSE) { + NOTE("Input pin is not connected"); + m_State = State_Stopped; + return NOERROR; + } + + CBaseFilter::Stop(); + + // If we are going into a stopped state then we must decommit whatever + // allocator we are using it so that any source filter waiting in the + // GetBuffer can be released and unlock themselves for a state change + + if (m_pInputPin->Allocator()) { + m_pInputPin->Allocator()->Decommit(); + } + + // Cancel any scheduled rendering + + SetRepaintStatus(TRUE); + StopStreaming(); + SourceThreadCanWait(FALSE); + ResetEndOfStream(); + CancelNotification(); + + // There should be no outstanding clock advise + ASSERT(CancelNotification() == S_FALSE); + ASSERT(WAIT_TIMEOUT == WaitForSingleObject((HANDLE)m_RenderEvent,0)); + ASSERT(m_EndOfStreamTimer == 0); + + Ready(); + WaitForReceiveToComplete(); + m_bAbort = FALSE; + + return NOERROR; +} + + +// When we pause the filter the things we do are:- + +// Commit the allocator being used in the connection +// Allow a source filter thread to wait in Receive +// Cancel any clock advise link (we may be running) +// Possibly complete the state change if we have data +// Allow us to be paused when we are not connected + +STDMETHODIMP CBaseRenderer::Pause() +{ + CAutoLock cRendererLock(&m_InterfaceLock); + FILTER_STATE OldState = m_State; + ASSERT(m_pInputPin->IsFlushing() == FALSE); + + // Make sure there really is a state change + + if (m_State == State_Paused) { + return CompleteStateChange(State_Paused); + } + + // Has our input pin been connected + + if (m_pInputPin->IsConnected() == FALSE) { + NOTE("Input pin is not connected"); + m_State = State_Paused; + return CompleteStateChange(State_Paused); + } + + // Pause the base filter class + + HRESULT hr = CBaseFilter::Pause(); + if (FAILED(hr)) { + NOTE("Pause failed"); + return hr; + } + + // Enable EC_REPAINT events again + + SetRepaintStatus(TRUE); + StopStreaming(); + SourceThreadCanWait(TRUE); + CancelNotification(); + ResetEndOfStreamTimer(); + + // If we are going into a paused state then we must commit whatever + // allocator we are using it so that any source filter can call the + // GetBuffer and expect to get a buffer without returning an error + + if (m_pInputPin->Allocator()) { + m_pInputPin->Allocator()->Commit(); + } + + // There should be no outstanding advise + ASSERT(CancelNotification() == S_FALSE); + ASSERT(WAIT_TIMEOUT == WaitForSingleObject((HANDLE)m_RenderEvent,0)); + ASSERT(m_EndOfStreamTimer == 0); + ASSERT(m_pInputPin->IsFlushing() == FALSE); + + // When we come out of a stopped state we must clear any image we were + // holding onto for frame refreshing. Since renderers see state changes + // first we can reset ourselves ready to accept the source thread data + // Paused or running after being stopped causes the current position to + // be reset so we're not interested in passing end of stream signals + + if (OldState == State_Stopped) { + m_bAbort = FALSE; + ClearPendingSample(); + } + return CompleteStateChange(OldState); +} + + +// When we run the filter the things we do are:- + +// Commit the allocator being used in the connection +// Allow a source filter thread to wait in Receive +// Signal the render event just to get us going +// Start the base class by calling StartStreaming +// Allow us to be run when we are not connected +// Signal EC_COMPLETE if we are not connected + +STDMETHODIMP CBaseRenderer::Run(REFERENCE_TIME StartTime) +{ + CAutoLock cRendererLock(&m_InterfaceLock); + FILTER_STATE OldState = m_State; + + // Make sure there really is a state change + + if (m_State == State_Running) { + return NOERROR; + } + + // Send EC_COMPLETE if we're not connected + + if (m_pInputPin->IsConnected() == FALSE) { + NotifyEvent(EC_COMPLETE,S_OK,(LONG_PTR)(IBaseFilter *)this); + m_State = State_Running; + return NOERROR; + } + + Ready(); + + // Pause the base filter class + + HRESULT hr = CBaseFilter::Run(StartTime); + if (FAILED(hr)) { + NOTE("Run failed"); + return hr; + } + + // Allow the source thread to wait + ASSERT(m_pInputPin->IsFlushing() == FALSE); + SourceThreadCanWait(TRUE); + SetRepaintStatus(FALSE); + + // There should be no outstanding advise + ASSERT(CancelNotification() == S_FALSE); + ASSERT(WAIT_TIMEOUT == WaitForSingleObject((HANDLE)m_RenderEvent,0)); + ASSERT(m_EndOfStreamTimer == 0); + ASSERT(m_pInputPin->IsFlushing() == FALSE); + + // If we are going into a running state then we must commit whatever + // allocator we are using it so that any source filter can call the + // GetBuffer and expect to get a buffer without returning an error + + if (m_pInputPin->Allocator()) { + m_pInputPin->Allocator()->Commit(); + } + + // When we come out of a stopped state we must clear any image we were + // holding onto for frame refreshing. Since renderers see state changes + // first we can reset ourselves ready to accept the source thread data + // Paused or running after being stopped causes the current position to + // be reset so we're not interested in passing end of stream signals + + if (OldState == State_Stopped) { + m_bAbort = FALSE; + ClearPendingSample(); + } + return StartStreaming(); +} + + +// Return the number of input pins we support + +int CBaseRenderer::GetPinCount() +{ + if (m_pInputPin == NULL) { + // Try to create it + (void)GetPin(0); + } + return m_pInputPin != NULL ? 1 : 0; +} + + +// We only support one input pin and it is numbered zero + +CBasePin *CBaseRenderer::GetPin(int n) +{ + CAutoLock cObjectCreationLock(&m_ObjectCreationLock); + + // Should only ever be called with zero + ASSERT(n == 0); + + if (n != 0) { + return NULL; + } + + // Create the input pin if not already done so + + if (m_pInputPin == NULL) { + + // hr must be initialized to NOERROR because + // CRendererInputPin's constructor only changes + // hr's value if an error occurs. + HRESULT hr = NOERROR; + + m_pInputPin = new CRendererInputPin(this,&hr,L"In"); + if (NULL == m_pInputPin) { + return NULL; + } + + if (FAILED(hr)) { + delete m_pInputPin; + m_pInputPin = NULL; + return NULL; + } + } + return m_pInputPin; +} + + +// If "In" then return the IPin for our input pin, otherwise NULL and error + +STDMETHODIMP CBaseRenderer::FindPin(LPCWSTR Id, __deref_out IPin **ppPin) +{ + CheckPointer(ppPin,E_POINTER); + + if (0==lstrcmpW(Id,L"In")) { + *ppPin = GetPin(0); + if (*ppPin) { + (*ppPin)->AddRef(); + } else { + return E_OUTOFMEMORY; + } + } else { + *ppPin = NULL; + return VFW_E_NOT_FOUND; + } + return NOERROR; +} + + +// Called when the input pin receives an EndOfStream notification. If we have +// not got a sample, then notify EC_COMPLETE now. If we have samples, then set +// m_bEOS and check for this on completing samples. If we're waiting to pause +// then complete the transition to paused state by setting the state event + +HRESULT CBaseRenderer::EndOfStream() +{ + // Ignore these calls if we are stopped + + if (m_State == State_Stopped) { + return NOERROR; + } + + // If we have a sample then wait for it to be rendered + + m_bEOS = TRUE; + if (m_pMediaSample) { + return NOERROR; + } + + // If we are waiting for pause then we are now ready since we cannot now + // carry on waiting for a sample to arrive since we are being told there + // won't be any. This sets an event that the GetState function picks up + + Ready(); + + // Only signal completion now if we are running otherwise queue it until + // we do run in StartStreaming. This is used when we seek because a seek + // causes a pause where early notification of completion is misleading + + if (m_bStreaming) { + SendEndOfStream(); + } + return NOERROR; +} + + +// When we are told to flush we should release the source thread + +HRESULT CBaseRenderer::BeginFlush() +{ + // If paused then report state intermediate until we get some data + + if (m_State == State_Paused) { + NotReady(); + } + + SourceThreadCanWait(FALSE); + CancelNotification(); + ClearPendingSample(); + // Wait for Receive to complete + WaitForReceiveToComplete(); + + return NOERROR; +} + + +// After flushing the source thread can wait in Receive again + +HRESULT CBaseRenderer::EndFlush() +{ + // Reset the current sample media time + if (m_pPosition) m_pPosition->ResetMediaTime(); + + // There should be no outstanding advise + + ASSERT(CancelNotification() == S_FALSE); + SourceThreadCanWait(TRUE); + return NOERROR; +} + + +// We can now send EC_REPAINTs if so required + +HRESULT CBaseRenderer::CompleteConnect(IPin *pReceivePin) +{ + // The caller should always hold the interface lock because + // the function uses CBaseFilter::m_State. + ASSERT(CritCheckIn(&m_InterfaceLock)); + + m_bAbort = FALSE; + + if (State_Running == GetRealState()) { + HRESULT hr = StartStreaming(); + if (FAILED(hr)) { + return hr; + } + + SetRepaintStatus(FALSE); + } else { + SetRepaintStatus(TRUE); + } + + return NOERROR; +} + + +// Called when we go paused or running + +HRESULT CBaseRenderer::Active() +{ + return NOERROR; +} + + +// Called when we go into a stopped state + +HRESULT CBaseRenderer::Inactive() +{ + if (m_pPosition) { + m_pPosition->ResetMediaTime(); + } + // People who derive from this may want to override this behaviour + // to keep hold of the sample in some circumstances + ClearPendingSample(); + + return NOERROR; +} + + +// Tell derived classes about the media type agreed + +HRESULT CBaseRenderer::SetMediaType(const CMediaType *pmt) +{ + return NOERROR; +} + + +// When we break the input pin connection we should reset the EOS flags. When +// we are asked for either IMediaPosition or IMediaSeeking we will create a +// CPosPassThru object to handles media time pass through. When we're handed +// samples we store (by calling CPosPassThru::RegisterMediaTime) their media +// times so we can then return a real current position of data being rendered + +HRESULT CBaseRenderer::BreakConnect() +{ + // Do we have a quality management sink + + if (m_pQSink) { + m_pQSink->Release(); + m_pQSink = NULL; + } + + // Check we have a valid connection + + if (m_pInputPin->IsConnected() == FALSE) { + return S_FALSE; + } + + // Check we are stopped before disconnecting + if (m_State != State_Stopped && !m_pInputPin->CanReconnectWhenActive()) { + return VFW_E_NOT_STOPPED; + } + + SetRepaintStatus(FALSE); + ResetEndOfStream(); + ClearPendingSample(); + m_bAbort = FALSE; + + if (State_Running == m_State) { + StopStreaming(); + } + + return NOERROR; +} + + +// Retrieves the sample times for this samples (note the sample times are +// passed in by reference not value). We return S_FALSE to say schedule this +// sample according to the times on the sample. We also return S_OK in +// which case the object should simply render the sample data immediately + +HRESULT CBaseRenderer::GetSampleTimes(IMediaSample *pMediaSample, + __out REFERENCE_TIME *pStartTime, + __out REFERENCE_TIME *pEndTime) +{ + ASSERT(m_dwAdvise == 0); + ASSERT(pMediaSample); + + // If the stop time for this sample is before or the same as start time, + // then just ignore it (release it) and schedule the next one in line + // Source filters should always fill in the start and end times properly! + + if (SUCCEEDED(pMediaSample->GetTime(pStartTime, pEndTime))) { + if (*pEndTime < *pStartTime) { + return VFW_E_START_TIME_AFTER_END; + } + } else { + // no time set in the sample... draw it now? + return S_OK; + } + + // Can't synchronise without a clock so we return S_OK which tells the + // caller that the sample should be rendered immediately without going + // through the overhead of setting a timer advise link with the clock + + if (m_pClock == NULL) { + return S_OK; + } + return ShouldDrawSampleNow(pMediaSample,pStartTime,pEndTime); +} + + +// By default all samples are drawn according to their time stamps so we +// return S_FALSE. Returning S_OK means draw immediately, this is used +// by the derived video renderer class in its quality management. + +HRESULT CBaseRenderer::ShouldDrawSampleNow(IMediaSample *pMediaSample, + __out REFERENCE_TIME *ptrStart, + __out REFERENCE_TIME *ptrEnd) +{ + return S_FALSE; +} + + +// We must always reset the current advise time to zero after a timer fires +// because there are several possible ways which lead us not to do any more +// scheduling such as the pending image being cleared after state changes + +void CBaseRenderer::SignalTimerFired() +{ + m_dwAdvise = 0; +} + + +// Cancel any notification currently scheduled. This is called by the owning +// window object when it is told to stop streaming. If there is no timer link +// outstanding then calling this is benign otherwise we go ahead and cancel +// We must always reset the render event as the quality management code can +// signal immediate rendering by setting the event without setting an advise +// link. If we're subsequently stopped and run the first attempt to setup an +// advise link with the reference clock will find the event still signalled + +HRESULT CBaseRenderer::CancelNotification() +{ + ASSERT(m_dwAdvise == 0 || m_pClock); + DWORD_PTR dwAdvise = m_dwAdvise; + + // Have we a live advise link + + if (m_dwAdvise) { + m_pClock->Unadvise(m_dwAdvise); + SignalTimerFired(); + ASSERT(m_dwAdvise == 0); + } + + // Clear the event and return our status + + m_RenderEvent.Reset(); + return (dwAdvise ? S_OK : S_FALSE); +} + + +// Responsible for setting up one shot advise links with the clock +// Return FALSE if the sample is to be dropped (not drawn at all) +// Return TRUE if the sample is to be drawn and in this case also +// arrange for m_RenderEvent to be set at the appropriate time + +BOOL CBaseRenderer::ScheduleSample(IMediaSample *pMediaSample) +{ + REFERENCE_TIME StartSample, EndSample; + + // Is someone pulling our leg + + if (pMediaSample == NULL) { + return FALSE; + } + + // Get the next sample due up for rendering. If there aren't any ready + // then GetNextSampleTimes returns an error. If there is one to be done + // then it succeeds and yields the sample times. If it is due now then + // it returns S_OK other if it's to be done when due it returns S_FALSE + + HRESULT hr = GetSampleTimes(pMediaSample, &StartSample, &EndSample); + if (FAILED(hr)) { + return FALSE; + } + + // If we don't have a reference clock then we cannot set up the advise + // time so we simply set the event indicating an image to render. This + // will cause us to run flat out without any timing or synchronisation + + if (hr == S_OK) { + EXECUTE_ASSERT(SetEvent((HANDLE) m_RenderEvent)); + return TRUE; + } + + ASSERT(m_dwAdvise == 0); + ASSERT(m_pClock); + ASSERT(WAIT_TIMEOUT == WaitForSingleObject((HANDLE)m_RenderEvent,0)); + + // We do have a valid reference clock interface so we can ask it to + // set an event when the image comes due for rendering. We pass in + // the reference time we were told to start at and also the current + // stream time which is the offset from the start reference time + + hr = m_pClock->AdviseTime( + (REFERENCE_TIME) m_tStart, // Start run time + StartSample, // Stream time + (HEVENT)(HANDLE) m_RenderEvent, // Render notification + &m_dwAdvise); // Advise cookie + + if (SUCCEEDED(hr)) { + return TRUE; + } + + // We could not schedule the next sample for rendering despite the fact + // we have a valid sample here. This is a fair indication that either + // the system clock is wrong or the time stamp for the sample is duff + + ASSERT(m_dwAdvise == 0); + return FALSE; +} + + +// This is called when a sample comes due for rendering. We pass the sample +// on to the derived class. After rendering we will initialise the timer for +// the next sample, NOTE signal that the last one fired first, if we don't +// do this it thinks there is still one outstanding that hasn't completed + +HRESULT CBaseRenderer::Render(IMediaSample *pMediaSample) +{ + // If the media sample is NULL then we will have been notified by the + // clock that another sample is ready but in the mean time someone has + // stopped us streaming which causes the next sample to be released + + if (pMediaSample == NULL) { + return S_FALSE; + } + + // If we have stopped streaming then don't render any more samples, the + // thread that got in and locked us and then reset this flag does not + // clear the pending sample as we can use it to refresh any output device + + if (m_bStreaming == FALSE) { + return S_FALSE; + } + + // Time how long the rendering takes + + OnRenderStart(pMediaSample); + DoRenderSample(pMediaSample); + OnRenderEnd(pMediaSample); + + return NOERROR; +} + + +// Checks if there is a sample waiting at the renderer + +BOOL CBaseRenderer::HaveCurrentSample() +{ + CAutoLock cRendererLock(&m_RendererLock); + return (m_pMediaSample == NULL ? FALSE : TRUE); +} + + +// Returns the current sample waiting at the video renderer. We AddRef the +// sample before returning so that should it come due for rendering the +// person who called this method will hold the remaining reference count +// that will stop the sample being added back onto the allocator free list + +IMediaSample *CBaseRenderer::GetCurrentSample() +{ + CAutoLock cRendererLock(&m_RendererLock); + if (m_pMediaSample) { + m_pMediaSample->AddRef(); + } + return m_pMediaSample; +} + + +// Called when the source delivers us a sample. We go through a few checks to +// make sure the sample can be rendered. If we are running (streaming) then we +// have the sample scheduled with the reference clock, if we are not streaming +// then we have received an sample in paused mode so we can complete any state +// transition. On leaving this function everything will be unlocked so an app +// thread may get in and change our state to stopped (for example) in which +// case it will also signal the thread event so that our wait call is stopped + +HRESULT CBaseRenderer::PrepareReceive(IMediaSample *pMediaSample) +{ + CAutoLock cInterfaceLock(&m_InterfaceLock); + m_bInReceive = TRUE; + + // Check our flushing and filter state + + // This function must hold the interface lock because it calls + // CBaseInputPin::Receive() and CBaseInputPin::Receive() uses + // CBasePin::m_bRunTimeError. + HRESULT hr = m_pInputPin->CBaseInputPin::Receive(pMediaSample); + + if (hr != NOERROR) { + m_bInReceive = FALSE; + return E_FAIL; + } + + // Has the type changed on a media sample. We do all rendering + // synchronously on the source thread, which has a side effect + // that only one buffer is ever outstanding. Therefore when we + // have Receive called we can go ahead and change the format + // Since the format change can cause a SendMessage we just don't + // lock + if (m_pInputPin->SampleProps()->pMediaType) { + hr = m_pInputPin->SetMediaType( + (CMediaType *)m_pInputPin->SampleProps()->pMediaType); + if (FAILED(hr)) { + m_bInReceive = FALSE; + return hr; + } + } + + + CAutoLock cSampleLock(&m_RendererLock); + + ASSERT(IsActive() == TRUE); + ASSERT(m_pInputPin->IsFlushing() == FALSE); + ASSERT(m_pInputPin->IsConnected() == TRUE); + ASSERT(m_pMediaSample == NULL); + + // Return an error if we already have a sample waiting for rendering + // source pins must serialise the Receive calls - we also check that + // no data is being sent after the source signalled an end of stream + + if (m_pMediaSample || m_bEOS || m_bAbort) { + Ready(); + m_bInReceive = FALSE; + return E_UNEXPECTED; + } + + // Store the media times from this sample + if (m_pPosition) m_pPosition->RegisterMediaTime(pMediaSample); + + // Schedule the next sample if we are streaming + + if ((m_bStreaming == TRUE) && (ScheduleSample(pMediaSample) == FALSE)) { + ASSERT(WAIT_TIMEOUT == WaitForSingleObject((HANDLE)m_RenderEvent,0)); + ASSERT(CancelNotification() == S_FALSE); + m_bInReceive = FALSE; + return VFW_E_SAMPLE_REJECTED; + } + + // Store the sample end time for EC_COMPLETE handling + m_SignalTime = m_pInputPin->SampleProps()->tStop; + + // BEWARE we sometimes keep the sample even after returning the thread to + // the source filter such as when we go into a stopped state (we keep it + // to refresh the device with) so we must AddRef it to keep it safely. If + // we start flushing the source thread is released and any sample waiting + // will be released otherwise GetBuffer may never return (see BeginFlush) + + m_pMediaSample = pMediaSample; + m_pMediaSample->AddRef(); + + if (m_bStreaming == FALSE) { + SetRepaintStatus(TRUE); + } + return NOERROR; +} + + +// Called by the source filter when we have a sample to render. Under normal +// circumstances we set an advise link with the clock, wait for the time to +// arrive and then render the data using the PURE virtual DoRenderSample that +// the derived class will have overriden. After rendering the sample we may +// also signal EOS if it was the last one sent before EndOfStream was called + +HRESULT CBaseRenderer::Receive(IMediaSample *pSample) +{ + ASSERT(pSample); + + // It may return VFW_E_SAMPLE_REJECTED code to say don't bother + + HRESULT hr = PrepareReceive(pSample); + ASSERT(m_bInReceive == SUCCEEDED(hr)); + if (FAILED(hr)) { + if (hr == VFW_E_SAMPLE_REJECTED) { + return NOERROR; + } + return hr; + } + + // We realize the palette in "PrepareRender()" so we have to give away the + // filter lock here. + if (m_State == State_Paused) { + PrepareRender(); + // no need to use InterlockedExchange + m_bInReceive = FALSE; + { + // We must hold both these locks + CAutoLock cRendererLock(&m_InterfaceLock); + if (m_State == State_Stopped) + return NOERROR; + + m_bInReceive = TRUE; + CAutoLock cSampleLock(&m_RendererLock); + OnReceiveFirstSample(pSample); + } + Ready(); + } + // Having set an advise link with the clock we sit and wait. We may be + // awoken by the clock firing or by a state change. The rendering call + // will lock the critical section and check we can still render the data + + hr = WaitForRenderTime(); + if (FAILED(hr)) { + m_bInReceive = FALSE; + return NOERROR; + } + + PrepareRender(); + + // Set this here and poll it until we work out the locking correctly + // It can't be right that the streaming stuff grabs the interface + // lock - after all we want to be able to wait for this stuff + // to complete + m_bInReceive = FALSE; + + // We must hold both these locks + CAutoLock cRendererLock(&m_InterfaceLock); + + // since we gave away the filter wide lock, the sate of the filter could + // have chnaged to Stopped + if (m_State == State_Stopped) + return NOERROR; + + CAutoLock cSampleLock(&m_RendererLock); + + // Deal with this sample + + Render(m_pMediaSample); + ClearPendingSample(); + SendEndOfStream(); + CancelNotification(); + return NOERROR; +} + + +// This is called when we stop or are inactivated to clear the pending sample +// We release the media sample interface so that they can be allocated to the +// source filter again, unless of course we are changing state to inactive in +// which case GetBuffer will return an error. We must also reset the current +// media sample to NULL so that we know we do not currently have an image + +HRESULT CBaseRenderer::ClearPendingSample() +{ + CAutoLock cRendererLock(&m_RendererLock); + if (m_pMediaSample) { + m_pMediaSample->Release(); + m_pMediaSample = NULL; + } + return NOERROR; +} + + +// Used to signal end of stream according to the sample end time + +void CALLBACK EndOfStreamTimer(UINT uID, // Timer identifier + UINT uMsg, // Not currently used + DWORD_PTR dwUser,// User information + DWORD_PTR dw1, // Windows reserved + DWORD_PTR dw2) // is also reserved +{ + CBaseRenderer *pRenderer = (CBaseRenderer *) dwUser; + NOTE1("EndOfStreamTimer called (%d)",uID); + pRenderer->TimerCallback(); +} + +// Do the timer callback work +void CBaseRenderer::TimerCallback() +{ + // Lock for synchronization (but don't hold this lock when calling + // timeKillEvent) + CAutoLock cRendererLock(&m_RendererLock); + + // See if we should signal end of stream now + + if (m_EndOfStreamTimer) { + m_EndOfStreamTimer = 0; + SendEndOfStream(); + } +} + + +// If we are at the end of the stream signal the filter graph but do not set +// the state flag back to FALSE. Once we drop off the end of the stream we +// leave the flag set (until a subsequent ResetEndOfStream). Each sample we +// get delivered will update m_SignalTime to be the last sample's end time. +// We must wait this long before signalling end of stream to the filtergraph + +#define TIMEOUT_DELIVERYWAIT 50 +#define TIMEOUT_RESOLUTION 10 + +HRESULT CBaseRenderer::SendEndOfStream() +{ + ASSERT(CritCheckIn(&m_RendererLock)); + if (m_bEOS == FALSE || m_bEOSDelivered || m_EndOfStreamTimer) { + return NOERROR; + } + + // If there is no clock then signal immediately + if (m_pClock == NULL) { + return NotifyEndOfStream(); + } + + // How long into the future is the delivery time + + REFERENCE_TIME Signal = m_tStart + m_SignalTime; + REFERENCE_TIME CurrentTime; + m_pClock->GetTime(&CurrentTime); + LONG Delay = LONG((Signal - CurrentTime) / 10000); + + // Dump the timing information to the debugger + + NOTE1("Delay until end of stream delivery %d",Delay); + NOTE1("Current %s",(LPCTSTR)CDisp((LONGLONG)CurrentTime)); + NOTE1("Signal %s",(LPCTSTR)CDisp((LONGLONG)Signal)); + + // Wait for the delivery time to arrive + + if (Delay < TIMEOUT_DELIVERYWAIT) { + return NotifyEndOfStream(); + } + + // Signal a timer callback on another worker thread + + m_EndOfStreamTimer = CompatibleTimeSetEvent((UINT) Delay, // Period of timer + TIMEOUT_RESOLUTION, // Timer resolution + EndOfStreamTimer, // Callback function + DWORD_PTR(this), // Used information + TIME_ONESHOT); // Type of callback + if (m_EndOfStreamTimer == 0) { + return NotifyEndOfStream(); + } + return NOERROR; +} + + +// Signals EC_COMPLETE to the filtergraph manager + +HRESULT CBaseRenderer::NotifyEndOfStream() +{ + CAutoLock cRendererLock(&m_RendererLock); + ASSERT(m_bEOSDelivered == FALSE); + ASSERT(m_EndOfStreamTimer == 0); + + // Has the filter changed state + + if (m_bStreaming == FALSE) { + ASSERT(m_EndOfStreamTimer == 0); + return NOERROR; + } + + // Reset the end of stream timer + m_EndOfStreamTimer = 0; + + // If we've been using the IMediaPosition interface, set it's start + // and end media "times" to the stop position by hand. This ensures + // that we actually get to the end, even if the MPEG guestimate has + // been bad or if the quality management dropped the last few frames + + if (m_pPosition) m_pPosition->EOS(); + m_bEOSDelivered = TRUE; + NOTE("Sending EC_COMPLETE..."); + return NotifyEvent(EC_COMPLETE,S_OK,(LONG_PTR)(IBaseFilter *)this); +} + + +// Reset the end of stream flag, this is typically called when we transfer to +// stopped states since that resets the current position back to the start so +// we will receive more samples or another EndOfStream if there aren't any. We +// keep two separate flags one to say we have run off the end of the stream +// (this is the m_bEOS flag) and another to say we have delivered EC_COMPLETE +// to the filter graph. We need the latter otherwise we can end up sending an +// EC_COMPLETE every time the source changes state and calls our EndOfStream + +HRESULT CBaseRenderer::ResetEndOfStream() +{ + ResetEndOfStreamTimer(); + CAutoLock cRendererLock(&m_RendererLock); + + m_bEOS = FALSE; + m_bEOSDelivered = FALSE; + m_SignalTime = 0; + + return NOERROR; +} + + +// Kills any outstanding end of stream timer + +void CBaseRenderer::ResetEndOfStreamTimer() +{ + ASSERT(CritCheckOut(&m_RendererLock)); + if (m_EndOfStreamTimer) { + timeKillEvent(m_EndOfStreamTimer); + m_EndOfStreamTimer = 0; + } +} + + +// This is called when we start running so that we can schedule any pending +// image we have with the clock and display any timing information. If we +// don't have any sample but we have queued an EOS flag then we send it. If +// we do have a sample then we wait until that has been rendered before we +// signal the filter graph otherwise we may change state before it's done + +HRESULT CBaseRenderer::StartStreaming() +{ + CAutoLock cRendererLock(&m_RendererLock); + if (m_bStreaming == TRUE) { + return NOERROR; + } + + // Reset the streaming times ready for running + + m_bStreaming = TRUE; + + timeBeginPeriod(1); + OnStartStreaming(); + + // There should be no outstanding advise + ASSERT(WAIT_TIMEOUT == WaitForSingleObject((HANDLE)m_RenderEvent,0)); + ASSERT(CancelNotification() == S_FALSE); + + // If we have an EOS and no data then deliver it now + + if (m_pMediaSample == NULL) { + return SendEndOfStream(); + } + + // Have the data rendered + + ASSERT(m_pMediaSample); + if (!ScheduleSample(m_pMediaSample)) + m_RenderEvent.Set(); + + return NOERROR; +} + + +// This is called when we stop streaming so that we can set our internal flag +// indicating we are not now to schedule any more samples arriving. The state +// change methods in the filter implementation take care of cancelling any +// clock advise link we have set up and clearing any pending sample we have + +HRESULT CBaseRenderer::StopStreaming() +{ + CAutoLock cRendererLock(&m_RendererLock); + m_bEOSDelivered = FALSE; + + if (m_bStreaming == TRUE) { + m_bStreaming = FALSE; + OnStopStreaming(); + timeEndPeriod(1); + } + return NOERROR; +} + + +// We have a boolean flag that is reset when we have signalled EC_REPAINT to +// the filter graph. We set this when we receive an image so that should any +// conditions arise again we can send another one. By having a flag we ensure +// we don't flood the filter graph with redundant calls. We do not set the +// event when we receive an EndOfStream call since there is no point in us +// sending further EC_REPAINTs. In particular the AutoShowWindow method and +// the DirectDraw object use this method to control the window repainting + +void CBaseRenderer::SetRepaintStatus(BOOL bRepaint) +{ + CAutoLock cSampleLock(&m_RendererLock); + m_bRepaintStatus = bRepaint; +} + + +// Pass the window handle to the upstream filter + +void CBaseRenderer::SendNotifyWindow(IPin *pPin,HWND hwnd) +{ + IMediaEventSink *pSink; + + // Does the pin support IMediaEventSink + HRESULT hr = pPin->QueryInterface(IID_IMediaEventSink,(void **)&pSink); + if (SUCCEEDED(hr)) { + pSink->Notify(EC_NOTIFY_WINDOW,LONG_PTR(hwnd),0); + pSink->Release(); + } + NotifyEvent(EC_NOTIFY_WINDOW,LONG_PTR(hwnd),0); +} + + +// Signal an EC_REPAINT to the filter graph. This can be used to have data +// sent to us. For example when a video window is first displayed it may +// not have an image to display, at which point it signals EC_REPAINT. The +// filtergraph will either pause the graph if stopped or if already paused +// it will call put_CurrentPosition of the current position. Setting the +// current position to itself has the stream flushed and the image resent + +#define RLOG(_x_) DbgLog((LOG_TRACE,1,TEXT(_x_))); + +void CBaseRenderer::SendRepaint() +{ + CAutoLock cSampleLock(&m_RendererLock); + ASSERT(m_pInputPin); + + // We should not send repaint notifications when... + // - An end of stream has been notified + // - Our input pin is being flushed + // - The input pin is not connected + // - We have aborted a video playback + // - There is a repaint already sent + + if (m_bAbort == FALSE) { + if (m_pInputPin->IsConnected() == TRUE) { + if (m_pInputPin->IsFlushing() == FALSE) { + if (IsEndOfStream() == FALSE) { + if (m_bRepaintStatus == TRUE) { + IPin *pPin = (IPin *) m_pInputPin; + NotifyEvent(EC_REPAINT,(LONG_PTR) pPin,0); + SetRepaintStatus(FALSE); + RLOG("Sending repaint"); + } + } + } + } + } +} + + +// When a video window detects a display change (WM_DISPLAYCHANGE message) it +// can send an EC_DISPLAY_CHANGED event code along with the renderer pin. The +// filtergraph will stop everyone and reconnect our input pin. As we're then +// reconnected we can accept the media type that matches the new display mode +// since we may no longer be able to draw the current image type efficiently + +BOOL CBaseRenderer::OnDisplayChange() +{ + // Ignore if we are not connected yet + + CAutoLock cSampleLock(&m_RendererLock); + if (m_pInputPin->IsConnected() == FALSE) { + return FALSE; + } + + RLOG("Notification of EC_DISPLAY_CHANGE"); + + // Pass our input pin as parameter on the event + + IPin *pPin = (IPin *) m_pInputPin; + m_pInputPin->AddRef(); + NotifyEvent(EC_DISPLAY_CHANGED,(LONG_PTR) pPin,0); + SetAbortSignal(TRUE); + ClearPendingSample(); + m_pInputPin->Release(); + + return TRUE; +} + + +// Called just before we start drawing. +// Store the current time in m_trRenderStart to allow the rendering time to be +// logged. Log the time stamp of the sample and how late it is (neg is early) + +void CBaseRenderer::OnRenderStart(IMediaSample *pMediaSample) +{ +#ifdef PERF + REFERENCE_TIME trStart, trEnd; + pMediaSample->GetTime(&trStart, &trEnd); + + MSR_INTEGER(m_idBaseStamp, (int)trStart); // dump low order 32 bits + + m_pClock->GetTime(&m_trRenderStart); + MSR_INTEGER(0, (int)m_trRenderStart); + REFERENCE_TIME trStream; + trStream = m_trRenderStart-m_tStart; // convert reftime to stream time + MSR_INTEGER(0,(int)trStream); + + const int trLate = (int)(trStream - trStart); + MSR_INTEGER(m_idBaseAccuracy, trLate/10000); // dump in mSec +#endif + +} // OnRenderStart + + +// Called directly after drawing an image. +// calculate the time spent drawing and log it. + +void CBaseRenderer::OnRenderEnd(IMediaSample *pMediaSample) +{ +#ifdef PERF + REFERENCE_TIME trNow; + m_pClock->GetTime(&trNow); + MSR_INTEGER(0,(int)trNow); + int t = (int)((trNow - m_trRenderStart)/10000); // convert UNITS->msec + MSR_INTEGER(m_idBaseRenderTime, t); +#endif +} // OnRenderEnd + + + + +// Constructor must be passed the base renderer object + +CRendererInputPin::CRendererInputPin(__inout CBaseRenderer *pRenderer, + __inout HRESULT *phr, + __in_opt LPCWSTR pPinName) : + CBaseInputPin(NAME("Renderer pin"), + pRenderer, + &pRenderer->m_InterfaceLock, + (HRESULT *) phr, + pPinName) +{ + m_pRenderer = pRenderer; + ASSERT(m_pRenderer); +} + + +// Signals end of data stream on the input pin + +STDMETHODIMP CRendererInputPin::EndOfStream() +{ + CAutoLock cRendererLock(&m_pRenderer->m_InterfaceLock); + CAutoLock cSampleLock(&m_pRenderer->m_RendererLock); + + // Make sure we're streaming ok + + HRESULT hr = CheckStreaming(); + if (hr != NOERROR) { + return hr; + } + + // Pass it onto the renderer + + hr = m_pRenderer->EndOfStream(); + if (SUCCEEDED(hr)) { + hr = CBaseInputPin::EndOfStream(); + } + return hr; +} + + +// Signals start of flushing on the input pin - we do the final reset end of +// stream with the renderer lock unlocked but with the interface lock locked +// We must do this because we call timeKillEvent, our timer callback method +// has to take the renderer lock to serialise our state. Therefore holding a +// renderer lock when calling timeKillEvent could cause a deadlock condition + +STDMETHODIMP CRendererInputPin::BeginFlush() +{ + CAutoLock cRendererLock(&m_pRenderer->m_InterfaceLock); + { + CAutoLock cSampleLock(&m_pRenderer->m_RendererLock); + CBaseInputPin::BeginFlush(); + m_pRenderer->BeginFlush(); + } + return m_pRenderer->ResetEndOfStream(); +} + + +// Signals end of flushing on the input pin + +STDMETHODIMP CRendererInputPin::EndFlush() +{ + CAutoLock cRendererLock(&m_pRenderer->m_InterfaceLock); + CAutoLock cSampleLock(&m_pRenderer->m_RendererLock); + + HRESULT hr = m_pRenderer->EndFlush(); + if (SUCCEEDED(hr)) { + hr = CBaseInputPin::EndFlush(); + } + return hr; +} + + +// Pass the sample straight through to the renderer object + +STDMETHODIMP CRendererInputPin::Receive(IMediaSample *pSample) +{ + HRESULT hr = m_pRenderer->Receive(pSample); + if (FAILED(hr)) { + + // A deadlock could occur if the caller holds the renderer lock and + // attempts to acquire the interface lock. + ASSERT(CritCheckOut(&m_pRenderer->m_RendererLock)); + + { + // The interface lock must be held when the filter is calling + // IsStopped() or IsFlushing(). The interface lock must also + // be held because the function uses m_bRunTimeError. + CAutoLock cRendererLock(&m_pRenderer->m_InterfaceLock); + + // We do not report errors which occur while the filter is stopping, + // flushing or if the m_bAbort flag is set . Errors are expected to + // occur during these operations and the streaming thread correctly + // handles the errors. + if (!IsStopped() && !IsFlushing() && !m_pRenderer->m_bAbort && !m_bRunTimeError) { + + // EC_ERRORABORT's first parameter is the error which caused + // the event and its' last parameter is 0. See the Direct + // Show SDK documentation for more information. + m_pRenderer->NotifyEvent(EC_ERRORABORT,hr,0); + + { + CAutoLock alRendererLock(&m_pRenderer->m_RendererLock); + if (m_pRenderer->IsStreaming() && !m_pRenderer->IsEndOfStreamDelivered()) { + m_pRenderer->NotifyEndOfStream(); + } + } + + m_bRunTimeError = TRUE; + } + } + } + + return hr; +} + + +// Called when the input pin is disconnected + +HRESULT CRendererInputPin::BreakConnect() +{ + HRESULT hr = m_pRenderer->BreakConnect(); + if (FAILED(hr)) { + return hr; + } + return CBaseInputPin::BreakConnect(); +} + + +// Called when the input pin is connected + +HRESULT CRendererInputPin::CompleteConnect(IPin *pReceivePin) +{ + HRESULT hr = m_pRenderer->CompleteConnect(pReceivePin); + if (FAILED(hr)) { + return hr; + } + return CBaseInputPin::CompleteConnect(pReceivePin); +} + + +// Give the pin id of our one and only pin + +STDMETHODIMP CRendererInputPin::QueryId(__deref_out LPWSTR *Id) +{ + CheckPointer(Id,E_POINTER); + + const WCHAR szIn[] = L"In"; + + *Id = (LPWSTR)CoTaskMemAlloc(sizeof(szIn)); + if (*Id == NULL) { + return E_OUTOFMEMORY; + } + CopyMemory(*Id, szIn, sizeof(szIn)); + return NOERROR; +} + + +// Will the filter accept this media type + +HRESULT CRendererInputPin::CheckMediaType(const CMediaType *pmt) +{ + return m_pRenderer->CheckMediaType(pmt); +} + + +// Called when we go paused or running + +HRESULT CRendererInputPin::Active() +{ + return m_pRenderer->Active(); +} + + +// Called when we go into a stopped state + +HRESULT CRendererInputPin::Inactive() +{ + // The caller must hold the interface lock because + // this function uses m_bRunTimeError. + ASSERT(CritCheckIn(&m_pRenderer->m_InterfaceLock)); + + m_bRunTimeError = FALSE; + + return m_pRenderer->Inactive(); +} + + +// Tell derived classes about the media type agreed + +HRESULT CRendererInputPin::SetMediaType(const CMediaType *pmt) +{ + HRESULT hr = CBaseInputPin::SetMediaType(pmt); + if (FAILED(hr)) { + return hr; + } + return m_pRenderer->SetMediaType(pmt); +} + + +// We do not keep an event object to use when setting up a timer link with +// the clock but are given a pointer to one by the owning object through the +// SetNotificationObject method - this must be initialised before starting +// We can override the default quality management process to have it always +// draw late frames, this is currently done by having the following registry +// key (actually an INI key) called DrawLateFrames set to 1 (default is 0) + +const TCHAR AMQUALITY[] = TEXT("ActiveMovie"); +const TCHAR DRAWLATEFRAMES[] = TEXT("DrawLateFrames"); + +CBaseVideoRenderer::CBaseVideoRenderer( + REFCLSID RenderClass, // CLSID for this renderer + __in_opt LPCTSTR pName, // Debug ONLY description + __inout_opt LPUNKNOWN pUnk, // Aggregated owner object + __inout HRESULT *phr) : // General OLE return code + + CBaseRenderer(RenderClass,pName,pUnk,phr), + m_cFramesDropped(0), + m_cFramesDrawn(0), + m_bSupplierHandlingQuality(FALSE) +{ + ResetStreamingTimes(); + +#ifdef PERF + m_idTimeStamp = MSR_REGISTER(TEXT("Frame time stamp")); + m_idEarliness = MSR_REGISTER(TEXT("Earliness fudge")); + m_idTarget = MSR_REGISTER(TEXT("Target (mSec)")); + m_idSchLateTime = MSR_REGISTER(TEXT("mSec late when scheduled")); + m_idDecision = MSR_REGISTER(TEXT("Scheduler decision code")); + m_idQualityRate = MSR_REGISTER(TEXT("Quality rate sent")); + m_idQualityTime = MSR_REGISTER(TEXT("Quality time sent")); + m_idWaitReal = MSR_REGISTER(TEXT("Render wait")); + // m_idWait = MSR_REGISTER(TEXT("wait time recorded (msec)")); + m_idFrameAccuracy = MSR_REGISTER(TEXT("Frame accuracy (msecs)")); + m_bDrawLateFrames = GetProfileInt(AMQUALITY, DRAWLATEFRAMES, FALSE); + //m_idSendQuality = MSR_REGISTER(TEXT("Processing Quality message")); + + m_idRenderAvg = MSR_REGISTER(TEXT("Render draw time Avg")); + m_idFrameAvg = MSR_REGISTER(TEXT("FrameAvg")); + m_idWaitAvg = MSR_REGISTER(TEXT("WaitAvg")); + m_idDuration = MSR_REGISTER(TEXT("Duration")); + m_idThrottle = MSR_REGISTER(TEXT("Audio-video throttle wait")); + // m_idDebug = MSR_REGISTER(TEXT("Debug stuff")); +#endif // PERF +} // Constructor + + +// Destructor is just a placeholder + +CBaseVideoRenderer::~CBaseVideoRenderer() +{ + ASSERT(m_dwAdvise == 0); +} + + +// The timing functions in this class are called by the window object and by +// the renderer's allocator. +// The windows object calls timing functions as it receives media sample +// images for drawing using GDI. +// The allocator calls timing functions when it starts passing DCI/DirectDraw +// surfaces which are not rendered in the same way; The decompressor writes +// directly to the surface with no separate rendering, so those code paths +// call direct into us. Since we only ever hand out DCI/DirectDraw surfaces +// when we have allocated one and only one image we know there cannot be any +// conflict between the two. +// +// We use timeGetTime to return the timing counts we use (since it's relative +// performance we are interested in rather than absolute compared to a clock) +// The window object sets the accuracy of the system clock (normally 1ms) by +// calling timeBeginPeriod/timeEndPeriod when it changes streaming states + + +// Reset all times controlling streaming. +// Set them so that +// 1. Frames will not initially be dropped +// 2. The first frame will definitely be drawn (achieved by saying that there +// has not ben a frame drawn for a long time). + +HRESULT CBaseVideoRenderer::ResetStreamingTimes() +{ + m_trLastDraw = -1000; // set up as first frame since ages (1 sec) ago + m_tStreamingStart = timeGetTime(); + m_trRenderAvg = 0; + m_trFrameAvg = -1; // -1000 fps == "unset" + m_trDuration = 0; // 0 - strange value + m_trRenderLast = 0; + m_trWaitAvg = 0; + m_tRenderStart = 0; + m_cFramesDrawn = 0; + m_cFramesDropped = 0; + m_iTotAcc = 0; + m_iSumSqAcc = 0; + m_iSumSqFrameTime = 0; + m_trFrame = 0; // hygeine - not really needed + m_trLate = 0; // hygeine - not really needed + m_iSumFrameTime = 0; + m_nNormal = 0; + m_trEarliness = 0; + m_trTarget = -300000; // 30mSec early + m_trThrottle = 0; + m_trRememberStampForPerf = 0; + +#ifdef PERF + m_trRememberFrameForPerf = 0; +#endif + + return NOERROR; +} // ResetStreamingTimes + + +// Reset all times controlling streaming. Note that we're now streaming. We +// don't need to set the rendering event to have the source filter released +// as it is done during the Run processing. When we are run we immediately +// release the source filter thread and draw any image waiting (that image +// may already have been drawn once as a poster frame while we were paused) + +HRESULT CBaseVideoRenderer::OnStartStreaming() +{ + ResetStreamingTimes(); + return NOERROR; +} // OnStartStreaming + + +// Called at end of streaming. Fixes times for property page report + +HRESULT CBaseVideoRenderer::OnStopStreaming() +{ + m_tStreamingStart = timeGetTime()-m_tStreamingStart; + return NOERROR; +} // OnStopStreaming + + +// Called when we start waiting for a rendering event. +// Used to update times spent waiting and not waiting. + +void CBaseVideoRenderer::OnWaitStart() +{ + MSR_START(m_idWaitReal); +} // OnWaitStart + + +// Called when we are awoken from the wait in the window OR by our allocator +// when it is hanging around until the next sample is due for rendering on a +// DCI/DirectDraw surface. We add the wait time into our rolling average. +// We grab the interface lock so that we're serialised with the application +// thread going through the run code - which in due course ends up calling +// ResetStreaming times - possibly as we run through this section of code + +void CBaseVideoRenderer::OnWaitEnd() +{ +#ifdef PERF + MSR_STOP(m_idWaitReal); + // for a perf build we want to know just exactly how late we REALLY are. + // even if this means that we have to look at the clock again. + + REFERENCE_TIME trRealStream; // the real time now expressed as stream time. +#if 0 + m_pClock->GetTime(&trRealStream); // Calling clock here causes W95 deadlock! +#else + // We will be discarding overflows like mad here! + // This is wrong really because timeGetTime() can wrap but it's + // only for PERF + REFERENCE_TIME tr = timeGetTime()*10000; + trRealStream = tr + m_llTimeOffset; +#endif + trRealStream -= m_tStart; // convert to stream time (this is a reftime) + + if (m_trRememberStampForPerf==0) { + // This is probably the poster frame at the start, and it is not scheduled + // in the usual way at all. Just count it. The rememberstamp gets set + // in ShouldDrawSampleNow, so this does invalid frame recording until we + // actually start playing. + PreparePerformanceData(0, 0); + } else { + int trLate = (int)(trRealStream - m_trRememberStampForPerf); + int trFrame = (int)(tr - m_trRememberFrameForPerf); + PreparePerformanceData(trLate, trFrame); + } + m_trRememberFrameForPerf = tr; +#endif //PERF +} // OnWaitEnd + + +// Put data on one side that describes the lateness of the current frame. +// We don't yet know whether it will actually be drawn. In direct draw mode, +// this decision is up to the filter upstream, and it could change its mind. +// The rules say that if it did draw it must call Receive(). One way or +// another we eventually get into either OnRenderStart or OnDirectRender and +// these both call RecordFrameLateness to update the statistics. + +void CBaseVideoRenderer::PreparePerformanceData(int trLate, int trFrame) +{ + m_trLate = trLate; + m_trFrame = trFrame; +} // PreparePerformanceData + + +// update the statistics: +// m_iTotAcc, m_iSumSqAcc, m_iSumSqFrameTime, m_iSumFrameTime, m_cFramesDrawn +// Note that because the properties page reports using these variables, +// 1. We need to be inside a critical section +// 2. They must all be updated together. Updating the sums here and the count +// elsewhere can result in imaginary jitter (i.e. attempts to find square roots +// of negative numbers) in the property page code. + +void CBaseVideoRenderer::RecordFrameLateness(int trLate, int trFrame) +{ + // Record how timely we are. + int tLate = trLate/10000; + + // Best estimate of moment of appearing on the screen is average of + // start and end draw times. Here we have only the end time. This may + // tend to show us as spuriously late by up to 1/2 frame rate achieved. + // Decoder probably monitors draw time. We don't bother. + MSR_INTEGER( m_idFrameAccuracy, tLate ); + + // This is a kludge - we can get frames that are very late + // especially (at start-up) and they invalidate the statistics. + // So ignore things that are more than 1 sec off. + if (tLate>1000 || tLate<-1000) { + if (m_cFramesDrawn<=1) { + tLate = 0; + } else if (tLate>0) { + tLate = 1000; + } else { + tLate = -1000; + } + } + // The very first frame often has a invalid time, so don't + // count it into the statistics. (???) + if (m_cFramesDrawn>1) { + m_iTotAcc += tLate; + m_iSumSqAcc += (tLate*tLate); + } + + // calculate inter-frame time. Doesn't make sense for first frame + // second frame suffers from invalid first frame stamp. + if (m_cFramesDrawn>2) { + int tFrame = trFrame/10000; // convert to mSec else it overflows + + // This is a kludge. It can overflow anyway (a pause can cause + // a very long inter-frame time) and it overflows at 2**31/10**7 + // or about 215 seconds i.e. 3min 35sec + if (tFrame>1000||tFrame<0) tFrame = 1000; + m_iSumSqFrameTime += tFrame*tFrame; + ASSERT(m_iSumSqFrameTime>=0); + m_iSumFrameTime += tFrame; + } + ++m_cFramesDrawn; + +} // RecordFrameLateness + + +void CBaseVideoRenderer::ThrottleWait() +{ + if (m_trThrottle>0) { + int iThrottle = m_trThrottle/10000; // convert to mSec + MSR_INTEGER( m_idThrottle, iThrottle); + DbgLog((LOG_TRACE, 0, TEXT("Throttle %d ms"), iThrottle)); + Sleep(iThrottle); + } else { + Sleep(0); + } +} // ThrottleWait + + +// Whenever a frame is rendered it goes though either OnRenderStart +// or OnDirectRender. Data that are generated during ShouldDrawSample +// are added to the statistics by calling RecordFrameLateness from both +// these two places. + +// Called in place of OnRenderStart..OnRenderEnd +// When a DirectDraw image is drawn +void CBaseVideoRenderer::OnDirectRender(IMediaSample *pMediaSample) +{ + m_trRenderAvg = 0; + m_trRenderLast = 5000000; // If we mode switch, we do NOT want this + // to inhibit the new average getting going! + // so we set it to half a second + // MSR_INTEGER(m_idRenderAvg, m_trRenderAvg/10000); + RecordFrameLateness(m_trLate, m_trFrame); + ThrottleWait(); +} // OnDirectRender + + +// Called just before we start drawing. All we do is to get the current clock +// time (from the system) and return. We have to store the start render time +// in a member variable because it isn't used until we complete the drawing +// The rest is just performance logging. + +void CBaseVideoRenderer::OnRenderStart(IMediaSample *pMediaSample) +{ + RecordFrameLateness(m_trLate, m_trFrame); + m_tRenderStart = timeGetTime(); +} // OnRenderStart + + +// Called directly after drawing an image. We calculate the time spent in the +// drawing code and if this doesn't appear to have any odd looking spikes in +// it then we add it to the current average draw time. Measurement spikes may +// occur if the drawing thread is interrupted and switched to somewhere else. + +void CBaseVideoRenderer::OnRenderEnd(IMediaSample *pMediaSample) +{ + // The renderer time can vary erratically if we are interrupted so we do + // some smoothing to help get more sensible figures out but even that is + // not enough as figures can go 9,10,9,9,83,9 and we must disregard 83 + + int tr = (timeGetTime() - m_tRenderStart)*10000; // convert mSec->UNITS + if (tr < m_trRenderAvg*2 || tr < 2 * m_trRenderLast) { + // DO_MOVING_AVG(m_trRenderAvg, tr); + m_trRenderAvg = (tr + (AVGPERIOD-1)*m_trRenderAvg)/AVGPERIOD; + } + m_trRenderLast = tr; + ThrottleWait(); +} // OnRenderEnd + + +STDMETHODIMP CBaseVideoRenderer::SetSink( IQualityControl * piqc) +{ + + m_pQSink = piqc; + + return NOERROR; +} // SetSink + + +STDMETHODIMP CBaseVideoRenderer::Notify( IBaseFilter * pSelf, Quality q) +{ + // NOTE: We are NOT getting any locks here. We could be called + // asynchronously and possibly even on a time critical thread of + // someone else's - so we do the minumum. We only set one state + // variable (an integer) and if that happens to be in the middle + // of another thread reading it they will just get either the new + // or the old value. Locking would achieve no more than this. + + // It might be nice to check that we are being called from m_pGraph, but + // it turns out to be a millisecond or so per throw! + + // This is heuristics, these numbers are aimed at being "what works" + // rather than anything based on some theory. + // We use a hyperbola because it's easy to calculate and it includes + // a panic button asymptote (which we push off just to the left) + // The throttling fits the following table (roughly) + // Proportion Throttle (msec) + // >=1000 0 + // 900 3 + // 800 7 + // 700 11 + // 600 17 + // 500 25 + // 400 35 + // 300 50 + // 200 72 + // 125 100 + // 100 112 + // 50 146 + // 0 200 + + // (some evidence that we could go for a sharper kink - e.g. no throttling + // until below the 750 mark - might give fractionally more frames on a + // P60-ish machine). The easy way to get these coefficients is to use + // Renbase.xls follow the instructions therein using excel solver. + + if (q.Proportion>=1000) { m_trThrottle = 0; } + else { + // The DWORD is to make quite sure I get unsigned arithmetic + // as the constant is between 2**31 and 2**32 + m_trThrottle = -330000 + (388880000/(q.Proportion+167)); + } + return NOERROR; +} // Notify + + +// Send a message to indicate what our supplier should do about quality. +// Theory: +// What a supplier wants to know is "is the frame I'm working on NOW +// going to be late?". +// F1 is the frame at the supplier (as above) +// Tf1 is the due time for F1 +// T1 is the time at that point (NOW!) +// Tr1 is the time that f1 WILL actually be rendered +// L1 is the latency of the graph for frame F1 = Tr1-T1 +// D1 (for delay) is how late F1 will be beyond its due time i.e. +// D1 = (Tr1-Tf1) which is what the supplier really wants to know. +// Unfortunately Tr1 is in the future and is unknown, so is L1 +// +// We could estimate L1 by its value for a previous frame, +// L0 = Tr0-T0 and work off +// D1' = ((T1+L0)-Tf1) = (T1 + (Tr0-T0) -Tf1) +// Rearranging terms: +// D1' = (T1-T0) + (Tr0-Tf1) +// adding (Tf0-Tf0) and rearranging again: +// = (T1-T0) + (Tr0-Tf0) + (Tf0-Tf1) +// = (T1-T0) - (Tf1-Tf0) + (Tr0-Tf0) +// But (Tr0-Tf0) is just D0 - how late frame zero was, and this is the +// Late field in the quality message that we send. +// The other two terms just state what correction should be applied before +// using the lateness of F0 to predict the lateness of F1. +// (T1-T0) says how much time has actually passed (we have lost this much) +// (Tf1-Tf0) says how much time should have passed if we were keeping pace +// (we have gained this much). +// +// Suppliers should therefore work off: +// Quality.Late + (T1-T0) - (Tf1-Tf0) +// and see if this is "acceptably late" or even early (i.e. negative). +// They get T1 and T0 by polling the clock, they get Tf1 and Tf0 from +// the time stamps in the frames. They get Quality.Late from us. +// + +HRESULT CBaseVideoRenderer::SendQuality(REFERENCE_TIME trLate, + REFERENCE_TIME trRealStream) +{ + Quality q; + HRESULT hr; + + // If we are the main user of time, then report this as Flood/Dry. + // If our suppliers are, then report it as Famine/Glut. + // + // We need to take action, but avoid hunting. Hunting is caused by + // 1. Taking too much action too soon and overshooting + // 2. Taking too long to react (so averaging can CAUSE hunting). + // + // The reason why we use trLate as well as Wait is to reduce hunting; + // if the wait time is coming down and about to go into the red, we do + // NOT want to rely on some average which is only telling is that it used + // to be OK once. + + q.TimeStamp = (REFERENCE_TIME)trRealStream; + + if (m_trFrameAvg<0) { + q.Type = Famine; // guess + } + // Is the greater part of the time taken bltting or something else + else if (m_trFrameAvg > 2*m_trRenderAvg) { + q.Type = Famine; // mainly other + } else { + q.Type = Flood; // mainly bltting + } + + q.Proportion = 1000; // default + + if (m_trFrameAvg<0) { + // leave it alone - we don't know enough + } + else if ( trLate> 0 ) { + // try to catch up over the next second + // We could be Really, REALLY late, but rendering all the frames + // anyway, just because it's so cheap. + + q.Proportion = 1000 - (int)((trLate)/(UNITS/1000)); + if (q.Proportion<500) { + q.Proportion = 500; // don't go daft. (could've been negative!) + } else { + } + + } else if ( m_trWaitAvg>20000 + && trLate<-20000 + ){ + // Go cautiously faster - aim at 2mSec wait. + if (m_trWaitAvg>=m_trFrameAvg) { + // This can happen because of some fudges. + // The waitAvg is how long we originally planned to wait + // The frameAvg is more honest. + // It means that we are spending a LOT of time waiting + q.Proportion = 2000; // double. + } else { + if (m_trFrameAvg+20000 > m_trWaitAvg) { + q.Proportion + = 1000 * (m_trFrameAvg / (m_trFrameAvg + 20000 - m_trWaitAvg)); + } else { + // We're apparently spending more than the whole frame time waiting. + // Assume that the averages are slightly out of kilter, but that we + // are indeed doing a lot of waiting. (This leg probably never + // happens, but the code avoids any potential divide by zero). + q.Proportion = 2000; + } + } + + if (q.Proportion>2000) { + q.Proportion = 2000; // don't go crazy. + } + } + + // Tell the supplier how late frames are when they get rendered + // That's how late we are now. + // If we are in directdraw mode then the guy upstream can see the drawing + // times and we'll just report on the start time. He can figure out any + // offset to apply. If we are in DIB Section mode then we will apply an + // extra offset which is half of our drawing time. This is usually small + // but can sometimes be the dominant effect. For this we will use the + // average drawing time rather than the last frame. If the last frame took + // a long time to draw and made us late, that's already in the lateness + // figure. We should not add it in again unless we expect the next frame + // to be the same. We don't, we expect the average to be a better shot. + // In direct draw mode the RenderAvg will be zero. + + q.Late = trLate + m_trRenderAvg/2; + + // log what we're doing + MSR_INTEGER(m_idQualityRate, q.Proportion); + MSR_INTEGER( m_idQualityTime, (int)q.Late / 10000 ); + + // A specific sink interface may be set through IPin + + if (m_pQSink==NULL) { + // Get our input pin's peer. We send quality management messages + // to any nominated receiver of these things (set in the IPin + // interface), or else to our source filter. + + IQualityControl *pQC = NULL; + IPin *pOutputPin = m_pInputPin->GetConnected(); + ASSERT(pOutputPin != NULL); + + // And get an AddRef'd quality control interface + + hr = pOutputPin->QueryInterface(IID_IQualityControl,(void**) &pQC); + if (SUCCEEDED(hr)) { + m_pQSink = pQC; + } + } + if (m_pQSink) { + return m_pQSink->Notify(this,q); + } + + return S_FALSE; + +} // SendQuality + + +// We are called with a valid IMediaSample image to decide whether this is to +// be drawn or not. There must be a reference clock in operation. +// Return S_OK if it is to be drawn Now (as soon as possible) +// Return S_FALSE if it is to be drawn when it's due +// Return an error if we want to drop it +// m_nNormal=-1 indicates that we dropped the previous frame and so this +// one should be drawn early. Respect it and update it. +// Use current stream time plus a number of heuristics (detailed below) +// to make the decision + +HRESULT CBaseVideoRenderer::ShouldDrawSampleNow(IMediaSample *pMediaSample, + __inout REFERENCE_TIME *ptrStart, + __inout REFERENCE_TIME *ptrEnd) +{ + + // Don't call us unless there's a clock interface to synchronise with + ASSERT(m_pClock); + + MSR_INTEGER(m_idTimeStamp, (int)((*ptrStart)>>32)); // high order 32 bits + MSR_INTEGER(m_idTimeStamp, (int)(*ptrStart)); // low order 32 bits + + // We lose a bit of time depending on the monitor type waiting for the next + // screen refresh. On average this might be about 8mSec - so it will be + // later than we think when the picture appears. To compensate a bit + // we bias the media samples by -8mSec i.e. 80000 UNITs. + // We don't ever make a stream time negative (call it paranoia) + if (*ptrStart>=80000) { + *ptrStart -= 80000; + *ptrEnd -= 80000; // bias stop to to retain valid frame duration + } + + // Cache the time stamp now. We will want to compare what we did with what + // we started with (after making the monitor allowance). + m_trRememberStampForPerf = *ptrStart; + + // Get reference times (current and late) + REFERENCE_TIME trRealStream; // the real time now expressed as stream time. + m_pClock->GetTime(&trRealStream); +#ifdef PERF + // While the reference clock is expensive: + // Remember the offset from timeGetTime and use that. + // This overflows all over the place, but when we subtract to get + // differences the overflows all cancel out. + m_llTimeOffset = trRealStream-timeGetTime()*10000; +#endif + trRealStream -= m_tStart; // convert to stream time (this is a reftime) + + // We have to wory about two versions of "lateness". The truth, which we + // try to work out here and the one measured against m_trTarget which + // includes long term feedback. We report statistics against the truth + // but for operational decisions we work to the target. + // We use TimeDiff to make sure we get an integer because we + // may actually be late (or more likely early if there is a big time + // gap) by a very long time. + const int trTrueLate = TimeDiff(trRealStream - *ptrStart); + const int trLate = trTrueLate; + + MSR_INTEGER(m_idSchLateTime, trTrueLate/10000); + + // Send quality control messages upstream, measured against target + HRESULT hr = SendQuality(trLate, trRealStream); + // Note: the filter upstream is allowed to this FAIL meaning "you do it". + m_bSupplierHandlingQuality = (hr==S_OK); + + // Decision time! Do we drop, draw when ready or draw immediately? + + const int trDuration = (int)(*ptrEnd - *ptrStart); + { + // We need to see if the frame rate of the file has just changed. + // This would make comparing our previous frame rate with the current + // frame rate inefficent. Hang on a moment though. I've seen files + // where the frames vary between 33 and 34 mSec so as to average + // 30fps. A minor variation like that won't hurt us. + int t = m_trDuration/32; + if ( trDuration > m_trDuration+t + || trDuration < m_trDuration-t + ) { + // There's a major variation. Reset the average frame rate to + // exactly the current rate to disable decision 9002 for this frame, + // and remember the new rate. + m_trFrameAvg = trDuration; + m_trDuration = trDuration; + } + } + + MSR_INTEGER(m_idEarliness, m_trEarliness/10000); + MSR_INTEGER(m_idRenderAvg, m_trRenderAvg/10000); + MSR_INTEGER(m_idFrameAvg, m_trFrameAvg/10000); + MSR_INTEGER(m_idWaitAvg, m_trWaitAvg/10000); + MSR_INTEGER(m_idDuration, trDuration/10000); + +#ifdef PERF + if (S_OK==pMediaSample->IsDiscontinuity()) { + MSR_INTEGER(m_idDecision, 9000); + } +#endif + + // Control the graceful slide back from slow to fast machine mode. + // After a frame drop accept an early frame and set the earliness to here + // If this frame is already later than the earliness then slide it to here + // otherwise do the standard slide (reduce by about 12% per frame). + // Note: earliness is normally NEGATIVE + BOOL bJustDroppedFrame + = ( m_bSupplierHandlingQuality + // Can't use the pin sample properties because we might + // not be in Receive when we call this + && (S_OK == pMediaSample->IsDiscontinuity()) // he just dropped one + ) + || (m_nNormal==-1); // we just dropped one + + + // Set m_trEarliness (slide back from slow to fast machine mode) + if (trLate>0) { + m_trEarliness = 0; // we are no longer in fast machine mode at all! + } else if ( (trLate>=m_trEarliness) || bJustDroppedFrame) { + m_trEarliness = trLate; // Things have slipped of their own accord + } else { + m_trEarliness = m_trEarliness - m_trEarliness/8; // graceful slide + } + + // prepare the new wait average - but don't pollute the old one until + // we have finished with it. + int trWaitAvg; + { + // We never mix in a negative wait. This causes us to believe in fast machines + // slightly more. + int trL = trLate<0 ? -trLate : 0; + trWaitAvg = (trL + m_trWaitAvg*(AVGPERIOD-1))/AVGPERIOD; + } + + + int trFrame; + { + REFERENCE_TIME tr = trRealStream - m_trLastDraw; // Cd be large - 4 min pause! + if (tr>10000000) { + tr = 10000000; // 1 second - arbitrarily. + } + trFrame = int(tr); + } + + // We will DRAW this frame IF... + if ( + // ...the time we are spending drawing is a small fraction of the total + // observed inter-frame time so that dropping it won't help much. + (3*m_trRenderAvg <= m_trFrameAvg) + + // ...or our supplier is NOT handling things and the next frame would + // be less timely than this one or our supplier CLAIMS to be handling + // things, and is now less than a full FOUR frames late. + || ( m_bSupplierHandlingQuality + ? (trLate <= trDuration*4) + : (trLate+trLate < trDuration) + ) + + // ...or we are on average waiting for over eight milliseconds then + // this may be just a glitch. Draw it and we'll hope to catch up. + || (m_trWaitAvg > 80000) + + // ...or we haven't drawn an image for over a second. We will update + // the display, which stops the video looking hung. + // Do this regardless of how late this media sample is. + || ((trRealStream - m_trLastDraw) > UNITS) + + ) { + HRESULT Result; + + // We are going to play this frame. We may want to play it early. + // We will play it early if we think we are in slow machine mode. + // If we think we are NOT in slow machine mode, we will still play + // it early by m_trEarliness as this controls the graceful slide back. + // and in addition we aim at being m_trTarget late rather than "on time". + + BOOL bPlayASAP = FALSE; + + // we will play it AT ONCE (slow machine mode) if... + + // ...we are playing catch-up + if ( bJustDroppedFrame) { + bPlayASAP = TRUE; + MSR_INTEGER(m_idDecision, 9001); + } + + // ...or if we are running below the true frame rate + // exact comparisons are glitchy, for these measurements, + // so add an extra 5% or so + else if ( (m_trFrameAvg > trDuration + trDuration/16) + + // It's possible to get into a state where we are losing ground, but + // are a very long way ahead. To avoid this or recover from it + // we refuse to play early by more than 10 frames. + && (trLate > - trDuration*10) + ){ + bPlayASAP = TRUE; + MSR_INTEGER(m_idDecision, 9002); + } +#if 0 + // ...or if we have been late and are less than one frame early + else if ( (trLate + trDuration > 0) + && (m_trWaitAvg<=20000) + ) { + bPlayASAP = TRUE; + MSR_INTEGER(m_idDecision, 9003); + } +#endif + // We will NOT play it at once if we are grossly early. On very slow frame + // rate movies - e.g. clock.avi - it is not a good idea to leap ahead just + // because we got starved (for instance by the net) and dropped one frame + // some time or other. If we are more than 900mSec early, then wait. + if (trLate<-9000000) { + bPlayASAP = FALSE; + } + + if (bPlayASAP) { + + m_nNormal = 0; + MSR_INTEGER(m_idDecision, 0); + // When we are here, we are in slow-machine mode. trLate may well + // oscillate between negative and positive when the supplier is + // dropping frames to keep sync. We should not let that mislead + // us into thinking that we have as much as zero spare time! + // We just update with a zero wait. + m_trWaitAvg = (m_trWaitAvg*(AVGPERIOD-1))/AVGPERIOD; + + // Assume that we draw it immediately. Update inter-frame stats + m_trFrameAvg = (trFrame + m_trFrameAvg*(AVGPERIOD-1))/AVGPERIOD; +#ifndef PERF + // If this is NOT a perf build, then report what we know so far + // without looking at the clock any more. This assumes that we + // actually wait for exactly the time we hope to. It also reports + // how close we get to the manipulated time stamps that we now have + // rather than the ones we originally started with. It will + // therefore be a little optimistic. However it's fast. + PreparePerformanceData(trTrueLate, trFrame); +#endif + m_trLastDraw = trRealStream; + if (m_trEarliness > trLate) { + m_trEarliness = trLate; // if we are actually early, this is neg + } + Result = S_OK; // Draw it now + + } else { + ++m_nNormal; + // Set the average frame rate to EXACTLY the ideal rate. + // If we are exiting slow-machine mode then we will have caught up + // and be running ahead, so as we slide back to exact timing we will + // have a longer than usual gap at this point. If we record this + // real gap then we'll think that we're running slow and go back + // into slow-machine mode and vever get it straight. + m_trFrameAvg = trDuration; + MSR_INTEGER(m_idDecision, 1); + + // Play it early by m_trEarliness and by m_trTarget + + { + int trE = m_trEarliness; + if (trE < -m_trFrameAvg) { + trE = -m_trFrameAvg; + } + *ptrStart += trE; // N.B. earliness is negative + } + + int Delay = -trTrueLate; + Result = Delay<=0 ? S_OK : S_FALSE; // OK = draw now, FALSE = wait + + m_trWaitAvg = trWaitAvg; + + // Predict when it will actually be drawn and update frame stats + + if (Result==S_FALSE) { // We are going to wait + trFrame = TimeDiff(*ptrStart-m_trLastDraw); + m_trLastDraw = *ptrStart; + } else { + // trFrame is already = trRealStream-m_trLastDraw; + m_trLastDraw = trRealStream; + } +#ifndef PERF + int iAccuracy; + if (Delay>0) { + // Report lateness based on when we intend to play it + iAccuracy = TimeDiff(*ptrStart-m_trRememberStampForPerf); + } else { + // Report lateness based on playing it *now*. + iAccuracy = trTrueLate; // trRealStream-RememberStampForPerf; + } + PreparePerformanceData(iAccuracy, trFrame); +#endif + } + return Result; + } + + // We are going to drop this frame! + // Of course in DirectDraw mode the guy upstream may draw it anyway. + + // This will probably give a large negative wack to the wait avg. + m_trWaitAvg = trWaitAvg; + +#ifdef PERF + // Respect registry setting - debug only! + if (m_bDrawLateFrames) { + return S_OK; // draw it when it's ready + } // even though it's late. +#endif + + // We are going to drop this frame so draw the next one early + // n.b. if the supplier is doing direct draw then he may draw it anyway + // but he's doing something funny to arrive here in that case. + + MSR_INTEGER(m_idDecision, 2); + m_nNormal = -1; + return E_FAIL; // drop it + +} // ShouldDrawSampleNow + + +// NOTE we're called by both the window thread and the source filter thread +// so we have to be protected by a critical section (locked before called) +// Also, when the window thread gets signalled to render an image, it always +// does so regardless of how late it is. All the degradation is done when we +// are scheduling the next sample to be drawn. Hence when we start an advise +// link to draw a sample, that sample's time will always become the last one +// drawn - unless of course we stop streaming in which case we cancel links + +BOOL CBaseVideoRenderer::ScheduleSample(IMediaSample *pMediaSample) +{ + // We override ShouldDrawSampleNow to add quality management + + BOOL bDrawImage = CBaseRenderer::ScheduleSample(pMediaSample); + if (bDrawImage == FALSE) { + ++m_cFramesDropped; + return FALSE; + } + + // m_cFramesDrawn must NOT be updated here. It has to be updated + // in RecordFrameLateness at the same time as the other statistics. + return TRUE; +} + + +// Implementation of IQualProp interface needed to support the property page +// This is how the property page gets the data out of the scheduler. We are +// passed into the constructor the owning object in the COM sense, this will +// either be the video renderer or an external IUnknown if we're aggregated. +// We initialise our CUnknown base class with this interface pointer. Then +// all we have to do is to override NonDelegatingQueryInterface to expose +// our IQualProp interface. The AddRef and Release are handled automatically +// by the base class and will be passed on to the appropriate outer object + +STDMETHODIMP CBaseVideoRenderer::get_FramesDroppedInRenderer(__out int *pcFramesDropped) +{ + CheckPointer(pcFramesDropped,E_POINTER); + CAutoLock cVideoLock(&m_InterfaceLock); + *pcFramesDropped = m_cFramesDropped; + return NOERROR; +} // get_FramesDroppedInRenderer + + +// Set *pcFramesDrawn to the number of frames drawn since +// streaming started. + +STDMETHODIMP CBaseVideoRenderer::get_FramesDrawn( int *pcFramesDrawn) +{ + CheckPointer(pcFramesDrawn,E_POINTER); + CAutoLock cVideoLock(&m_InterfaceLock); + *pcFramesDrawn = m_cFramesDrawn; + return NOERROR; +} // get_FramesDrawn + + +// Set iAvgFrameRate to the frames per hundred secs since +// streaming started. 0 otherwise. + +STDMETHODIMP CBaseVideoRenderer::get_AvgFrameRate( int *piAvgFrameRate) +{ + CheckPointer(piAvgFrameRate,E_POINTER); + CAutoLock cVideoLock(&m_InterfaceLock); + + int t; + if (m_bStreaming) { + t = timeGetTime()-m_tStreamingStart; + } else { + t = m_tStreamingStart; + } + + if (t<=0) { + *piAvgFrameRate = 0; + ASSERT(m_cFramesDrawn == 0); + } else { + // i is frames per hundred seconds + *piAvgFrameRate = MulDiv(100000, m_cFramesDrawn, t); + } + return NOERROR; +} // get_AvgFrameRate + + +// Set *piAvg to the average sync offset since streaming started +// in mSec. The sync offset is the time in mSec between when the frame +// should have been drawn and when the frame was actually drawn. + +STDMETHODIMP CBaseVideoRenderer::get_AvgSyncOffset(__out int *piAvg) +{ + CheckPointer(piAvg,E_POINTER); + CAutoLock cVideoLock(&m_InterfaceLock); + + if (NULL==m_pClock) { + *piAvg = 0; + return NOERROR; + } + + // Note that we didn't gather the stats on the first frame + // so we use m_cFramesDrawn-1 here + if (m_cFramesDrawn<=1) { + *piAvg = 0; + } else { + *piAvg = (int)(m_iTotAcc / (m_cFramesDrawn-1)); + } + return NOERROR; +} // get_AvgSyncOffset + + +// To avoid dragging in the maths library - a cheap +// approximate integer square root. +// We do this by getting a starting guess which is between 1 +// and 2 times too large, followed by THREE iterations of +// Newton Raphson. (That will give accuracy to the nearest mSec +// for the range in question - roughly 0..1000) +// +// It would be faster to use a linear interpolation and ONE NR, but +// who cares. If anyone does - the best linear interpolation is +// to approximates sqrt(x) by +// y = x * (sqrt(2)-1) + 1 - 1/sqrt(2) + 1/(8*(sqrt(2)-1)) +// 0r y = x*0.41421 + 0.59467 +// This minimises the maximal error in the range in question. +// (error is about +0.008883 and then one NR will give error .0000something +// (Of course these are integers, so you can't just multiply by 0.41421 +// you'd have to do some sort of MulDiv). +// Anyone wanna check my maths? (This is only for a property display!) + +int isqrt(int x) +{ + int s = 1; + // Make s an initial guess for sqrt(x) + if (x > 0x40000000) { + s = 0x8000; // prevent any conceivable closed loop + } else { + while (s*s=0) s = (s*s+x)/(2*s); + if (s>=0) s = (s*s+x)/(2*s); + } + } + return s; +} + +// +// Do estimates for standard deviations for per-frame +// statistics +// +HRESULT CBaseVideoRenderer::GetStdDev( + int nSamples, + __out int *piResult, + LONGLONG llSumSq, + LONGLONG iTot +) +{ + CheckPointer(piResult,E_POINTER); + CAutoLock cVideoLock(&m_InterfaceLock); + + if (NULL==m_pClock) { + *piResult = 0; + return NOERROR; + } + + // If S is the Sum of the Squares of observations and + // T the Total (i.e. sum) of the observations and there were + // N observations, then an estimate of the standard deviation is + // sqrt( (S - T**2/N) / (N-1) ) + + if (nSamples<=1) { + *piResult = 0; + } else { + LONGLONG x; + // First frames have invalid stamps, so we get no stats for them + // So we need 2 frames to get 1 datum, so N is cFramesDrawn-1 + + // so we use m_cFramesDrawn-1 here + x = llSumSq - llMulDiv(iTot, iTot, nSamples, 0); + x = x / (nSamples-1); + ASSERT(x>=0); + *piResult = isqrt((LONG)x); + } + return NOERROR; +} + +// Set *piDev to the standard deviation in mSec of the sync offset +// of each frame since streaming started. + +STDMETHODIMP CBaseVideoRenderer::get_DevSyncOffset(__out int *piDev) +{ + // First frames have invalid stamps, so we get no stats for them + // So we need 2 frames to get 1 datum, so N is cFramesDrawn-1 + return GetStdDev(m_cFramesDrawn - 1, + piDev, + m_iSumSqAcc, + m_iTotAcc); +} // get_DevSyncOffset + + +// Set *piJitter to the standard deviation in mSec of the inter-frame time +// of frames since streaming started. + +STDMETHODIMP CBaseVideoRenderer::get_Jitter(__out int *piJitter) +{ + // First frames have invalid stamps, so we get no stats for them + // So second frame gives invalid inter-frame time + // So we need 3 frames to get 1 datum, so N is cFramesDrawn-2 + return GetStdDev(m_cFramesDrawn - 2, + piJitter, + m_iSumSqFrameTime, + m_iSumFrameTime); +} // get_Jitter + + +// Overidden to return our IQualProp interface + +STDMETHODIMP +CBaseVideoRenderer::NonDelegatingQueryInterface(REFIID riid,__deref_out VOID **ppv) +{ + // We return IQualProp and delegate everything else + + if (riid == IID_IQualProp) { + return GetInterface( (IQualProp *)this, ppv); + } else if (riid == IID_IQualityControl) { + return GetInterface( (IQualityControl *)this, ppv); + } + return CBaseRenderer::NonDelegatingQueryInterface(riid,ppv); +} + + +// Override JoinFilterGraph so that, just before leaving +// the graph we can send an EC_WINDOW_DESTROYED event + +STDMETHODIMP +CBaseVideoRenderer::JoinFilterGraph(__inout_opt IFilterGraph *pGraph, __in_opt LPCWSTR pName) +{ + // Since we send EC_ACTIVATE, we also need to ensure + // we send EC_WINDOW_DESTROYED or the resource manager may be + // holding us as a focus object + if (!pGraph && m_pGraph) { + + // We were in a graph and now we're not + // Do this properly in case we are aggregated + IBaseFilter* pFilter = this; + NotifyEvent(EC_WINDOW_DESTROYED, (LPARAM) pFilter, 0); + } + return CBaseFilter::JoinFilterGraph(pGraph, pName); +} + + +// This removes a large number of level 4 warnings from the +// Microsoft compiler which in this case are not very useful +#pragma warning(disable: 4514) + diff --git a/third_party/BaseClasses/renbase.h b/third_party/BaseClasses/renbase.h new file mode 100644 index 00000000..c2685bb2 --- /dev/null +++ b/third_party/BaseClasses/renbase.h @@ -0,0 +1,478 @@ +//------------------------------------------------------------------------------ +// File: RenBase.h +// +// Desc: DirectShow base classes - defines a generic ActiveX base renderer +// class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __RENBASE__ +#define __RENBASE__ + +// Forward class declarations + +class CBaseRenderer; +class CBaseVideoRenderer; +class CRendererInputPin; + +// This is our input pin class that channels calls to the renderer + +class CRendererInputPin : public CBaseInputPin +{ +protected: + + CBaseRenderer *m_pRenderer; + +public: + + CRendererInputPin(__inout CBaseRenderer *pRenderer, + __inout HRESULT *phr, + __in_opt LPCWSTR Name); + + // Overriden from the base pin classes + + HRESULT BreakConnect(); + HRESULT CompleteConnect(IPin *pReceivePin); + HRESULT SetMediaType(const CMediaType *pmt); + HRESULT CheckMediaType(const CMediaType *pmt); + HRESULT Active(); + HRESULT Inactive(); + + // Add rendering behaviour to interface functions + + STDMETHODIMP QueryId(__deref_out LPWSTR *Id); + STDMETHODIMP EndOfStream(); + STDMETHODIMP BeginFlush(); + STDMETHODIMP EndFlush(); + STDMETHODIMP Receive(IMediaSample *pMediaSample); + + // Helper + IMemAllocator inline *Allocator() const + { + return m_pAllocator; + } +}; + +// Main renderer class that handles synchronisation and state changes + +class CBaseRenderer : public CBaseFilter +{ +protected: + + friend class CRendererInputPin; + + friend void CALLBACK EndOfStreamTimer(UINT uID, // Timer identifier + UINT uMsg, // Not currently used + DWORD_PTR dwUser, // User information + DWORD_PTR dw1, // Windows reserved + DWORD_PTR dw2); // Is also reserved + + CRendererPosPassThru *m_pPosition; // Media seeking pass by object + CAMEvent m_RenderEvent; // Used to signal timer events + CAMEvent m_ThreadSignal; // Signalled to release worker thread + CAMEvent m_evComplete; // Signalled when state complete + BOOL m_bAbort; // Stop us from rendering more data + BOOL m_bStreaming; // Are we currently streaming + DWORD_PTR m_dwAdvise; // Timer advise cookie + IMediaSample *m_pMediaSample; // Current image media sample + BOOL m_bEOS; // Any more samples in the stream + BOOL m_bEOSDelivered; // Have we delivered an EC_COMPLETE + CRendererInputPin *m_pInputPin; // Our renderer input pin object + CCritSec m_InterfaceLock; // Critical section for interfaces + CCritSec m_RendererLock; // Controls access to internals + IQualityControl * m_pQSink; // QualityControl sink + BOOL m_bRepaintStatus; // Can we signal an EC_REPAINT + // Avoid some deadlocks by tracking filter during stop + volatile BOOL m_bInReceive; // Inside Receive between PrepareReceive + // And actually processing the sample + REFERENCE_TIME m_SignalTime; // Time when we signal EC_COMPLETE + UINT m_EndOfStreamTimer; // Used to signal end of stream + CCritSec m_ObjectCreationLock; // This lock protects the creation and + // of m_pPosition and m_pInputPin. It + // ensures that two threads cannot create + // either object simultaneously. + +public: + + CBaseRenderer(REFCLSID RenderClass, // CLSID for this renderer + __in_opt LPCTSTR pName, // Debug ONLY description + __inout_opt LPUNKNOWN pUnk, // Aggregated owner object + __inout HRESULT *phr); // General OLE return code + + ~CBaseRenderer(); + + // Overriden to say what interfaces we support and where + + virtual HRESULT GetMediaPositionInterface(REFIID riid, __deref_out void **ppv); + STDMETHODIMP NonDelegatingQueryInterface(REFIID, __deref_out void **); + + virtual HRESULT SourceThreadCanWait(BOOL bCanWait); + +#ifdef DEBUG + // Debug only dump of the renderer state + void DisplayRendererState(); +#endif + virtual HRESULT WaitForRenderTime(); + virtual HRESULT CompleteStateChange(FILTER_STATE OldState); + + // Return internal information about this filter + + BOOL IsEndOfStream() { return m_bEOS; }; + BOOL IsEndOfStreamDelivered() { return m_bEOSDelivered; }; + BOOL IsStreaming() { return m_bStreaming; }; + void SetAbortSignal(BOOL bAbort) { m_bAbort = bAbort; }; + virtual void OnReceiveFirstSample(IMediaSample *pMediaSample) { }; + CAMEvent *GetRenderEvent() { return &m_RenderEvent; }; + + // Permit access to the transition state + + void Ready() { m_evComplete.Set(); }; + void NotReady() { m_evComplete.Reset(); }; + BOOL CheckReady() { return m_evComplete.Check(); }; + + virtual int GetPinCount(); + virtual CBasePin *GetPin(int n); + FILTER_STATE GetRealState(); + void SendRepaint(); + void SendNotifyWindow(IPin *pPin,HWND hwnd); + BOOL OnDisplayChange(); + void SetRepaintStatus(BOOL bRepaint); + + // Override the filter and pin interface functions + + STDMETHODIMP Stop(); + STDMETHODIMP Pause(); + STDMETHODIMP Run(REFERENCE_TIME StartTime); + STDMETHODIMP GetState(DWORD dwMSecs, __out FILTER_STATE *State); + STDMETHODIMP FindPin(LPCWSTR Id, __deref_out IPin **ppPin); + + // These are available for a quality management implementation + + virtual void OnRenderStart(IMediaSample *pMediaSample); + virtual void OnRenderEnd(IMediaSample *pMediaSample); + virtual HRESULT OnStartStreaming() { return NOERROR; }; + virtual HRESULT OnStopStreaming() { return NOERROR; }; + virtual void OnWaitStart() { }; + virtual void OnWaitEnd() { }; + virtual void PrepareRender() { }; + +#ifdef PERF + REFERENCE_TIME m_trRenderStart; // Just before we started drawing + // Set in OnRenderStart, Used in OnRenderEnd + int m_idBaseStamp; // MSR_id for frame time stamp + int m_idBaseRenderTime; // MSR_id for true wait time + int m_idBaseAccuracy; // MSR_id for time frame is late (int) +#endif + + // Quality management implementation for scheduling rendering + + virtual BOOL ScheduleSample(IMediaSample *pMediaSample); + virtual HRESULT GetSampleTimes(IMediaSample *pMediaSample, + __out REFERENCE_TIME *pStartTime, + __out REFERENCE_TIME *pEndTime); + + virtual HRESULT ShouldDrawSampleNow(IMediaSample *pMediaSample, + __out REFERENCE_TIME *ptrStart, + __out REFERENCE_TIME *ptrEnd); + + // Lots of end of stream complexities + + void TimerCallback(); + void ResetEndOfStreamTimer(); + HRESULT NotifyEndOfStream(); + virtual HRESULT SendEndOfStream(); + virtual HRESULT ResetEndOfStream(); + virtual HRESULT EndOfStream(); + + // Rendering is based around the clock + + void SignalTimerFired(); + virtual HRESULT CancelNotification(); + virtual HRESULT ClearPendingSample(); + + // Called when the filter changes state + + virtual HRESULT Active(); + virtual HRESULT Inactive(); + virtual HRESULT StartStreaming(); + virtual HRESULT StopStreaming(); + virtual HRESULT BeginFlush(); + virtual HRESULT EndFlush(); + + // Deal with connections and type changes + + virtual HRESULT BreakConnect(); + virtual HRESULT SetMediaType(const CMediaType *pmt); + virtual HRESULT CompleteConnect(IPin *pReceivePin); + + // These look after the handling of data samples + + virtual HRESULT PrepareReceive(IMediaSample *pMediaSample); + virtual HRESULT Receive(IMediaSample *pMediaSample); + virtual BOOL HaveCurrentSample(); + virtual IMediaSample *GetCurrentSample(); + virtual HRESULT Render(IMediaSample *pMediaSample); + + // Derived classes MUST override these + virtual HRESULT DoRenderSample(IMediaSample *pMediaSample) PURE; + virtual HRESULT CheckMediaType(const CMediaType *) PURE; + + // Helper + void WaitForReceiveToComplete(); +}; + + +// CBaseVideoRenderer is a renderer class (see its ancestor class) and +// it handles scheduling of media samples so that they are drawn at the +// correct time by the reference clock. It implements a degradation +// strategy. Possible degradation modes are: +// Drop frames here (only useful if the drawing takes significant time) +// Signal supplier (upstream) to drop some frame(s) - i.e. one-off skip. +// Signal supplier to change the frame rate - i.e. ongoing skipping. +// Or any combination of the above. +// In order to determine what's useful to try we need to know what's going +// on. This is done by timing various operations (including the supplier). +// This timing is done by using timeGetTime as it is accurate enough and +// usually cheaper than calling the reference clock. It also tells the +// truth if there is an audio break and the reference clock stops. +// We provide a number of public entry points (named OnXxxStart, OnXxxEnd) +// which the rest of the renderer calls at significant moments. These do +// the timing. + +// the number of frames that the sliding averages are averaged over. +// the rule is (1024*NewObservation + (AVGPERIOD-1) * PreviousAverage)/AVGPERIOD +#define AVGPERIOD 4 +#define DO_MOVING_AVG(avg,obs) (avg = (1024*obs + (AVGPERIOD-1)*avg)/AVGPERIOD) +// Spot the bug in this macro - I can't. but it doesn't work! + +class CBaseVideoRenderer : public CBaseRenderer, // Base renderer class + public IQualProp, // Property page guff + public IQualityControl // Allow throttling +{ +protected: + + // Hungarian: + // tFoo is the time Foo in mSec (beware m_tStart from filter.h) + // trBar is the time Bar by the reference clock + + //****************************************************************** + // State variables to control synchronisation + //****************************************************************** + + // Control of sending Quality messages. We need to know whether + // we are in trouble (e.g. frames being dropped) and where the time + // is being spent. + + // When we drop a frame we play the next one early. + // The frame after that is likely to wait before drawing and counting this + // wait as spare time is unfair, so we count it as a zero wait. + // We therefore need to know whether we are playing frames early or not. + + int m_nNormal; // The number of consecutive frames + // drawn at their normal time (not early) + // -1 means we just dropped a frame. + +#ifdef PERF + BOOL m_bDrawLateFrames; // Don't drop any frames (debug and I'm + // not keen on people using it!) +#endif + + BOOL m_bSupplierHandlingQuality;// The response to Quality messages says + // our supplier is handling things. + // We will allow things to go extra late + // before dropping frames. We will play + // very early after he has dropped one. + + // Control of scheduling, frame dropping etc. + // We need to know where the time is being spent so as to tell whether + // we should be taking action here, signalling supplier or what. + // The variables are initialised to a mode of NOT dropping frames. + // They will tell the truth after a few frames. + // We typically record a start time for an event, later we get the time + // again and subtract to get the elapsed time, and we average this over + // a few frames. The average is used to tell what mode we are in. + + // Although these are reference times (64 bit) they are all DIFFERENCES + // between times which are small. An int will go up to 214 secs before + // overflow. Avoiding 64 bit multiplications and divisions seems + // worth while. + + + + // Audio-video throttling. If the user has turned up audio quality + // very high (in principle it could be any other stream, not just audio) + // then we can receive cries for help via the graph manager. In this case + // we put in a wait for some time after rendering each frame. + int m_trThrottle; + + // The time taken to render (i.e. BitBlt) frames controls which component + // needs to degrade. If the blt is expensive, the renderer degrades. + // If the blt is cheap it's done anyway and the supplier degrades. + int m_trRenderAvg; // Time frames are taking to blt + int m_trRenderLast; // Time for last frame blt + int m_tRenderStart; // Just before we started drawing (mSec) + // derived from timeGetTime. + + // When frames are dropped we will play the next frame as early as we can. + // If it was a false alarm and the machine is fast we slide gently back to + // normal timing. To do this, we record the offset showing just how early + // we really are. This will normally be negative meaning early or zero. + int m_trEarliness; + + // Target provides slow long-term feedback to try to reduce the + // average sync offset to zero. Whenever a frame is actually rendered + // early we add a msec or two, whenever late we take off a few. + // We add or take off 1/32 of the error time. + // Eventually we should be hovering around zero. For a really bad case + // where we were (say) 300mSec off, it might take 100 odd frames to + // settle down. The rate of change of this is intended to be slower + // than any other mechanism in Quartz, thereby avoiding hunting. + int m_trTarget; + + // The proportion of time spent waiting for the right moment to blt + // controls whether we bother to drop a frame or whether we reckon that + // we're doing well enough that we can stand a one-frame glitch. + int m_trWaitAvg; // Average of last few wait times + // (actually we just average how early + // we were). Negative here means LATE. + + // The average inter-frame time. + // This is used to calculate the proportion of the time used by the + // three operations (supplying us, waiting, rendering) + int m_trFrameAvg; // Average inter-frame time + int m_trDuration; // duration of last frame. + +#ifdef PERF + // Performance logging identifiers + int m_idTimeStamp; // MSR_id for frame time stamp + int m_idEarliness; // MSR_id for earliness fudge + int m_idTarget; // MSR_id for Target fudge + int m_idWaitReal; // MSR_id for true wait time + int m_idWait; // MSR_id for wait time recorded + int m_idFrameAccuracy; // MSR_id for time frame is late (int) + int m_idRenderAvg; // MSR_id for Render time recorded (int) + int m_idSchLateTime; // MSR_id for lateness at scheduler + int m_idQualityRate; // MSR_id for Quality rate requested + int m_idQualityTime; // MSR_id for Quality time requested + int m_idDecision; // MSR_id for decision code + int m_idDuration; // MSR_id for duration of a frame + int m_idThrottle; // MSR_id for audio-video throttling + //int m_idDebug; // MSR_id for trace style debugging + //int m_idSendQuality; // MSR_id for timing the notifications per se +#endif // PERF + REFERENCE_TIME m_trRememberStampForPerf; // original time stamp of frame + // with no earliness fudges etc. +#ifdef PERF + REFERENCE_TIME m_trRememberFrameForPerf; // time when previous frame rendered + + // debug... + int m_idFrameAvg; + int m_idWaitAvg; +#endif + + // PROPERTY PAGE + // This has edit fields that show the user what's happening + // These member variables hold these counts. + + int m_cFramesDropped; // cumulative frames dropped IN THE RENDERER + int m_cFramesDrawn; // Frames since streaming started seen BY THE + // RENDERER (some may be dropped upstream) + + // Next two support average sync offset and standard deviation of sync offset. + LONGLONG m_iTotAcc; // Sum of accuracies in mSec + LONGLONG m_iSumSqAcc; // Sum of squares of (accuracies in mSec) + + // Next two allow jitter calculation. Jitter is std deviation of frame time. + REFERENCE_TIME m_trLastDraw; // Time of prev frame (for inter-frame times) + LONGLONG m_iSumSqFrameTime; // Sum of squares of (inter-frame time in mSec) + LONGLONG m_iSumFrameTime; // Sum of inter-frame times in mSec + + // To get performance statistics on frame rate, jitter etc, we need + // to record the lateness and inter-frame time. What we actually need are the + // data above (sum, sum of squares and number of entries for each) but the data + // is generated just ahead of time and only later do we discover whether the + // frame was actually drawn or not. So we have to hang on to the data + int m_trLate; // hold onto frame lateness + int m_trFrame; // hold onto inter-frame time + + int m_tStreamingStart; // if streaming then time streaming started + // else time of last streaming session + // used for property page statistics +#ifdef PERF + LONGLONG m_llTimeOffset; // timeGetTime()*10000+m_llTimeOffset==ref time +#endif + +public: + + + CBaseVideoRenderer(REFCLSID RenderClass, // CLSID for this renderer + __in_opt LPCTSTR pName, // Debug ONLY description + __inout_opt LPUNKNOWN pUnk, // Aggregated owner object + __inout HRESULT *phr); // General OLE return code + + ~CBaseVideoRenderer(); + + // IQualityControl methods - Notify allows audio-video throttling + + STDMETHODIMP SetSink( IQualityControl * piqc); + STDMETHODIMP Notify( IBaseFilter * pSelf, Quality q); + + // These provide a full video quality management implementation + + void OnRenderStart(IMediaSample *pMediaSample); + void OnRenderEnd(IMediaSample *pMediaSample); + void OnWaitStart(); + void OnWaitEnd(); + HRESULT OnStartStreaming(); + HRESULT OnStopStreaming(); + void ThrottleWait(); + + // Handle the statistics gathering for our quality management + + void PreparePerformanceData(int trLate, int trFrame); + virtual void RecordFrameLateness(int trLate, int trFrame); + virtual void OnDirectRender(IMediaSample *pMediaSample); + virtual HRESULT ResetStreamingTimes(); + BOOL ScheduleSample(IMediaSample *pMediaSample); + HRESULT ShouldDrawSampleNow(IMediaSample *pMediaSample, + __inout REFERENCE_TIME *ptrStart, + __inout REFERENCE_TIME *ptrEnd); + + virtual HRESULT SendQuality(REFERENCE_TIME trLate, REFERENCE_TIME trRealStream); + STDMETHODIMP JoinFilterGraph(__inout_opt IFilterGraph * pGraph, __in_opt LPCWSTR pName); + + // + // Do estimates for standard deviations for per-frame + // statistics + // + // *piResult = (llSumSq - iTot * iTot / m_cFramesDrawn - 1) / + // (m_cFramesDrawn - 2) + // or 0 if m_cFramesDrawn <= 3 + // + HRESULT GetStdDev( + int nSamples, + __out int *piResult, + LONGLONG llSumSq, + LONGLONG iTot + ); +public: + + // IQualProp property page support + + STDMETHODIMP get_FramesDroppedInRenderer(__out int *cFramesDropped); + STDMETHODIMP get_FramesDrawn(__out int *pcFramesDrawn); + STDMETHODIMP get_AvgFrameRate(__out int *piAvgFrameRate); + STDMETHODIMP get_Jitter(__out int *piJitter); + STDMETHODIMP get_AvgSyncOffset(__out int *piAvg); + STDMETHODIMP get_DevSyncOffset(__out int *piDev); + + // Implement an IUnknown interface and expose IQualProp + + DECLARE_IUNKNOWN + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid,__deref_out VOID **ppv); +}; + +#endif // __RENBASE__ + diff --git a/third_party/BaseClasses/schedule.cpp b/third_party/BaseClasses/schedule.cpp new file mode 100644 index 00000000..7d798306 --- /dev/null +++ b/third_party/BaseClasses/schedule.cpp @@ -0,0 +1,284 @@ +//------------------------------------------------------------------------------ +// File: Schedule.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1996-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include + +// DbgLog values (all on LOG_TIMING): +// +// 2 for schedulting, firing and shunting of events +// 3 for wait delays and wake-up times of event thread +// 4 for details of whats on the list when the thread awakes + +/* Construct & destructors */ + +CAMSchedule::CAMSchedule( HANDLE ev ) +: CBaseObject(TEXT("CAMSchedule")) +, head(&z, 0), z(0, MAX_TIME) +, m_dwNextCookie(0), m_dwAdviseCount(0) +, m_pAdviseCache(0), m_dwCacheCount(0) +, m_ev( ev ) +{ + head.m_dwAdviseCookie = z.m_dwAdviseCookie = 0; +} + +CAMSchedule::~CAMSchedule() +{ + m_Serialize.Lock(); + + // Delete cache + CAdvisePacket * p = m_pAdviseCache; + while (p) + { + CAdvisePacket *const p_next = p->m_next; + delete p; + p = p_next; + } + + ASSERT( m_dwAdviseCount == 0 ); + // Better to be safe than sorry + if ( m_dwAdviseCount > 0 ) + { + DumpLinkedList(); + while ( !head.m_next->IsZ() ) + { + head.DeleteNext(); + --m_dwAdviseCount; + } + } + + // If, in the debug version, we assert twice, it means, not only + // did we have left over advises, but we have also let m_dwAdviseCount + // get out of sync. with the number of advises actually on the list. + ASSERT( m_dwAdviseCount == 0 ); + + m_Serialize.Unlock(); +} + +/* Public methods */ + +DWORD CAMSchedule::GetAdviseCount() +{ + // No need to lock, m_dwAdviseCount is 32bits & declared volatile + return m_dwAdviseCount; +} + +REFERENCE_TIME CAMSchedule::GetNextAdviseTime() +{ + CAutoLock lck(&m_Serialize); // Need to stop the linked list from changing + return head.m_next->m_rtEventTime; +} + +DWORD_PTR CAMSchedule::AddAdvisePacket +( const REFERENCE_TIME & time1 +, const REFERENCE_TIME & time2 +, HANDLE h, BOOL periodic +) +{ + // Since we use MAX_TIME as a sentry, we can't afford to + // schedule a notification at MAX_TIME + ASSERT( time1 < MAX_TIME ); + DWORD_PTR Result; + CAdvisePacket * p; + + m_Serialize.Lock(); + + if (m_pAdviseCache) + { + p = m_pAdviseCache; + m_pAdviseCache = p->m_next; + --m_dwCacheCount; + } + else + { + p = new CAdvisePacket(); + } + if (p) + { + p->m_rtEventTime = time1; p->m_rtPeriod = time2; + p->m_hNotify = h; p->m_bPeriodic = periodic; + Result = AddAdvisePacket( p ); + } + else Result = 0; + + m_Serialize.Unlock(); + + return Result; +} + +HRESULT CAMSchedule::Unadvise(DWORD_PTR dwAdviseCookie) +{ + HRESULT hr = S_FALSE; + CAdvisePacket * p_prev = &head; + CAdvisePacket * p_n; + m_Serialize.Lock(); + while ( p_n = p_prev->Next() ) // The Next() method returns NULL when it hits z + { + if ( p_n->m_dwAdviseCookie == dwAdviseCookie ) + { + Delete( p_prev->RemoveNext() ); + --m_dwAdviseCount; + hr = S_OK; + // Having found one cookie that matches, there should be no more + #ifdef DEBUG + while (p_n = p_prev->Next()) + { + ASSERT(p_n->m_dwAdviseCookie != dwAdviseCookie); + p_prev = p_n; + } + #endif + break; + } + p_prev = p_n; + }; + m_Serialize.Unlock(); + return hr; +} + +REFERENCE_TIME CAMSchedule::Advise( const REFERENCE_TIME & rtTime ) +{ + REFERENCE_TIME rtNextTime; + CAdvisePacket * pAdvise; + + DbgLog((LOG_TIMING, 2, + TEXT("CAMSchedule::Advise( %lu ms )"), ULONG(rtTime / (UNITS / MILLISECONDS)))); + + CAutoLock lck(&m_Serialize); + + #ifdef DEBUG + if (DbgCheckModuleLevel(LOG_TIMING, 4)) DumpLinkedList(); + #endif + + // Note - DON'T cache the difference, it might overflow + while ( rtTime >= (rtNextTime = (pAdvise=head.m_next)->m_rtEventTime) && + !pAdvise->IsZ() ) + { + ASSERT(pAdvise->m_dwAdviseCookie); // If this is zero, its the head or the tail!! + + ASSERT(pAdvise->m_hNotify != INVALID_HANDLE_VALUE); + + if (pAdvise->m_bPeriodic == TRUE) + { + ReleaseSemaphore(pAdvise->m_hNotify,1,NULL); + pAdvise->m_rtEventTime += pAdvise->m_rtPeriod; + ShuntHead(); + } + else + { + ASSERT( pAdvise->m_bPeriodic == FALSE ); + EXECUTE_ASSERT(SetEvent(pAdvise->m_hNotify)); + --m_dwAdviseCount; + Delete( head.RemoveNext() ); + } + + } + + DbgLog((LOG_TIMING, 3, + TEXT("CAMSchedule::Advise() Next time stamp: %lu ms, for advise %lu."), + DWORD(rtNextTime / (UNITS / MILLISECONDS)), pAdvise->m_dwAdviseCookie )); + + return rtNextTime; +} + +/* Private methods */ + +DWORD_PTR CAMSchedule::AddAdvisePacket( __inout CAdvisePacket * pPacket ) +{ + ASSERT(pPacket->m_rtEventTime >= 0 && pPacket->m_rtEventTime < MAX_TIME); + ASSERT(CritCheckIn(&m_Serialize)); + + CAdvisePacket * p_prev = &head; + CAdvisePacket * p_n; + + const DWORD_PTR Result = pPacket->m_dwAdviseCookie = ++m_dwNextCookie; + // This relies on the fact that z is a sentry with a maximal m_rtEventTime + for(;;p_prev = p_n) + { + p_n = p_prev->m_next; + if ( p_n->m_rtEventTime >= pPacket->m_rtEventTime ) break; + } + p_prev->InsertAfter( pPacket ); + ++m_dwAdviseCount; + + DbgLog((LOG_TIMING, 2, TEXT("Added advise %lu, for thread 0x%02X, scheduled at %lu"), + pPacket->m_dwAdviseCookie, GetCurrentThreadId(), (pPacket->m_rtEventTime / (UNITS / MILLISECONDS)) )); + + // If packet added at the head, then clock needs to re-evaluate wait time. + if ( p_prev == &head ) SetEvent( m_ev ); + + return Result; +} + +void CAMSchedule::Delete( __inout CAdvisePacket * pPacket ) +{ + if ( m_dwCacheCount >= dwCacheMax ) delete pPacket; + else + { + m_Serialize.Lock(); + pPacket->m_next = m_pAdviseCache; + m_pAdviseCache = pPacket; + ++m_dwCacheCount; + m_Serialize.Unlock(); + } +} + + +// Takes the head of the list & repositions it +void CAMSchedule::ShuntHead() +{ + CAdvisePacket * p_prev = &head; + CAdvisePacket * p_n; + + m_Serialize.Lock(); + CAdvisePacket *const pPacket = head.m_next; + + // This will catch both an empty list, + // and if somehow a MAX_TIME time gets into the list + // (which would also break this method). + ASSERT( pPacket->m_rtEventTime < MAX_TIME ); + + // This relies on the fact that z is a sentry with a maximal m_rtEventTime + for(;;p_prev = p_n) + { + p_n = p_prev->m_next; + if ( p_n->m_rtEventTime > pPacket->m_rtEventTime ) break; + } + // If p_prev == pPacket then we're already in the right place + if (p_prev != pPacket) + { + head.m_next = pPacket->m_next; + (p_prev->m_next = pPacket)->m_next = p_n; + } + #ifdef DEBUG + DbgLog((LOG_TIMING, 2, TEXT("Periodic advise %lu, shunted to %lu"), + pPacket->m_dwAdviseCookie, (pPacket->m_rtEventTime / (UNITS / MILLISECONDS)) )); + #endif + m_Serialize.Unlock(); +} + + +#ifdef DEBUG +void CAMSchedule::DumpLinkedList() +{ + m_Serialize.Lock(); + int i=0; + DbgLog((LOG_TIMING, 1, TEXT("CAMSchedule::DumpLinkedList() this = 0x%p"), this)); + for ( CAdvisePacket * p = &head + ; p + ; p = p->m_next , i++ + ) + { + DbgLog((LOG_TIMING, 1, TEXT("Advise List # %lu, Cookie %d, RefTime %lu"), + i, + p->m_dwAdviseCookie, + p->m_rtEventTime / (UNITS / MILLISECONDS) + )); + } + m_Serialize.Unlock(); +} +#endif diff --git a/third_party/BaseClasses/schedule.h b/third_party/BaseClasses/schedule.h new file mode 100644 index 00000000..c16700a2 --- /dev/null +++ b/third_party/BaseClasses/schedule.h @@ -0,0 +1,128 @@ +//------------------------------------------------------------------------------ +// File: Schedule.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1996-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __CAMSchedule__ +#define __CAMSchedule__ + +class CAMSchedule : private CBaseObject +{ +public: + virtual ~CAMSchedule(); + // ev is the event we should fire if the advise time needs re-evaluating + CAMSchedule( HANDLE ev ); + + DWORD GetAdviseCount(); + REFERENCE_TIME GetNextAdviseTime(); + + // We need a method for derived classes to add advise packets, we return the cookie + DWORD_PTR AddAdvisePacket( const REFERENCE_TIME & time1, const REFERENCE_TIME & time2, HANDLE h, BOOL periodic ); + // And a way to cancel + HRESULT Unadvise(DWORD_PTR dwAdviseCookie); + + // Tell us the time please, and we'll dispatch the expired events. We return the time of the next event. + // NB: The time returned will be "useless" if you start adding extra Advises. But that's the problem of + // whoever is using this helper class (typically a clock). + REFERENCE_TIME Advise( const REFERENCE_TIME & rtTime ); + + // Get the event handle which will be set if advise time requires re-evaluation. + HANDLE GetEvent() const { return m_ev; } + +private: + // We define the nodes that will be used in our singly linked list + // of advise packets. The list is ordered by time, with the + // elements that will expire first at the front. + class CAdvisePacket + { + public: + CAdvisePacket() + {} + + CAdvisePacket * m_next; + DWORD_PTR m_dwAdviseCookie; + REFERENCE_TIME m_rtEventTime; // Time at which event should be set + REFERENCE_TIME m_rtPeriod; // Periodic time + HANDLE m_hNotify; // Handle to event or semephore + BOOL m_bPeriodic; // TRUE => Periodic event + + CAdvisePacket( __inout_opt CAdvisePacket * next, LONGLONG time ) : m_next(next), m_rtEventTime(time) + {} + + void InsertAfter( __inout CAdvisePacket * p ) + { + p->m_next = m_next; + m_next = p; + } + + int IsZ() const // That is, is it the node that represents the end of the list + { return m_next == 0; } + + CAdvisePacket * RemoveNext() + { + CAdvisePacket *const next = m_next; + CAdvisePacket *const new_next = next->m_next; + m_next = new_next; + return next; + } + + void DeleteNext() + { + delete RemoveNext(); + } + + CAdvisePacket * Next() const + { + CAdvisePacket * result = m_next; + if (result->IsZ()) result = 0; + return result; + } + + DWORD_PTR Cookie() const + { return m_dwAdviseCookie; } + }; + + // Structure is: + // head -> elmt1 -> elmt2 -> z -> null + // So an empty list is: head -> z -> null + // Having head & z as links makes insertaion, + // deletion and shunting much easier. + CAdvisePacket head, z; // z is both a tail and a sentry + + volatile DWORD_PTR m_dwNextCookie; // Strictly increasing + volatile DWORD m_dwAdviseCount; // Number of elements on list + + CCritSec m_Serialize; + + // AddAdvisePacket: adds the packet, returns the cookie (0 if failed) + DWORD_PTR AddAdvisePacket( __inout CAdvisePacket * pPacket ); + // Event that we should set if the packed added above will be the next to fire. + const HANDLE m_ev; + + // A Shunt is where we have changed the first element in the + // list and want it re-evaluating (i.e. repositioned) in + // the list. + void ShuntHead(); + + // Rather than delete advise packets, we cache them for future use + CAdvisePacket * m_pAdviseCache; + DWORD m_dwCacheCount; + enum { dwCacheMax = 5 }; // Don't bother caching more than five + + void Delete( __inout CAdvisePacket * pLink );// This "Delete" will cache the Link + +// Attributes and methods for debugging +public: +#ifdef DEBUG + void DumpLinkedList(); +#else + void DumpLinkedList() {} +#endif + +}; + +#endif // __CAMSchedule__ diff --git a/third_party/BaseClasses/seekpt.cpp b/third_party/BaseClasses/seekpt.cpp new file mode 100644 index 00000000..bb13d6f0 --- /dev/null +++ b/third_party/BaseClasses/seekpt.cpp @@ -0,0 +1,83 @@ +//------------------------------------------------------------------------------ +// File: SeekPT.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include "seekpt.h" + +//================================================================== +// CreateInstance +// This goes in the factory template table to create new instances +// If there is already a mapper instance - return that, else make one +// and save it in a static variable so that forever after we can return that. +//================================================================== + +CUnknown * CSeekingPassThru::CreateInstance(__inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr) +{ + return new CSeekingPassThru(NAME("Seeking PassThru"),pUnk, phr); +} + + +STDMETHODIMP CSeekingPassThru::NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv) +{ + if (riid == IID_ISeekingPassThru) { + return GetInterface((ISeekingPassThru *) this, ppv); + } else { + if (m_pPosPassThru && + (riid == IID_IMediaSeeking || + riid == IID_IMediaPosition)) { + return m_pPosPassThru->NonDelegatingQueryInterface(riid,ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid, ppv); + } + } +} + + +CSeekingPassThru::CSeekingPassThru( __in_opt LPCTSTR pName, __inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr ) + : CUnknown(pName, pUnk, phr), + m_pPosPassThru(NULL) +{ +} + + +CSeekingPassThru::~CSeekingPassThru() +{ + delete m_pPosPassThru; +} + +STDMETHODIMP CSeekingPassThru::Init(BOOL bRendererSeeking, IPin *pPin) +{ + HRESULT hr = NOERROR; + if (m_pPosPassThru) { + hr = E_FAIL; + } else { + m_pPosPassThru = + bRendererSeeking ? + new CRendererPosPassThru( + NAME("Render Seeking COM object"), + (IUnknown *)this, + &hr, + pPin) : + new CPosPassThru( + NAME("Render Seeking COM object"), + (IUnknown *)this, + &hr, + pPin); + if (!m_pPosPassThru) { + hr = E_OUTOFMEMORY; + } else { + if (FAILED(hr)) { + delete m_pPosPassThru; + m_pPosPassThru = NULL; + } + } + } + return hr; +} + diff --git a/third_party/BaseClasses/seekpt.h b/third_party/BaseClasses/seekpt.h new file mode 100644 index 00000000..208d418f --- /dev/null +++ b/third_party/BaseClasses/seekpt.h @@ -0,0 +1,30 @@ +//------------------------------------------------------------------------------ +// File: SeekPT.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __seekpt_h__ +#define __seekpt_h__ + + +class CSeekingPassThru : public ISeekingPassThru, public CUnknown +{ +public: + static CUnknown *CreateInstance(__inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr); + CSeekingPassThru(__in_opt LPCTSTR pName, __inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr); + ~CSeekingPassThru(); + + DECLARE_IUNKNOWN; + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv); + + STDMETHODIMP Init(BOOL bSupportRendering, IPin *pPin); + +private: + CPosPassThru *m_pPosPassThru; +}; + +#endif diff --git a/third_party/BaseClasses/source.cpp b/third_party/BaseClasses/source.cpp new file mode 100644 index 00000000..ef7795c4 --- /dev/null +++ b/third_party/BaseClasses/source.cpp @@ -0,0 +1,522 @@ +//------------------------------------------------------------------------------ +// File: Source.cpp +// +// Desc: DirectShow base classes - implements CSource, which is a Quartz +// source filter 'template.' +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// Locking Strategy. +// +// Hold the filter critical section (m_pFilter->pStateLock()) to serialise +// access to functions. Note that, in general, this lock may be held +// by a function when the worker thread may want to hold it. Therefore +// if you wish to access shared state from the worker thread you will +// need to add another critical section object. The execption is during +// the threads processing loop, when it is safe to get the filter critical +// section from within FillBuffer(). + +#include + + +// +// CSource::Constructor +// +// Initialise the pin count for the filter. The user will create the pins in +// the derived class. +CSource::CSource(__in_opt LPCTSTR pName, __inout_opt LPUNKNOWN lpunk, CLSID clsid) + : CBaseFilter(pName, lpunk, &m_cStateLock, clsid), + m_iPins(0), + m_paStreams(NULL) +{ +} + +CSource::CSource(__in_opt LPCTSTR pName, __inout_opt LPUNKNOWN lpunk, CLSID clsid, __inout HRESULT *phr) + : CBaseFilter(pName, lpunk, &m_cStateLock, clsid), + m_iPins(0), + m_paStreams(NULL) +{ + UNREFERENCED_PARAMETER(phr); +} + +#ifdef UNICODE +CSource::CSource(__in_opt LPCSTR pName, __inout_opt LPUNKNOWN lpunk, CLSID clsid) + : CBaseFilter(pName, lpunk, &m_cStateLock, clsid), + m_iPins(0), + m_paStreams(NULL) +{ +} + +CSource::CSource(__in_opt LPCSTR pName, __inout_opt LPUNKNOWN lpunk, CLSID clsid, __inout HRESULT *phr) + : CBaseFilter(pName, lpunk, &m_cStateLock, clsid), + m_iPins(0), + m_paStreams(NULL) +{ + UNREFERENCED_PARAMETER(phr); +} +#endif + +// +// CSource::Destructor +// +CSource::~CSource() +{ + /* Free our pins and pin array */ + while (m_iPins != 0) { + // deleting the pins causes them to be removed from the array... + delete m_paStreams[m_iPins - 1]; + } + + ASSERT(m_paStreams == NULL); +} + + +// +// Add a new pin +// +HRESULT CSource::AddPin(__in CSourceStream *pStream) +{ + CAutoLock lock(&m_cStateLock); + + /* Allocate space for this pin and the old ones */ + CSourceStream **paStreams = new CSourceStream *[m_iPins + 1]; + if (paStreams == NULL) { + return E_OUTOFMEMORY; + } + if (m_paStreams != NULL) { + CopyMemory((PVOID)paStreams, (PVOID)m_paStreams, + m_iPins * sizeof(m_paStreams[0])); + paStreams[m_iPins] = pStream; + delete [] m_paStreams; + } + m_paStreams = paStreams; + m_paStreams[m_iPins] = pStream; + m_iPins++; + return S_OK; +} + +// +// Remove a pin - pStream is NOT deleted +// +HRESULT CSource::RemovePin(__in CSourceStream *pStream) +{ + int i; + for (i = 0; i < m_iPins; i++) { + if (m_paStreams[i] == pStream) { + if (m_iPins == 1) { + delete [] m_paStreams; + m_paStreams = NULL; + } else { + /* no need to reallocate */ + while (++i < m_iPins) + m_paStreams[i - 1] = m_paStreams[i]; + } + m_iPins--; + return S_OK; + } + } + return S_FALSE; +} + +// +// FindPin +// +// Set *ppPin to the IPin* that has the id Id. +// or to NULL if the Id cannot be matched. +STDMETHODIMP CSource::FindPin(LPCWSTR Id, __deref_out IPin **ppPin) +{ + CheckPointer(ppPin,E_POINTER); + ValidateReadWritePtr(ppPin,sizeof(IPin *)); + // The -1 undoes the +1 in QueryId and ensures that totally invalid + // strings (for which WstrToInt delivers 0) give a deliver a NULL pin. + int i = WstrToInt(Id) -1; + *ppPin = GetPin(i); + if (*ppPin!=NULL){ + (*ppPin)->AddRef(); + return NOERROR; + } else { + return VFW_E_NOT_FOUND; + } +} + +// +// FindPinNumber +// +// return the number of the pin with this IPin* or -1 if none +int CSource::FindPinNumber(__in IPin *iPin) { + int i; + for (i=0; in && n>=0 it follows that m_iPins>0 + // which is what used to be checked (i.e. checking that we have a pin) + if ((n >= 0) && (n < m_iPins)) { + + ASSERT(m_paStreams[n]); + return m_paStreams[n]; + } + return NULL; +} + + +// + + +// * +// * --- CSourceStream ---- +// * + +// +// Set Id to point to a CoTaskMemAlloc'd +STDMETHODIMP CSourceStream::QueryId(__deref_out LPWSTR *Id) { + CheckPointer(Id,E_POINTER); + ValidateReadWritePtr(Id,sizeof(LPWSTR)); + + // We give the pins id's which are 1,2,... + // FindPinNumber returns -1 for an invalid pin + int i = 1+ m_pFilter->FindPinNumber(this); + if (i<1) return VFW_E_NOT_FOUND; + *Id = (LPWSTR)CoTaskMemAlloc(sizeof(WCHAR) * 12); + if (*Id==NULL) { + return E_OUTOFMEMORY; + } + IntToWstr(i, *Id); + return NOERROR; +} + + + +// +// CSourceStream::Constructor +// +// increments the number of pins present on the filter +CSourceStream::CSourceStream( + __in_opt LPCTSTR pObjectName, + __inout HRESULT *phr, + __inout CSource *ps, + __in_opt LPCWSTR pPinName) + : CBaseOutputPin(pObjectName, ps, ps->pStateLock(), phr, pPinName), + m_pFilter(ps) { + + *phr = m_pFilter->AddPin(this); +} + +#ifdef UNICODE +CSourceStream::CSourceStream( + __in_opt LPCSTR pObjectName, + __inout HRESULT *phr, + __inout CSource *ps, + __in_opt LPCWSTR pPinName) + : CBaseOutputPin(pObjectName, ps, ps->pStateLock(), phr, pPinName), + m_pFilter(ps) { + + *phr = m_pFilter->AddPin(this); +} +#endif +// +// CSourceStream::Destructor +// +// Decrements the number of pins on this filter +CSourceStream::~CSourceStream(void) { + + m_pFilter->RemovePin(this); +} + + +// +// CheckMediaType +// +// Do we support this type? Provides the default support for 1 type. +HRESULT CSourceStream::CheckMediaType(const CMediaType *pMediaType) { + + CAutoLock lock(m_pFilter->pStateLock()); + + CMediaType mt; + GetMediaType(&mt); + + if (mt == *pMediaType) { + return NOERROR; + } + + return E_FAIL; +} + + +// +// GetMediaType/3 +// +// By default we support only one type +// iPosition indexes are 0-n +HRESULT CSourceStream::GetMediaType(int iPosition, __inout CMediaType *pMediaType) { + + CAutoLock lock(m_pFilter->pStateLock()); + + if (iPosition<0) { + return E_INVALIDARG; + } + if (iPosition>0) { + return VFW_S_NO_MORE_ITEMS; + } + return GetMediaType(pMediaType); +} + + +// +// Active +// +// The pin is active - start up the worker thread +HRESULT CSourceStream::Active(void) { + + CAutoLock lock(m_pFilter->pStateLock()); + + HRESULT hr; + + if (m_pFilter->IsActive()) { + return S_FALSE; // succeeded, but did not allocate resources (they already exist...) + } + + // do nothing if not connected - its ok not to connect to + // all pins of a source filter + if (!IsConnected()) { + return NOERROR; + } + + hr = CBaseOutputPin::Active(); + if (FAILED(hr)) { + return hr; + } + + ASSERT(!ThreadExists()); + + // start the thread + if (!Create()) { + return E_FAIL; + } + + // Tell thread to initialize. If OnThreadCreate Fails, so does this. + hr = Init(); + if (FAILED(hr)) + return hr; + + return Pause(); +} + + +// +// Inactive +// +// Pin is inactive - shut down the worker thread +// Waits for the worker to exit before returning. +HRESULT CSourceStream::Inactive(void) { + + CAutoLock lock(m_pFilter->pStateLock()); + + HRESULT hr; + + // do nothing if not connected - its ok not to connect to + // all pins of a source filter + if (!IsConnected()) { + return NOERROR; + } + + // !!! need to do this before trying to stop the thread, because + // we may be stuck waiting for our own allocator!!! + + hr = CBaseOutputPin::Inactive(); // call this first to Decommit the allocator + if (FAILED(hr)) { + return hr; + } + + if (ThreadExists()) { + hr = Stop(); + + if (FAILED(hr)) { + return hr; + } + + hr = Exit(); + if (FAILED(hr)) { + return hr; + } + + Close(); // Wait for the thread to exit, then tidy up. + } + + // hr = CBaseOutputPin::Inactive(); // call this first to Decommit the allocator + //if (FAILED(hr)) { + // return hr; + //} + + return NOERROR; +} + + +// +// ThreadProc +// +// When this returns the thread exits +// Return codes > 0 indicate an error occured +DWORD CSourceStream::ThreadProc(void) { + + HRESULT hr; // the return code from calls + Command com; + + do { + com = GetRequest(); + if (com != CMD_INIT) { + DbgLog((LOG_ERROR, 1, TEXT("Thread expected init command"))); + Reply((DWORD) E_UNEXPECTED); + } + } while (com != CMD_INIT); + + DbgLog((LOG_TRACE, 1, TEXT("CSourceStream worker thread initializing"))); + + hr = OnThreadCreate(); // perform set up tasks + if (FAILED(hr)) { + DbgLog((LOG_ERROR, 1, TEXT("CSourceStream::OnThreadCreate failed. Aborting thread."))); + OnThreadDestroy(); + Reply(hr); // send failed return code from OnThreadCreate + return 1; + } + + // Initialisation suceeded + Reply(NOERROR); + + Command cmd; + do { + cmd = GetRequest(); + + switch (cmd) { + + case CMD_EXIT: + Reply(NOERROR); + break; + + case CMD_RUN: + DbgLog((LOG_ERROR, 1, TEXT("CMD_RUN received before a CMD_PAUSE???"))); + // !!! fall through??? + + case CMD_PAUSE: + Reply(NOERROR); + DoBufferProcessingLoop(); + break; + + case CMD_STOP: + Reply(NOERROR); + break; + + default: + DbgLog((LOG_ERROR, 1, TEXT("Unknown command %d received!"), cmd)); + Reply((DWORD) E_NOTIMPL); + break; + } + } while (cmd != CMD_EXIT); + + hr = OnThreadDestroy(); // tidy up. + if (FAILED(hr)) { + DbgLog((LOG_ERROR, 1, TEXT("CSourceStream::OnThreadDestroy failed. Exiting thread."))); + return 1; + } + + DbgLog((LOG_TRACE, 1, TEXT("CSourceStream worker thread exiting"))); + return 0; +} + + +// +// DoBufferProcessingLoop +// +// Grabs a buffer and calls the users processing function. +// Overridable, so that different delivery styles can be catered for. +HRESULT CSourceStream::DoBufferProcessingLoop(void) { + + Command com; + + OnThreadStartPlay(); + + do { + while (!CheckRequest(&com)) { + + IMediaSample *pSample; + + HRESULT hr = GetDeliveryBuffer(&pSample,NULL,NULL,0); + if (FAILED(hr)) { + Sleep(1); + continue; // go round again. Perhaps the error will go away + // or the allocator is decommited & we will be asked to + // exit soon. + } + + // Virtual function user will override. + hr = FillBuffer(pSample); + + if (hr == S_OK) { + hr = Deliver(pSample); + pSample->Release(); + + // downstream filter returns S_FALSE if it wants us to + // stop or an error if it's reporting an error. + if(hr != S_OK) + { + DbgLog((LOG_TRACE, 2, TEXT("Deliver() returned %08x; stopping"), hr)); + return S_OK; + } + + } else if (hr == S_FALSE) { + // derived class wants us to stop pushing data + pSample->Release(); + DeliverEndOfStream(); + return S_OK; + } else { + // derived class encountered an error + pSample->Release(); + DbgLog((LOG_ERROR, 1, TEXT("Error %08lX from FillBuffer!!!"), hr)); + DeliverEndOfStream(); + m_pFilter->NotifyEvent(EC_ERRORABORT, hr, 0); + return hr; + } + + // all paths release the sample + } + + // For all commands sent to us there must be a Reply call! + + if (com == CMD_RUN || com == CMD_PAUSE) { + Reply(NOERROR); + } else if (com != CMD_STOP) { + Reply((DWORD) E_UNEXPECTED); + DbgLog((LOG_ERROR, 1, TEXT("Unexpected command!!!"))); + } + } while (com != CMD_STOP); + + return S_FALSE; +} + diff --git a/third_party/BaseClasses/source.h b/third_party/BaseClasses/source.h new file mode 100644 index 00000000..528d5bcb --- /dev/null +++ b/third_party/BaseClasses/source.h @@ -0,0 +1,172 @@ +//------------------------------------------------------------------------------ +// File: Source.h +// +// Desc: DirectShow base classes - defines classes to simplify creation of +// ActiveX source filters that support continuous generation of data. +// No support is provided for IMediaControl or IMediaPosition. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// +// Derive your source filter from CSource. +// During construction either: +// Create some CSourceStream objects to manage your pins +// Provide the user with a means of doing so eg, an IPersistFile interface. +// +// CSource provides: +// IBaseFilter interface management +// IMediaFilter interface management, via CBaseFilter +// Pin counting for CBaseFilter +// +// Derive a class from CSourceStream to manage your output pin types +// Implement GetMediaType/1 to return the type you support. If you support multiple +// types then overide GetMediaType/3, CheckMediaType and GetMediaTypeCount. +// Implement Fillbuffer() to put data into one buffer. +// +// CSourceStream provides: +// IPin management via CBaseOutputPin +// Worker thread management + +#ifndef __CSOURCE__ +#define __CSOURCE__ + +class CSourceStream; // The class that will handle each pin + + +// +// CSource +// +// Override construction to provide a means of creating +// CSourceStream derived objects - ie a way of creating pins. +class CSource : public CBaseFilter { +public: + + CSource(__in_opt LPCTSTR pName, __inout_opt LPUNKNOWN lpunk, CLSID clsid, __inout HRESULT *phr); + CSource(__in_opt LPCTSTR pName, __inout_opt LPUNKNOWN lpunk, CLSID clsid); +#ifdef UNICODE + CSource(__in_opt LPCSTR pName, __inout_opt LPUNKNOWN lpunk, CLSID clsid, __inout HRESULT *phr); + CSource(__in_opt LPCSTR pName, __inout_opt LPUNKNOWN lpunk, CLSID clsid); +#endif + ~CSource(); + + int GetPinCount(void); + CBasePin *GetPin(int n); + + // -- Utilities -- + + CCritSec* pStateLock(void) { return &m_cStateLock; } // provide our critical section + + HRESULT AddPin(__in CSourceStream *); + HRESULT RemovePin(__in CSourceStream *); + + STDMETHODIMP FindPin( + LPCWSTR Id, + __deref_out IPin ** ppPin + ); + + int FindPinNumber(__in IPin *iPin); + +protected: + + int m_iPins; // The number of pins on this filter. Updated by CSourceStream + // constructors & destructors. + CSourceStream **m_paStreams; // the pins on this filter. + + CCritSec m_cStateLock; // Lock this to serialize function accesses to the filter state + +}; + + +// +// CSourceStream +// +// Use this class to manage a stream of data that comes from a +// pin. +// Uses a worker thread to put data on the pin. +class CSourceStream : public CAMThread, public CBaseOutputPin { +public: + + CSourceStream(__in_opt LPCTSTR pObjectName, + __inout HRESULT *phr, + __inout CSource *pms, + __in_opt LPCWSTR pName); +#ifdef UNICODE + CSourceStream(__in_opt LPCSTR pObjectName, + __inout HRESULT *phr, + __inout CSource *pms, + __in_opt LPCWSTR pName); +#endif + virtual ~CSourceStream(void); // virtual destructor ensures derived class destructors are called too. + +protected: + + CSource *m_pFilter; // The parent of this stream + + // * + // * Data Source + // * + // * The following three functions: FillBuffer, OnThreadCreate/Destroy, are + // * called from within the ThreadProc. They are used in the creation of + // * the media samples this pin will provide + // * + + // Override this to provide the worker thread a means + // of processing a buffer + virtual HRESULT FillBuffer(IMediaSample *pSamp) PURE; + + // Called as the thread is created/destroyed - use to perform + // jobs such as start/stop streaming mode + // If OnThreadCreate returns an error the thread will exit. + virtual HRESULT OnThreadCreate(void) {return NOERROR;}; + virtual HRESULT OnThreadDestroy(void) {return NOERROR;}; + virtual HRESULT OnThreadStartPlay(void) {return NOERROR;}; + + // * + // * Worker Thread + // * + + HRESULT Active(void); // Starts up the worker thread + HRESULT Inactive(void); // Exits the worker thread. + +public: + // thread commands + enum Command {CMD_INIT, CMD_PAUSE, CMD_RUN, CMD_STOP, CMD_EXIT}; + HRESULT Init(void) { return CallWorker(CMD_INIT); } + HRESULT Exit(void) { return CallWorker(CMD_EXIT); } + HRESULT Run(void) { return CallWorker(CMD_RUN); } + HRESULT Pause(void) { return CallWorker(CMD_PAUSE); } + HRESULT Stop(void) { return CallWorker(CMD_STOP); } + +protected: + Command GetRequest(void) { return (Command) CAMThread::GetRequest(); } + BOOL CheckRequest(Command *pCom) { return CAMThread::CheckRequest( (DWORD *) pCom); } + + // override these if you want to add thread commands + virtual DWORD ThreadProc(void); // the thread function + + virtual HRESULT DoBufferProcessingLoop(void); // the loop executed whilst running + + + // * + // * AM_MEDIA_TYPE support + // * + + // If you support more than one media type then override these 2 functions + virtual HRESULT CheckMediaType(const CMediaType *pMediaType); + virtual HRESULT GetMediaType(int iPosition, __inout CMediaType *pMediaType); // List pos. 0-n + + // If you support only one type then override this fn. + // This will only be called by the default implementations + // of CheckMediaType and GetMediaType(int, CMediaType*) + // You must override this fn. or the above 2! + virtual HRESULT GetMediaType(__inout CMediaType *pMediaType) {return E_UNEXPECTED;} + + STDMETHODIMP QueryId( + __deref_out LPWSTR * Id + ); +}; + +#endif // __CSOURCE__ + diff --git a/third_party/BaseClasses/streams.h b/third_party/BaseClasses/streams.h new file mode 100644 index 00000000..1926321d --- /dev/null +++ b/third_party/BaseClasses/streams.h @@ -0,0 +1,202 @@ +//------------------------------------------------------------------------------ +// File: Streams.h +// +// Desc: DirectShow base classes - defines overall streams architecture. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __STREAMS__ +#define __STREAMS__ + +#ifdef _MSC_VER +// disable some level-4 warnings, use #pragma warning(enable:###) to re-enable +#pragma warning(disable:4100) // warning C4100: unreferenced formal parameter +#pragma warning(disable:4201) // warning C4201: nonstandard extension used : nameless struct/union +#pragma warning(disable:4511) // warning C4511: copy constructor could not be generated +#pragma warning(disable:4512) // warning C4512: assignment operator could not be generated +#pragma warning(disable:4514) // warning C4514: "unreferenced inline function has been removed" + +#if _MSC_VER>=1100 +#define AM_NOVTABLE __declspec(novtable) +#else +#define AM_NOVTABLE +#endif +#endif // MSC_VER + + +// Because of differences between Visual C++ and older Microsoft SDKs, +// you may have defined _DEBUG without defining DEBUG. This logic +// ensures that both will be set if Visual C++ sets _DEBUG. +#ifdef _DEBUG +#ifndef DEBUG +#define DEBUG +#endif +#endif + + +#include +#include +#include +#include +#include + + +#ifndef NUMELMS +#if _WIN32_WINNT < 0x0600 + #define NUMELMS(aa) (sizeof(aa)/sizeof((aa)[0])) +#else + #define NUMELMS(aa) ARRAYSIZE(aa) +#endif +#endif + +/////////////////////////////////////////////////////////////////////////// +// The following definitions come from the Platform SDK and are required if +// the applicaiton is being compiled with the headers from Visual C++ 6.0. +/////////////////////////////////////////////////// //////////////////////// +#ifndef InterlockedExchangePointer + #define InterlockedExchangePointer(Target, Value) \ + (PVOID)InterlockedExchange((PLONG)(Target), (LONG)(Value)) +#endif + +#ifndef _WAVEFORMATEXTENSIBLE_ +#define _WAVEFORMATEXTENSIBLE_ +typedef struct { + WAVEFORMATEX Format; + union { + WORD wValidBitsPerSample; /* bits of precision */ + WORD wSamplesPerBlock; /* valid if wBitsPerSample==0 */ + WORD wReserved; /* If neither applies, set to zero. */ + } Samples; + DWORD dwChannelMask; /* which channels are */ + /* present in stream */ + GUID SubFormat; +} WAVEFORMATEXTENSIBLE, *PWAVEFORMATEXTENSIBLE; +#endif // !_WAVEFORMATEXTENSIBLE_ + +#if !defined(WAVE_FORMAT_EXTENSIBLE) +#define WAVE_FORMAT_EXTENSIBLE 0xFFFE +#endif // !defined(WAVE_FORMAT_EXTENSIBLE) + +#ifndef GetWindowLongPtr + #define GetWindowLongPtrA GetWindowLongA + #define GetWindowLongPtrW GetWindowLongW + #ifdef UNICODE + #define GetWindowLongPtr GetWindowLongPtrW + #else + #define GetWindowLongPtr GetWindowLongPtrA + #endif // !UNICODE +#endif // !GetWindowLongPtr + +#ifndef SetWindowLongPtr + #define SetWindowLongPtrA SetWindowLongA + #define SetWindowLongPtrW SetWindowLongW + #ifdef UNICODE + #define SetWindowLongPtr SetWindowLongPtrW + #else + #define SetWindowLongPtr SetWindowLongPtrA + #endif // !UNICODE +#endif // !SetWindowLongPtr + +#ifndef GWLP_WNDPROC + #define GWLP_WNDPROC (-4) +#endif +#ifndef GWLP_HINSTANCE + #define GWLP_HINSTANCE (-6) +#endif +#ifndef GWLP_HWNDPARENT + #define GWLP_HWNDPARENT (-8) +#endif +#ifndef GWLP_USERDATA + #define GWLP_USERDATA (-21) +#endif +#ifndef GWLP_ID + #define GWLP_ID (-12) +#endif +#ifndef DWLP_MSGRESULT + #define DWLP_MSGRESULT 0 +#endif +#ifndef DWLP_DLGPROC + #define DWLP_DLGPROC DWLP_MSGRESULT + sizeof(LRESULT) +#endif +#ifndef DWLP_USER + #define DWLP_USER DWLP_DLGPROC + sizeof(DLGPROC) +#endif + + +#pragma warning(push) +#pragma warning(disable: 4312 4244) +// _GetWindowLongPtr +// Templated version of GetWindowLongPtr, to suppress spurious compiler warning. +template +T _GetWindowLongPtr(HWND hwnd, int nIndex) +{ + return (T)GetWindowLongPtr(hwnd, nIndex); +} + +// _SetWindowLongPtr +// Templated version of SetWindowLongPtr, to suppress spurious compiler warning. +template +LONG_PTR _SetWindowLongPtr(HWND hwnd, int nIndex, T p) +{ + return SetWindowLongPtr(hwnd, nIndex, (LONG_PTR)p); +} +#pragma warning(pop) + +/////////////////////////////////////////////////////////////////////////// +// End Platform SDK definitions +/////////////////////////////////////////////////////////////////////////// + + +#include // Generated IDL header file for streams interfaces +#include // required by amvideo.h + +#include // Helper class for REFERENCE_TIME management +#include // Debug support for logging and ASSERTs +#include // ActiveMovie video interfaces and definitions +//include amaudio.h explicitly if you need it. it requires the DX SDK. +//#include // ActiveMovie audio interfaces and definitions +#include // General helper classes for threads etc +#include // Base COM classes to support IUnknown +#include // Filter registration support functions +#include // Performance measurement +#include // Light weight com function prototypes + +#include // Simple cache container class +#include // Non MFC generic list class +#include // CMsgThread +#include // Helper class for managing media types +#include // conversions between FOURCCs and GUIDs +#include // generated from control.odl +#include // control interface utility classes +#include // event code definitions +#include // Main streams architecture class hierachy +#include // Generic transform filter +#include // Generic transform-in-place filter +#include // declaration of type GUIDs and well-known clsids +#include // Generic source filter +#include // Output pin queueing +#include // HRESULT status and error definitions +#include // Base class for writing ActiveX renderers +#include // Helps with filters that manage windows +#include // Implements the IVideoWindow interface +#include // Specifically video related classes +#include // Base clock class +#include // System clock +#include // IPersistStream helper class +#include // Video Transform Filter base class +#include +#include // Base property page class +#include // IAMStreamControl support +#include // External device control interface defines +#include // audio filter device error event codes + + + +#else + #ifdef DEBUG + #pragma message("STREAMS.H included TWICE") + #endif +#endif // __STREAMS__ + diff --git a/third_party/BaseClasses/strmctl.cpp b/third_party/BaseClasses/strmctl.cpp new file mode 100644 index 00000000..b7f59521 --- /dev/null +++ b/third_party/BaseClasses/strmctl.cpp @@ -0,0 +1,402 @@ +//------------------------------------------------------------------------------ +// File: StrmCtl.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1996-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include + +CBaseStreamControl::CBaseStreamControl(__inout HRESULT *phr) +: m_StreamState(STREAM_FLOWING) +, m_StreamStateOnStop(STREAM_FLOWING) // means no pending stop +, m_tStartTime(MAX_TIME) +, m_tStopTime(MAX_TIME) +, m_StreamEvent(FALSE, phr) +, m_dwStartCookie(0) +, m_dwStopCookie(0) +, m_pRefClock(NULL) +, m_FilterState(State_Stopped) +, m_bIsFlushing(FALSE) +, m_bStopSendExtra(FALSE) +{} + +CBaseStreamControl::~CBaseStreamControl() +{ + // Make sure we release the clock. + SetSyncSource(NULL); + return; +} + + +STDMETHODIMP CBaseStreamControl::StopAt(const REFERENCE_TIME * ptStop, BOOL bSendExtra, DWORD dwCookie) +{ + CAutoLock lck(&m_CritSec); + m_bStopSendExtra = FALSE; // reset + m_bStopExtraSent = FALSE; + if (ptStop) + { + if (*ptStop == MAX_TIME) + { + DbgLog((LOG_TRACE,2,TEXT("StopAt: Cancel stop"))); + CancelStop(); + // If there's now a command to start in the future, we assume + // they want to be stopped when the graph is first run + if (m_FilterState == State_Stopped && m_tStartTime < MAX_TIME) { + m_StreamState = STREAM_DISCARDING; + DbgLog((LOG_TRACE,2,TEXT("graph will begin by DISCARDING"))); + } + return NOERROR; + } + DbgLog((LOG_TRACE,2,TEXT("StopAt: %dms extra=%d"), + (int)(*ptStop/10000), bSendExtra)); + // if the first command is to stop in the future, then we assume they + // want to be started when the graph is first run + if (m_FilterState == State_Stopped && m_tStartTime > *ptStop) { + m_StreamState = STREAM_FLOWING; + DbgLog((LOG_TRACE,2,TEXT("graph will begin by FLOWING"))); + } + m_bStopSendExtra = bSendExtra; + m_tStopTime = *ptStop; + m_dwStopCookie = dwCookie; + m_StreamStateOnStop = STREAM_DISCARDING; + } + else + { + DbgLog((LOG_TRACE,2,TEXT("StopAt: now"))); + // sending an extra frame when told to stop now would mess people up + m_bStopSendExtra = FALSE; + m_tStopTime = MAX_TIME; + m_dwStopCookie = 0; + m_StreamState = STREAM_DISCARDING; + m_StreamStateOnStop = STREAM_FLOWING; // no pending stop + } + // we might change our mind what to do with a sample we're blocking + m_StreamEvent.Set(); + return NOERROR; +} + +STDMETHODIMP CBaseStreamControl::StartAt +( const REFERENCE_TIME *ptStart, DWORD dwCookie ) +{ + CAutoLock lck(&m_CritSec); + if (ptStart) + { + if (*ptStart == MAX_TIME) + { + DbgLog((LOG_TRACE,2,TEXT("StartAt: Cancel start"))); + CancelStart(); + // If there's now a command to stop in the future, we assume + // they want to be started when the graph is first run + if (m_FilterState == State_Stopped && m_tStopTime < MAX_TIME) { + DbgLog((LOG_TRACE,2,TEXT("graph will begin by FLOWING"))); + m_StreamState = STREAM_FLOWING; + } + return NOERROR; + } + DbgLog((LOG_TRACE,2,TEXT("StartAt: %dms"), (int)(*ptStart/10000))); + // if the first command is to start in the future, then we assume they + // want to be stopped when the graph is first run + if (m_FilterState == State_Stopped && m_tStopTime >= *ptStart) { + DbgLog((LOG_TRACE,2,TEXT("graph will begin by DISCARDING"))); + m_StreamState = STREAM_DISCARDING; + } + m_tStartTime = *ptStart; + m_dwStartCookie = dwCookie; + // if (m_tStopTime == m_tStartTime) CancelStop(); + } + else + { + DbgLog((LOG_TRACE,2,TEXT("StartAt: now"))); + m_tStartTime = MAX_TIME; + m_dwStartCookie = 0; + m_StreamState = STREAM_FLOWING; + } + // we might change our mind what to do with a sample we're blocking + m_StreamEvent.Set(); + return NOERROR; +} + +// Retrieve information about current settings +STDMETHODIMP CBaseStreamControl::GetInfo(__out AM_STREAM_INFO *pInfo) +{ + if (pInfo == NULL) + return E_POINTER; + + pInfo->tStart = m_tStartTime; + pInfo->tStop = m_tStopTime; + pInfo->dwStartCookie = m_dwStartCookie; + pInfo->dwStopCookie = m_dwStopCookie; + pInfo->dwFlags = m_bStopSendExtra ? AM_STREAM_INFO_STOP_SEND_EXTRA : 0; + pInfo->dwFlags |= m_tStartTime == MAX_TIME ? 0 : AM_STREAM_INFO_START_DEFINED; + pInfo->dwFlags |= m_tStopTime == MAX_TIME ? 0 : AM_STREAM_INFO_STOP_DEFINED; + switch (m_StreamState) { + default: + DbgBreak("Invalid stream state"); + case STREAM_FLOWING: + break; + case STREAM_DISCARDING: + pInfo->dwFlags |= AM_STREAM_INFO_DISCARDING; + break; + } + return S_OK; +} + + +void CBaseStreamControl::ExecuteStop() +{ + ASSERT(CritCheckIn(&m_CritSec)); + m_StreamState = m_StreamStateOnStop; + if (m_dwStopCookie && m_pSink) { + DbgLog((LOG_TRACE,2,TEXT("*sending EC_STREAM_CONTROL_STOPPED (%d)"), + m_dwStopCookie)); + m_pSink->Notify(EC_STREAM_CONTROL_STOPPED, (LONG_PTR)this, m_dwStopCookie); + } + CancelStop(); // This will do the tidy up +} + +void CBaseStreamControl::ExecuteStart() +{ + ASSERT(CritCheckIn(&m_CritSec)); + m_StreamState = STREAM_FLOWING; + if (m_dwStartCookie) { + DbgLog((LOG_TRACE,2,TEXT("*sending EC_STREAM_CONTROL_STARTED (%d)"), + m_dwStartCookie)); + m_pSink->Notify(EC_STREAM_CONTROL_STARTED, (LONG_PTR)this, m_dwStartCookie); + } + CancelStart(); // This will do the tidy up +} + +void CBaseStreamControl::CancelStop() +{ + ASSERT(CritCheckIn(&m_CritSec)); + m_tStopTime = MAX_TIME; + m_dwStopCookie = 0; + m_StreamStateOnStop = STREAM_FLOWING; +} + +void CBaseStreamControl::CancelStart() +{ + ASSERT(CritCheckIn(&m_CritSec)); + m_tStartTime = MAX_TIME; + m_dwStartCookie = 0; +} + + +// This guy will return one of the three StreamControlState's. Here's what the caller +// should do for each one: +// +// STREAM_FLOWING: Proceed as usual (render or pass the sample on) +// STREAM_DISCARDING: Calculate the time 'til *pSampleStart and wait that long +// for the event handle (GetStreamEventHandle()). If the +// wait expires, throw the sample away. If the event +// fires, call me back, I've changed my mind. +// I use pSampleStart (not Stop) so that live sources don't +// block for the duration of their samples, since the clock +// will always read approximately pSampleStart when called + + +// All through this code, you'll notice the following rules: +// - When start and stop time are the same, it's as if start was first +// - An event is considered inside the sample when it's >= sample start time +// but < sample stop time +// - if any part of the sample is supposed to be sent, we'll send the whole +// thing since we don't break it into smaller pieces +// - If we skip over a start or stop without doing it, we still signal the event +// and reset ourselves in case somebody's waiting for the event, and to make +// sure we notice that the event is past and should be forgotten +// Here are the 19 cases that have to be handled (x=start o=stop <-->=sample): +// +// 1. xo<--> start then stop +// 2. ox<--> stop then start +// 3. x start +// 4. o stop then start +// 5. x<-->o start +// 6. o<-->x stop +// 7. o start +// 8. x no change +// 9. start +// 10. stop then start +// 11. <-->xo no change +// 12. <-->ox no change +// 13. x<--> start +// 14. start +// 15. <-->x no change +// 16. o<--> stop +// 17. no change +// 18. <-->o no change +// 19. <--> no change + + +enum CBaseStreamControl::StreamControlState CBaseStreamControl::CheckSampleTimes +( __in const REFERENCE_TIME * pSampleStart, __in const REFERENCE_TIME * pSampleStop ) +{ + CAutoLock lck(&m_CritSec); + + ASSERT(!m_bIsFlushing); + ASSERT(pSampleStart && pSampleStop); + + // Don't ask me how I came up with the code below to handle all 19 cases + // - DannyMi + + if (m_tStopTime >= *pSampleStart) + { + if (m_tStartTime >= *pSampleStop) + return m_StreamState; // cases 8 11 12 15 17 18 19 + if (m_tStopTime < m_tStartTime) + ExecuteStop(); // case 10 + ExecuteStart(); // cases 3 5 7 9 13 14 + return m_StreamState; + } + + if (m_tStartTime >= *pSampleStop) + { + ExecuteStop(); // cases 6 16 + return m_StreamState; + } + + if (m_tStartTime <= m_tStopTime) + { + ExecuteStart(); + ExecuteStop(); + return m_StreamState; // case 1 + } + else + { + ExecuteStop(); + ExecuteStart(); + return m_StreamState; // cases 2 4 + } +} + + +enum CBaseStreamControl::StreamControlState CBaseStreamControl::CheckStreamState( IMediaSample * pSample ) +{ + + REFERENCE_TIME rtBufferStart, rtBufferStop; + const BOOL bNoBufferTimes = + pSample == NULL || + FAILED(pSample->GetTime(&rtBufferStart, &rtBufferStop)); + + StreamControlState state; + LONG lWait; + + do + { + // something has to break out of the blocking + if (m_bIsFlushing || m_FilterState == State_Stopped) + return STREAM_DISCARDING; + + if (bNoBufferTimes) { + // Can't do anything until we get a time stamp + state = m_StreamState; + break; + } else { + state = CheckSampleTimes( &rtBufferStart, &rtBufferStop ); + if (state == STREAM_FLOWING) + break; + + // we aren't supposed to send this, but we've been + // told to send one more than we were supposed to + // (and the stop isn't still pending and we're streaming) + if (m_bStopSendExtra && !m_bStopExtraSent && + m_tStopTime == MAX_TIME && + m_FilterState != State_Stopped) { + m_bStopExtraSent = TRUE; + DbgLog((LOG_TRACE,2,TEXT("%d sending an EXTRA frame"), + m_dwStopCookie)); + state = STREAM_FLOWING; + break; + } + } + + // We're in discarding mode + + // If we've no clock, discard as fast as we can + if (!m_pRefClock) { + break; + + // If we're paused, we can't discard in a timely manner because + // there's no such thing as stream times. We must block until + // we run or stop, or we'll end up throwing the whole stream away + // as quickly as possible + } else if (m_FilterState == State_Paused) { + lWait = INFINITE; + + } else { + // wait until it's time for the sample until we say "discard" + // ("discard in a timely fashion") + REFERENCE_TIME rtNow; + EXECUTE_ASSERT(SUCCEEDED(m_pRefClock->GetTime(&rtNow))); + rtNow -= m_tRunStart; // Into relative ref-time + lWait = LONG((rtBufferStart - rtNow)/10000); // 100ns -> ms + if (lWait < 10) break; // Not worth waiting - discard early + } + + } while(WaitForSingleObject(GetStreamEventHandle(), lWait) != WAIT_TIMEOUT); + + return state; +} + + +void CBaseStreamControl::NotifyFilterState( FILTER_STATE new_state, REFERENCE_TIME tStart ) +{ + CAutoLock lck(&m_CritSec); + + // or we will get confused + if (m_FilterState == new_state) + return; + + switch (new_state) + { + case State_Stopped: + + DbgLog((LOG_TRACE,2,TEXT("Filter is STOPPED"))); + + // execute any pending starts and stops in the right order, + // to make sure all notifications get sent, and we end up + // in the right state to begin next time (??? why not?) + + if (m_tStartTime != MAX_TIME && m_tStopTime == MAX_TIME) { + ExecuteStart(); + } else if (m_tStopTime != MAX_TIME && m_tStartTime == MAX_TIME) { + ExecuteStop(); + } else if (m_tStopTime != MAX_TIME && m_tStartTime != MAX_TIME) { + if (m_tStartTime <= m_tStopTime) { + ExecuteStart(); + ExecuteStop(); + } else { + ExecuteStop(); + ExecuteStart(); + } + } + // always start off flowing when the graph starts streaming + // unless told otherwise + m_StreamState = STREAM_FLOWING; + m_FilterState = new_state; + break; + + case State_Running: + + DbgLog((LOG_TRACE,2,TEXT("Filter is RUNNING"))); + + m_tRunStart = tStart; + // fall-through + + default: // case State_Paused: + m_FilterState = new_state; + } + // unblock! + m_StreamEvent.Set(); +} + + +void CBaseStreamControl::Flushing(BOOL bInProgress) +{ + CAutoLock lck(&m_CritSec); + m_bIsFlushing = bInProgress; + m_StreamEvent.Set(); +} diff --git a/third_party/BaseClasses/strmctl.h b/third_party/BaseClasses/strmctl.h new file mode 100644 index 00000000..cb2adf30 --- /dev/null +++ b/third_party/BaseClasses/strmctl.h @@ -0,0 +1,157 @@ +//------------------------------------------------------------------------------ +// File: StrmCtl.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1996-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __strmctl_h__ +#define __strmctl_h__ + +class CBaseStreamControl : public IAMStreamControl +{ +public: + // Used by the implementation + enum StreamControlState + { STREAM_FLOWING = 0x1000, + STREAM_DISCARDING + }; + +private: + enum StreamControlState m_StreamState; // Current stream state + enum StreamControlState m_StreamStateOnStop; // State after next stop + // (i.e.Blocking or Discarding) + + REFERENCE_TIME m_tStartTime; // MAX_TIME implies none + REFERENCE_TIME m_tStopTime; // MAX_TIME implies none + DWORD m_dwStartCookie; // Cookie for notification to app + DWORD m_dwStopCookie; // Cookie for notification to app + volatile BOOL m_bIsFlushing; // No optimization pls! + volatile BOOL m_bStopSendExtra; // bSendExtra was set + volatile BOOL m_bStopExtraSent; // the extra one was sent + + CCritSec m_CritSec; // CritSec to guard above attributes + + // Event to fire when we can come + // out of blocking, or to come out of waiting + // to discard if we change our minds. + // + CAMEvent m_StreamEvent; + + // All of these methods execute immediately. Helpers for others. + // + void ExecuteStop(); + void ExecuteStart(); + void CancelStop(); + void CancelStart(); + + // Some things we need to be told by our owning filter + // Your pin must also expose IAMStreamControl when QI'd for it! + // + IReferenceClock * m_pRefClock; // Need it to set advises + // Filter must tell us via + // SetSyncSource + IMediaEventSink * m_pSink; // Event sink + // Filter must tell us after it + // creates it in JoinFilterGraph() + FILTER_STATE m_FilterState; // Just need it! + // Filter must tell us via + // NotifyFilterState + REFERENCE_TIME m_tRunStart; // Per the Run call to the filter + + // This guy will return one of the three StreamControlState's. Here's what + // the caller should do for each one: + // + // STREAM_FLOWING: Proceed as usual (render or pass the sample on) + // STREAM_DISCARDING: Calculate the time 'til *pSampleStop and wait + // that long for the event handle + // (GetStreamEventHandle()). If the wait + // expires, throw the sample away. If the event + // fires, call me back - I've changed my mind. + // + enum StreamControlState CheckSampleTimes( __in const REFERENCE_TIME * pSampleStart, + __in const REFERENCE_TIME * pSampleStop ); + +public: + // You don't have to tell us much when we're created, but there are other + // obligations that must be met. See SetSyncSource & NotifyFilterState + // below. + // + CBaseStreamControl(__inout_opt HRESULT *phr = NULL); + ~CBaseStreamControl(); + + // If you want this class to work properly, there are thing you need to + // (keep) telling it. Filters with pins that use this class + // should ensure that they pass through to this method any calls they + // receive on their SetSyncSource. + + // We need a clock to see what time it is. This is for the + // "discard in a timely fashion" logic. If we discard everything as + // quick as possible, a whole 60 minute file could get discarded in the + // first 10 seconds, and if somebody wants to turn streaming on at 30 + // minutes into the file, and they make the call more than a few seconds + // after the graph is run, it may be too late! + // So we hold every sample until it's time has gone, then we discard it. + // The filter should call this when it gets a SetSyncSource + // + void SetSyncSource( IReferenceClock * pRefClock ) + { + CAutoLock lck(&m_CritSec); + if (m_pRefClock) m_pRefClock->Release(); + m_pRefClock = pRefClock; + if (m_pRefClock) m_pRefClock->AddRef(); + } + + // Set event sink for notifications + // The filter should call this in its JoinFilterGraph after it creates the + // IMediaEventSink + // + void SetFilterGraph( IMediaEventSink *pSink ) { + m_pSink = pSink; + } + + // Since we schedule in stream time, we need the tStart and must track the + // state of our owning filter. + // The app should call this ever state change + // + void NotifyFilterState( FILTER_STATE new_state, REFERENCE_TIME tStart = 0 ); + + // Filter should call Flushing(TRUE) in BeginFlush, + // and Flushing(FALSE) in EndFlush. + // + void Flushing( BOOL bInProgress ); + + + // The two main methods of IAMStreamControl + + // Class adds default values suitable for immediate + // muting and unmuting of the stream. + + STDMETHODIMP StopAt( const REFERENCE_TIME * ptStop = NULL, + BOOL bSendExtra = FALSE, + DWORD dwCookie = 0 ); + STDMETHODIMP StartAt( const REFERENCE_TIME * ptStart = NULL, + DWORD dwCookie = 0 ); + STDMETHODIMP GetInfo( __out AM_STREAM_INFO *pInfo); + + // Helper function for pin's receive method. Call this with + // the sample and we'll tell you what to do with it. We'll do a + // WaitForSingleObject within this call if one is required. This is + // a "What should I do with this sample?" kind of call. We'll tell the + // caller to either flow it or discard it. + // If pSample is NULL we evaluate based on the current state + // settings + enum StreamControlState CheckStreamState( IMediaSample * pSample ); + +private: + // These don't require locking, but we are relying on the fact that + // m_StreamState can be retrieved with integrity, and is a snap shot that + // may have just been, or may be just about to be, changed. + HANDLE GetStreamEventHandle() const { return m_StreamEvent; } + enum StreamControlState GetStreamState() const { return m_StreamState; } + BOOL IsStreaming() const { return m_StreamState == STREAM_FLOWING; } +}; + +#endif diff --git a/third_party/BaseClasses/sysclock.cpp b/third_party/BaseClasses/sysclock.cpp new file mode 100644 index 00000000..0d582917 --- /dev/null +++ b/third_party/BaseClasses/sysclock.cpp @@ -0,0 +1,74 @@ +//------------------------------------------------------------------------------ +// File: SysClock.cpp +// +// Desc: DirectShow base classes - implements a system clock based on +// IReferenceClock. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include + + +#ifdef FILTER_DLL + +/* List of class IDs and creator functions for the class factory. This + provides the link between the OLE entry point in the DLL and an object + being created. The class factory will call the static CreateInstance + function when it is asked to create a CLSID_SystemClock object */ + +CFactoryTemplate g_Templates[1] = { + {&CLSID_SystemClock, CSystemClock::CreateInstance} +}; + +int g_cTemplates = sizeof(g_Templates) / sizeof(g_Templates[0]); +#endif + +/* This goes in the factory template table to create new instances */ +CUnknown * WINAPI CSystemClock::CreateInstance(__inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr) +{ + return new CSystemClock(NAME("System reference clock"),pUnk, phr); +} + + +CSystemClock::CSystemClock(__in_opt LPCTSTR pName, __inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr) : + CBaseReferenceClock(pName, pUnk, phr) +{ +} + +STDMETHODIMP CSystemClock::NonDelegatingQueryInterface( + REFIID riid, + __deref_out void ** ppv) +{ + if (riid == IID_IPersist) + { + return GetInterface(static_cast(this), ppv); + } + else if (riid == IID_IAMClockAdjust) + { + return GetInterface(static_cast(this), ppv); + } + else + { + return CBaseReferenceClock::NonDelegatingQueryInterface(riid, ppv); + } +} + +/* Return the clock's clsid */ +STDMETHODIMP +CSystemClock::GetClassID(__out CLSID *pClsID) +{ + CheckPointer(pClsID,E_POINTER); + ValidateReadWritePtr(pClsID,sizeof(CLSID)); + *pClsID = CLSID_SystemClock; + return NOERROR; +} + + +STDMETHODIMP +CSystemClock::SetClockDelta(REFERENCE_TIME rtDelta) +{ + return SetTimeDelta(rtDelta); +} diff --git a/third_party/BaseClasses/sysclock.h b/third_party/BaseClasses/sysclock.h new file mode 100644 index 00000000..3976d346 --- /dev/null +++ b/third_party/BaseClasses/sysclock.h @@ -0,0 +1,39 @@ +//------------------------------------------------------------------------------ +// File: SysClock.h +// +// Desc: DirectShow base classes - defines a system clock implementation of +// IReferenceClock. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __SYSTEMCLOCK__ +#define __SYSTEMCLOCK__ + +// +// Base clock. Uses timeGetTime ONLY +// Uses most of the code in the base reference clock. +// Provides GetTime +// + +class CSystemClock : public CBaseReferenceClock, public IAMClockAdjust, public IPersist +{ +public: + // We must be able to create an instance of ourselves + static CUnknown * WINAPI CreateInstance(__inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr); + CSystemClock(__in_opt LPCTSTR pName, __inout_opt LPUNKNOWN pUnk, __inout HRESULT *phr); + + DECLARE_IUNKNOWN + + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void ** ppv); + + // Yield up our class id so that we can be persisted + // Implement required Ipersist method + STDMETHODIMP GetClassID(__out CLSID *pClsID); + + // IAMClockAdjust methods + STDMETHODIMP SetClockDelta(REFERENCE_TIME rtDelta); +}; //CSystemClock + +#endif /* __SYSTEMCLOCK__ */ diff --git a/third_party/BaseClasses/transfrm.cpp b/third_party/BaseClasses/transfrm.cpp new file mode 100644 index 00000000..3d170779 --- /dev/null +++ b/third_party/BaseClasses/transfrm.cpp @@ -0,0 +1,1016 @@ +//------------------------------------------------------------------------------ +// File: Transfrm.cpp +// +// Desc: DirectShow base classes - implements class for simple transform +// filters such as video decompressors. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include + + +// ================================================================= +// Implements the CTransformFilter class +// ================================================================= + +CTransformFilter::CTransformFilter(__in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + REFCLSID clsid) : + CBaseFilter(pName,pUnk,&m_csFilter, clsid), + m_pInput(NULL), + m_pOutput(NULL), + m_bEOSDelivered(FALSE), + m_bQualityChanged(FALSE), + m_bSampleSkipped(FALSE) +{ +#ifdef PERF + RegisterPerfId(); +#endif // PERF +} + +#ifdef UNICODE +CTransformFilter::CTransformFilter(__in_opt LPCSTR pName, + __inout_opt LPUNKNOWN pUnk, + REFCLSID clsid) : + CBaseFilter(pName,pUnk,&m_csFilter, clsid), + m_pInput(NULL), + m_pOutput(NULL), + m_bEOSDelivered(FALSE), + m_bQualityChanged(FALSE), + m_bSampleSkipped(FALSE) +{ +#ifdef PERF + RegisterPerfId(); +#endif // PERF +} +#endif + +// destructor + +CTransformFilter::~CTransformFilter() +{ + // Delete the pins + + delete m_pInput; + delete m_pOutput; +} + + +// Transform place holder - should never be called +HRESULT CTransformFilter::Transform(IMediaSample * pIn, IMediaSample *pOut) +{ + UNREFERENCED_PARAMETER(pIn); + UNREFERENCED_PARAMETER(pOut); + DbgBreak("CTransformFilter::Transform() should never be called"); + return E_UNEXPECTED; +} + + +// return the number of pins we provide + +int CTransformFilter::GetPinCount() +{ + return 2; +} + + +// return a non-addrefed CBasePin * for the user to addref if he holds onto it +// for longer than his pointer to us. We create the pins dynamically when they +// are asked for rather than in the constructor. This is because we want to +// give the derived class an oppportunity to return different pin objects + +// We return the objects as and when they are needed. If either of these fails +// then we return NULL, the assumption being that the caller will realise the +// whole deal is off and destroy us - which in turn will delete everything. + +CBasePin * +CTransformFilter::GetPin(int n) +{ + HRESULT hr = S_OK; + + // Create an input pin if necessary + + if (m_pInput == NULL) { + + m_pInput = new CTransformInputPin(NAME("Transform input pin"), + this, // Owner filter + &hr, // Result code + L"XForm In"); // Pin name + + + // Can't fail + ASSERT(SUCCEEDED(hr)); + if (m_pInput == NULL) { + return NULL; + } + m_pOutput = (CTransformOutputPin *) + new CTransformOutputPin(NAME("Transform output pin"), + this, // Owner filter + &hr, // Result code + L"XForm Out"); // Pin name + + + // Can't fail + ASSERT(SUCCEEDED(hr)); + if (m_pOutput == NULL) { + delete m_pInput; + m_pInput = NULL; + } + } + + // Return the appropriate pin + + if (n == 0) { + return m_pInput; + } else + if (n == 1) { + return m_pOutput; + } else { + return NULL; + } +} + + +// +// FindPin +// +// If Id is In or Out then return the IPin* for that pin +// creating the pin if need be. Otherwise return NULL with an error. + +STDMETHODIMP CTransformFilter::FindPin(LPCWSTR Id, __deref_out IPin **ppPin) +{ + CheckPointer(ppPin,E_POINTER); + ValidateReadWritePtr(ppPin,sizeof(IPin *)); + + if (0==lstrcmpW(Id,L"In")) { + *ppPin = GetPin(0); + } else if (0==lstrcmpW(Id,L"Out")) { + *ppPin = GetPin(1); + } else { + *ppPin = NULL; + return VFW_E_NOT_FOUND; + } + + HRESULT hr = NOERROR; + // AddRef() returned pointer - but GetPin could fail if memory is low. + if (*ppPin) { + (*ppPin)->AddRef(); + } else { + hr = E_OUTOFMEMORY; // probably. There's no pin anyway. + } + return hr; +} + + +// override these two functions if you want to inform something +// about entry to or exit from streaming state. + +HRESULT +CTransformFilter::StartStreaming() +{ + return NOERROR; +} + + +HRESULT +CTransformFilter::StopStreaming() +{ + return NOERROR; +} + + +// override this to grab extra interfaces on connection + +HRESULT +CTransformFilter::CheckConnect(PIN_DIRECTION dir, IPin *pPin) +{ + UNREFERENCED_PARAMETER(dir); + UNREFERENCED_PARAMETER(pPin); + return NOERROR; +} + + +// place holder to allow derived classes to release any extra interfaces + +HRESULT +CTransformFilter::BreakConnect(PIN_DIRECTION dir) +{ + UNREFERENCED_PARAMETER(dir); + return NOERROR; +} + + +// Let derived classes know about connection completion + +HRESULT +CTransformFilter::CompleteConnect(PIN_DIRECTION direction,IPin *pReceivePin) +{ + UNREFERENCED_PARAMETER(direction); + UNREFERENCED_PARAMETER(pReceivePin); + return NOERROR; +} + + +// override this to know when the media type is really set + +HRESULT +CTransformFilter::SetMediaType(PIN_DIRECTION direction,const CMediaType *pmt) +{ + UNREFERENCED_PARAMETER(direction); + UNREFERENCED_PARAMETER(pmt); + return NOERROR; +} + + +// Set up our output sample +HRESULT +CTransformFilter::InitializeOutputSample(IMediaSample *pSample, __deref_out IMediaSample **ppOutSample) +{ + IMediaSample *pOutSample; + + // default - times are the same + + AM_SAMPLE2_PROPERTIES * const pProps = m_pInput->SampleProps(); + DWORD dwFlags = m_bSampleSkipped ? AM_GBF_PREVFRAMESKIPPED : 0; + + // This will prevent the image renderer from switching us to DirectDraw + // when we can't do it without skipping frames because we're not on a + // keyframe. If it really has to switch us, it still will, but then we + // will have to wait for the next keyframe + if (!(pProps->dwSampleFlags & AM_SAMPLE_SPLICEPOINT)) { + dwFlags |= AM_GBF_NOTASYNCPOINT; + } + + ASSERT(m_pOutput->m_pAllocator != NULL); + HRESULT hr = m_pOutput->m_pAllocator->GetBuffer( + &pOutSample + , pProps->dwSampleFlags & AM_SAMPLE_TIMEVALID ? + &pProps->tStart : NULL + , pProps->dwSampleFlags & AM_SAMPLE_STOPVALID ? + &pProps->tStop : NULL + , dwFlags + ); + *ppOutSample = pOutSample; + if (FAILED(hr)) { + return hr; + } + + ASSERT(pOutSample); + IMediaSample2 *pOutSample2; + if (SUCCEEDED(pOutSample->QueryInterface(IID_IMediaSample2, + (void **)&pOutSample2))) { + /* Modify it */ + AM_SAMPLE2_PROPERTIES OutProps; + EXECUTE_ASSERT(SUCCEEDED(pOutSample2->GetProperties( + FIELD_OFFSET(AM_SAMPLE2_PROPERTIES, tStart), (PBYTE)&OutProps) + )); + OutProps.dwTypeSpecificFlags = pProps->dwTypeSpecificFlags; + OutProps.dwSampleFlags = + (OutProps.dwSampleFlags & AM_SAMPLE_TYPECHANGED) | + (pProps->dwSampleFlags & ~AM_SAMPLE_TYPECHANGED); + OutProps.tStart = pProps->tStart; + OutProps.tStop = pProps->tStop; + OutProps.cbData = FIELD_OFFSET(AM_SAMPLE2_PROPERTIES, dwStreamId); + hr = pOutSample2->SetProperties( + FIELD_OFFSET(AM_SAMPLE2_PROPERTIES, dwStreamId), + (PBYTE)&OutProps + ); + if (pProps->dwSampleFlags & AM_SAMPLE_DATADISCONTINUITY) { + m_bSampleSkipped = FALSE; + } + pOutSample2->Release(); + } else { + if (pProps->dwSampleFlags & AM_SAMPLE_TIMEVALID) { + pOutSample->SetTime(&pProps->tStart, + &pProps->tStop); + } + if (pProps->dwSampleFlags & AM_SAMPLE_SPLICEPOINT) { + pOutSample->SetSyncPoint(TRUE); + } + if (pProps->dwSampleFlags & AM_SAMPLE_DATADISCONTINUITY) { + pOutSample->SetDiscontinuity(TRUE); + m_bSampleSkipped = FALSE; + } + // Copy the media times + + LONGLONG MediaStart, MediaEnd; + if (pSample->GetMediaTime(&MediaStart,&MediaEnd) == NOERROR) { + pOutSample->SetMediaTime(&MediaStart,&MediaEnd); + } + } + return S_OK; +} + +// override this to customize the transform process + +HRESULT +CTransformFilter::Receive(IMediaSample *pSample) +{ + /* Check for other streams and pass them on */ + AM_SAMPLE2_PROPERTIES * const pProps = m_pInput->SampleProps(); + if (pProps->dwStreamId != AM_STREAM_MEDIA) { + return m_pOutput->m_pInputPin->Receive(pSample); + } + HRESULT hr; + ASSERT(pSample); + IMediaSample * pOutSample; + + // If no output to deliver to then no point sending us data + + ASSERT (m_pOutput != NULL) ; + + // Set up the output sample + hr = InitializeOutputSample(pSample, &pOutSample); + + if (FAILED(hr)) { + return hr; + } + + // Start timing the transform (if PERF is defined) + MSR_START(m_idTransform); + + // have the derived class transform the data + + hr = Transform(pSample, pOutSample); + + // Stop the clock and log it (if PERF is defined) + MSR_STOP(m_idTransform); + + if (FAILED(hr)) { + DbgLog((LOG_TRACE,1,TEXT("Error from transform"))); + } else { + // the Transform() function can return S_FALSE to indicate that the + // sample should not be delivered; we only deliver the sample if it's + // really S_OK (same as NOERROR, of course.) + if (hr == NOERROR) { + hr = m_pOutput->m_pInputPin->Receive(pOutSample); + m_bSampleSkipped = FALSE; // last thing no longer dropped + } else { + // S_FALSE returned from Transform is a PRIVATE agreement + // We should return NOERROR from Receive() in this cause because returning S_FALSE + // from Receive() means that this is the end of the stream and no more data should + // be sent. + if (S_FALSE == hr) { + + // Release the sample before calling notify to avoid + // deadlocks if the sample holds a lock on the system + // such as DirectDraw buffers do + pOutSample->Release(); + m_bSampleSkipped = TRUE; + if (!m_bQualityChanged) { + NotifyEvent(EC_QUALITY_CHANGE,0,0); + m_bQualityChanged = TRUE; + } + return NOERROR; + } + } + } + + // release the output buffer. If the connected pin still needs it, + // it will have addrefed it itself. + pOutSample->Release(); + + return hr; +} + + +// Return S_FALSE to mean "pass the note on upstream" +// Return NOERROR (Same as S_OK) +// to mean "I've done something about it, don't pass it on" +HRESULT CTransformFilter::AlterQuality(Quality q) +{ + UNREFERENCED_PARAMETER(q); + return S_FALSE; +} + + +// EndOfStream received. Default behaviour is to deliver straight +// downstream, since we have no queued data. If you overrode Receive +// and have queue data, then you need to handle this and deliver EOS after +// all queued data is sent +HRESULT +CTransformFilter::EndOfStream(void) +{ + HRESULT hr = NOERROR; + if (m_pOutput != NULL) { + hr = m_pOutput->DeliverEndOfStream(); + } + + return hr; +} + + +// enter flush state. Receives already blocked +// must override this if you have queued data or a worker thread +HRESULT +CTransformFilter::BeginFlush(void) +{ + HRESULT hr = NOERROR; + if (m_pOutput != NULL) { + // block receives -- done by caller (CBaseInputPin::BeginFlush) + + // discard queued data -- we have no queued data + + // free anyone blocked on receive - not possible in this filter + + // call downstream + hr = m_pOutput->DeliverBeginFlush(); + } + return hr; +} + + +// leave flush state. must override this if you have queued data +// or a worker thread +HRESULT +CTransformFilter::EndFlush(void) +{ + // sync with pushing thread -- we have no worker thread + + // ensure no more data to go downstream -- we have no queued data + + // call EndFlush on downstream pins + ASSERT (m_pOutput != NULL); + return m_pOutput->DeliverEndFlush(); + + // caller (the input pin's method) will unblock Receives +} + + +// override these so that the derived filter can catch them + +STDMETHODIMP +CTransformFilter::Stop() +{ + CAutoLock lck1(&m_csFilter); + if (m_State == State_Stopped) { + return NOERROR; + } + + // Succeed the Stop if we are not completely connected + + ASSERT(m_pInput == NULL || m_pOutput != NULL); + if (m_pInput == NULL || m_pInput->IsConnected() == FALSE || + m_pOutput->IsConnected() == FALSE) { + m_State = State_Stopped; + m_bEOSDelivered = FALSE; + return NOERROR; + } + + ASSERT(m_pInput); + ASSERT(m_pOutput); + + // decommit the input pin before locking or we can deadlock + m_pInput->Inactive(); + + // synchronize with Receive calls + + CAutoLock lck2(&m_csReceive); + m_pOutput->Inactive(); + + // allow a class derived from CTransformFilter + // to know about starting and stopping streaming + + HRESULT hr = StopStreaming(); + if (SUCCEEDED(hr)) { + // complete the state transition + m_State = State_Stopped; + m_bEOSDelivered = FALSE; + } + return hr; +} + + +STDMETHODIMP +CTransformFilter::Pause() +{ + CAutoLock lck(&m_csFilter); + HRESULT hr = NOERROR; + + if (m_State == State_Paused) { + // (This space left deliberately blank) + } + + // If we have no input pin or it isn't yet connected then when we are + // asked to pause we deliver an end of stream to the downstream filter. + // This makes sure that it doesn't sit there forever waiting for + // samples which we cannot ever deliver without an input connection. + + else if (m_pInput == NULL || m_pInput->IsConnected() == FALSE) { + if (m_pOutput && m_bEOSDelivered == FALSE) { + m_pOutput->DeliverEndOfStream(); + m_bEOSDelivered = TRUE; + } + m_State = State_Paused; + } + + // We may have an input connection but no output connection + // However, if we have an input pin we do have an output pin + + else if (m_pOutput->IsConnected() == FALSE) { + m_State = State_Paused; + } + + else { + if (m_State == State_Stopped) { + // allow a class derived from CTransformFilter + // to know about starting and stopping streaming + CAutoLock lck2(&m_csReceive); + hr = StartStreaming(); + } + if (SUCCEEDED(hr)) { + hr = CBaseFilter::Pause(); + } + } + + m_bSampleSkipped = FALSE; + m_bQualityChanged = FALSE; + return hr; +} + +HRESULT +CTransformFilter::NewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate) +{ + if (m_pOutput != NULL) { + return m_pOutput->DeliverNewSegment(tStart, tStop, dRate); + } + return S_OK; +} + +// Check streaming status +HRESULT +CTransformInputPin::CheckStreaming() +{ + ASSERT(m_pTransformFilter->m_pOutput != NULL); + if (!m_pTransformFilter->m_pOutput->IsConnected()) { + return VFW_E_NOT_CONNECTED; + } else { + // Shouldn't be able to get any data if we're not connected! + ASSERT(IsConnected()); + + // we're flushing + if (m_bFlushing) { + return S_FALSE; + } + // Don't process stuff in Stopped state + if (IsStopped()) { + return VFW_E_WRONG_STATE; + } + if (m_bRunTimeError) { + return VFW_E_RUNTIME_ERROR; + } + return S_OK; + } +} + + +// ================================================================= +// Implements the CTransformInputPin class +// ================================================================= + + +// constructor + +CTransformInputPin::CTransformInputPin( + __in_opt LPCTSTR pObjectName, + __inout CTransformFilter *pTransformFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pName) + : CBaseInputPin(pObjectName, pTransformFilter, &pTransformFilter->m_csFilter, phr, pName) +{ + DbgLog((LOG_TRACE,2,TEXT("CTransformInputPin::CTransformInputPin"))); + m_pTransformFilter = pTransformFilter; +} + +#ifdef UNICODE +CTransformInputPin::CTransformInputPin( + __in_opt LPCSTR pObjectName, + __inout CTransformFilter *pTransformFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pName) + : CBaseInputPin(pObjectName, pTransformFilter, &pTransformFilter->m_csFilter, phr, pName) +{ + DbgLog((LOG_TRACE,2,TEXT("CTransformInputPin::CTransformInputPin"))); + m_pTransformFilter = pTransformFilter; +} +#endif + +// provides derived filter a chance to grab extra interfaces + +HRESULT +CTransformInputPin::CheckConnect(IPin *pPin) +{ + HRESULT hr = m_pTransformFilter->CheckConnect(PINDIR_INPUT,pPin); + if (FAILED(hr)) { + return hr; + } + return CBaseInputPin::CheckConnect(pPin); +} + + +// provides derived filter a chance to release it's extra interfaces + +HRESULT +CTransformInputPin::BreakConnect() +{ + // Can't disconnect unless stopped + ASSERT(IsStopped()); + m_pTransformFilter->BreakConnect(PINDIR_INPUT); + return CBaseInputPin::BreakConnect(); +} + + +// Let derived class know when the input pin is connected + +HRESULT +CTransformInputPin::CompleteConnect(IPin *pReceivePin) +{ + HRESULT hr = m_pTransformFilter->CompleteConnect(PINDIR_INPUT,pReceivePin); + if (FAILED(hr)) { + return hr; + } + return CBaseInputPin::CompleteConnect(pReceivePin); +} + + +// check that we can support a given media type + +HRESULT +CTransformInputPin::CheckMediaType(const CMediaType* pmt) +{ + // Check the input type + + HRESULT hr = m_pTransformFilter->CheckInputType(pmt); + if (S_OK != hr) { + return hr; + } + + // if the output pin is still connected, then we have + // to check the transform not just the input format + + if ((m_pTransformFilter->m_pOutput != NULL) && + (m_pTransformFilter->m_pOutput->IsConnected())) { + return m_pTransformFilter->CheckTransform( + pmt, + &m_pTransformFilter->m_pOutput->CurrentMediaType()); + } else { + return hr; + } +} + + +// set the media type for this connection + +HRESULT +CTransformInputPin::SetMediaType(const CMediaType* mtIn) +{ + // Set the base class media type (should always succeed) + HRESULT hr = CBasePin::SetMediaType(mtIn); + if (FAILED(hr)) { + return hr; + } + + // check the transform can be done (should always succeed) + ASSERT(SUCCEEDED(m_pTransformFilter->CheckInputType(mtIn))); + + return m_pTransformFilter->SetMediaType(PINDIR_INPUT,mtIn); +} + + +// ================================================================= +// Implements IMemInputPin interface +// ================================================================= + + +// provide EndOfStream that passes straight downstream +// (there is no queued data) +STDMETHODIMP +CTransformInputPin::EndOfStream(void) +{ + CAutoLock lck(&m_pTransformFilter->m_csReceive); + HRESULT hr = CheckStreaming(); + if (S_OK == hr) { + hr = m_pTransformFilter->EndOfStream(); + } + return hr; +} + + +// enter flushing state. Call default handler to block Receives, then +// pass to overridable method in filter +STDMETHODIMP +CTransformInputPin::BeginFlush(void) +{ + CAutoLock lck(&m_pTransformFilter->m_csFilter); + // Are we actually doing anything? + ASSERT(m_pTransformFilter->m_pOutput != NULL); + if (!IsConnected() || + !m_pTransformFilter->m_pOutput->IsConnected()) { + return VFW_E_NOT_CONNECTED; + } + HRESULT hr = CBaseInputPin::BeginFlush(); + if (FAILED(hr)) { + return hr; + } + + return m_pTransformFilter->BeginFlush(); +} + + +// leave flushing state. +// Pass to overridable method in filter, then call base class +// to unblock receives (finally) +STDMETHODIMP +CTransformInputPin::EndFlush(void) +{ + CAutoLock lck(&m_pTransformFilter->m_csFilter); + // Are we actually doing anything? + ASSERT(m_pTransformFilter->m_pOutput != NULL); + if (!IsConnected() || + !m_pTransformFilter->m_pOutput->IsConnected()) { + return VFW_E_NOT_CONNECTED; + } + + HRESULT hr = m_pTransformFilter->EndFlush(); + if (FAILED(hr)) { + return hr; + } + + return CBaseInputPin::EndFlush(); +} + + +// here's the next block of data from the stream. +// AddRef it yourself if you need to hold it beyond the end +// of this call. + +HRESULT +CTransformInputPin::Receive(IMediaSample * pSample) +{ + HRESULT hr; + CAutoLock lck(&m_pTransformFilter->m_csReceive); + ASSERT(pSample); + + // check all is well with the base class + hr = CBaseInputPin::Receive(pSample); + if (S_OK == hr) { + hr = m_pTransformFilter->Receive(pSample); + } + return hr; +} + + + + +// override to pass downstream +STDMETHODIMP +CTransformInputPin::NewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate) +{ + // Save the values in the pin + CBasePin::NewSegment(tStart, tStop, dRate); + return m_pTransformFilter->NewSegment(tStart, tStop, dRate); +} + + + + +// ================================================================= +// Implements the CTransformOutputPin class +// ================================================================= + + +// constructor + +CTransformOutputPin::CTransformOutputPin( + __in_opt LPCTSTR pObjectName, + __inout CTransformFilter *pTransformFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pPinName) + : CBaseOutputPin(pObjectName, pTransformFilter, &pTransformFilter->m_csFilter, phr, pPinName), + m_pPosition(NULL) +{ + DbgLog((LOG_TRACE,2,TEXT("CTransformOutputPin::CTransformOutputPin"))); + m_pTransformFilter = pTransformFilter; + +} + +#ifdef UNICODE +CTransformOutputPin::CTransformOutputPin( + __in_opt LPCSTR pObjectName, + __inout CTransformFilter *pTransformFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pPinName) + : CBaseOutputPin(pObjectName, pTransformFilter, &pTransformFilter->m_csFilter, phr, pPinName), + m_pPosition(NULL) +{ + DbgLog((LOG_TRACE,2,TEXT("CTransformOutputPin::CTransformOutputPin"))); + m_pTransformFilter = pTransformFilter; + +} +#endif + +// destructor + +CTransformOutputPin::~CTransformOutputPin() +{ + DbgLog((LOG_TRACE,2,TEXT("CTransformOutputPin::~CTransformOutputPin"))); + + if (m_pPosition) m_pPosition->Release(); +} + + +// overriden to expose IMediaPosition and IMediaSeeking control interfaces + +STDMETHODIMP +CTransformOutputPin::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + CheckPointer(ppv,E_POINTER); + ValidateReadWritePtr(ppv,sizeof(PVOID)); + *ppv = NULL; + + if (riid == IID_IMediaPosition || riid == IID_IMediaSeeking) { + + // we should have an input pin by now + + ASSERT(m_pTransformFilter->m_pInput != NULL); + + if (m_pPosition == NULL) { + + HRESULT hr = CreatePosPassThru( + GetOwner(), + FALSE, + (IPin *)m_pTransformFilter->m_pInput, + &m_pPosition); + if (FAILED(hr)) { + return hr; + } + } + return m_pPosition->QueryInterface(riid, ppv); + } else { + return CBaseOutputPin::NonDelegatingQueryInterface(riid, ppv); + } +} + + +// provides derived filter a chance to grab extra interfaces + +HRESULT +CTransformOutputPin::CheckConnect(IPin *pPin) +{ + // we should have an input connection first + + ASSERT(m_pTransformFilter->m_pInput != NULL); + if ((m_pTransformFilter->m_pInput->IsConnected() == FALSE)) { + return E_UNEXPECTED; + } + + HRESULT hr = m_pTransformFilter->CheckConnect(PINDIR_OUTPUT,pPin); + if (FAILED(hr)) { + return hr; + } + return CBaseOutputPin::CheckConnect(pPin); +} + + +// provides derived filter a chance to release it's extra interfaces + +HRESULT +CTransformOutputPin::BreakConnect() +{ + // Can't disconnect unless stopped + ASSERT(IsStopped()); + m_pTransformFilter->BreakConnect(PINDIR_OUTPUT); + return CBaseOutputPin::BreakConnect(); +} + + +// Let derived class know when the output pin is connected + +HRESULT +CTransformOutputPin::CompleteConnect(IPin *pReceivePin) +{ + HRESULT hr = m_pTransformFilter->CompleteConnect(PINDIR_OUTPUT,pReceivePin); + if (FAILED(hr)) { + return hr; + } + return CBaseOutputPin::CompleteConnect(pReceivePin); +} + + +// check a given transform - must have selected input type first + +HRESULT +CTransformOutputPin::CheckMediaType(const CMediaType* pmtOut) +{ + // must have selected input first + ASSERT(m_pTransformFilter->m_pInput != NULL); + if ((m_pTransformFilter->m_pInput->IsConnected() == FALSE)) { + return E_INVALIDARG; + } + + return m_pTransformFilter->CheckTransform( + &m_pTransformFilter->m_pInput->CurrentMediaType(), + pmtOut); +} + + +// called after we have agreed a media type to actually set it in which case +// we run the CheckTransform function to get the output format type again + +HRESULT +CTransformOutputPin::SetMediaType(const CMediaType* pmtOut) +{ + HRESULT hr = NOERROR; + ASSERT(m_pTransformFilter->m_pInput != NULL); + + ASSERT(m_pTransformFilter->m_pInput->CurrentMediaType().IsValid()); + + // Set the base class media type (should always succeed) + hr = CBasePin::SetMediaType(pmtOut); + if (FAILED(hr)) { + return hr; + } + +#ifdef DEBUG + if (FAILED(m_pTransformFilter->CheckTransform(&m_pTransformFilter-> + m_pInput->CurrentMediaType(),pmtOut))) { + DbgLog((LOG_ERROR,0,TEXT("*** This filter is accepting an output media type"))); + DbgLog((LOG_ERROR,0,TEXT(" that it can't currently transform to. I hope"))); + DbgLog((LOG_ERROR,0,TEXT(" it's smart enough to reconnect its input."))); + } +#endif + + return m_pTransformFilter->SetMediaType(PINDIR_OUTPUT,pmtOut); +} + + +// pass the buffer size decision through to the main transform class + +HRESULT +CTransformOutputPin::DecideBufferSize( + IMemAllocator * pAllocator, + __inout ALLOCATOR_PROPERTIES* pProp) +{ + return m_pTransformFilter->DecideBufferSize(pAllocator, pProp); +} + + + +// return a specific media type indexed by iPosition + +HRESULT +CTransformOutputPin::GetMediaType( + int iPosition, + __inout CMediaType *pMediaType) +{ + ASSERT(m_pTransformFilter->m_pInput != NULL); + + // We don't have any media types if our input is not connected + + if (m_pTransformFilter->m_pInput->IsConnected()) { + return m_pTransformFilter->GetMediaType(iPosition,pMediaType); + } else { + return VFW_S_NO_MORE_ITEMS; + } +} + + +// Override this if you can do something constructive to act on the +// quality message. Consider passing it upstream as well + +// Pass the quality mesage on upstream. + +STDMETHODIMP +CTransformOutputPin::Notify(IBaseFilter * pSender, Quality q) +{ + UNREFERENCED_PARAMETER(pSender); + ValidateReadPtr(pSender,sizeof(IBaseFilter)); + + // First see if we want to handle this ourselves + HRESULT hr = m_pTransformFilter->AlterQuality(q); + if (hr!=S_FALSE) { + return hr; // either S_OK or a failure + } + + // S_FALSE means we pass the message on. + // Find the quality sink for our input pin and send it there + + ASSERT(m_pTransformFilter->m_pInput != NULL); + + return m_pTransformFilter->m_pInput->PassNotify(q); + +} // Notify + + +// the following removes a very large number of level 4 warnings from the microsoft +// compiler output, which are not useful at all in this case. +#pragma warning(disable:4514) diff --git a/third_party/BaseClasses/transfrm.h b/third_party/BaseClasses/transfrm.h new file mode 100644 index 00000000..9b276471 --- /dev/null +++ b/third_party/BaseClasses/transfrm.h @@ -0,0 +1,304 @@ +//------------------------------------------------------------------------------ +// File: Transfrm.h +// +// Desc: DirectShow base classes - defines classes from which simple +// transform codecs may be derived. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// It assumes the codec has one input and one output stream, and has no +// interest in memory management, interface negotiation or anything else. +// +// derive your class from this, and supply Transform and the media type/format +// negotiation functions. Implement that class, compile and link and +// you're done. + + +#ifndef __TRANSFRM__ +#define __TRANSFRM__ + +// ====================================================================== +// This is the com object that represents a simple transform filter. It +// supports IBaseFilter, IMediaFilter and two pins through nested interfaces +// ====================================================================== + +class CTransformFilter; + +// ================================================== +// Implements the input pin +// ================================================== + +class CTransformInputPin : public CBaseInputPin +{ + friend class CTransformFilter; + +protected: + CTransformFilter *m_pTransformFilter; + + +public: + + CTransformInputPin( + __in_opt LPCTSTR pObjectName, + __inout CTransformFilter *pTransformFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pName); +#ifdef UNICODE + CTransformInputPin( + __in_opt LPCSTR pObjectName, + __inout CTransformFilter *pTransformFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pName); +#endif + + STDMETHODIMP QueryId(__deref_out LPWSTR * Id) + { + return AMGetWideString(L"In", Id); + } + + // Grab and release extra interfaces if required + + HRESULT CheckConnect(IPin *pPin); + HRESULT BreakConnect(); + HRESULT CompleteConnect(IPin *pReceivePin); + + // check that we can support this output type + HRESULT CheckMediaType(const CMediaType* mtIn); + + // set the connection media type + HRESULT SetMediaType(const CMediaType* mt); + + // --- IMemInputPin ----- + + // here's the next block of data from the stream. + // AddRef it yourself if you need to hold it beyond the end + // of this call. + STDMETHODIMP Receive(IMediaSample * pSample); + + // provide EndOfStream that passes straight downstream + // (there is no queued data) + STDMETHODIMP EndOfStream(void); + + // passes it to CTransformFilter::BeginFlush + STDMETHODIMP BeginFlush(void); + + // passes it to CTransformFilter::EndFlush + STDMETHODIMP EndFlush(void); + + STDMETHODIMP NewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate); + + // Check if it's OK to process samples + virtual HRESULT CheckStreaming(); + + // Media type +public: + CMediaType& CurrentMediaType() { return m_mt; }; + +}; + +// ================================================== +// Implements the output pin +// ================================================== + +class CTransformOutputPin : public CBaseOutputPin +{ + friend class CTransformFilter; + +protected: + CTransformFilter *m_pTransformFilter; + +public: + + // implement IMediaPosition by passing upstream + IUnknown * m_pPosition; + + CTransformOutputPin( + __in_opt LPCTSTR pObjectName, + __inout CTransformFilter *pTransformFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pName); +#ifdef UNICODE + CTransformOutputPin( + __in_opt LPCSTR pObjectName, + __inout CTransformFilter *pTransformFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pName); +#endif + ~CTransformOutputPin(); + + // override to expose IMediaPosition + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv); + + // --- CBaseOutputPin ------------ + + STDMETHODIMP QueryId(__deref_out LPWSTR * Id) + { + return AMGetWideString(L"Out", Id); + } + + // Grab and release extra interfaces if required + + HRESULT CheckConnect(IPin *pPin); + HRESULT BreakConnect(); + HRESULT CompleteConnect(IPin *pReceivePin); + + // check that we can support this output type + HRESULT CheckMediaType(const CMediaType* mtOut); + + // set the connection media type + HRESULT SetMediaType(const CMediaType *pmt); + + // called from CBaseOutputPin during connection to ask for + // the count and size of buffers we need. + HRESULT DecideBufferSize( + IMemAllocator * pAlloc, + __inout ALLOCATOR_PROPERTIES *pProp); + + // returns the preferred formats for a pin + HRESULT GetMediaType(int iPosition, __inout CMediaType *pMediaType); + + // inherited from IQualityControl via CBasePin + STDMETHODIMP Notify(IBaseFilter * pSender, Quality q); + + // Media type +public: + CMediaType& CurrentMediaType() { return m_mt; }; +}; + + +class AM_NOVTABLE CTransformFilter : public CBaseFilter +{ + +public: + + // map getpin/getpincount for base enum of pins to owner + // override this to return more specialised pin objects + + virtual int GetPinCount(); + virtual CBasePin * GetPin(int n); + STDMETHODIMP FindPin(LPCWSTR Id, __deref_out IPin **ppPin); + + // override state changes to allow derived transform filter + // to control streaming start/stop + STDMETHODIMP Stop(); + STDMETHODIMP Pause(); + +public: + + CTransformFilter(__in_opt LPCTSTR , __inout_opt LPUNKNOWN, REFCLSID clsid); +#ifdef UNICODE + CTransformFilter(__in_opt LPCSTR , __inout_opt LPUNKNOWN, REFCLSID clsid); +#endif + ~CTransformFilter(); + + // ================================================================= + // ----- override these bits --------------------------------------- + // ================================================================= + + // These must be supplied in a derived class + + virtual HRESULT Transform(IMediaSample * pIn, IMediaSample *pOut); + + // check if you can support mtIn + virtual HRESULT CheckInputType(const CMediaType* mtIn) PURE; + + // check if you can support the transform from this input to this output + virtual HRESULT CheckTransform(const CMediaType* mtIn, const CMediaType* mtOut) PURE; + + // this goes in the factory template table to create new instances + // static CCOMObject * CreateInstance(__inout_opt LPUNKNOWN, HRESULT *); + + // call the SetProperties function with appropriate arguments + virtual HRESULT DecideBufferSize( + IMemAllocator * pAllocator, + __inout ALLOCATOR_PROPERTIES *pprop) PURE; + + // override to suggest OUTPUT pin media types + virtual HRESULT GetMediaType(int iPosition, __inout CMediaType *pMediaType) PURE; + + + + // ================================================================= + // ----- Optional Override Methods ----------------------- + // ================================================================= + + // you can also override these if you want to know about streaming + virtual HRESULT StartStreaming(); + virtual HRESULT StopStreaming(); + + // override if you can do anything constructive with quality notifications + virtual HRESULT AlterQuality(Quality q); + + // override this to know when the media type is actually set + virtual HRESULT SetMediaType(PIN_DIRECTION direction,const CMediaType *pmt); + + // chance to grab extra interfaces on connection + virtual HRESULT CheckConnect(PIN_DIRECTION dir,IPin *pPin); + virtual HRESULT BreakConnect(PIN_DIRECTION dir); + virtual HRESULT CompleteConnect(PIN_DIRECTION direction,IPin *pReceivePin); + + // chance to customize the transform process + virtual HRESULT Receive(IMediaSample *pSample); + + // Standard setup for output sample + HRESULT InitializeOutputSample(IMediaSample *pSample, __deref_out IMediaSample **ppOutSample); + + // if you override Receive, you may need to override these three too + virtual HRESULT EndOfStream(void); + virtual HRESULT BeginFlush(void); + virtual HRESULT EndFlush(void); + virtual HRESULT NewSegment( + REFERENCE_TIME tStart, + REFERENCE_TIME tStop, + double dRate); + +#ifdef PERF + // Override to register performance measurement with a less generic string + // You should do this to avoid confusion with other filters + virtual void RegisterPerfId() + {m_idTransform = MSR_REGISTER(TEXT("Transform"));} +#endif // PERF + + +// implementation details + +protected: + +#ifdef PERF + int m_idTransform; // performance measuring id +#endif + BOOL m_bEOSDelivered; // have we sent EndOfStream + BOOL m_bSampleSkipped; // Did we just skip a frame + BOOL m_bQualityChanged; // Have we degraded? + + // critical section protecting filter state. + + CCritSec m_csFilter; + + // critical section stopping state changes (ie Stop) while we're + // processing a sample. + // + // This critical section is held when processing + // events that occur on the receive thread - Receive() and EndOfStream(). + // + // If you want to hold both m_csReceive and m_csFilter then grab + // m_csFilter FIRST - like CTransformFilter::Stop() does. + + CCritSec m_csReceive; + + // these hold our input and output pins + + friend class CTransformInputPin; + friend class CTransformOutputPin; + CTransformInputPin *m_pInput; + CTransformOutputPin *m_pOutput; +}; + +#endif /* __TRANSFRM__ */ + + diff --git a/third_party/BaseClasses/transip.cpp b/third_party/BaseClasses/transip.cpp new file mode 100644 index 00000000..e8e12eb5 --- /dev/null +++ b/third_party/BaseClasses/transip.cpp @@ -0,0 +1,974 @@ +//------------------------------------------------------------------------------ +// File: TransIP.cpp +// +// Desc: DirectShow base classes - implements class for simple Transform- +// In-Place filters such as audio. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// How allocators are decided. +// +// An in-place transform tries to do its work in someone else's buffers. +// It tries to persuade the filters on either side to use the same allocator +// (and for that matter the same media type). In desperation, if the downstream +// filter refuses to supply an allocator and the upstream filter offers only +// a read-only one then it will provide an allocator. +// if the upstream filter insists on a read-only allocator then the transform +// filter will (reluctantly) copy the data before transforming it. +// +// In order to pass an allocator through it needs to remember the one it got +// from the first connection to pass it on to the second one. +// +// It is good if we can avoid insisting on a particular order of connection +// (There is a precedent for insisting on the input +// being connected first. Insisting on the output being connected first is +// not allowed. That would break RenderFile.) +// +// The base pin classes (CBaseOutputPin and CBaseInputPin) both have a +// m_pAllocator member which is used in places like +// CBaseOutputPin::GetDeliveryBuffer and CBaseInputPin::Inactive. +// To avoid lots of extra overriding, we should keep these happy +// by using these pointers. +// +// When each pin is connected, it will set the corresponding m_pAllocator +// and will have a single ref-count on that allocator. +// +// Refcounts are acquired by GetAllocator calls which return AddReffed +// allocators and are released in one of: +// CBaseInputPin::Disconnect +// CBaseOutputPin::BreakConect +// In each case m_pAllocator is set to NULL after the release, so this +// is the last chance to ever release it. If there should ever be +// multiple refcounts associated with the same pointer, this had better +// be cleared up before that happens. To avoid such problems, we'll +// stick with one per pointer. + + + +// RECONNECTING and STATE CHANGES +// +// Each pin could be disconnected, connected with a read-only allocator, +// connected with an upstream read/write allocator, connected with an +// allocator from downstream or connected with its own allocator. +// Five states for each pin gives a data space of 25 states. +// +// Notation: +// +// R/W == read/write +// R-O == read-only +// +// +// +// 00 means an unconnected pin. +// <- means using a R/W allocator from the upstream filter +// <= means using a R-O allocator from an upstream filter +// || means using our own (R/W) allocator. +// -> means using a R/W allocator from a downstream filter +// (a R-O allocator from downstream is nonsense, it can't ever work). +// +// +// That makes 25 possible states. Some states are nonsense (two different +// allocators from the same place). These are just an artifact of the notation. +// <= <- Nonsense. +// <- <= Nonsense +// Some states are illegal (the output pin never accepts a R-O allocator): +// 00 <= !! Error !! +// <= <= !! Error !! +// || <= !! Error !! +// -> <= !! Error !! +// Three states appears to be inaccessible: +// -> || Inaccessible +// || -> Inaccessible +// || <- Inaccessible +// Some states only ever occur as intermediates with a pending reconnect which +// is guaranteed to finish in another state. +// -> 00 ?? unstable goes to || 00 +// 00 <- ?? unstable goes to 00 || +// -> <- ?? unstable goes to -> -> +// <- || ?? unstable goes to <- <- +// <- -> ?? unstable goes to <- <- +// And that leaves 11 possible resting states: +// 1 00 00 Nothing connected. +// 2 <- 00 Input pin connected. +// 3 <= 00 Input pin connected using R-O allocator. +// 4 || 00 Needs several state changes to get here. +// 5 00 || Output pin connected using our allocator +// 6 00 -> Downstream only connected +// 7 || || Undesirable but can be forced upon us. +// 8 <= || Copy forced. <= -> is preferable +// 9 <= -> OK - forced to copy. +// 10 <- <- Transform in place (ideal) +// 11 -> -> Transform in place (ideal) +// +// The object of the exercise is to ensure that we finish up in states +// 10 or 11 whenever possible. State 10 is only possible if the upstream +// filter has a R/W allocator (the AVI splitter notoriously +// doesn't) and state 11 is only possible if the downstream filter does +// offer an allocator. +// +// The transition table (entries marked * go via a reconnect) +// +// There are 8 possible transitions: +// A: Connect upstream to filter with R-O allocator that insists on using it. +// B: Connect upstream to filter with R-O allocator but chooses not to use it. +// C: Connect upstream to filter with R/W allocator and insists on using it. +// D: Connect upstream to filter with R/W allocator but chooses not to use it. +// E: Connect downstream to a filter that offers an allocator +// F: Connect downstream to a filter that does not offer an allocator +// G: disconnect upstream +// H: Disconnect downstream +// +// A B C D E F G H +// --------------------------------------------------------- +// 00 00 1 | 3 3 2 2 6 5 . . |1 00 00 +// <- 00 2 | . . . . *10/11 10 1 . |2 <- 00 +// <= 00 3 | . . . . *9/11 *7/8 1 . |3 <= 00 +// || 00 4 | . . . . *8 *7 1 . |4 || 00 +// 00 || 5 | 8 7 *10 7 . . . 1 |5 00 || +// 00 -> 6 | 9 11 *10 11 . . . 1 |6 00 -> +// || || 7 | . . . . . . 5 4 |7 || || +// <= || 8 | . . . . . . 5 3 |8 <= || +// <= -> 9 | . . . . . . 6 3 |9 <= -> +// <- <- 10| . . . . . . *5/6 2 |10 <- <- +// -> -> 11| . . . . . . 6 *2/3 |11 -> -> +// --------------------------------------------------------- +// A B C D E F G H +// +// All these states are accessible without requiring any filter to +// change its behaviour but not all transitions are accessible, for +// instance a transition from state 4 to anywhere other than +// state 8 requires that the upstream filter first offer a R-O allocator +// and then changes its mind and offer R/W. This is NOT allowable - it +// leads to things like the output pin getting a R/W allocator from +// upstream and then the input pin being told it can only have a R-O one. +// Note that you CAN change (say) the upstream filter for a different one, but +// only as a disconnect / connect, not as a Reconnect. (Exercise for +// the reader is to see how you get into state 4). +// +// The reconnection stuff goes as follows (some of the cases shown here as +// "no reconnect" may get one to finalise media type - an old story). +// If there is a reconnect where it says "no reconnect" here then the +// reconnection must not change the allocator choice. +// +// state 2: <- 00 transition E <- <- case C <- <- (no change) +// case D -> <- and then to -> -> +// +// state 2: <- 00 transition F <- <- (no reconnect) +// +// state 3: <= 00 transition E <= -> case A <= -> (no change) +// case B -> -> +// transition F <= || case A <= || (no change) +// case B || || +// +// state 4: || 00 transition E || || case B -> || and then all cases to -> -> +// F || || case B || || (no change) +// +// state 5: 00 || transition A <= || (no reconnect) +// B || || (no reconnect) +// C <- || all cases <- <- +// D || || (unfortunate, but upstream's choice) +// +// state 6: 00 -> transition A <= -> (no reconnect) +// B -> -> (no reconnect) +// C <- -> all cases <- <- +// D -> -> (no reconnect) +// +// state 10:<- <- transition G 00 <- case E 00 -> +// case F 00 || +// +// state 11:-> -> transition H -> 00 case A <= 00 (schizo) +// case B <= 00 +// case C <- 00 (schizo) +// case D <- 00 +// +// The Rules: +// To sort out media types: +// The input is reconnected +// if the input pin is connected and the output pin connects +// The output is reconnected +// If the output pin is connected +// and the input pin connects to a different media type +// +// To sort out allocators: +// The input is reconnected +// if the output disconnects and the input was using a downstream allocator +// The output pin calls SetAllocator to pass on a new allocator +// if the output is connected and +// if the input disconnects and the output was using an upstream allocator +// if the input acquires an allocator different from the output one +// and that new allocator is not R-O +// +// Data is copied (i.e. call getbuffer and copy the data before transforming it) +// if the two allocators are different. + + + +// CHAINS of filters: +// +// We sit between two filters (call them A and Z). We should finish up +// with the same allocator on both of our pins and that should be the +// same one that A and Z would have agreed on if we hadn't been in the +// way. Furthermore, it should not matter how many in-place transforms +// are in the way. Let B, C, D... be in-place transforms ("us"). +// Here's how it goes: +// +// 1. +// A connects to B. They agree on A's allocator. +// A-a->B +// +// 2. +// B connects to C. Same story. There is no point in a reconnect, but +// B will request an input reconnect anyway. +// A-a->B-a->C +// +// 3. +// C connects to Z. +// C insists on using A's allocator, but compromises by requesting a reconnect. +// of C's input. +// A-a->B-?->C-a->Z +// +// We now have pending reconnects on both A--->B and B--->C +// +// 4. +// The A--->B link is reconnected. +// A asks B for an allocator. B sees that it has a downstream connection so +// asks its downstream input pin i.e. C's input pin for an allocator. C sees +// that it too has a downstream connection so asks Z for an allocator. +// +// Even though Z's input pin is connected, it is being asked for an allocator. +// It could refuse, in which case the chain is done and will use A's allocator +// Alternatively, Z may supply one. A chooses either Z's or A's own one. +// B's input pin gets NotifyAllocator called to tell it the decision and it +// propagates this downstream by calling ReceiveAllocator on its output pin +// which calls NotifyAllocator on the next input pin downstream etc. +// If the choice is Z then it goes: +// A-z->B-a->C-a->Z +// A-z->B-z->C-a->Z +// A-z->B-z->C-z->Z +// +// And that's IT!! Any further (essentially spurious) reconnects peter out +// with no change in the chain. + +#include +#include +#include + + +// ================================================================= +// Implements the CTransInPlaceFilter class +// ================================================================= + +CTransInPlaceFilter::CTransInPlaceFilter + ( __in_opt LPCTSTR pName, + __inout_opt LPUNKNOWN pUnk, + REFCLSID clsid, + __inout HRESULT *phr, + bool bModifiesData + ) + : CTransformFilter(pName, pUnk, clsid), + m_bModifiesData(bModifiesData) +{ +#ifdef PERF + RegisterPerfId(); +#endif // PERF + +} // constructor + +#ifdef UNICODE +CTransInPlaceFilter::CTransInPlaceFilter + ( __in_opt LPCSTR pName, + __inout_opt LPUNKNOWN pUnk, + REFCLSID clsid, + __inout HRESULT *phr, + bool bModifiesData + ) + : CTransformFilter(pName, pUnk, clsid), + m_bModifiesData(bModifiesData) +{ +#ifdef PERF + RegisterPerfId(); +#endif // PERF + +} // constructor +#endif + +// return a non-addrefed CBasePin * for the user to addref if he holds onto it +// for longer than his pointer to us. We create the pins dynamically when they +// are asked for rather than in the constructor. This is because we want to +// give the derived class an oppportunity to return different pin objects + +// As soon as any pin is needed we create both (this is different from the +// usual transform filter) because enumerators, allocators etc are passed +// through from one pin to another and it becomes very painful if the other +// pin isn't there. If we fail to create either pin we ensure we fail both. + +CBasePin * +CTransInPlaceFilter::GetPin(int n) +{ + HRESULT hr = S_OK; + + // Create an input pin if not already done + + if (m_pInput == NULL) { + + m_pInput = new CTransInPlaceInputPin( NAME("TransInPlace input pin") + , this // Owner filter + , &hr // Result code + , L"Input" // Pin name + ); + + // Constructor for CTransInPlaceInputPin can't fail + ASSERT(SUCCEEDED(hr)); + } + + // Create an output pin if not already done + + if (m_pInput!=NULL && m_pOutput == NULL) { + + m_pOutput = new CTransInPlaceOutputPin( NAME("TransInPlace output pin") + , this // Owner filter + , &hr // Result code + , L"Output" // Pin name + ); + + // a failed return code should delete the object + + ASSERT(SUCCEEDED(hr)); + if (m_pOutput == NULL) { + delete m_pInput; + m_pInput = NULL; + } + } + + // Return the appropriate pin + + ASSERT (n>=0 && n<=1); + if (n == 0) { + return m_pInput; + } else if (n==1) { + return m_pOutput; + } else { + return NULL; + } + +} // GetPin + + + +// dir is the direction of our pin. +// pReceivePin is the pin we are connecting to. +HRESULT CTransInPlaceFilter::CompleteConnect(PIN_DIRECTION dir, IPin *pReceivePin) +{ + UNREFERENCED_PARAMETER(pReceivePin); + ASSERT(m_pInput); + ASSERT(m_pOutput); + + // if we are not part of a graph, then don't indirect the pointer + // this probably prevents use of the filter without a filtergraph + if (!m_pGraph) { + return VFW_E_NOT_IN_GRAPH; + } + + // Always reconnect the input to account for buffering changes + // + // Because we don't get to suggest a type on ReceiveConnection + // we need another way of making sure the right type gets used. + // + // One way would be to have our EnumMediaTypes return our output + // connection type first but more deterministic and simple is to + // call ReconnectEx passing the type we want to reconnect with + // via the base class ReconeectPin method. + + if (dir == PINDIR_OUTPUT) { + if( m_pInput->IsConnected() ) { + return ReconnectPin( m_pInput, &m_pOutput->CurrentMediaType() ); + } + return NOERROR; + } + + ASSERT(dir == PINDIR_INPUT); + + // Reconnect output if necessary + + if( m_pOutput->IsConnected() ) { + + if ( m_pInput->CurrentMediaType() + != m_pOutput->CurrentMediaType() + ) { + return ReconnectPin( m_pOutput, &m_pInput->CurrentMediaType() ); + } + } + return NOERROR; + +} // ComnpleteConnect + + +// +// DecideBufferSize +// +// Tell the output pin's allocator what size buffers we require. +// *pAlloc will be the allocator our output pin is using. +// + +HRESULT CTransInPlaceFilter::DecideBufferSize + ( IMemAllocator *pAlloc + , __inout ALLOCATOR_PROPERTIES *pProperties + ) +{ + ALLOCATOR_PROPERTIES Request, Actual; + HRESULT hr; + + // If we are connected upstream, get his views + if (m_pInput->IsConnected()) { + // Get the input pin allocator, and get its size and count. + // we don't care about his alignment and prefix. + + hr = InputPin()->PeekAllocator()->GetProperties(&Request); + if (FAILED(hr)) { + // Input connected but with a secretive allocator - enough! + return hr; + } + } else { + // Propose one byte + // If this isn't enough then when the other pin does get connected + // we can revise it. + ZeroMemory(&Request, sizeof(Request)); + Request.cBuffers = 1; + Request.cbBuffer = 1; + } + + + DbgLog((LOG_MEMORY,1,TEXT("Setting Allocator Requirements"))); + DbgLog((LOG_MEMORY,1,TEXT("Count %d, Size %d"), + Request.cBuffers, Request.cbBuffer)); + + // Pass the allocator requirements to our output side + // but do a little sanity checking first or we'll just hit + // asserts in the allocator. + + pProperties->cBuffers = Request.cBuffers; + pProperties->cbBuffer = Request.cbBuffer; + pProperties->cbAlign = Request.cbAlign; + if (pProperties->cBuffers<=0) {pProperties->cBuffers = 1; } + if (pProperties->cbBuffer<=0) {pProperties->cbBuffer = 1; } + hr = pAlloc->SetProperties(pProperties, &Actual); + + if (FAILED(hr)) { + return hr; + } + + DbgLog((LOG_MEMORY,1,TEXT("Obtained Allocator Requirements"))); + DbgLog((LOG_MEMORY,1,TEXT("Count %d, Size %d, Alignment %d"), + Actual.cBuffers, Actual.cbBuffer, Actual.cbAlign)); + + // Make sure we got the right alignment and at least the minimum required + + if ( (Request.cBuffers > Actual.cBuffers) + || (Request.cbBuffer > Actual.cbBuffer) + || (Request.cbAlign > Actual.cbAlign) + ) { + return E_FAIL; + } + return NOERROR; + +} // DecideBufferSize + +// +// Copy +// +// return a pointer to an identical copy of pSample +__out_opt IMediaSample * CTransInPlaceFilter::Copy(IMediaSample *pSource) +{ + IMediaSample * pDest; + + HRESULT hr; + REFERENCE_TIME tStart, tStop; + const BOOL bTime = S_OK == pSource->GetTime( &tStart, &tStop); + + // this may block for an indeterminate amount of time + hr = OutputPin()->PeekAllocator()->GetBuffer( + &pDest + , bTime ? &tStart : NULL + , bTime ? &tStop : NULL + , m_bSampleSkipped ? AM_GBF_PREVFRAMESKIPPED : 0 + ); + + if (FAILED(hr)) { + return NULL; + } + + ASSERT(pDest); + IMediaSample2 *pSample2; + if (SUCCEEDED(pDest->QueryInterface(IID_IMediaSample2, (void **)&pSample2))) { + HRESULT hrProps = pSample2->SetProperties( + FIELD_OFFSET(AM_SAMPLE2_PROPERTIES, pbBuffer), + (PBYTE)m_pInput->SampleProps()); + pSample2->Release(); + if (FAILED(hrProps)) { + pDest->Release(); + return NULL; + } + } else { + if (bTime) { + pDest->SetTime(&tStart, &tStop); + } + + if (S_OK == pSource->IsSyncPoint()) { + pDest->SetSyncPoint(TRUE); + } + if (S_OK == pSource->IsDiscontinuity() || m_bSampleSkipped) { + pDest->SetDiscontinuity(TRUE); + } + if (S_OK == pSource->IsPreroll()) { + pDest->SetPreroll(TRUE); + } + + // Copy the media type + AM_MEDIA_TYPE *pMediaType; + if (S_OK == pSource->GetMediaType(&pMediaType)) { + pDest->SetMediaType(pMediaType); + DeleteMediaType( pMediaType ); + } + + } + + m_bSampleSkipped = FALSE; + + // Copy the sample media times + REFERENCE_TIME TimeStart, TimeEnd; + if (pSource->GetMediaTime(&TimeStart,&TimeEnd) == NOERROR) { + pDest->SetMediaTime(&TimeStart,&TimeEnd); + } + + // Copy the actual data length and the actual data. + { + const long lDataLength = pSource->GetActualDataLength(); + if (FAILED(pDest->SetActualDataLength(lDataLength))) { + pDest->Release(); + return NULL; + } + + // Copy the sample data + { + BYTE *pSourceBuffer, *pDestBuffer; + long lSourceSize = pSource->GetSize(); + long lDestSize = pDest->GetSize(); + + ASSERT(lDestSize >= lSourceSize && lDestSize >= lDataLength); + + if (FAILED(pSource->GetPointer(&pSourceBuffer)) || + FAILED(pDest->GetPointer(&pDestBuffer)) || + lDestSize < lDataLength || + lDataLength < 0) { + pDest->Release(); + return NULL; + } + ASSERT(lDestSize == 0 || pSourceBuffer != NULL && pDestBuffer != NULL); + + CopyMemory( (PVOID) pDestBuffer, (PVOID) pSourceBuffer, lDataLength ); + } + } + + return pDest; + +} // Copy + + +// override this to customize the transform process + +HRESULT +CTransInPlaceFilter::Receive(IMediaSample *pSample) +{ + /* Check for other streams and pass them on */ + AM_SAMPLE2_PROPERTIES * const pProps = m_pInput->SampleProps(); + if (pProps->dwStreamId != AM_STREAM_MEDIA) { + return m_pOutput->Deliver(pSample); + } + HRESULT hr; + + // Start timing the TransInPlace (if PERF is defined) + MSR_START(m_idTransInPlace); + + if (UsingDifferentAllocators()) { + + // We have to copy the data. + + pSample = Copy(pSample); + + if (pSample==NULL) { + MSR_STOP(m_idTransInPlace); + return E_UNEXPECTED; + } + } + + // have the derived class transform the data + hr = Transform(pSample); + + // Stop the clock and log it (if PERF is defined) + MSR_STOP(m_idTransInPlace); + + if (FAILED(hr)) { + DbgLog((LOG_TRACE, 1, TEXT("Error from TransInPlace"))); + if (UsingDifferentAllocators()) { + pSample->Release(); + } + return hr; + } + + // the Transform() function can return S_FALSE to indicate that the + // sample should not be delivered; we only deliver the sample if it's + // really S_OK (same as NOERROR, of course.) + if (hr == NOERROR) { + hr = m_pOutput->Deliver(pSample); + } else { + // But it would be an error to return this private workaround + // to the caller ... + if (S_FALSE == hr) { + // S_FALSE returned from Transform is a PRIVATE agreement + // We should return NOERROR from Receive() in this cause because + // returning S_FALSE from Receive() means that this is the end + // of the stream and no more data should be sent. + m_bSampleSkipped = TRUE; + if (!m_bQualityChanged) { + NotifyEvent(EC_QUALITY_CHANGE,0,0); + m_bQualityChanged = TRUE; + } + hr = NOERROR; + } + } + + // release the output buffer. If the connected pin still needs it, + // it will have addrefed it itself. + if (UsingDifferentAllocators()) { + pSample->Release(); + } + + return hr; + +} // Receive + + + +// ================================================================= +// Implements the CTransInPlaceInputPin class +// ================================================================= + + +// constructor + +CTransInPlaceInputPin::CTransInPlaceInputPin + ( __in_opt LPCTSTR pObjectName + , __inout CTransInPlaceFilter *pFilter + , __inout HRESULT *phr + , __in_opt LPCWSTR pName + ) + : CTransformInputPin(pObjectName, + pFilter, + phr, + pName) + , m_bReadOnly(FALSE) + , m_pTIPFilter(pFilter) +{ + DbgLog((LOG_TRACE, 2 + , TEXT("CTransInPlaceInputPin::CTransInPlaceInputPin"))); + +} // constructor + + +// ================================================================= +// Implements IMemInputPin interface +// ================================================================= + + +// If the downstream filter has one then offer that (even if our own output +// pin is not using it yet. If the upstream filter chooses it then we will +// tell our output pin to ReceiveAllocator). +// Else if our output pin is using an allocator then offer that. +// ( This could mean offering the upstream filter his own allocator, +// it could mean offerring our own +// ) or it could mean offering the one from downstream +// Else fail to offer any allocator at all. + +STDMETHODIMP CTransInPlaceInputPin::GetAllocator(__deref_out IMemAllocator ** ppAllocator) +{ + CheckPointer(ppAllocator,E_POINTER); + ValidateReadWritePtr(ppAllocator,sizeof(IMemAllocator *)); + CAutoLock cObjectLock(m_pLock); + + HRESULT hr; + + if ( m_pTIPFilter->m_pOutput->IsConnected() ) { + // Store the allocator we got + hr = m_pTIPFilter->OutputPin()->ConnectedIMemInputPin() + ->GetAllocator( ppAllocator ); + if (SUCCEEDED(hr)) { + m_pTIPFilter->OutputPin()->SetAllocator( *ppAllocator ); + } + } + else { + // Help upstream filter (eg TIP filter which is having to do a copy) + // by providing a temp allocator here - we'll never use + // this allocator because when our output is connected we'll + // reconnect this pin + hr = CTransformInputPin::GetAllocator( ppAllocator ); + } + return hr; + +} // GetAllocator + + + +/* Get told which allocator the upstream output pin is actually going to use */ + + +STDMETHODIMP +CTransInPlaceInputPin::NotifyAllocator( + IMemAllocator * pAllocator, + BOOL bReadOnly) +{ + HRESULT hr = S_OK; + CheckPointer(pAllocator,E_POINTER); + ValidateReadPtr(pAllocator,sizeof(IMemAllocator)); + + CAutoLock cObjectLock(m_pLock); + + m_bReadOnly = bReadOnly; + // If we modify data then don't accept the allocator if it's + // the same as the output pin's allocator + + // If our output is not connected just accept the allocator + // We're never going to use this allocator because when our + // output pin is connected we'll reconnect this pin + if (!m_pTIPFilter->OutputPin()->IsConnected()) { + return CTransformInputPin::NotifyAllocator(pAllocator, bReadOnly); + } + + // If the allocator is read-only and we're modifying data + // and the allocator is the same as the output pin's + // then reject + if (bReadOnly && m_pTIPFilter->m_bModifiesData) { + IMemAllocator *pOutputAllocator = + m_pTIPFilter->OutputPin()->PeekAllocator(); + + // Make sure we have an output allocator + if (pOutputAllocator == NULL) { + hr = m_pTIPFilter->OutputPin()->ConnectedIMemInputPin()-> + GetAllocator(&pOutputAllocator); + if(FAILED(hr)) { + hr = CreateMemoryAllocator(&pOutputAllocator); + } + if (SUCCEEDED(hr)) { + m_pTIPFilter->OutputPin()->SetAllocator(pOutputAllocator); + pOutputAllocator->Release(); + } + } + if (pAllocator == pOutputAllocator) { + hr = E_FAIL; + } else if(SUCCEEDED(hr)) { + // Must copy so set the allocator properties on the output + ALLOCATOR_PROPERTIES Props, Actual; + hr = pAllocator->GetProperties(&Props); + if (SUCCEEDED(hr)) { + hr = pOutputAllocator->SetProperties(&Props, &Actual); + } + if (SUCCEEDED(hr)) { + if ( (Props.cBuffers > Actual.cBuffers) + || (Props.cbBuffer > Actual.cbBuffer) + || (Props.cbAlign > Actual.cbAlign) + ) { + hr = E_FAIL; + } + } + + // Set the allocator on the output pin + if (SUCCEEDED(hr)) { + hr = m_pTIPFilter->OutputPin()->ConnectedIMemInputPin() + ->NotifyAllocator( pOutputAllocator, FALSE ); + } + } + } else { + hr = m_pTIPFilter->OutputPin()->ConnectedIMemInputPin() + ->NotifyAllocator( pAllocator, bReadOnly ); + if (SUCCEEDED(hr)) { + m_pTIPFilter->OutputPin()->SetAllocator( pAllocator ); + } + } + + if (SUCCEEDED(hr)) { + + // It's possible that the old and the new are the same thing. + // AddRef before release ensures that we don't unload it. + pAllocator->AddRef(); + + if( m_pAllocator != NULL ) + m_pAllocator->Release(); + + m_pAllocator = pAllocator; // We have an allocator for the input pin + } + + return hr; + +} // NotifyAllocator + + +// EnumMediaTypes +// - pass through to our downstream filter +STDMETHODIMP CTransInPlaceInputPin::EnumMediaTypes( __deref_out IEnumMediaTypes **ppEnum ) +{ + // Can only pass through if connected + if( !m_pTIPFilter->m_pOutput->IsConnected() ) + return VFW_E_NOT_CONNECTED; + + return m_pTIPFilter->m_pOutput->GetConnected()->EnumMediaTypes( ppEnum ); + +} // EnumMediaTypes + + +// CheckMediaType +// - agree to anything if not connected, +// otherwise pass through to the downstream filter. +// This assumes that the filter does not change the media type. + +HRESULT CTransInPlaceInputPin::CheckMediaType(const CMediaType *pmt ) +{ + HRESULT hr = m_pTIPFilter->CheckInputType(pmt); + if (hr!=S_OK) return hr; + + if( m_pTIPFilter->m_pOutput->IsConnected() ) + return m_pTIPFilter->m_pOutput->GetConnected()->QueryAccept( pmt ); + else + return S_OK; + +} // CheckMediaType + + +// If upstream asks us what our requirements are, we will try to ask downstream +// if that doesn't work, we'll just take the defaults. +STDMETHODIMP +CTransInPlaceInputPin::GetAllocatorRequirements(__out ALLOCATOR_PROPERTIES *pProps) +{ + + if( m_pTIPFilter->m_pOutput->IsConnected() ) + return m_pTIPFilter->OutputPin() + ->ConnectedIMemInputPin()->GetAllocatorRequirements( pProps ); + else + return E_NOTIMPL; + +} // GetAllocatorRequirements + + +// CTransInPlaceInputPin::CompleteConnect() calls CBaseInputPin::CompleteConnect() +// and then calls CTransInPlaceFilter::CompleteConnect(). It does this because +// CTransInPlaceFilter::CompleteConnect() can reconnect a pin and we do not +// want to reconnect a pin if CBaseInputPin::CompleteConnect() fails. +HRESULT +CTransInPlaceInputPin::CompleteConnect(IPin *pReceivePin) +{ + HRESULT hr = CBaseInputPin::CompleteConnect(pReceivePin); + if (FAILED(hr)) { + return hr; + } + + return m_pTransformFilter->CompleteConnect(PINDIR_INPUT,pReceivePin); +} // CompleteConnect + + +// ================================================================= +// Implements the CTransInPlaceOutputPin class +// ================================================================= + + +// constructor + +CTransInPlaceOutputPin::CTransInPlaceOutputPin( + __in_opt LPCTSTR pObjectName, + __inout CTransInPlaceFilter *pFilter, + __inout HRESULT * phr, + __in_opt LPCWSTR pPinName) + : CTransformOutputPin( pObjectName + , pFilter + , phr + , pPinName), + m_pTIPFilter(pFilter) +{ + DbgLog(( LOG_TRACE, 2 + , TEXT("CTransInPlaceOutputPin::CTransInPlaceOutputPin"))); + +} // constructor + + +// EnumMediaTypes +// - pass through to our upstream filter +STDMETHODIMP CTransInPlaceOutputPin::EnumMediaTypes( __deref_out IEnumMediaTypes **ppEnum ) +{ + // Can only pass through if connected. + if( ! m_pTIPFilter->m_pInput->IsConnected() ) + return VFW_E_NOT_CONNECTED; + + return m_pTIPFilter->m_pInput->GetConnected()->EnumMediaTypes( ppEnum ); + +} // EnumMediaTypes + + + +// CheckMediaType +// - agree to anything if not connected, +// otherwise pass through to the upstream filter. + +HRESULT CTransInPlaceOutputPin::CheckMediaType(const CMediaType *pmt ) +{ + // Don't accept any output pin type changes if we're copying + // between allocators - it's too late to change the input + // allocator size. + if (m_pTIPFilter->UsingDifferentAllocators() && !m_pFilter->IsStopped()) { + if (*pmt == m_mt) { + return S_OK; + } else { + return VFW_E_TYPE_NOT_ACCEPTED; + } + } + + // Assumes the type does not change. That's why we're calling + // CheckINPUTType here on the OUTPUT pin. + HRESULT hr = m_pTIPFilter->CheckInputType(pmt); + if (hr!=S_OK) return hr; + + if( m_pTIPFilter->m_pInput->IsConnected() ) + return m_pTIPFilter->m_pInput->GetConnected()->QueryAccept( pmt ); + else + return S_OK; + +} // CheckMediaType + + +/* Save the allocator pointer in the output pin +*/ +void +CTransInPlaceOutputPin::SetAllocator(IMemAllocator * pAllocator) +{ + pAllocator->AddRef(); + if (m_pAllocator) { + m_pAllocator->Release(); + } + m_pAllocator = pAllocator; +} // SetAllocator + + +// CTransInPlaceOutputPin::CompleteConnect() calls CBaseOutputPin::CompleteConnect() +// and then calls CTransInPlaceFilter::CompleteConnect(). It does this because +// CTransInPlaceFilter::CompleteConnect() can reconnect a pin and we do not want to +// reconnect a pin if CBaseOutputPin::CompleteConnect() fails. +// CBaseOutputPin::CompleteConnect() often fails when our output pin is being connected +// to the Video Mixing Renderer. +HRESULT +CTransInPlaceOutputPin::CompleteConnect(IPin *pReceivePin) +{ + HRESULT hr = CBaseOutputPin::CompleteConnect(pReceivePin); + if (FAILED(hr)) { + return hr; + } + + return m_pTransformFilter->CompleteConnect(PINDIR_OUTPUT,pReceivePin); +} // CompleteConnect diff --git a/third_party/BaseClasses/transip.h b/third_party/BaseClasses/transip.h new file mode 100644 index 00000000..3fc335ef --- /dev/null +++ b/third_party/BaseClasses/transip.h @@ -0,0 +1,250 @@ +//------------------------------------------------------------------------------ +// File: TransIP.h +// +// Desc: DirectShow base classes - defines classes from which simple +// Transform-In-Place filters may be derived. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// +// The difference between this and Transfrm.h is that Transfrm copies the data. +// +// It assumes the filter has one input and one output stream, and has no +// interest in memory management, interface negotiation or anything else. +// +// Derive your class from this, and supply Transform and the media type/format +// negotiation functions. Implement that class, compile and link and +// you're done. + + +#ifndef __TRANSIP__ +#define __TRANSIP__ + +// ====================================================================== +// This is the com object that represents a simple transform filter. It +// supports IBaseFilter, IMediaFilter and two pins through nested interfaces +// ====================================================================== + +class CTransInPlaceFilter; + +// Several of the pin functions call filter functions to do the work, +// so you can often use the pin classes unaltered, just overriding the +// functions in CTransInPlaceFilter. If that's not enough and you want +// to derive your own pin class, override GetPin in the filter to supply +// your own pin classes to the filter. + +// ================================================== +// Implements the input pin +// ================================================== + +class CTransInPlaceInputPin : public CTransformInputPin +{ + +protected: + CTransInPlaceFilter * const m_pTIPFilter; // our filter + BOOL m_bReadOnly; // incoming stream is read only + +public: + + CTransInPlaceInputPin( + __in_opt LPCTSTR pObjectName, + __inout CTransInPlaceFilter *pFilter, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); + + // --- IMemInputPin ----- + + // Provide an enumerator for media types by getting one from downstream + STDMETHODIMP EnumMediaTypes( __deref_out IEnumMediaTypes **ppEnum ); + + // Say whether media type is acceptable. + HRESULT CheckMediaType(const CMediaType* pmt); + + // Return our upstream allocator + STDMETHODIMP GetAllocator(__deref_out IMemAllocator ** ppAllocator); + + // get told which allocator the upstream output pin is actually + // going to use. + STDMETHODIMP NotifyAllocator(IMemAllocator * pAllocator, + BOOL bReadOnly); + + // Allow the filter to see what allocator we have + // N.B. This does NOT AddRef + __out IMemAllocator * PeekAllocator() const + { return m_pAllocator; } + + // Pass this on downstream if it ever gets called. + STDMETHODIMP GetAllocatorRequirements(__out ALLOCATOR_PROPERTIES *pProps); + + HRESULT CompleteConnect(IPin *pReceivePin); + + inline const BOOL ReadOnly() { return m_bReadOnly ; } + +}; // CTransInPlaceInputPin + +// ================================================== +// Implements the output pin +// ================================================== + +class CTransInPlaceOutputPin : public CTransformOutputPin +{ + +protected: + // m_pFilter points to our CBaseFilter + CTransInPlaceFilter * const m_pTIPFilter; + +public: + + CTransInPlaceOutputPin( + __in_opt LPCTSTR pObjectName, + __inout CTransInPlaceFilter *pFilter, + __inout HRESULT *phr, + __in_opt LPCWSTR pName); + + + // --- CBaseOutputPin ------------ + + // negotiate the allocator and its buffer size/count + // Insists on using our own allocator. (Actually the one upstream of us). + // We don't override this - instead we just agree the default + // then let the upstream filter decide for itself on reconnect + // virtual HRESULT DecideAllocator(IMemInputPin * pPin, IMemAllocator ** pAlloc); + + // Provide a media type enumerator. Get it from upstream. + STDMETHODIMP EnumMediaTypes( __deref_out IEnumMediaTypes **ppEnum ); + + // Say whether media type is acceptable. + HRESULT CheckMediaType(const CMediaType* pmt); + + // This just saves the allocator being used on the output pin + // Also called by input pin's GetAllocator() + void SetAllocator(IMemAllocator * pAllocator); + + __out_opt IMemInputPin * ConnectedIMemInputPin() + { return m_pInputPin; } + + // Allow the filter to see what allocator we have + // N.B. This does NOT AddRef + __out IMemAllocator * PeekAllocator() const + { return m_pAllocator; } + + HRESULT CompleteConnect(IPin *pReceivePin); + +}; // CTransInPlaceOutputPin + + +class AM_NOVTABLE CTransInPlaceFilter : public CTransformFilter +{ + +public: + + // map getpin/getpincount for base enum of pins to owner + // override this to return more specialised pin objects + + virtual CBasePin *GetPin(int n); + +public: + + // Set bModifiesData == false if your derived filter does + // not modify the data samples (for instance it's just copying + // them somewhere else or looking at the timestamps). + + CTransInPlaceFilter(__in_opt LPCTSTR, __inout_opt LPUNKNOWN, REFCLSID clsid, __inout HRESULT *, + bool bModifiesData = true); +#ifdef UNICODE + CTransInPlaceFilter(__in_opt LPCSTR, __inout_opt LPUNKNOWN, REFCLSID clsid, __inout HRESULT *, + bool bModifiesData = true); +#endif + // The following are defined to avoid undefined pure virtuals. + // Even if they are never called, they will give linkage warnings/errors + + // We override EnumMediaTypes to bypass the transform class enumerator + // which would otherwise call this. + HRESULT GetMediaType(int iPosition, __inout CMediaType *pMediaType) + { DbgBreak("CTransInPlaceFilter::GetMediaType should never be called"); + return E_UNEXPECTED; + } + + // This is called when we actually have to provide our own allocator. + HRESULT DecideBufferSize(IMemAllocator*, __inout ALLOCATOR_PROPERTIES *); + + // The functions which call this in CTransform are overridden in this + // class to call CheckInputType with the assumption that the type + // does not change. In Debug builds some calls will be made and + // we just ensure that they do not assert. + HRESULT CheckTransform(const CMediaType *mtIn, const CMediaType *mtOut) + { + return S_OK; + }; + + + // ================================================================= + // ----- You may want to override this ----------------------------- + // ================================================================= + + HRESULT CompleteConnect(PIN_DIRECTION dir,IPin *pReceivePin); + + // chance to customize the transform process + virtual HRESULT Receive(IMediaSample *pSample); + + // ================================================================= + // ----- You MUST override these ----------------------------------- + // ================================================================= + + virtual HRESULT Transform(IMediaSample *pSample) PURE; + + // this goes in the factory template table to create new instances + // static CCOMObject * CreateInstance(LPUNKNOWN, HRESULT *); + + +#ifdef PERF + // Override to register performance measurement with a less generic string + // You should do this to avoid confusion with other filters + virtual void RegisterPerfId() + {m_idTransInPlace = MSR_REGISTER(TEXT("TransInPlace"));} +#endif // PERF + + +// implementation details + +protected: + + __out_opt IMediaSample * CTransInPlaceFilter::Copy(IMediaSample *pSource); + +#ifdef PERF + int m_idTransInPlace; // performance measuring id +#endif // PERF + bool m_bModifiesData; // Does this filter change the data? + + // these hold our input and output pins + + friend class CTransInPlaceInputPin; + friend class CTransInPlaceOutputPin; + + __out CTransInPlaceInputPin *InputPin() const + { + return (CTransInPlaceInputPin *)m_pInput; + }; + __out CTransInPlaceOutputPin *OutputPin() const + { + return (CTransInPlaceOutputPin *)m_pOutput; + }; + + // Helper to see if the input and output types match + BOOL TypesMatch() + { + return InputPin()->CurrentMediaType() == + OutputPin()->CurrentMediaType(); + } + + // Are the input and output allocators different? + BOOL UsingDifferentAllocators() const + { + return InputPin()->PeekAllocator() != OutputPin()->PeekAllocator(); + } +}; // CTransInPlaceFilter + +#endif /* __TRANSIP__ */ + diff --git a/third_party/BaseClasses/videoctl.cpp b/third_party/BaseClasses/videoctl.cpp new file mode 100644 index 00000000..b12ccbd3 --- /dev/null +++ b/third_party/BaseClasses/videoctl.cpp @@ -0,0 +1,746 @@ +//------------------------------------------------------------------------------ +// File: VideoCtl.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include "ddmm.h" + +// Load a string from the resource file string table. The buffer must be at +// least STR_MAX_LENGTH bytes. The easiest way to use this is to declare a +// buffer in the property page class and use it for all string loading. It +// cannot be static as multiple property pages may be active simultaneously + +LPTSTR WINAPI StringFromResource(__out_ecount(STR_MAX_LENGTH) LPTSTR pBuffer, int iResourceID) +{ + if (LoadString(g_hInst,iResourceID,pBuffer,STR_MAX_LENGTH) == 0) { + return TEXT(""); + } + return pBuffer; +} + +#ifdef UNICODE +LPSTR WINAPI StringFromResource(__out_ecount(STR_MAX_LENGTH) LPSTR pBuffer, int iResourceID) +{ + if (LoadStringA(g_hInst,iResourceID,pBuffer,STR_MAX_LENGTH) == 0) { + return ""; + } + return pBuffer; +} +#endif + + + +// Property pages typically are called through their OLE interfaces. These +// use UNICODE strings regardless of how the binary is built. So when we +// load strings from the resource file we sometimes want to convert them +// to UNICODE. This method is passed the target UNICODE buffer and does a +// convert after loading the string (if built UNICODE this is not needed) +// On WinNT we can explicitly call LoadStringW which saves two conversions + +#ifndef UNICODE + +LPWSTR WINAPI WideStringFromResource(__out_ecount(STR_MAX_LENGTH) LPWSTR pBuffer, int iResourceID) +{ + *pBuffer = 0; + + if (g_amPlatform == VER_PLATFORM_WIN32_NT) { + LoadStringW(g_hInst,iResourceID,pBuffer,STR_MAX_LENGTH); + } else { + + CHAR szBuffer[STR_MAX_LENGTH]; + DWORD dwStringLength = LoadString(g_hInst,iResourceID,szBuffer,STR_MAX_LENGTH); + // if we loaded a string convert it to wide characters, ensuring + // that we also null terminate the result. + if (dwStringLength++) { + MultiByteToWideChar(CP_ACP,0,szBuffer,dwStringLength,pBuffer,STR_MAX_LENGTH); + } + } + return pBuffer; +} + +#endif + + +// Helper function to calculate the size of the dialog + +BOOL WINAPI GetDialogSize(int iResourceID, + DLGPROC pDlgProc, + LPARAM lParam, + __out SIZE *pResult) +{ + RECT rc; + HWND hwnd; + + // Create a temporary property page + + hwnd = CreateDialogParam(g_hInst, + MAKEINTRESOURCE(iResourceID), + GetDesktopWindow(), + pDlgProc, + lParam); + if (hwnd == NULL) { + return FALSE; + } + + GetWindowRect(hwnd, &rc); + pResult->cx = rc.right - rc.left; + pResult->cy = rc.bottom - rc.top; + + DestroyWindow(hwnd); + return TRUE; +} + + +// Class that aggregates on the IDirectDraw interface. Although DirectDraw +// has the ability in its interfaces to be aggregated they're not currently +// implemented. This makes it difficult for various parts of Quartz that want +// to aggregate these interfaces. In particular the video renderer passes out +// media samples that expose IDirectDraw and IDirectDrawSurface. The filter +// graph manager also exposes IDirectDraw as a plug in distributor. For these +// objects we provide these aggregation classes that republish the interfaces + +STDMETHODIMP CAggDirectDraw::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + ASSERT(m_pDirectDraw); + + // Do we have this interface + + if (riid == IID_IDirectDraw) { + return GetInterface((IDirectDraw *)this,ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid,ppv); + } +} + + +STDMETHODIMP CAggDirectDraw::Compact() +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->Compact(); +} + + +STDMETHODIMP CAggDirectDraw::CreateClipper(DWORD dwFlags, __deref_out LPDIRECTDRAWCLIPPER *lplpDDClipper, __inout_opt IUnknown *pUnkOuter) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->CreateClipper(dwFlags,lplpDDClipper,pUnkOuter); +} + + +STDMETHODIMP CAggDirectDraw::CreatePalette(DWORD dwFlags, + __in LPPALETTEENTRY lpColorTable, + __deref_out LPDIRECTDRAWPALETTE *lplpDDPalette, + __inout_opt IUnknown *pUnkOuter) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->CreatePalette(dwFlags,lpColorTable,lplpDDPalette,pUnkOuter); +} + + +STDMETHODIMP CAggDirectDraw::CreateSurface(__in LPDDSURFACEDESC lpDDSurfaceDesc, + __deref_out LPDIRECTDRAWSURFACE *lplpDDSurface, + __inout_opt IUnknown *pUnkOuter) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->CreateSurface(lpDDSurfaceDesc,lplpDDSurface,pUnkOuter); +} + + +STDMETHODIMP CAggDirectDraw::DuplicateSurface(__in LPDIRECTDRAWSURFACE lpDDSurface, + __deref_out LPDIRECTDRAWSURFACE *lplpDupDDSurface) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->DuplicateSurface(lpDDSurface,lplpDupDDSurface); +} + + +STDMETHODIMP CAggDirectDraw::EnumDisplayModes(DWORD dwSurfaceDescCount, + __in LPDDSURFACEDESC lplpDDSurfaceDescList, + __in LPVOID lpContext, + __in LPDDENUMMODESCALLBACK lpEnumCallback) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->EnumDisplayModes(dwSurfaceDescCount,lplpDDSurfaceDescList,lpContext,lpEnumCallback); +} + + +STDMETHODIMP CAggDirectDraw::EnumSurfaces(DWORD dwFlags, + __in LPDDSURFACEDESC lpDDSD, + __in LPVOID lpContext, + __in LPDDENUMSURFACESCALLBACK lpEnumCallback) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->EnumSurfaces(dwFlags,lpDDSD,lpContext,lpEnumCallback); +} + + +STDMETHODIMP CAggDirectDraw::FlipToGDISurface() +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->FlipToGDISurface(); +} + + +STDMETHODIMP CAggDirectDraw::GetCaps(__out LPDDCAPS lpDDDriverCaps,__out LPDDCAPS lpDDHELCaps) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->GetCaps(lpDDDriverCaps,lpDDHELCaps); +} + + +STDMETHODIMP CAggDirectDraw::GetDisplayMode(__out LPDDSURFACEDESC lpDDSurfaceDesc) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->GetDisplayMode(lpDDSurfaceDesc); +} + + +STDMETHODIMP CAggDirectDraw::GetFourCCCodes(__inout LPDWORD lpNumCodes,__out_ecount(*lpNumCodes) LPDWORD lpCodes) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->GetFourCCCodes(lpNumCodes,lpCodes); +} + + +STDMETHODIMP CAggDirectDraw::GetGDISurface(__deref_out LPDIRECTDRAWSURFACE *lplpGDIDDSurface) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->GetGDISurface(lplpGDIDDSurface); +} + + +STDMETHODIMP CAggDirectDraw::GetMonitorFrequency(__out LPDWORD lpdwFrequency) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->GetMonitorFrequency(lpdwFrequency); +} + + +STDMETHODIMP CAggDirectDraw::GetScanLine(__out LPDWORD lpdwScanLine) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->GetScanLine(lpdwScanLine); +} + + +STDMETHODIMP CAggDirectDraw::GetVerticalBlankStatus(__out LPBOOL lpblsInVB) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->GetVerticalBlankStatus(lpblsInVB); +} + + +STDMETHODIMP CAggDirectDraw::Initialize(__in GUID *lpGUID) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->Initialize(lpGUID); +} + + +STDMETHODIMP CAggDirectDraw::RestoreDisplayMode() +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->RestoreDisplayMode(); +} + + +STDMETHODIMP CAggDirectDraw::SetCooperativeLevel(HWND hWnd,DWORD dwFlags) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->SetCooperativeLevel(hWnd,dwFlags); +} + + +STDMETHODIMP CAggDirectDraw::SetDisplayMode(DWORD dwWidth,DWORD dwHeight,DWORD dwBpp) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->SetDisplayMode(dwWidth,dwHeight,dwBpp); +} + + +STDMETHODIMP CAggDirectDraw::WaitForVerticalBlank(DWORD dwFlags,HANDLE hEvent) +{ + ASSERT(m_pDirectDraw); + return m_pDirectDraw->WaitForVerticalBlank(dwFlags,hEvent); +} + + +// Class that aggregates an IDirectDrawSurface interface. Although DirectDraw +// has the ability in its interfaces to be aggregated they're not currently +// implemented. This makes it difficult for various parts of Quartz that want +// to aggregate these interfaces. In particular the video renderer passes out +// media samples that expose IDirectDraw and IDirectDrawSurface. The filter +// graph manager also exposes IDirectDraw as a plug in distributor. For these +// objects we provide these aggregation classes that republish the interfaces + +STDMETHODIMP CAggDrawSurface::NonDelegatingQueryInterface(REFIID riid, __deref_out void **ppv) +{ + ASSERT(m_pDirectDrawSurface); + + // Do we have this interface + + if (riid == IID_IDirectDrawSurface) { + return GetInterface((IDirectDrawSurface *)this,ppv); + } else { + return CUnknown::NonDelegatingQueryInterface(riid,ppv); + } +} + + +STDMETHODIMP CAggDrawSurface::AddAttachedSurface(__in LPDIRECTDRAWSURFACE lpDDSAttachedSurface) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->AddAttachedSurface(lpDDSAttachedSurface); +} + + +STDMETHODIMP CAggDrawSurface::AddOverlayDirtyRect(__in LPRECT lpRect) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->AddOverlayDirtyRect(lpRect); +} + + +STDMETHODIMP CAggDrawSurface::Blt(__in LPRECT lpDestRect, + __in LPDIRECTDRAWSURFACE lpDDSrcSurface, + __in LPRECT lpSrcRect, + DWORD dwFlags, + __in LPDDBLTFX lpDDBltFx) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->Blt(lpDestRect,lpDDSrcSurface,lpSrcRect,dwFlags,lpDDBltFx); +} + + +STDMETHODIMP CAggDrawSurface::BltBatch(__in_ecount(dwCount) LPDDBLTBATCH lpDDBltBatch,DWORD dwCount,DWORD dwFlags) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->BltBatch(lpDDBltBatch,dwCount,dwFlags); +} + + +STDMETHODIMP CAggDrawSurface::BltFast(DWORD dwX,DWORD dwY, + __in LPDIRECTDRAWSURFACE lpDDSrcSurface, + __in LPRECT lpSrcRect, + DWORD dwTrans) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->BltFast(dwX,dwY,lpDDSrcSurface,lpSrcRect,dwTrans); +} + + +STDMETHODIMP CAggDrawSurface::DeleteAttachedSurface(DWORD dwFlags, + __in LPDIRECTDRAWSURFACE lpDDSAttachedSurface) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->DeleteAttachedSurface(dwFlags,lpDDSAttachedSurface); +} + + +STDMETHODIMP CAggDrawSurface::EnumAttachedSurfaces(__in LPVOID lpContext, + __in LPDDENUMSURFACESCALLBACK lpEnumSurfacesCallback) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->EnumAttachedSurfaces(lpContext,lpEnumSurfacesCallback); +} + + +STDMETHODIMP CAggDrawSurface::EnumOverlayZOrders(DWORD dwFlags, + __in LPVOID lpContext, + __in LPDDENUMSURFACESCALLBACK lpfnCallback) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->EnumOverlayZOrders(dwFlags,lpContext,lpfnCallback); +} + + +STDMETHODIMP CAggDrawSurface::Flip(__in LPDIRECTDRAWSURFACE lpDDSurfaceTargetOverride,DWORD dwFlags) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->Flip(lpDDSurfaceTargetOverride,dwFlags); +} + + +STDMETHODIMP CAggDrawSurface::GetAttachedSurface(__in LPDDSCAPS lpDDSCaps, + __deref_out LPDIRECTDRAWSURFACE *lplpDDAttachedSurface) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetAttachedSurface(lpDDSCaps,lplpDDAttachedSurface); +} + + +STDMETHODIMP CAggDrawSurface::GetBltStatus(DWORD dwFlags) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetBltStatus(dwFlags); +} + + +STDMETHODIMP CAggDrawSurface::GetCaps(__out LPDDSCAPS lpDDSCaps) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetCaps(lpDDSCaps); +} + + +STDMETHODIMP CAggDrawSurface::GetClipper(__deref_out LPDIRECTDRAWCLIPPER *lplpDDClipper) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetClipper(lplpDDClipper); +} + + +STDMETHODIMP CAggDrawSurface::GetColorKey(DWORD dwFlags,__out LPDDCOLORKEY lpDDColorKey) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetColorKey(dwFlags,lpDDColorKey); +} + + +STDMETHODIMP CAggDrawSurface::GetDC(__out HDC *lphDC) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetDC(lphDC); +} + + +STDMETHODIMP CAggDrawSurface::GetFlipStatus(DWORD dwFlags) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetFlipStatus(dwFlags); +} + + +STDMETHODIMP CAggDrawSurface::GetOverlayPosition(__out LPLONG lpdwX,__out LPLONG lpdwY) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetOverlayPosition(lpdwX,lpdwY); +} + + +STDMETHODIMP CAggDrawSurface::GetPalette(__deref_out LPDIRECTDRAWPALETTE *lplpDDPalette) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetPalette(lplpDDPalette); +} + + +STDMETHODIMP CAggDrawSurface::GetPixelFormat(__out LPDDPIXELFORMAT lpDDPixelFormat) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->GetPixelFormat(lpDDPixelFormat); +} + + +// A bit of a warning here: Our media samples in DirectShow aggregate on +// IDirectDraw and IDirectDrawSurface (ie are available through IMediaSample +// by QueryInterface). Unfortunately the underlying DirectDraw code cannot +// be aggregated so we have to use these classes. The snag is that when we +// call a different surface and pass in this interface as perhaps the source +// surface the call will fail because DirectDraw dereferences the pointer to +// get at its private data structures. Therefore we supply this workaround to give +// access to the real IDirectDraw surface. A filter can call GetSurfaceDesc +// and we will fill in the lpSurface pointer with the real underlying surface + +STDMETHODIMP CAggDrawSurface::GetSurfaceDesc(__out LPDDSURFACEDESC lpDDSurfaceDesc) +{ + ASSERT(m_pDirectDrawSurface); + + // First call down to the underlying DirectDraw + + HRESULT hr = m_pDirectDrawSurface->GetSurfaceDesc(lpDDSurfaceDesc); + if (FAILED(hr)) { + return hr; + } + + // Store the real DirectDrawSurface interface + lpDDSurfaceDesc->lpSurface = m_pDirectDrawSurface; + return hr; +} + + +STDMETHODIMP CAggDrawSurface::Initialize(__in LPDIRECTDRAW lpDD,__in LPDDSURFACEDESC lpDDSurfaceDesc) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->Initialize(lpDD,lpDDSurfaceDesc); +} + + +STDMETHODIMP CAggDrawSurface::IsLost() +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->IsLost(); +} + + +STDMETHODIMP CAggDrawSurface::Lock(__in LPRECT lpDestRect, + __inout LPDDSURFACEDESC lpDDSurfaceDesc, + DWORD dwFlags, + HANDLE hEvent) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->Lock(lpDestRect,lpDDSurfaceDesc,dwFlags,hEvent); +} + + +STDMETHODIMP CAggDrawSurface::ReleaseDC(HDC hDC) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->ReleaseDC(hDC); +} + + +STDMETHODIMP CAggDrawSurface::Restore() +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->Restore(); +} + + +STDMETHODIMP CAggDrawSurface::SetClipper(__in LPDIRECTDRAWCLIPPER lpDDClipper) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->SetClipper(lpDDClipper); +} + + +STDMETHODIMP CAggDrawSurface::SetColorKey(DWORD dwFlags,__in LPDDCOLORKEY lpDDColorKey) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->SetColorKey(dwFlags,lpDDColorKey); +} + + +STDMETHODIMP CAggDrawSurface::SetOverlayPosition(LONG dwX,LONG dwY) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->SetOverlayPosition(dwX,dwY); +} + + +STDMETHODIMP CAggDrawSurface::SetPalette(__in LPDIRECTDRAWPALETTE lpDDPalette) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->SetPalette(lpDDPalette); +} + + +STDMETHODIMP CAggDrawSurface::Unlock(__in LPVOID lpSurfaceData) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->Unlock(lpSurfaceData); +} + + +STDMETHODIMP CAggDrawSurface::UpdateOverlay(__in LPRECT lpSrcRect, + __in LPDIRECTDRAWSURFACE lpDDDestSurface, + __in LPRECT lpDestRect, + DWORD dwFlags, + __in LPDDOVERLAYFX lpDDOverlayFX) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->UpdateOverlay(lpSrcRect,lpDDDestSurface,lpDestRect,dwFlags,lpDDOverlayFX); +} + + +STDMETHODIMP CAggDrawSurface::UpdateOverlayDisplay(DWORD dwFlags) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->UpdateOverlayDisplay(dwFlags); +} + + +STDMETHODIMP CAggDrawSurface::UpdateOverlayZOrder(DWORD dwFlags,__in LPDIRECTDRAWSURFACE lpDDSReference) +{ + ASSERT(m_pDirectDrawSurface); + return m_pDirectDrawSurface->UpdateOverlayZOrder(dwFlags,lpDDSReference); +} + + +// DirectShow must work on multiple platforms. In particular, it also runs on +// Windows NT 3.51 which does not have DirectDraw capabilities. The filters +// cannot therefore link statically to the DirectDraw library. To make their +// lives that little bit easier we provide this class that manages loading +// and unloading the library and creating the initial IDirectDraw interface + +CLoadDirectDraw::CLoadDirectDraw() : + m_pDirectDraw(NULL), + m_hDirectDraw(NULL) +{ +} + + +// Destructor forces unload + +CLoadDirectDraw::~CLoadDirectDraw() +{ + ReleaseDirectDraw(); + + if (m_hDirectDraw) { + NOTE("Unloading library"); + FreeLibrary(m_hDirectDraw); + } +} + + +// We can't be sure that DirectDraw is always available so we can't statically +// link to the library. Therefore we load the library, get the function entry +// point addresses and call them to create the driver objects. We return S_OK +// if we manage to load DirectDraw correctly otherwise we return E_NOINTERFACE +// We initialise a DirectDraw instance by explicitely loading the library and +// calling GetProcAddress on the DirectDrawCreate entry point that it exports + +// On a multi monitor system, we can get the DirectDraw object for any +// monitor (device) with the optional szDevice parameter + +HRESULT CLoadDirectDraw::LoadDirectDraw(__in LPSTR szDevice) +{ + PDRAWCREATE pDrawCreate; + PDRAWENUM pDrawEnum; + LPDIRECTDRAWENUMERATEEXA pDrawEnumEx; + HRESULT hr = NOERROR; + + NOTE("Entering DoLoadDirectDraw"); + + // Is DirectDraw already loaded + + if (m_pDirectDraw) { + NOTE("Already loaded"); + ASSERT(m_hDirectDraw); + return NOERROR; + } + + // Make sure the library is available + + if(!m_hDirectDraw) + { + UINT ErrorMode = SetErrorMode(SEM_NOOPENFILEERRORBOX); + m_hDirectDraw = LoadLibrary(TEXT("DDRAW.DLL")); + SetErrorMode(ErrorMode); + + if (m_hDirectDraw == NULL) { + DbgLog((LOG_ERROR,1,TEXT("Can't load DDRAW.DLL"))); + NOTE("No library"); + return E_NOINTERFACE; + } + } + + // Get the DLL address for the creator function + + pDrawCreate = (PDRAWCREATE)GetProcAddress(m_hDirectDraw,"DirectDrawCreate"); + // force ANSI, we assume it + pDrawEnum = (PDRAWENUM)GetProcAddress(m_hDirectDraw,"DirectDrawEnumerateA"); + pDrawEnumEx = (LPDIRECTDRAWENUMERATEEXA)GetProcAddress(m_hDirectDraw, + "DirectDrawEnumerateExA"); + + // We don't NEED DirectDrawEnumerateEx, that's just for multimon stuff + if (pDrawCreate == NULL || pDrawEnum == NULL) { + DbgLog((LOG_ERROR,1,TEXT("Can't get functions: Create=%x Enum=%x"), + pDrawCreate, pDrawEnum)); + NOTE("No entry point"); + ReleaseDirectDraw(); + return E_NOINTERFACE; + } + + DbgLog((LOG_TRACE,3,TEXT("Creating DDraw for device %s"), + szDevice ? szDevice : "")); + + // Create a DirectDraw display provider for this device, using the fancy + // multimon-aware version, if it exists + if (pDrawEnumEx) + m_pDirectDraw = DirectDrawCreateFromDeviceEx(szDevice, pDrawCreate, + pDrawEnumEx); + else + m_pDirectDraw = DirectDrawCreateFromDevice(szDevice, pDrawCreate, + pDrawEnum); + + if (m_pDirectDraw == NULL) { + DbgLog((LOG_ERROR,1,TEXT("Can't create DDraw"))); + NOTE("No instance"); + ReleaseDirectDraw(); + return E_NOINTERFACE; + } + return NOERROR; +} + + +// Called to release any DirectDraw provider we previously loaded. We may be +// called at any time especially when something goes horribly wrong and when +// we need to clean up before returning so we can't guarantee that all state +// variables are consistent so free only those really allocated allocated +// This should only be called once all reference counts have been released + +void CLoadDirectDraw::ReleaseDirectDraw() +{ + NOTE("Releasing DirectDraw driver"); + + // Release any DirectDraw provider interface + + if (m_pDirectDraw) { + NOTE("Releasing instance"); + m_pDirectDraw->Release(); + m_pDirectDraw = NULL; + } + +} + + +// Return NOERROR (S_OK) if DirectDraw has been loaded by this object + +HRESULT CLoadDirectDraw::IsDirectDrawLoaded() +{ + NOTE("Entering IsDirectDrawLoaded"); + + if (m_pDirectDraw == NULL) { + NOTE("DirectDraw not loaded"); + return S_FALSE; + } + return NOERROR; +} + + +// Return the IDirectDraw interface we look after + +LPDIRECTDRAW CLoadDirectDraw::GetDirectDraw() +{ + NOTE("Entering GetDirectDraw"); + + if (m_pDirectDraw == NULL) { + NOTE("No DirectDraw"); + return NULL; + } + + NOTE("Returning DirectDraw"); + m_pDirectDraw->AddRef(); + return m_pDirectDraw; +} + + +// Are we running on Direct Draw version 1? We need to find out as +// we rely on specific bug fixes in DirectDraw 2 for fullscreen playback. To +// find out, we simply see if it supports IDirectDraw2. Only version 2 and +// higher support this. + +BOOL CLoadDirectDraw::IsDirectDrawVersion1() +{ + + if (m_pDirectDraw == NULL) + return FALSE; + + IDirectDraw2 *p = NULL; + HRESULT hr = m_pDirectDraw->QueryInterface(IID_IDirectDraw2, (void **)&p); + if (p) + p->Release(); + if (hr == NOERROR) { + DbgLog((LOG_TRACE,3,TEXT("Direct Draw Version 2 or greater"))); + return FALSE; + } else { + DbgLog((LOG_TRACE,3,TEXT("Direct Draw Version 1"))); + return TRUE; + } +} diff --git a/third_party/BaseClasses/videoctl.h b/third_party/BaseClasses/videoctl.h new file mode 100644 index 00000000..30c37783 --- /dev/null +++ b/third_party/BaseClasses/videoctl.h @@ -0,0 +1,168 @@ +//------------------------------------------------------------------------------ +// File: VideoCtl.h +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __VIDEOCTL__ +#define __VIDEOCTL__ + +// These help with property page implementations. The first can be used to +// load any string from a resource file. The buffer to load into is passed +// as an input parameter. The same buffer is the return value if the string +// was found otherwise it returns TEXT(""). The GetDialogSize is passed the +// resource ID of a dialog box and returns the size of it in screen pixels + +#define STR_MAX_LENGTH 256 +LPTSTR WINAPI StringFromResource(__out_ecount(STR_MAX_LENGTH) LPTSTR pBuffer, int iResourceID); + +#ifdef UNICODE +#define WideStringFromResource StringFromResource +LPSTR WINAPI StringFromResource(__out_ecount(STR_MAX_LENGTH) LPSTR pBuffer, int iResourceID); +#else +LPWSTR WINAPI WideStringFromResource(__out_ecount(STR_MAX_LENGTH) LPWSTR pBuffer, int iResourceID); +#endif + + +BOOL WINAPI GetDialogSize(int iResourceID, // Dialog box resource identifier + DLGPROC pDlgProc, // Pointer to dialog procedure + LPARAM lParam, // Any user data wanted in pDlgProc + __out SIZE *pResult);// Returns the size of dialog box + +// Class that aggregates an IDirectDraw interface + +class CAggDirectDraw : public IDirectDraw, public CUnknown +{ +protected: + + LPDIRECTDRAW m_pDirectDraw; + +public: + + DECLARE_IUNKNOWN + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid,__deref_out void **ppv); + + // Constructor and destructor + + CAggDirectDraw(__in_opt LPCTSTR pName,__inout_opt LPUNKNOWN pUnk) : + CUnknown(pName,pUnk), + m_pDirectDraw(NULL) { }; + + virtual CAggDirectDraw::~CAggDirectDraw() { }; + + // Set the object we should be aggregating + void SetDirectDraw(__inout LPDIRECTDRAW pDirectDraw) { + m_pDirectDraw = pDirectDraw; + } + + // IDirectDraw methods + + STDMETHODIMP Compact(); + STDMETHODIMP CreateClipper(DWORD dwFlags,__deref_out LPDIRECTDRAWCLIPPER *lplpDDClipper,__inout_opt IUnknown *pUnkOuter); + STDMETHODIMP CreatePalette(DWORD dwFlags,__in LPPALETTEENTRY lpColorTable,__deref_out LPDIRECTDRAWPALETTE *lplpDDPalette,__inout_opt IUnknown *pUnkOuter); + STDMETHODIMP CreateSurface(__in LPDDSURFACEDESC lpDDSurfaceDesc,__deref_out LPDIRECTDRAWSURFACE *lplpDDSurface,__inout_opt IUnknown *pUnkOuter); + STDMETHODIMP DuplicateSurface(__in LPDIRECTDRAWSURFACE lpDDSurface,__deref_out LPDIRECTDRAWSURFACE *lplpDupDDSurface); + STDMETHODIMP EnumDisplayModes(DWORD dwSurfaceDescCount,__in LPDDSURFACEDESC lplpDDSurfaceDescList,__in LPVOID lpContext,__in LPDDENUMMODESCALLBACK lpEnumCallback); + STDMETHODIMP EnumSurfaces(DWORD dwFlags,__in LPDDSURFACEDESC lpDDSD,__in LPVOID lpContext,__in LPDDENUMSURFACESCALLBACK lpEnumCallback); + STDMETHODIMP FlipToGDISurface(); + STDMETHODIMP GetCaps(__out LPDDCAPS lpDDDriverCaps,__out LPDDCAPS lpDDHELCaps); + STDMETHODIMP GetDisplayMode(__out LPDDSURFACEDESC lpDDSurfaceDesc); + STDMETHODIMP GetFourCCCodes(__inout LPDWORD lpNumCodes,__out_ecount(*lpNumCodes) LPDWORD lpCodes); + STDMETHODIMP GetGDISurface(__deref_out LPDIRECTDRAWSURFACE *lplpGDIDDSurface); + STDMETHODIMP GetMonitorFrequency(__out LPDWORD lpdwFrequency); + STDMETHODIMP GetScanLine(__out LPDWORD lpdwScanLine); + STDMETHODIMP GetVerticalBlankStatus(__out LPBOOL lpblsInVB); + STDMETHODIMP Initialize(__in GUID *lpGUID); + STDMETHODIMP RestoreDisplayMode(); + STDMETHODIMP SetCooperativeLevel(HWND hWnd,DWORD dwFlags); + STDMETHODIMP SetDisplayMode(DWORD dwWidth,DWORD dwHeight,DWORD dwBpp); + STDMETHODIMP WaitForVerticalBlank(DWORD dwFlags,HANDLE hEvent); +}; + + +// Class that aggregates an IDirectDrawSurface interface + +class CAggDrawSurface : public IDirectDrawSurface, public CUnknown +{ +protected: + + LPDIRECTDRAWSURFACE m_pDirectDrawSurface; + +public: + + DECLARE_IUNKNOWN + STDMETHODIMP NonDelegatingQueryInterface(REFIID riid,__deref_out void **ppv); + + // Constructor and destructor + + CAggDrawSurface(__in_opt LPCTSTR pName,__inout_opt LPUNKNOWN pUnk) : + CUnknown(pName,pUnk), + m_pDirectDrawSurface(NULL) { }; + + virtual ~CAggDrawSurface() { }; + + // Set the object we should be aggregating + void SetDirectDrawSurface(__inout LPDIRECTDRAWSURFACE pDirectDrawSurface) { + m_pDirectDrawSurface = pDirectDrawSurface; + } + + // IDirectDrawSurface methods + + STDMETHODIMP AddAttachedSurface(__in LPDIRECTDRAWSURFACE lpDDSAttachedSurface); + STDMETHODIMP AddOverlayDirtyRect(__in LPRECT lpRect); + STDMETHODIMP Blt(__in LPRECT lpDestRect,__in LPDIRECTDRAWSURFACE lpDDSrcSurface,__in LPRECT lpSrcRect,DWORD dwFlags,__in LPDDBLTFX lpDDBltFx); + STDMETHODIMP BltBatch(__in_ecount(dwCount) LPDDBLTBATCH lpDDBltBatch,DWORD dwCount,DWORD dwFlags); + STDMETHODIMP BltFast(DWORD dwX,DWORD dwY,__in LPDIRECTDRAWSURFACE lpDDSrcSurface,__in LPRECT lpSrcRect,DWORD dwTrans); + STDMETHODIMP DeleteAttachedSurface(DWORD dwFlags,__in LPDIRECTDRAWSURFACE lpDDSAttachedSurface); + STDMETHODIMP EnumAttachedSurfaces(__in LPVOID lpContext,__in LPDDENUMSURFACESCALLBACK lpEnumSurfacesCallback); + STDMETHODIMP EnumOverlayZOrders(DWORD dwFlags,__in LPVOID lpContext,__in LPDDENUMSURFACESCALLBACK lpfnCallback); + STDMETHODIMP Flip(__in LPDIRECTDRAWSURFACE lpDDSurfaceTargetOverride,DWORD dwFlags); + STDMETHODIMP GetAttachedSurface(__in LPDDSCAPS lpDDSCaps,__deref_out LPDIRECTDRAWSURFACE *lplpDDAttachedSurface); + STDMETHODIMP GetBltStatus(DWORD dwFlags); + STDMETHODIMP GetCaps(__out LPDDSCAPS lpDDSCaps); + STDMETHODIMP GetClipper(__deref_out LPDIRECTDRAWCLIPPER *lplpDDClipper); + STDMETHODIMP GetColorKey(DWORD dwFlags,__out LPDDCOLORKEY lpDDColorKey); + STDMETHODIMP GetDC(__out HDC *lphDC); + STDMETHODIMP GetFlipStatus(DWORD dwFlags); + STDMETHODIMP GetOverlayPosition(__out LPLONG lpdwX,__out LPLONG lpdwY); + STDMETHODIMP GetPalette(__deref_out LPDIRECTDRAWPALETTE *lplpDDPalette); + STDMETHODIMP GetPixelFormat(__out LPDDPIXELFORMAT lpDDPixelFormat); + STDMETHODIMP GetSurfaceDesc(__out LPDDSURFACEDESC lpDDSurfaceDesc); + STDMETHODIMP Initialize(__in LPDIRECTDRAW lpDD,__in LPDDSURFACEDESC lpDDSurfaceDesc); + STDMETHODIMP IsLost(); + STDMETHODIMP Lock(__in LPRECT lpDestRect,__inout LPDDSURFACEDESC lpDDSurfaceDesc,DWORD dwFlags,HANDLE hEvent); + STDMETHODIMP ReleaseDC(HDC hDC); + STDMETHODIMP Restore(); + STDMETHODIMP SetClipper(__in LPDIRECTDRAWCLIPPER lpDDClipper); + STDMETHODIMP SetColorKey(DWORD dwFlags,__in LPDDCOLORKEY lpDDColorKey); + STDMETHODIMP SetOverlayPosition(LONG dwX,LONG dwY); + STDMETHODIMP SetPalette(__in LPDIRECTDRAWPALETTE lpDDPalette); + STDMETHODIMP Unlock(__in LPVOID lpSurfaceData); + STDMETHODIMP UpdateOverlay(__in LPRECT lpSrcRect,__in LPDIRECTDRAWSURFACE lpDDDestSurface,__in LPRECT lpDestRect,DWORD dwFlags,__in LPDDOVERLAYFX lpDDOverlayFX); + STDMETHODIMP UpdateOverlayDisplay(DWORD dwFlags); + STDMETHODIMP UpdateOverlayZOrder(DWORD dwFlags,__in LPDIRECTDRAWSURFACE lpDDSReference); +}; + + +class CLoadDirectDraw +{ + LPDIRECTDRAW m_pDirectDraw; // The DirectDraw driver instance + HINSTANCE m_hDirectDraw; // Handle to the loaded library + +public: + + CLoadDirectDraw(); + ~CLoadDirectDraw(); + + HRESULT LoadDirectDraw(__in LPSTR szDevice); + void ReleaseDirectDraw(); + HRESULT IsDirectDrawLoaded(); + LPDIRECTDRAW GetDirectDraw(); + BOOL IsDirectDrawVersion1(); +}; + +#endif // __VIDEOCTL__ + diff --git a/third_party/BaseClasses/vtrans.cpp b/third_party/BaseClasses/vtrans.cpp new file mode 100644 index 00000000..cb4fa998 --- /dev/null +++ b/third_party/BaseClasses/vtrans.cpp @@ -0,0 +1,468 @@ +//------------------------------------------------------------------------------ +// File: Vtrans.cpp +// +// Desc: DirectShow base classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include +// #include // now in precomp file streams.h + +CVideoTransformFilter::CVideoTransformFilter + ( __in_opt LPCTSTR pName, __inout_opt LPUNKNOWN pUnk, REFCLSID clsid) + : CTransformFilter(pName, pUnk, clsid) + , m_itrLate(0) + , m_nKeyFramePeriod(0) // No QM until we see at least 2 key frames + , m_nFramesSinceKeyFrame(0) + , m_bSkipping(FALSE) + , m_tDecodeStart(0) + , m_itrAvgDecode(300000) // 30mSec - probably allows skipping + , m_bQualityChanged(FALSE) +{ +#ifdef PERF + RegisterPerfId(); +#endif // PERF +} + + +CVideoTransformFilter::~CVideoTransformFilter() +{ + // nothing to do +} + + +// Reset our quality management state + +HRESULT CVideoTransformFilter::StartStreaming() +{ + m_itrLate = 0; + m_nKeyFramePeriod = 0; // No QM until we see at least 2 key frames + m_nFramesSinceKeyFrame = 0; + m_bSkipping = FALSE; + m_tDecodeStart = 0; + m_itrAvgDecode = 300000; // 30mSec - probably allows skipping + m_bQualityChanged = FALSE; + m_bSampleSkipped = FALSE; + return NOERROR; +} + + +// Overriden to reset quality management information + +HRESULT CVideoTransformFilter::EndFlush() +{ + { + // Synchronize + CAutoLock lck(&m_csReceive); + + // Reset our stats + // + // Note - we don't want to call derived classes here, + // we only want to reset our internal variables and this + // is a convenient way to do it + CVideoTransformFilter::StartStreaming(); + } + return CTransformFilter::EndFlush(); +} + + +HRESULT CVideoTransformFilter::AbortPlayback(HRESULT hr) +{ + NotifyEvent(EC_ERRORABORT, hr, 0); + m_pOutput->DeliverEndOfStream(); + return hr; +} + + +// Receive() +// +// Accept a sample from upstream, decide whether to process it +// or drop it. If we process it then get a buffer from the +// allocator of the downstream connection, transform it into the +// new buffer and deliver it to the downstream filter. +// If we decide not to process it then we do not get a buffer. + +// Remember that although this code will notice format changes coming into +// the input pin, it will NOT change its output format if that results +// in the filter needing to make a corresponding output format change. Your +// derived filter will have to take care of that. (eg. a palette change if +// the input and output is an 8 bit format). If the input sample is discarded +// and nothing is sent out for this Receive, please remember to put the format +// change on the first output sample that you actually do send. +// If your filter will produce the same output type even when the input type +// changes, then this base class code will do everything you need. + +HRESULT CVideoTransformFilter::Receive(IMediaSample *pSample) +{ + // If the next filter downstream is the video renderer, then it may + // be able to operate in DirectDraw mode which saves copying the data + // and gives higher performance. In that case the buffer which we + // get from GetDeliveryBuffer will be a DirectDraw buffer, and + // drawing into this buffer draws directly onto the display surface. + // This means that any waiting for the correct time to draw occurs + // during GetDeliveryBuffer, and that once the buffer is given to us + // the video renderer will count it in its statistics as a frame drawn. + // This means that any decision to drop the frame must be taken before + // calling GetDeliveryBuffer. + + ASSERT(CritCheckIn(&m_csReceive)); + AM_MEDIA_TYPE *pmtOut, *pmt; +#ifdef DEBUG + FOURCCMap fccOut; +#endif + HRESULT hr; + ASSERT(pSample); + IMediaSample * pOutSample; + + // If no output pin to deliver to then no point sending us data + ASSERT (m_pOutput != NULL) ; + + // The source filter may dynamically ask us to start transforming from a + // different media type than the one we're using now. If we don't, we'll + // draw garbage. (typically, this is a palette change in the movie, + // but could be something more sinister like the compression type changing, + // or even the video size changing) + +#define rcS1 ((VIDEOINFOHEADER *)(pmt->pbFormat))->rcSource +#define rcT1 ((VIDEOINFOHEADER *)(pmt->pbFormat))->rcTarget + + pSample->GetMediaType(&pmt); + if (pmt != NULL && pmt->pbFormat != NULL) { + + // spew some debug output + ASSERT(!IsEqualGUID(pmt->majortype, GUID_NULL)); +#ifdef DEBUG + fccOut.SetFOURCC(&pmt->subtype); + LONG lCompression = HEADER(pmt->pbFormat)->biCompression; + LONG lBitCount = HEADER(pmt->pbFormat)->biBitCount; + LONG lStride = (HEADER(pmt->pbFormat)->biWidth * lBitCount + 7) / 8; + lStride = (lStride + 3) & ~3; + DbgLog((LOG_TRACE,3,TEXT("*Changing input type on the fly to"))); + DbgLog((LOG_TRACE,3,TEXT("FourCC: %lx Compression: %lx BitCount: %ld"), + fccOut.GetFOURCC(), lCompression, lBitCount)); + DbgLog((LOG_TRACE,3,TEXT("biHeight: %ld rcDst: (%ld, %ld, %ld, %ld)"), + HEADER(pmt->pbFormat)->biHeight, + rcT1.left, rcT1.top, rcT1.right, rcT1.bottom)); + DbgLog((LOG_TRACE,3,TEXT("rcSrc: (%ld, %ld, %ld, %ld) Stride: %ld"), + rcS1.left, rcS1.top, rcS1.right, rcS1.bottom, + lStride)); +#endif + + // now switch to using the new format. I am assuming that the + // derived filter will do the right thing when its media type is + // switched and streaming is restarted. + + StopStreaming(); + m_pInput->CurrentMediaType() = *pmt; + DeleteMediaType(pmt); + // if this fails, playback will stop, so signal an error + hr = StartStreaming(); + if (FAILED(hr)) { + return AbortPlayback(hr); + } + } + + // Now that we have noticed any format changes on the input sample, it's + // OK to discard it. + + if (ShouldSkipFrame(pSample)) { + MSR_NOTE(m_idSkip); + m_bSampleSkipped = TRUE; + return NOERROR; + } + + // Set up the output sample + hr = InitializeOutputSample(pSample, &pOutSample); + + if (FAILED(hr)) { + return hr; + } + + m_bSampleSkipped = FALSE; + + // The renderer may ask us to on-the-fly to start transforming to a + // different format. If we don't obey it, we'll draw garbage + +#define rcS ((VIDEOINFOHEADER *)(pmtOut->pbFormat))->rcSource +#define rcT ((VIDEOINFOHEADER *)(pmtOut->pbFormat))->rcTarget + + pOutSample->GetMediaType(&pmtOut); + if (pmtOut != NULL && pmtOut->pbFormat != NULL) { + + // spew some debug output + ASSERT(!IsEqualGUID(pmtOut->majortype, GUID_NULL)); +#ifdef DEBUG + fccOut.SetFOURCC(&pmtOut->subtype); + LONG lCompression = HEADER(pmtOut->pbFormat)->biCompression; + LONG lBitCount = HEADER(pmtOut->pbFormat)->biBitCount; + LONG lStride = (HEADER(pmtOut->pbFormat)->biWidth * lBitCount + 7) / 8; + lStride = (lStride + 3) & ~3; + DbgLog((LOG_TRACE,3,TEXT("*Changing output type on the fly to"))); + DbgLog((LOG_TRACE,3,TEXT("FourCC: %lx Compression: %lx BitCount: %ld"), + fccOut.GetFOURCC(), lCompression, lBitCount)); + DbgLog((LOG_TRACE,3,TEXT("biHeight: %ld rcDst: (%ld, %ld, %ld, %ld)"), + HEADER(pmtOut->pbFormat)->biHeight, + rcT.left, rcT.top, rcT.right, rcT.bottom)); + DbgLog((LOG_TRACE,3,TEXT("rcSrc: (%ld, %ld, %ld, %ld) Stride: %ld"), + rcS.left, rcS.top, rcS.right, rcS.bottom, + lStride)); +#endif + + // now switch to using the new format. I am assuming that the + // derived filter will do the right thing when its media type is + // switched and streaming is restarted. + + StopStreaming(); + m_pOutput->CurrentMediaType() = *pmtOut; + DeleteMediaType(pmtOut); + hr = StartStreaming(); + + if (SUCCEEDED(hr)) { + // a new format, means a new empty buffer, so wait for a keyframe + // before passing anything on to the renderer. + // !!! a keyframe may never come, so give up after 30 frames + DbgLog((LOG_TRACE,3,TEXT("Output format change means we must wait for a keyframe"))); + m_nWaitForKey = 30; + + // if this fails, playback will stop, so signal an error + } else { + + // Must release the sample before calling AbortPlayback + // because we might be holding the win16 lock or + // ddraw lock + pOutSample->Release(); + AbortPlayback(hr); + return hr; + } + } + + // After a discontinuity, we need to wait for the next key frame + if (pSample->IsDiscontinuity() == S_OK) { + DbgLog((LOG_TRACE,3,TEXT("Non-key discontinuity - wait for keyframe"))); + m_nWaitForKey = 30; + } + + // Start timing the transform (and log it if PERF is defined) + + if (SUCCEEDED(hr)) { + m_tDecodeStart = timeGetTime(); + MSR_START(m_idTransform); + + // have the derived class transform the data + hr = Transform(pSample, pOutSample); + + // Stop the clock (and log it if PERF is defined) + MSR_STOP(m_idTransform); + m_tDecodeStart = timeGetTime()-m_tDecodeStart; + m_itrAvgDecode = m_tDecodeStart*(10000/16) + 15*(m_itrAvgDecode/16); + + // Maybe we're waiting for a keyframe still? + if (m_nWaitForKey) + m_nWaitForKey--; + if (m_nWaitForKey && pSample->IsSyncPoint() == S_OK) + m_nWaitForKey = FALSE; + + // if so, then we don't want to pass this on to the renderer + if (m_nWaitForKey && hr == NOERROR) { + DbgLog((LOG_TRACE,3,TEXT("still waiting for a keyframe"))); + hr = S_FALSE; + } + } + + if (FAILED(hr)) { + DbgLog((LOG_TRACE,1,TEXT("Error from video transform"))); + } else { + // the Transform() function can return S_FALSE to indicate that the + // sample should not be delivered; we only deliver the sample if it's + // really S_OK (same as NOERROR, of course.) + // Try not to return S_FALSE to a direct draw buffer (it's wasteful) + // Try to take the decision earlier - before you get it. + + if (hr == NOERROR) { + hr = m_pOutput->Deliver(pOutSample); + } else { + // S_FALSE returned from Transform is a PRIVATE agreement + // We should return NOERROR from Receive() in this case because returning S_FALSE + // from Receive() means that this is the end of the stream and no more data should + // be sent. + if (S_FALSE == hr) { + + // We must Release() the sample before doing anything + // like calling the filter graph because having the + // sample means we may have the DirectDraw lock + // (== win16 lock on some versions) + pOutSample->Release(); + m_bSampleSkipped = TRUE; + if (!m_bQualityChanged) { + m_bQualityChanged = TRUE; + NotifyEvent(EC_QUALITY_CHANGE,0,0); + } + return NOERROR; + } + } + } + + // release the output buffer. If the connected pin still needs it, + // it will have addrefed it itself. + pOutSample->Release(); + ASSERT(CritCheckIn(&m_csReceive)); + + return hr; +} + + + +BOOL CVideoTransformFilter::ShouldSkipFrame( IMediaSample * pIn) +{ + REFERENCE_TIME trStart, trStopAt; + HRESULT hr = pIn->GetTime(&trStart, &trStopAt); + + // Don't skip frames with no timestamps + if (hr != S_OK) + return FALSE; + + int itrFrame = (int)(trStopAt - trStart); // frame duration + + if(S_OK==pIn->IsSyncPoint()) { + MSR_INTEGER(m_idFrameType, 1); + if ( m_nKeyFramePeriod < m_nFramesSinceKeyFrame ) { + // record the max + m_nKeyFramePeriod = m_nFramesSinceKeyFrame; + } + m_nFramesSinceKeyFrame = 0; + m_bSkipping = FALSE; + } else { + MSR_INTEGER(m_idFrameType, 2); + if ( m_nFramesSinceKeyFrame>m_nKeyFramePeriod + && m_nKeyFramePeriod>0 + ) { + // We haven't seen the key frame yet, but we were clearly being + // overoptimistic about how frequent they are. + m_nKeyFramePeriod = m_nFramesSinceKeyFrame; + } + } + + + // Whatever we might otherwise decide, + // if we are taking only a small fraction of the required frame time to decode + // then any quality problems are actually coming from somewhere else. + // Could be a net problem at the source for instance. In this case there's + // no point in us skipping frames here. + if (m_itrAvgDecode*4>itrFrame) { + + // Don't skip unless we are at least a whole frame late. + // (We would skip B frames if more than 1/2 frame late, but they're safe). + if ( m_itrLate > itrFrame ) { + + // Don't skip unless the anticipated key frame would be no more than + // 1 frame early. If the renderer has not been waiting (we *guess* + // it hasn't because we're late) then it will allow frames to be + // played early by up to a frame. + + // Let T = Stream time from now to anticipated next key frame + // = (frame duration) * (KeyFramePeriod - FramesSinceKeyFrame) + // So we skip if T - Late < one frame i.e. + // (duration) * (freq - FramesSince) - Late < duration + // or (duration) * (freq - FramesSince - 1) < Late + + // We don't dare skip until we have seen some key frames and have + // some idea how often they occur and they are reasonably frequent. + if (m_nKeyFramePeriod>0) { + // It would be crazy - but we could have a stream with key frames + // a very long way apart - and if they are further than about + // 3.5 minutes apart then we could get arithmetic overflow in + // reference time units. Therefore we switch to mSec at this point + int it = (itrFrame/10000) + * (m_nKeyFramePeriod-m_nFramesSinceKeyFrame - 1); + MSR_INTEGER(m_idTimeTillKey, it); + + // For debug - might want to see the details - dump them as scratch pad +#ifdef VTRANSPERF + MSR_INTEGER(0, itrFrame); + MSR_INTEGER(0, m_nFramesSinceKeyFrame); + MSR_INTEGER(0, m_nKeyFramePeriod); +#endif + if (m_itrLate/10000 > it) { + m_bSkipping = TRUE; + // Now we are committed. Once we start skipping, we + // cannot stop until we hit a key frame. + } else { +#ifdef VTRANSPERF + MSR_INTEGER(0, 777770); // not near enough to next key +#endif + } + } else { +#ifdef VTRANSPERF + MSR_INTEGER(0, 777771); // Next key not predictable +#endif + } + } else { +#ifdef VTRANSPERF + MSR_INTEGER(0, 777772); // Less than one frame late + MSR_INTEGER(0, m_itrLate); + MSR_INTEGER(0, itrFrame); +#endif + } + } else { +#ifdef VTRANSPERF + MSR_INTEGER(0, 777773); // Decode time short - not not worth skipping + MSR_INTEGER(0, m_itrAvgDecode); + MSR_INTEGER(0, itrFrame); +#endif + } + + ++m_nFramesSinceKeyFrame; + + if (m_bSkipping) { + // We will count down the lateness as we skip each frame. + // We re-assess each frame. The key frame might not arrive when expected. + // We reset m_itrLate if we get a new Quality message, but actually that's + // not likely because we're not sending frames on to the Renderer. In + // fact if we DID get another one it would mean that there's a long + // pipe between us and the renderer and we might need an altogether + // better strategy to avoid hunting! + m_itrLate = m_itrLate - itrFrame; + } + + MSR_INTEGER(m_idLate, (int)m_itrLate/10000 ); // Note how late we think we are + if (m_bSkipping) { + if (!m_bQualityChanged) { + m_bQualityChanged = TRUE; + NotifyEvent(EC_QUALITY_CHANGE,0,0); + } + } + return m_bSkipping; +} + + +HRESULT CVideoTransformFilter::AlterQuality(Quality q) +{ + // to reduce the amount of 64 bit arithmetic, m_itrLate is an int. + // +, -, >, == etc are not too bad, but * and / are painful. + if (m_itrLate>300000000) { + // Avoid overflow and silliness - more than 30 secs late is already silly + m_itrLate = 300000000; + } else { + m_itrLate = (int)q.Late; + } + // We ignore the other fields + + // We're actually not very good at handling this. In non-direct draw mode + // most of the time can be spent in the renderer which can skip any frame. + // In that case we'd rather the renderer handled things. + // Nevertheless we will keep an eye on it and if we really start getting + // a very long way behind then we will actually skip - but we'll still tell + // the renderer (or whoever is downstream) that they should handle quality. + + return E_FAIL; // Tell the renderer to do his thing. + +} + + + +// This will avoid several hundred useless warnings if compiled -W4 by MS VC++ v4 +#pragma warning(disable:4514) + diff --git a/third_party/BaseClasses/vtrans.h b/third_party/BaseClasses/vtrans.h new file mode 100644 index 00000000..49b1509b --- /dev/null +++ b/third_party/BaseClasses/vtrans.h @@ -0,0 +1,143 @@ +//------------------------------------------------------------------------------ +// File: VTrans.h +// +// Desc: DirectShow base classes - defines a video transform class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// This class is derived from CTransformFilter, but is specialised to handle +// the requirements of video quality control by frame dropping. +// This is a non-in-place transform, (i.e. it copies the data) such as a decoder. + +class CVideoTransformFilter : public CTransformFilter +{ + public: + + CVideoTransformFilter(__in_opt LPCTSTR, __inout_opt LPUNKNOWN, REFCLSID clsid); + ~CVideoTransformFilter(); + HRESULT EndFlush(); + + // ================================================================= + // ----- override these bits --------------------------------------- + // ================================================================= + // The following methods are in CTransformFilter which is inherited. + // They are mentioned here for completeness + // + // These MUST be supplied in a derived class + // + // NOTE: + // virtual HRESULT Transform(IMediaSample * pIn, IMediaSample *pOut); + // virtual HRESULT CheckInputType(const CMediaType* mtIn) PURE; + // virtual HRESULT CheckTransform + // (const CMediaType* mtIn, const CMediaType* mtOut) PURE; + // static CCOMObject * CreateInstance(LPUNKNOWN, HRESULT *); + // virtual HRESULT DecideBufferSize + // (IMemAllocator * pAllocator, ALLOCATOR_PROPERTIES *pprop) PURE; + // virtual HRESULT GetMediaType(int iPosition, CMediaType *pMediaType) PURE; + // + // These MAY also be overridden + // + // virtual HRESULT StopStreaming(); + // virtual HRESULT SetMediaType(PIN_DIRECTION direction,const CMediaType *pmt); + // virtual HRESULT CheckConnect(PIN_DIRECTION dir,IPin *pPin); + // virtual HRESULT BreakConnect(PIN_DIRECTION dir); + // virtual HRESULT CompleteConnect(PIN_DIRECTION direction,IPin *pReceivePin); + // virtual HRESULT EndOfStream(void); + // virtual HRESULT BeginFlush(void); + // virtual HRESULT EndFlush(void); + // virtual HRESULT NewSegment + // (REFERENCE_TIME tStart,REFERENCE_TIME tStop,double dRate); +#ifdef PERF + + // If you override this - ensure that you register all these ids + // as well as any of your own, + virtual void RegisterPerfId() { + m_idSkip = MSR_REGISTER(TEXT("Video Transform Skip frame")); + m_idFrameType = MSR_REGISTER(TEXT("Video transform frame type")); + m_idLate = MSR_REGISTER(TEXT("Video Transform Lateness")); + m_idTimeTillKey = MSR_REGISTER(TEXT("Video Transform Estd. time to next key")); + CTransformFilter::RegisterPerfId(); + } +#endif + + protected: + + // =========== QUALITY MANAGEMENT IMPLEMENTATION ======================== + // Frames are assumed to come in three types: + // Type 1: an AVI key frame or an MPEG I frame. + // This frame can be decoded with no history. + // Dropping this frame means that no further frame can be decoded + // until the next type 1 frame. + // Type 1 frames are sync points. + // Type 2: an AVI non-key frame or an MPEG P frame. + // This frame cannot be decoded unless the previous type 1 frame was + // decoded and all type 2 frames since have been decoded. + // Dropping this frame means that no further frame can be decoded + // until the next type 1 frame. + // Type 3: An MPEG B frame. + // This frame cannot be decoded unless the previous type 1 or 2 frame + // has been decoded AND the subsequent type 1 or 2 frame has also + // been decoded. (This requires decoding the frames out of sequence). + // Dropping this frame affects no other frames. This implementation + // does not allow for these. All non-sync-point frames are treated + // as being type 2. + // + // The spacing of frames of type 1 in a file is not guaranteed. There MUST + // be a type 1 frame at (well, near) the start of the file in order to start + // decoding at all. After that there could be one every half second or so, + // there could be one at the start of each scene (aka "cut", "shot") or + // there could be no more at all. + // If there is only a single type 1 frame then NO FRAMES CAN BE DROPPED + // without losing all the rest of the movie. There is no way to tell whether + // this is the case, so we find that we are in the gambling business. + // To try to improve the odds, we record the greatest interval between type 1s + // that we have seen and we bet on things being no worse than this in the + // future. + + // You can tell if it's a type 1 frame by calling IsSyncPoint(). + // there is no architected way to test for a type 3, so you should override + // the quality management here if you have B-frames. + + int m_nKeyFramePeriod; // the largest observed interval between type 1 frames + // 1 means every frame is type 1, 2 means every other. + + int m_nFramesSinceKeyFrame; // Used to count frames since the last type 1. + // becomes the new m_nKeyFramePeriod if greater. + + BOOL m_bSkipping; // we are skipping to the next type 1 frame + +#ifdef PERF + int m_idFrameType; // MSR id Frame type. 1=Key, 2="non-key" + int m_idSkip; // MSR id skipping + int m_idLate; // MSR id lateness + int m_idTimeTillKey; // MSR id for guessed time till next key frame. +#endif + + virtual HRESULT StartStreaming(); + + HRESULT AbortPlayback(HRESULT hr); // if something bad happens + + HRESULT Receive(IMediaSample *pSample); + + HRESULT AlterQuality(Quality q); + + BOOL ShouldSkipFrame(IMediaSample * pIn); + + int m_itrLate; // lateness from last Quality message + // (this overflows at 214 secs late). + int m_tDecodeStart; // timeGetTime when decode started. + int m_itrAvgDecode; // Average decode time in reference units. + + BOOL m_bNoSkip; // debug - no skipping. + + // We send an EC_QUALITY_CHANGE notification to the app if we have to degrade. + // We send one when we start degrading, not one for every frame, this means + // we track whether we've sent one yet. + BOOL m_bQualityChanged; + + // When non-zero, don't pass anything to renderer until next keyframe + // If there are few keys, give up and eventually draw something + int m_nWaitForKey; +}; diff --git a/third_party/BaseClasses/winctrl.cpp b/third_party/BaseClasses/winctrl.cpp new file mode 100644 index 00000000..4d1f52e3 --- /dev/null +++ b/third_party/BaseClasses/winctrl.cpp @@ -0,0 +1,2081 @@ +//------------------------------------------------------------------------------ +// File: WinCtrl.cpp +// +// Desc: DirectShow base classes - implements video control interface class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include +#include + +// The control interface methods require us to be connected + +#define CheckConnected(pin,code) \ +{ \ + if (pin == NULL) { \ + ASSERT(!TEXT("Pin not set")); \ + } else if (pin->IsConnected() == FALSE) { \ + return (code); \ + } \ +} + +// This checks to see whether the window has a drain. An application can in +// most environments set the owner/parent of windows so that they appear in +// a compound document context (for example). In this case, the application +// would probably like to be told of any keyboard/mouse messages. Therefore +// we pass these messages on untranslated, returning TRUE if we're successful + +BOOL WINAPI PossiblyEatMessage(HWND hwndDrain, UINT uMsg, WPARAM wParam, LPARAM lParam) +{ + if (hwndDrain != NULL && !InSendMessage()) + { + switch (uMsg) + { + case WM_CHAR: + case WM_DEADCHAR: + case WM_KEYDOWN: + case WM_KEYUP: + case WM_LBUTTONDBLCLK: + case WM_LBUTTONDOWN: + case WM_LBUTTONUP: + case WM_MBUTTONDBLCLK: + case WM_MBUTTONDOWN: + case WM_MBUTTONUP: + case WM_MOUSEACTIVATE: + case WM_MOUSEMOVE: + // If we pass this on we don't get any mouse clicks + //case WM_NCHITTEST: + case WM_NCLBUTTONDBLCLK: + case WM_NCLBUTTONDOWN: + case WM_NCLBUTTONUP: + case WM_NCMBUTTONDBLCLK: + case WM_NCMBUTTONDOWN: + case WM_NCMBUTTONUP: + case WM_NCMOUSEMOVE: + case WM_NCRBUTTONDBLCLK: + case WM_NCRBUTTONDOWN: + case WM_NCRBUTTONUP: + case WM_RBUTTONDBLCLK: + case WM_RBUTTONDOWN: + case WM_RBUTTONUP: + case WM_SYSCHAR: + case WM_SYSDEADCHAR: + case WM_SYSKEYDOWN: + case WM_SYSKEYUP: + + DbgLog((LOG_TRACE, 2, TEXT("Forwarding %x to drain"))); + PostMessage(hwndDrain, uMsg, wParam, lParam); + + return TRUE; + } + } + return FALSE; +} + + +// This class implements the IVideoWindow control functions (dual interface) +// we support a large number of properties and methods designed to allow the +// client (whether it be an automation controller or a C/C++ application) to +// set and get a number of window related properties such as it's position. +// We also support some methods that duplicate the properties but provide a +// more direct and efficient mechanism as many values may be changed in one + +CBaseControlWindow::CBaseControlWindow( + __inout CBaseFilter *pFilter, // Owning filter + __in CCritSec *pInterfaceLock, // Locking object + __in_opt LPCTSTR pName, // Object description + __inout_opt LPUNKNOWN pUnk, // Normal COM ownership + __inout HRESULT *phr) : // OLE return code + + CBaseVideoWindow(pName,pUnk), + m_pInterfaceLock(pInterfaceLock), + m_hwndOwner(NULL), + m_hwndDrain(NULL), + m_bAutoShow(TRUE), + m_pFilter(pFilter), + m_bCursorHidden(FALSE), + m_pPin(NULL) +{ + ASSERT(m_pFilter); + ASSERT(m_pInterfaceLock); + ASSERT(phr); + m_BorderColour = VIDEO_COLOUR; +} + + +// Set the title caption on the base window, we don't do any field checking +// as we really don't care what title they intend to have. We can always get +// it back again later with GetWindowText. The only other complication is to +// do the necessary string conversions between ANSI and OLE Unicode strings + +STDMETHODIMP CBaseControlWindow::put_Caption(__in BSTR strCaption) +{ + CheckPointer((PVOID)strCaption,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); +#ifdef UNICODE + SetWindowText(m_hwnd, strCaption); +#else + CHAR Caption[CAPTION]; + + WideCharToMultiByte(CP_ACP,0,strCaption,-1,Caption,CAPTION,NULL,NULL); + SetWindowText(m_hwnd, Caption); +#endif + return NOERROR; +} + + +// Get the current base window title caption, once again we do no real field +// checking. We allocate a string for the window title to be filled in with +// which ensures the interface doesn't fiddle around with getting memory. A +// BSTR is a normal C string with the length at position (-1), we use the +// WriteBSTR helper function to create the caption to try and avoid OLE32 + +STDMETHODIMP CBaseControlWindow::get_Caption(__out BSTR *pstrCaption) +{ + CheckPointer(pstrCaption,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + WCHAR WideCaption[CAPTION]; + +#ifdef UNICODE + GetWindowText(m_hwnd,WideCaption,CAPTION); +#else + // Convert the ASCII caption to a UNICODE string + + TCHAR Caption[CAPTION]; + GetWindowText(m_hwnd,Caption,CAPTION); + MultiByteToWideChar(CP_ACP,0,Caption,-1,WideCaption,CAPTION); +#endif + return WriteBSTR(pstrCaption,WideCaption); +} + + +// Set the window style using GWL_EXSTYLE + +STDMETHODIMP CBaseControlWindow::put_WindowStyleEx(long WindowStyleEx) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + + // Should we be taking off WS_EX_TOPMOST + + if (GetWindowLong(m_hwnd,GWL_EXSTYLE) & WS_EX_TOPMOST) { + if ((WindowStyleEx & WS_EX_TOPMOST) == 0) { + SendMessage(m_hwnd,m_ShowStageTop,(WPARAM) FALSE,(LPARAM) 0); + } + } + + // Likewise should we be adding WS_EX_TOPMOST + + if (WindowStyleEx & WS_EX_TOPMOST) { + SendMessage(m_hwnd,m_ShowStageTop,(WPARAM) TRUE,(LPARAM) 0); + WindowStyleEx &= (~WS_EX_TOPMOST); + if (WindowStyleEx == 0) return NOERROR; + } + return DoSetWindowStyle(WindowStyleEx,GWL_EXSTYLE); +} + + +// Gets the current GWL_EXSTYLE base window style + +STDMETHODIMP CBaseControlWindow::get_WindowStyleEx(__out long *pWindowStyleEx) +{ + CheckPointer(pWindowStyleEx,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + return DoGetWindowStyle(pWindowStyleEx,GWL_EXSTYLE); +} + + +// Set the window style using GWL_STYLE + +STDMETHODIMP CBaseControlWindow::put_WindowStyle(long WindowStyle) +{ + // These styles cannot be changed dynamically + + if ((WindowStyle & WS_DISABLED) || + (WindowStyle & WS_ICONIC) || + (WindowStyle & WS_MAXIMIZE) || + (WindowStyle & WS_MINIMIZE) || + (WindowStyle & WS_HSCROLL) || + (WindowStyle & WS_VSCROLL)) { + + return E_INVALIDARG; + } + + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + return DoSetWindowStyle(WindowStyle,GWL_STYLE); +} + + +// Get the current GWL_STYLE base window style + +STDMETHODIMP CBaseControlWindow::get_WindowStyle(__out long *pWindowStyle) +{ + CheckPointer(pWindowStyle,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + return DoGetWindowStyle(pWindowStyle,GWL_STYLE); +} + + +// Change the base window style or the extended styles depending on whether +// WindowLong is GWL_STYLE or GWL_EXSTYLE. We must call SetWindowPos to have +// the window displayed in it's new style after the change which is a little +// tricky if the window is not currently visible as we realise it offscreen. +// In most cases the client will call get_WindowStyle before they call this +// and then AND and OR in extra bit settings according to the requirements + +HRESULT CBaseControlWindow::DoSetWindowStyle(long Style,long WindowLong) +{ + RECT WindowRect; + + // Get the window's visibility before setting the style + BOOL bVisible = IsWindowVisible(m_hwnd); + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + + // Set the new style flags for the window + SetWindowLong(m_hwnd,WindowLong,Style); + UINT WindowFlags = SWP_SHOWWINDOW | SWP_FRAMECHANGED | SWP_NOACTIVATE; + WindowFlags |= SWP_NOZORDER | SWP_NOSIZE | SWP_NOMOVE; + + // Show the window again in the current position + + if (bVisible == TRUE) { + + SetWindowPos(m_hwnd, // Base window handle + HWND_TOP, // Just a place holder + 0,0,0,0, // Leave size and position + WindowFlags); // Just draw it again + + return NOERROR; + } + + // Move the window offscreen so the user doesn't see the changes + + MoveWindow((HWND) m_hwnd, // Base window handle + GetSystemMetrics(SM_CXSCREEN), // Current desktop width + GetSystemMetrics(SM_CYSCREEN), // Likewise it's height + WIDTH(&WindowRect), // Use the same width + HEIGHT(&WindowRect), // Keep height same to + TRUE); // May as well repaint + + // Now show the previously hidden window + + SetWindowPos(m_hwnd, // Base window handle + HWND_TOP, // Just a place holder + 0,0,0,0, // Leave size and position + WindowFlags); // Just draw it again + + ShowWindow(m_hwnd,SW_HIDE); + + if (GetParent(m_hwnd)) { + + MapWindowPoints(HWND_DESKTOP, GetParent(m_hwnd), (LPPOINT)&WindowRect, 2); + } + + MoveWindow((HWND) m_hwnd, // Base window handle + WindowRect.left, // Existing x coordinate + WindowRect.top, // Existing y coordinate + WIDTH(&WindowRect), // Use the same width + HEIGHT(&WindowRect), // Keep height same to + TRUE); // May as well repaint + + return NOERROR; +} + + +// Get the current base window style (either GWL_STYLE or GWL_EXSTYLE) + +HRESULT CBaseControlWindow::DoGetWindowStyle(__out long *pStyle,long WindowLong) +{ + *pStyle = GetWindowLong(m_hwnd,WindowLong); + return NOERROR; +} + + +// Change the visibility of the base window, this takes the same parameters +// as the ShowWindow Win32 API does, so the client can have the window hidden +// or shown, minimised to an icon, or maximised to play in full screen mode +// We pass the request on to the base window to actually make the change + +STDMETHODIMP CBaseControlWindow::put_WindowState(long WindowState) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + DoShowWindow(WindowState); + return NOERROR; +} + + +// Get the current window state, this function returns a subset of the SW bit +// settings available in ShowWindow, if the window is visible then SW_SHOW is +// set, if it is hidden then the SW_HIDDEN is set, if it is either minimised +// or maximised then the SW_MINIMIZE or SW_MAXIMIZE is set respectively. The +// other SW bit settings are really set commands not readable output values + +STDMETHODIMP CBaseControlWindow::get_WindowState(__out long *pWindowState) +{ + CheckPointer(pWindowState,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + ASSERT(pWindowState); + *pWindowState = FALSE; + + // Is the window visible, a window is termed visible if it is somewhere on + // the current desktop even if it is completely obscured by other windows + // so the flag is a style for each window set with the WS_VISIBLE bit + + if (IsWindowVisible(m_hwnd) == TRUE) { + + // Is the base window iconic + if (IsIconic(m_hwnd) == TRUE) { + *pWindowState |= SW_MINIMIZE; + } + + // Has the window been maximised + else if (IsZoomed(m_hwnd) == TRUE) { + *pWindowState |= SW_MAXIMIZE; + } + + // Window is normal + else { + *pWindowState |= SW_SHOW; + } + + } else { + *pWindowState |= SW_HIDE; + } + return NOERROR; +} + + +// This makes sure that any palette we realise in the base window (through a +// media type or through the overlay interface) is done in the background and +// is therefore mapped to existing device entries rather than taking it over +// as it will do when we this window gets the keyboard focus. An application +// uses this to make sure it doesn't have it's palette removed by the window + +STDMETHODIMP CBaseControlWindow::put_BackgroundPalette(long BackgroundPalette) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cWindowLock(&m_WindowLock); + + // Check this is a valid automation boolean type + + if (BackgroundPalette != OATRUE) { + if (BackgroundPalette != OAFALSE) { + return E_INVALIDARG; + } + } + + // Make sure the window realises any palette it has again + + m_bBackground = (BackgroundPalette == OATRUE ? TRUE : FALSE); + PostMessage(m_hwnd,m_RealizePalette,0,0); + PaintWindow(FALSE); + + return NOERROR; +} + + +// This returns the current background realisation setting + +STDMETHODIMP +CBaseControlWindow::get_BackgroundPalette(__out long *pBackgroundPalette) +{ + CheckPointer(pBackgroundPalette,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cWindowLock(&m_WindowLock); + + // Get the current background palette setting + + *pBackgroundPalette = (m_bBackground == TRUE ? OATRUE : OAFALSE); + return NOERROR; +} + + +// Change the visibility of the base window + +STDMETHODIMP CBaseControlWindow::put_Visible(long Visible) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + + // Check this is a valid automation boolean type + + if (Visible != OATRUE) { + if (Visible != OAFALSE) { + return E_INVALIDARG; + } + } + + // Convert the boolean visibility into SW_SHOW and SW_HIDE + + INT Mode = (Visible == OATRUE ? SW_SHOWNORMAL : SW_HIDE); + DoShowWindow(Mode); + return NOERROR; +} + + +// Return OATRUE if the window is currently visible otherwise OAFALSE + +STDMETHODIMP CBaseControlWindow::get_Visible(__out long *pVisible) +{ + CheckPointer(pVisible,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + + // See if the base window has a WS_VISIBLE style - this will return TRUE + // even if the window is completely obscured by other desktop windows, we + // return FALSE if the window is not showing because of earlier calls + + BOOL Mode = IsWindowVisible(m_hwnd); + *pVisible = (Mode == TRUE ? OATRUE : OAFALSE); + return NOERROR; +} + + +// Change the left position of the base window. This keeps the window width +// and height properties the same so it effectively shunts the window left or +// right accordingly - there is the Width property to change that dimension + +STDMETHODIMP CBaseControlWindow::put_Left(long Left) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + BOOL bSuccess; + RECT WindowRect; + + // Get the current window position in a RECT + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + + if (GetParent(m_hwnd)) { + + MapWindowPoints(HWND_DESKTOP, GetParent(m_hwnd), (LPPOINT)&WindowRect, 2); + } + + // Adjust the coordinates ready for SetWindowPos, the window rectangle we + // get back from GetWindowRect is in left,top,right and bottom while the + // coordinates SetWindowPos wants are left,top,width and height values + + WindowRect.bottom = WindowRect.bottom - WindowRect.top; + WindowRect.right = WindowRect.right - WindowRect.left; + UINT WindowFlags = SWP_NOZORDER | SWP_FRAMECHANGED | SWP_NOACTIVATE; + + bSuccess = SetWindowPos(m_hwnd, // Window handle + HWND_TOP, // Put it at the top + Left, // New left position + WindowRect.top, // Leave top alone + WindowRect.right, // The WIDTH (not right) + WindowRect.bottom, // The HEIGHT (not bottom) + WindowFlags); // Show window options + + if (bSuccess == FALSE) { + return E_INVALIDARG; + } + return NOERROR; +} + + +// Return the current base window left position + +STDMETHODIMP CBaseControlWindow::get_Left(__out long *pLeft) +{ + CheckPointer(pLeft,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + RECT WindowRect; + + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + *pLeft = WindowRect.left; + return NOERROR; +} + + +// Change the current width of the base window. This property complements the +// left position property so we must keep the left edge constant and expand or +// contract to the right, the alternative would be to change the left edge so +// keeping the right edge constant but this is maybe a little more intuitive + +STDMETHODIMP CBaseControlWindow::put_Width(long Width) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + BOOL bSuccess; + RECT WindowRect; + + // Adjust the coordinates ready for SetWindowPos, the window rectangle we + // get back from GetWindowRect is in left,top,right and bottom while the + // coordinates SetWindowPos wants are left,top,width and height values + + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + + if (GetParent(m_hwnd)) { + + MapWindowPoints(HWND_DESKTOP, GetParent(m_hwnd), (LPPOINT)&WindowRect, 2); + } + + WindowRect.bottom = WindowRect.bottom - WindowRect.top; + UINT WindowFlags = SWP_NOZORDER | SWP_FRAMECHANGED | SWP_NOACTIVATE; + + // This seems to have a bug in that calling SetWindowPos on a window with + // just the width changing causes it to ignore the width that you pass in + // and sets it to a mimimum value of 110 pixels wide (Windows NT 3.51) + + bSuccess = SetWindowPos(m_hwnd, // Window handle + HWND_TOP, // Put it at the top + WindowRect.left, // Leave left alone + WindowRect.top, // Leave top alone + Width, // New WIDTH dimension + WindowRect.bottom, // The HEIGHT (not bottom) + WindowFlags); // Show window options + + if (bSuccess == FALSE) { + return E_INVALIDARG; + } + return NOERROR; +} + + +// Return the current base window width + +STDMETHODIMP CBaseControlWindow::get_Width(__out long *pWidth) +{ + CheckPointer(pWidth,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + RECT WindowRect; + + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + *pWidth = WindowRect.right - WindowRect.left; + return NOERROR; +} + + +// This allows the client program to change the top position for the window in +// the same way that changing the left position does not affect the width of +// the image so changing the top position does not affect the window height + +STDMETHODIMP CBaseControlWindow::put_Top(long Top) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + BOOL bSuccess; + RECT WindowRect; + + // Get the current window position in a RECT + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + + if (GetParent(m_hwnd)) { + + MapWindowPoints(HWND_DESKTOP, GetParent(m_hwnd), (LPPOINT)&WindowRect, 2); + } + + // Adjust the coordinates ready for SetWindowPos, the window rectangle we + // get back from GetWindowRect is in left,top,right and bottom while the + // coordinates SetWindowPos wants are left,top,width and height values + + WindowRect.bottom = WindowRect.bottom - WindowRect.top; + WindowRect.right = WindowRect.right - WindowRect.left; + UINT WindowFlags = SWP_NOZORDER | SWP_FRAMECHANGED | SWP_NOACTIVATE; + + bSuccess = SetWindowPos(m_hwnd, // Window handle + HWND_TOP, // Put it at the top + WindowRect.left, // Leave left alone + Top, // New top position + WindowRect.right, // The WIDTH (not right) + WindowRect.bottom, // The HEIGHT (not bottom) + WindowFlags); // Show window flags + + if (bSuccess == FALSE) { + return E_INVALIDARG; + } + return NOERROR; +} + + +// Return the current base window top position + +STDMETHODIMP CBaseControlWindow::get_Top(long *pTop) +{ + CheckPointer(pTop,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + RECT WindowRect; + + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + *pTop = WindowRect.top; + return NOERROR; +} + + +// Change the height of the window, this complements the top property so when +// we change this we must keep the top position for the base window, as said +// before we could keep the bottom and grow upwards although this is perhaps +// a little more intuitive since we already have a top position property + +STDMETHODIMP CBaseControlWindow::put_Height(long Height) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + BOOL bSuccess; + RECT WindowRect; + + // Adjust the coordinates ready for SetWindowPos, the window rectangle we + // get back from GetWindowRect is in left,top,right and bottom while the + // coordinates SetWindowPos wants are left,top,width and height values + + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + + if (GetParent(m_hwnd)) { + + MapWindowPoints(HWND_DESKTOP, GetParent(m_hwnd), (LPPOINT)&WindowRect, 2); + } + + WindowRect.right = WindowRect.right - WindowRect.left; + UINT WindowFlags = SWP_NOZORDER | SWP_FRAMECHANGED | SWP_NOACTIVATE; + + bSuccess = SetWindowPos(m_hwnd, // Window handle + HWND_TOP, // Put it at the top + WindowRect.left, // Leave left alone + WindowRect.top, // Leave top alone + WindowRect.right, // The WIDTH (not right) + Height, // New height dimension + WindowFlags); // Show window flags + + if (bSuccess == FALSE) { + return E_INVALIDARG; + } + return NOERROR; +} + + +// Return the current base window height + +STDMETHODIMP CBaseControlWindow::get_Height(__out long *pHeight) +{ + CheckPointer(pHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + RECT WindowRect; + + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + *pHeight = WindowRect.bottom - WindowRect.top; + return NOERROR; +} + + +// This can be called to change the owning window. Setting the owner is done +// through this function, however to make the window a true child window the +// style must also be set to WS_CHILD. After resetting the owner to NULL an +// application should also set the style to WS_OVERLAPPED | WS_CLIPCHILDREN. + +// We cannot lock the object here because the SetParent causes an interthread +// SendMessage to the owner window. If they are in GetState we will sit here +// incomplete with the critical section locked therefore blocking out source +// filter threads from accessing us. Because the source thread can't enter us +// it can't get buffers or call EndOfStream so the GetState will not complete + +STDMETHODIMP CBaseControlWindow::put_Owner(OAHWND Owner) +{ + // Check we are connected otherwise reject the call + + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + m_hwndOwner = (HWND) Owner; + HWND hwndParent = m_hwndOwner; + + // Add or remove WS_CHILD as appropriate + + LONG Style = GetWindowLong(m_hwnd,GWL_STYLE); + if (Owner == NULL) { + Style &= (~WS_CHILD); + } else { + Style |= (WS_CHILD); + } + SetWindowLong(m_hwnd,GWL_STYLE,Style); + + // Don't call this with the filter locked + + SetParent(m_hwnd,hwndParent); + + PaintWindow(TRUE); + NOTE1("Changed parent %lx",hwndParent); + + return NOERROR; +} + + +// This complements the put_Owner to get the current owning window property +// we always return NOERROR although the returned window handle may be NULL +// to indicate no owning window (the desktop window doesn't qualify as one) +// If an application sets the owner we call SetParent, however that returns +// NULL until the WS_CHILD bit is set on, so we store the owner internally + +STDMETHODIMP CBaseControlWindow::get_Owner(__out OAHWND *Owner) +{ + CheckPointer(Owner,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + *Owner = (OAHWND) m_hwndOwner; + return NOERROR; +} + + +// And renderer supporting IVideoWindow may have an HWND set who will get any +// keyboard and mouse messages we receive posted on to them. This is separate +// from setting an owning window. By separating the two, applications may get +// messages sent on even when they have set no owner (perhaps it's maximised) + +STDMETHODIMP CBaseControlWindow::put_MessageDrain(OAHWND Drain) +{ + // Check we are connected otherwise reject the call + + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + m_hwndDrain = (HWND) Drain; + return NOERROR; +} + + +// Return the current message drain + +STDMETHODIMP CBaseControlWindow::get_MessageDrain(__out OAHWND *Drain) +{ + CheckPointer(Drain,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + *Drain = (OAHWND) m_hwndDrain; + return NOERROR; +} + + +// This is called by the filter graph to inform us of a message we should know +// is being sent to our owning window. We have this because as a child window +// we do not get certain messages that are only sent to top level windows. We +// must see the palette changed/changing/query messages so that we know if we +// have the foreground palette or not. We pass the message on to our window +// using SendMessage - this will cause an interthread send message to occur + +STDMETHODIMP +CBaseControlWindow::NotifyOwnerMessage(OAHWND hwnd, // Window handle + long uMsg, // Message ID + LONG_PTR wParam, // Parameters + LONG_PTR lParam) // for message +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + + // Only interested in these Windows messages + + switch (uMsg) { + + case WM_SYSCOLORCHANGE: + case WM_PALETTECHANGED: + case WM_PALETTEISCHANGING: + case WM_QUERYNEWPALETTE: + case WM_DEVMODECHANGE: + case WM_DISPLAYCHANGE: + case WM_ACTIVATEAPP: + + // If we do not have an owner then ignore + + if (m_hwndOwner == NULL) { + return NOERROR; + } + SendMessage(m_hwnd,uMsg,(WPARAM)wParam,(LPARAM)lParam); + break; + + // do NOT fwd WM_MOVE. the parameters are the location of the parent + // window, NOT what the renderer should be looking at. But we need + // to make sure the overlay is moved with the parent window, so we + // do this. + case WM_MOVE: + PostMessage(m_hwnd,WM_PAINT,0,0); + break; + } + return NOERROR; +} + + +// Allow an application to have us set the base window in the foreground. We +// have this because it is difficult for one thread to do do this to a window +// owned by another thread. We ask the base window class to do the real work + +STDMETHODIMP CBaseControlWindow::SetWindowForeground(long Focus) +{ + // Check this is a valid automation boolean type + + if (Focus != OATRUE) { + if (Focus != OAFALSE) { + return E_INVALIDARG; + } + } + + // We shouldn't lock as this sends a message + + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + BOOL bFocus = (Focus == OATRUE ? TRUE : FALSE); + DoSetWindowForeground(bFocus); + + return NOERROR; +} + + +// This allows a client to set the complete window size and position in one +// atomic operation. The same affect can be had by changing each dimension +// in turn through their individual properties although some flashing will +// occur as each of them gets updated (they are better set at design time) + +STDMETHODIMP +CBaseControlWindow::SetWindowPosition(long Left,long Top,long Width,long Height) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + BOOL bSuccess; + + // Set the new size and position + UINT WindowFlags = SWP_NOZORDER | SWP_FRAMECHANGED | SWP_NOACTIVATE; + + ASSERT(IsWindow(m_hwnd)); + bSuccess = SetWindowPos(m_hwnd, // Window handle + HWND_TOP, // Put it at the top + Left, // Left position + Top, // Top position + Width, // Window width + Height, // Window height + WindowFlags); // Show window flags + ASSERT(bSuccess); +#ifdef DEBUG + DbgLog((LOG_TRACE, 1, TEXT("SWP failed error %d"), GetLastError())); +#endif + if (bSuccess == FALSE) { + return E_INVALIDARG; + } + return NOERROR; +} + + +// This complements the SetWindowPosition to return the current window place +// in device coordinates. As before the same information can be retrived by +// calling the property get functions individually but this is atomic and is +// therefore more suitable to a live environment rather than design time + +STDMETHODIMP +CBaseControlWindow::GetWindowPosition(__out long *pLeft,__out long *pTop,__out long *pWidth,__out long *pHeight) +{ + // Should check the pointers are not NULL + + CheckPointer(pLeft,E_POINTER); + CheckPointer(pTop,E_POINTER); + CheckPointer(pWidth,E_POINTER); + CheckPointer(pHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + RECT WindowRect; + + // Get the current window coordinates + + EXECUTE_ASSERT(GetWindowRect(m_hwnd,&WindowRect)); + + // Convert the RECT into left,top,width and height values + + *pLeft = WindowRect.left; + *pTop = WindowRect.top; + *pWidth = WindowRect.right - WindowRect.left; + *pHeight = WindowRect.bottom - WindowRect.top; + + return NOERROR; +} + + +// When a window is maximised or iconic calling GetWindowPosition will return +// the current window position (likewise for the properties). However if the +// restored size (ie the size we'll return to when normally shown) is needed +// then this should be used. When in a normal position (neither iconic nor +// maximised) then this returns the same coordinates as GetWindowPosition + +STDMETHODIMP +CBaseControlWindow::GetRestorePosition(__out long *pLeft,__out long *pTop,__out long *pWidth,__out long *pHeight) +{ + // Should check the pointers are not NULL + + CheckPointer(pLeft,E_POINTER); + CheckPointer(pTop,E_POINTER); + CheckPointer(pWidth,E_POINTER); + CheckPointer(pHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + + // Use GetWindowPlacement to find the restore position + + WINDOWPLACEMENT Place; + Place.length = sizeof(WINDOWPLACEMENT); + EXECUTE_ASSERT(GetWindowPlacement(m_hwnd,&Place)); + + RECT WorkArea; + + // We must take into account any task bar present + + if (SystemParametersInfo(SPI_GETWORKAREA,0,&WorkArea,FALSE) == TRUE) { + if (GetParent(m_hwnd) == NULL) { + Place.rcNormalPosition.top += WorkArea.top; + Place.rcNormalPosition.bottom += WorkArea.top; + Place.rcNormalPosition.left += WorkArea.left; + Place.rcNormalPosition.right += WorkArea.left; + } + } + + // Convert the RECT into left,top,width and height values + + *pLeft = Place.rcNormalPosition.left; + *pTop = Place.rcNormalPosition.top; + *pWidth = Place.rcNormalPosition.right - Place.rcNormalPosition.left; + *pHeight = Place.rcNormalPosition.bottom - Place.rcNormalPosition.top; + + return NOERROR; +} + + +// Return the current border colour, if we are playing something to a subset +// of the base window display there is an outside area exposed. The default +// action is to paint this colour in the Windows background colour (defined +// as value COLOR_WINDOW) We reset to this default when we're disconnected + +STDMETHODIMP CBaseControlWindow::get_BorderColor(__out long *Color) +{ + CheckPointer(Color,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + *Color = (long) m_BorderColour; + return NOERROR; +} + + +// This can be called to set the current border colour + +STDMETHODIMP CBaseControlWindow::put_BorderColor(long Color) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + + // Have the window repainted with the new border colour + + m_BorderColour = (COLORREF) Color; + PaintWindow(TRUE); + return NOERROR; +} + + +// Delegate fullscreen handling to plug in distributor + +STDMETHODIMP CBaseControlWindow::get_FullScreenMode(__out long *FullScreenMode) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CheckPointer(FullScreenMode,E_POINTER); + return E_NOTIMPL; +} + + +// Delegate fullscreen handling to plug in distributor + +STDMETHODIMP CBaseControlWindow::put_FullScreenMode(long FullScreenMode) +{ + return E_NOTIMPL; +} + + +// This sets the auto show property, this property causes the base window to +// be displayed whenever we change state. This allows an application to have +// to do nothing to have the window appear but still allow them to change the +// default behaviour if for example they want to keep it hidden for longer + +STDMETHODIMP CBaseControlWindow::put_AutoShow(long AutoShow) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + + // Check this is a valid automation boolean type + + if (AutoShow != OATRUE) { + if (AutoShow != OAFALSE) { + return E_INVALIDARG; + } + } + + m_bAutoShow = (AutoShow == OATRUE ? TRUE : FALSE); + return NOERROR; +} + + +// This can be called to get the current auto show flag. The flag is updated +// when we connect and disconnect and through this interface all of which are +// controlled and serialised by means of the main renderer critical section + +STDMETHODIMP CBaseControlWindow::get_AutoShow(__out long *AutoShow) +{ + CheckPointer(AutoShow,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + *AutoShow = (m_bAutoShow == TRUE ? OATRUE : OAFALSE); + return NOERROR; +} + + +// Return the minimum ideal image size for the current video. This may differ +// to the actual video dimensions because we may be using DirectDraw hardware +// that has specific stretching requirements. For example the Cirrus Logic +// cards have a minimum stretch factor depending on the overlay surface size + +STDMETHODIMP +CBaseControlWindow::GetMinIdealImageSize(__out long *pWidth,__out long *pHeight) +{ + CheckPointer(pWidth,E_POINTER); + CheckPointer(pHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + FILTER_STATE State; + + // Must not be stopped for this to work correctly + + m_pFilter->GetState(0,&State); + if (State == State_Stopped) { + return VFW_E_WRONG_STATE; + } + + RECT DefaultRect = GetDefaultRect(); + *pWidth = WIDTH(&DefaultRect); + *pHeight = HEIGHT(&DefaultRect); + return NOERROR; +} + + +// Return the maximum ideal image size for the current video. This may differ +// to the actual video dimensions because we may be using DirectDraw hardware +// that has specific stretching requirements. For example the Cirrus Logic +// cards have a maximum stretch factor depending on the overlay surface size + +STDMETHODIMP +CBaseControlWindow::GetMaxIdealImageSize(__out long *pWidth,__out long *pHeight) +{ + CheckPointer(pWidth,E_POINTER); + CheckPointer(pHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + FILTER_STATE State; + + // Must not be stopped for this to work correctly + + m_pFilter->GetState(0,&State); + if (State == State_Stopped) { + return VFW_E_WRONG_STATE; + } + + RECT DefaultRect = GetDefaultRect(); + *pWidth = WIDTH(&DefaultRect); + *pHeight = HEIGHT(&DefaultRect); + return NOERROR; +} + + +// Allow an application to hide the cursor on our window + +STDMETHODIMP +CBaseControlWindow::HideCursor(long HideCursor) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + + // Check this is a valid automation boolean type + + if (HideCursor != OATRUE) { + if (HideCursor != OAFALSE) { + return E_INVALIDARG; + } + } + + m_bCursorHidden = (HideCursor == OATRUE ? TRUE : FALSE); + return NOERROR; +} + + +// Returns whether we have the cursor hidden or not + +STDMETHODIMP CBaseControlWindow::IsCursorHidden(__out long *CursorHidden) +{ + CheckPointer(CursorHidden,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + *CursorHidden = (m_bCursorHidden == TRUE ? OATRUE : OAFALSE); + return NOERROR; +} + + +// This class implements the IBasicVideo control functions (dual interface) +// we support a large number of properties and methods designed to allow the +// client (whether it be an automation controller or a C/C++ application) to +// set and get a number of video related properties such as the native video +// size. We support some methods that duplicate the properties but provide a +// more direct and efficient mechanism as many values may be changed in one + +CBaseControlVideo::CBaseControlVideo( + __inout CBaseFilter *pFilter, // Owning filter + __in CCritSec *pInterfaceLock, // Locking object + __in_opt LPCTSTR pName, // Object description + __inout_opt LPUNKNOWN pUnk, // Normal COM ownership + __inout HRESULT *phr) : // OLE return code + + CBaseBasicVideo(pName,pUnk), + m_pFilter(pFilter), + m_pInterfaceLock(pInterfaceLock), + m_pPin(NULL) +{ + ASSERT(m_pFilter); + ASSERT(m_pInterfaceLock); + ASSERT(phr); +} + +// Return an approximate average time per frame + +STDMETHODIMP CBaseControlVideo::get_AvgTimePerFrame(__out REFTIME *pAvgTimePerFrame) +{ + CheckPointer(pAvgTimePerFrame,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + COARefTime AvgTime(pVideoInfo->AvgTimePerFrame); + *pAvgTimePerFrame = (REFTIME) AvgTime; + + return NOERROR; +} + + +// Return an approximate bit rate for the video + +STDMETHODIMP CBaseControlVideo::get_BitRate(__out long *pBitRate) +{ + CheckPointer(pBitRate,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + *pBitRate = pVideoInfo->dwBitRate; + return NOERROR; +} + + +// Return an approximate bit error rate + +STDMETHODIMP CBaseControlVideo::get_BitErrorRate(__out long *pBitErrorRate) +{ + CheckPointer(pBitErrorRate,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + *pBitErrorRate = pVideoInfo->dwBitErrorRate; + return NOERROR; +} + + +// This returns the current video width + +STDMETHODIMP CBaseControlVideo::get_VideoWidth(__out long *pVideoWidth) +{ + CheckPointer(pVideoWidth,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + *pVideoWidth = pVideoInfo->bmiHeader.biWidth; + return NOERROR; +} + + +// This returns the current video height + +STDMETHODIMP CBaseControlVideo::get_VideoHeight(__out long *pVideoHeight) +{ + CheckPointer(pVideoHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + *pVideoHeight = pVideoInfo->bmiHeader.biHeight; + return NOERROR; +} + + +// This returns the current palette the video is using as an array allocated +// by the user. To remain consistent we use PALETTEENTRY fields to return the +// colours in rather than RGBQUADs that multimedia decided to use. The memory +// is allocated by the user so we simple copy each in turn. We check that the +// number of entries requested and the start position offset are both valid +// If the number of entries evaluates to zero then we return an S_FALSE code + +STDMETHODIMP CBaseControlVideo::GetVideoPaletteEntries(long StartIndex, + long Entries, + __out long *pRetrieved, + __out_ecount_part(Entries, *pRetrieved) long *pPalette) +{ + CheckPointer(pRetrieved,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + CMediaType MediaType; + + // Get the video format from the derived class + + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + BITMAPINFOHEADER *pHeader = HEADER(pVideoInfo); + + // Is the current format palettised + + if (PALETTISED(pVideoInfo) == FALSE) { + *pRetrieved = 0; + return VFW_E_NO_PALETTE_AVAILABLE; + } + + // Do they just want to know how many are available + + if (pPalette == NULL) { + *pRetrieved = pHeader->biClrUsed; + return NOERROR; + } + + // Make sure the start position is a valid offset + + if (StartIndex >= (LONG) pHeader->biClrUsed || StartIndex < 0) { + *pRetrieved = 0; + return E_INVALIDARG; + } + + // Correct the number we can retrieve + + LONG Available = (LONG) pHeader->biClrUsed - StartIndex; + *pRetrieved = max(0,min(Available,Entries)); + if (*pRetrieved == 0) { + return S_FALSE; + } + + // Copy the palette entries to the output buffer + + PALETTEENTRY *pEntries = (PALETTEENTRY *) pPalette; + RGBQUAD *pColours = COLORS(pVideoInfo) + StartIndex; + + for (LONG Count = 0;Count < *pRetrieved;Count++) { + pEntries[Count].peRed = pColours[Count].rgbRed; + pEntries[Count].peGreen = pColours[Count].rgbGreen; + pEntries[Count].peBlue = pColours[Count].rgbBlue; + pEntries[Count].peFlags = 0; + } + return NOERROR; +} + + +// This returns the current video dimensions as a method rather than a number +// of individual property get calls. For the same reasons as said before we +// cannot access the renderer media type directly as the window object thread +// may be updating it since dynamic format changes may change these values + +STDMETHODIMP CBaseControlVideo::GetVideoSize(__out long *pWidth,__out long *pHeight) +{ + CheckPointer(pWidth,E_POINTER); + CheckPointer(pHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + + // Get the video format from the derived class + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + *pWidth = pVideoInfo->bmiHeader.biWidth; + *pHeight = pVideoInfo->bmiHeader.biHeight; + return NOERROR; +} + + +// Set the source video rectangle as left,top,right and bottom coordinates +// rather than left,top,width and height as per OLE automation interfaces +// Then pass the rectangle on to the window object to set the source + +STDMETHODIMP +CBaseControlVideo::SetSourcePosition(long Left,long Top,long Width,long Height) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + SourceRect.left = Left; + SourceRect.top = Top; + SourceRect.right = Left + Width; + SourceRect.bottom = Top + Height; + + // Check the source rectangle is valid + + HRESULT hr = CheckSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the source rectangle + + hr = SetSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the source rectangle in left,top,width and height rather than the +// left,top,right and bottom values that RECT uses (and which the window +// object returns through GetSourceRect) which requires a little work + +STDMETHODIMP +CBaseControlVideo::GetSourcePosition(__out long *pLeft,__out long *pTop,__out long *pWidth,__out long *pHeight) +{ + // Should check the pointers are non NULL + + CheckPointer(pLeft,E_POINTER); + CheckPointer(pTop,E_POINTER); + CheckPointer(pWidth,E_POINTER); + CheckPointer(pHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + RECT SourceRect; + + CAutoLock cInterfaceLock(m_pInterfaceLock); + GetSourceRect(&SourceRect); + + *pLeft = SourceRect.left; + *pTop = SourceRect.top; + *pWidth = WIDTH(&SourceRect); + *pHeight = HEIGHT(&SourceRect); + + return NOERROR; +} + + +// Set the video destination as left,top,right and bottom coordinates rather +// than the left,top,width and height uses as per OLE automation interfaces +// Then pass the rectangle on to the window object to set the destination + +STDMETHODIMP +CBaseControlVideo::SetDestinationPosition(long Left,long Top,long Width,long Height) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + + DestinationRect.left = Left; + DestinationRect.top = Top; + DestinationRect.right = Left + Width; + DestinationRect.bottom = Top + Height; + + // Check the target rectangle is valid + + HRESULT hr = CheckTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the new target rectangle + + hr = SetTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the destination rectangle in left,top,width and height rather than +// the left,top,right and bottom values that RECT uses (and which the window +// object returns through GetDestinationRect) which requires a little work + +STDMETHODIMP +CBaseControlVideo::GetDestinationPosition(__out long *pLeft,__out long *pTop,__out long *pWidth,__out long *pHeight) +{ + // Should check the pointers are not NULL + + CheckPointer(pLeft,E_POINTER); + CheckPointer(pTop,E_POINTER); + CheckPointer(pWidth,E_POINTER); + CheckPointer(pHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + RECT DestinationRect; + + CAutoLock cInterfaceLock(m_pInterfaceLock); + GetTargetRect(&DestinationRect); + + *pLeft = DestinationRect.left; + *pTop = DestinationRect.top; + *pWidth = WIDTH(&DestinationRect); + *pHeight = HEIGHT(&DestinationRect); + + return NOERROR; +} + + +// Set the source left position, the source rectangle we get back from the +// window object is a true rectangle in left,top,right and bottom positions +// so all we have to do is to update the left position and pass it back. We +// must keep the current width constant when we're updating this property + +STDMETHODIMP CBaseControlVideo::put_SourceLeft(long SourceLeft) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + GetSourceRect(&SourceRect); + SourceRect.right = SourceLeft + WIDTH(&SourceRect); + SourceRect.left = SourceLeft; + + // Check the source rectangle is valid + + HRESULT hr = CheckSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the source rectangle + + hr = SetSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the current left source video position + +STDMETHODIMP CBaseControlVideo::get_SourceLeft(__out long *pSourceLeft) +{ + CheckPointer(pSourceLeft,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + + GetSourceRect(&SourceRect); + *pSourceLeft = SourceRect.left; + return NOERROR; +} + + +// Set the source width, we get the current source rectangle and then update +// the right position to be the left position (thereby keeping it constant) +// plus the new source width we are passed in (it expands to the right) + +STDMETHODIMP CBaseControlVideo::put_SourceWidth(long SourceWidth) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + GetSourceRect(&SourceRect); + SourceRect.right = SourceRect.left + SourceWidth; + + // Check the source rectangle is valid + + HRESULT hr = CheckSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the source rectangle + + hr = SetSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the current source width + +STDMETHODIMP CBaseControlVideo::get_SourceWidth(__out long *pSourceWidth) +{ + CheckPointer(pSourceWidth,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + + GetSourceRect(&SourceRect); + *pSourceWidth = WIDTH(&SourceRect); + return NOERROR; +} + + +// Set the source top position - changing this property does not affect the +// current source height. So changing this shunts the source rectangle up and +// down appropriately. Changing the height complements this functionality by +// keeping the top position constant and simply changing the source height + +STDMETHODIMP CBaseControlVideo::put_SourceTop(long SourceTop) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + GetSourceRect(&SourceRect); + SourceRect.bottom = SourceTop + HEIGHT(&SourceRect); + SourceRect.top = SourceTop; + + // Check the source rectangle is valid + + HRESULT hr = CheckSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the source rectangle + + hr = SetSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the current top position + +STDMETHODIMP CBaseControlVideo::get_SourceTop(__out long *pSourceTop) +{ + CheckPointer(pSourceTop,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + + GetSourceRect(&SourceRect); + *pSourceTop = SourceRect.top; + return NOERROR; +} + + +// Set the source height + +STDMETHODIMP CBaseControlVideo::put_SourceHeight(long SourceHeight) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + GetSourceRect(&SourceRect); + SourceRect.bottom = SourceRect.top + SourceHeight; + + // Check the source rectangle is valid + + HRESULT hr = CheckSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the source rectangle + + hr = SetSourceRect(&SourceRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the current source height + +STDMETHODIMP CBaseControlVideo::get_SourceHeight(__out long *pSourceHeight) +{ + CheckPointer(pSourceHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT SourceRect; + + GetSourceRect(&SourceRect); + *pSourceHeight = HEIGHT(&SourceRect); + return NOERROR; +} + + +// Set the target left position, the target rectangle we get back from the +// window object is a true rectangle in left,top,right and bottom positions +// so all we have to do is to update the left position and pass it back. We +// must keep the current width constant when we're updating this property + +STDMETHODIMP CBaseControlVideo::put_DestinationLeft(long DestinationLeft) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + GetTargetRect(&DestinationRect); + DestinationRect.right = DestinationLeft + WIDTH(&DestinationRect); + DestinationRect.left = DestinationLeft; + + // Check the target rectangle is valid + + HRESULT hr = CheckTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the new target rectangle + + hr = SetTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the left position for the destination rectangle + +STDMETHODIMP CBaseControlVideo::get_DestinationLeft(__out long *pDestinationLeft) +{ + CheckPointer(pDestinationLeft,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + + GetTargetRect(&DestinationRect); + *pDestinationLeft = DestinationRect.left; + return NOERROR; +} + + +// Set the destination width + +STDMETHODIMP CBaseControlVideo::put_DestinationWidth(long DestinationWidth) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + GetTargetRect(&DestinationRect); + DestinationRect.right = DestinationRect.left + DestinationWidth; + + // Check the target rectangle is valid + + HRESULT hr = CheckTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the new target rectangle + + hr = SetTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the width for the destination rectangle + +STDMETHODIMP CBaseControlVideo::get_DestinationWidth(__out long *pDestinationWidth) +{ + CheckPointer(pDestinationWidth,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + + GetTargetRect(&DestinationRect); + *pDestinationWidth = WIDTH(&DestinationRect); + return NOERROR; +} + + +// Set the target top position - changing this property does not affect the +// current target height. So changing this shunts the target rectangle up and +// down appropriately. Changing the height complements this functionality by +// keeping the top position constant and simply changing the target height + +STDMETHODIMP CBaseControlVideo::put_DestinationTop(long DestinationTop) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + GetTargetRect(&DestinationRect); + DestinationRect.bottom = DestinationTop + HEIGHT(&DestinationRect); + DestinationRect.top = DestinationTop; + + // Check the target rectangle is valid + + HRESULT hr = CheckTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the new target rectangle + + hr = SetTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the top position for the destination rectangle + +STDMETHODIMP CBaseControlVideo::get_DestinationTop(__out long *pDestinationTop) +{ + CheckPointer(pDestinationTop,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + + GetTargetRect(&DestinationRect); + *pDestinationTop = DestinationRect.top; + return NOERROR; +} + + +// Set the destination height + +STDMETHODIMP CBaseControlVideo::put_DestinationHeight(long DestinationHeight) +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + GetTargetRect(&DestinationRect); + DestinationRect.bottom = DestinationRect.top + DestinationHeight; + + // Check the target rectangle is valid + + HRESULT hr = CheckTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + + // Now set the new target rectangle + + hr = SetTargetRect(&DestinationRect); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return the height for the destination rectangle + +STDMETHODIMP CBaseControlVideo::get_DestinationHeight(__out long *pDestinationHeight) +{ + CheckPointer(pDestinationHeight,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + RECT DestinationRect; + + GetTargetRect(&DestinationRect); + *pDestinationHeight = HEIGHT(&DestinationRect); + return NOERROR; +} + + +// Reset the source rectangle to the full video dimensions + +STDMETHODIMP CBaseControlVideo::SetDefaultSourcePosition() +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + HRESULT hr = SetDefaultSourceRect(); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return S_OK if we're using the default source otherwise S_FALSE + +STDMETHODIMP CBaseControlVideo::IsUsingDefaultSource() +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + return IsDefaultSourceRect(); +} + + +// Reset the video renderer to use the entire playback area + +STDMETHODIMP CBaseControlVideo::SetDefaultDestinationPosition() +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + HRESULT hr = SetDefaultTargetRect(); + if (FAILED(hr)) { + return hr; + } + return OnUpdateRectangles(); +} + + +// Return S_OK if we're using the default target otherwise S_FALSE + +STDMETHODIMP CBaseControlVideo::IsUsingDefaultDestination() +{ + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + return IsDefaultTargetRect(); +} + + +// Return a copy of the current image in the video renderer + +STDMETHODIMP +CBaseControlVideo::GetCurrentImage(__inout long *pBufferSize,__out_bcount_part(*pBufferSize, *pBufferSize) long *pVideoImage) +{ + CheckPointer(pBufferSize,E_POINTER); + CheckConnected(m_pPin,VFW_E_NOT_CONNECTED); + CAutoLock cInterfaceLock(m_pInterfaceLock); + FILTER_STATE State; + + // Make sure we are in a paused state + + if (pVideoImage != NULL) { + m_pFilter->GetState(0,&State); + if (State != State_Paused) { + return VFW_E_NOT_PAUSED; + } + return GetStaticImage(pBufferSize,pVideoImage); + } + + // Just return the memory required + + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + RECT SourceRect; + GetSourceRect(&SourceRect); + return GetImageSize(pVideoInfo,pBufferSize,&SourceRect); +} + + +// An application has two ways of using GetCurrentImage, one is to pass a real +// buffer which should be filled with the current image. The other is to pass +// a NULL buffer pointer which is interpreted as asking us to return how much +// memory is required for the image. The constraints for when the latter can +// be called are much looser. To calculate the memory required we synthesize +// a VIDEOINFO that takes into account the source rectangle that's being used + +HRESULT CBaseControlVideo::GetImageSize(__in VIDEOINFOHEADER *pVideoInfo, + __out long *pBufferSize, + __in RECT *pSourceRect) +{ + NOTE("Entering GetImageSize"); + ASSERT(pSourceRect); + + // Check we have the correct input parameters + + if (pSourceRect == NULL || + pVideoInfo == NULL || + pBufferSize == NULL) { + + return E_UNEXPECTED; + } + + // Is the data format compatible + + if (pVideoInfo->bmiHeader.biCompression != BI_RGB) { + if (pVideoInfo->bmiHeader.biCompression != BI_BITFIELDS) { + return E_INVALIDARG; + } + } + + ASSERT(IsRectEmpty(pSourceRect) == FALSE); + + BITMAPINFOHEADER bih; + bih.biWidth = WIDTH(pSourceRect); + bih.biHeight = HEIGHT(pSourceRect); + bih.biBitCount = pVideoInfo->bmiHeader.biBitCount; + LONG Size = DIBSIZE(bih); + Size += GetBitmapFormatSize(HEADER(pVideoInfo)) - SIZE_PREHEADER; + *pBufferSize = Size; + + return NOERROR; +} + + +// Given an IMediaSample containing a linear buffer with an image and a type +// describing the bitmap make a rendering of the image into the output buffer +// This may be called by derived classes who render typical video images to +// handle the IBasicVideo GetCurrentImage method. The pVideoImage pointer may +// be NULL when passed to GetCurrentImage in which case GetImageSize will be +// called instead, which will just do the calculation of the memory required + +HRESULT CBaseControlVideo::CopyImage(IMediaSample *pMediaSample, + __in VIDEOINFOHEADER *pVideoInfo, + __inout long *pBufferSize, + __out_bcount_part(*pBufferSize, *pBufferSize) BYTE *pVideoImage, + __in RECT *pSourceRect) +{ + NOTE("Entering CopyImage"); + ASSERT(pSourceRect); + BYTE *pCurrentImage; + + // Check we have an image to copy + + if (pMediaSample == NULL || pSourceRect == NULL || + pVideoInfo == NULL || pVideoImage == NULL || + pBufferSize == NULL) { + + return E_UNEXPECTED; + } + + // Is the data format compatible + + if (pVideoInfo->bmiHeader.biCompression != BI_RGB) { + if (pVideoInfo->bmiHeader.biCompression != BI_BITFIELDS) { + return E_INVALIDARG; + } + } + + if (*pBufferSize < 0) { + return E_INVALIDARG; + } + + // Arbitrarily large size to prevent integer overflow problems + if (pVideoInfo->bmiHeader.biSize > 4096) + { + return E_INVALIDARG; + } + + ASSERT(IsRectEmpty(pSourceRect) == FALSE); + + BITMAPINFOHEADER bih; + bih.biWidth = WIDTH(pSourceRect); + bih.biHeight = HEIGHT(pSourceRect); + bih.biBitCount = pVideoInfo->bmiHeader.biBitCount; + DWORD Size = GetBitmapFormatSize(HEADER(pVideoInfo)) - SIZE_PREHEADER; + DWORD Total; + DWORD dwDibSize; + + if( !ValidateBitmapInfoHeader( HEADER(pVideoInfo), Size)) { + return E_INVALIDARG; + } + + // ValidateBitmapInfoHeader checks this but for some reason code scanning + // tools aren't picking up the annotation + __analysis_assume(Size >= sizeof(BITMAPINFOHEADER)); + + if (FAILED(SAFE_DIBSIZE(&bih, &dwDibSize))) { + return E_INVALIDARG; + } + + if (FAILED(DWordAdd(Size, dwDibSize, &Total))) { + return E_INVALIDARG; + } + + // Make sure we have a large enough buffer + + if ((DWORD)*pBufferSize < Total) { + return E_OUTOFMEMORY; + } + + // Copy the BITMAPINFO + + CopyMemory((PVOID)pVideoImage, (PVOID)&pVideoInfo->bmiHeader, Size); + ((BITMAPINFOHEADER *)pVideoImage)->biWidth = WIDTH(pSourceRect); + ((BITMAPINFOHEADER *)pVideoImage)->biHeight = HEIGHT(pSourceRect); + ((BITMAPINFOHEADER *)pVideoImage)->biSizeImage = DIBSIZE(bih); + BYTE *pImageData = pVideoImage + Size; + + // Get the pointer to it's image data + + HRESULT hr = pMediaSample->GetPointer(&pCurrentImage); + if (FAILED(hr)) { + return hr; + } + + // Now we are ready to start copying the source scan lines + + LONG ScanLine = (pVideoInfo->bmiHeader.biBitCount / 8) * WIDTH(pSourceRect); + LONG LinesToSkip = pVideoInfo->bmiHeader.biHeight; + LinesToSkip -= pSourceRect->top + HEIGHT(pSourceRect); + pCurrentImage += LinesToSkip * DIBWIDTHBYTES(pVideoInfo->bmiHeader); + pCurrentImage += pSourceRect->left * (pVideoInfo->bmiHeader.biBitCount / 8); + + // Even money on this GP faulting sometime... + + for (LONG Line = 0;Line < HEIGHT(pSourceRect);Line++) { + CopyMemory((PVOID)pImageData, (PVOID)pCurrentImage, ScanLine); + pImageData += DIBWIDTHBYTES(*(BITMAPINFOHEADER *)pVideoImage); + pCurrentImage += DIBWIDTHBYTES(pVideoInfo->bmiHeader); + } + return NOERROR; +} + + +// Called when we change media types either during connection or dynamically +// We inform the filter graph and therefore the application that the video +// size may have changed, we don't bother looking to see if it really has as +// we leave that to the application - the dimensions are the event parameters + +HRESULT CBaseControlVideo::OnVideoSizeChange() +{ + // Get the video format from the derived class + + VIDEOINFOHEADER *pVideoInfo = GetVideoFormat(); + if (pVideoInfo == NULL) + return E_OUTOFMEMORY; + WORD Width = (WORD) pVideoInfo->bmiHeader.biWidth; + WORD Height = (WORD) pVideoInfo->bmiHeader.biHeight; + + return m_pFilter->NotifyEvent(EC_VIDEO_SIZE_CHANGED, + MAKELPARAM(Width,Height), + MAKEWPARAM(0,0)); +} + + +// Set the video source rectangle. We must check the source rectangle against +// the actual video dimensions otherwise when we come to draw the pictures we +// get access violations as GDI tries to touch data outside of the image data +// Although we store the rectangle in left, top, right and bottom coordinates +// instead of left, top, width and height as OLE uses we do take into account +// that the rectangle is used up to, but not including, the right column and +// bottom row of pixels, see the Win32 documentation on RECT for more details + +HRESULT CBaseControlVideo::CheckSourceRect(__in RECT *pSourceRect) +{ + CheckPointer(pSourceRect,E_POINTER); + LONG Width,Height; + GetVideoSize(&Width,&Height); + + // Check the coordinates are greater than zero + // and that the rectangle is valid (leftleft >= pSourceRect->right) || + (pSourceRect->left < 0) || + (pSourceRect->top >= pSourceRect->bottom) || + (pSourceRect->top < 0)) { + + return E_INVALIDARG; + } + + // Check the coordinates are less than the extents + + if ((pSourceRect->right > Width) || + (pSourceRect->bottom > Height)) { + + return E_INVALIDARG; + } + return NOERROR; +} + + +// Check the target rectangle has some valid coordinates, which amounts to +// little more than checking the destination rectangle isn't empty. Derived +// classes may call this when they have their SetTargetRect method called to +// check the rectangle validity, we do not update the rectangles passed in +// Although we store the rectangle in left, top, right and bottom coordinates +// instead of left, top, width and height as OLE uses we do take into account +// that the rectangle is used up to, but not including, the right column and +// bottom row of pixels, see the Win32 documentation on RECT for more details + +HRESULT CBaseControlVideo::CheckTargetRect(__in RECT *pTargetRect) +{ + // Check the pointer is valid + + if (pTargetRect == NULL) { + return E_POINTER; + } + + // These overflow the WIDTH and HEIGHT checks + + if (pTargetRect->left > pTargetRect->right || + pTargetRect->top > pTargetRect->bottom) { + return E_INVALIDARG; + } + + // Check the rectangle has valid coordinates + + if (WIDTH(pTargetRect) <= 0 || HEIGHT(pTargetRect) <= 0) { + return E_INVALIDARG; + } + + ASSERT(IsRectEmpty(pTargetRect) == FALSE); + return NOERROR; +} + diff --git a/third_party/BaseClasses/winctrl.h b/third_party/BaseClasses/winctrl.h new file mode 100644 index 00000000..1080a47c --- /dev/null +++ b/third_party/BaseClasses/winctrl.h @@ -0,0 +1,224 @@ +//------------------------------------------------------------------------------ +// File: WinCtrl.h +// +// Desc: DirectShow base classes - defines classes for video control +// interfaces. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __WINCTRL__ +#define __WINCTRL__ + +#define ABSOL(x) (x < 0 ? -x : x) +#define NEGAT(x) (x > 0 ? -x : x) + +// Helper +BOOL WINAPI PossiblyEatMessage(HWND hwnd, UINT uMsg, WPARAM wParam, LPARAM lParam); + +class CBaseControlWindow : public CBaseVideoWindow, public CBaseWindow +{ +protected: + + CBaseFilter *m_pFilter; // Pointer to owning media filter + CBasePin *m_pPin; // Controls media types for connection + CCritSec *m_pInterfaceLock; // Externally defined critical section + COLORREF m_BorderColour; // Current window border colour + BOOL m_bAutoShow; // What happens when the state changes + HWND m_hwndOwner; // Owner window that we optionally have + HWND m_hwndDrain; // HWND to post any messages received + BOOL m_bCursorHidden; // Should we hide the window cursor + +public: + + // Internal methods for other objects to get information out + + HRESULT DoSetWindowStyle(long Style,long WindowLong); + HRESULT DoGetWindowStyle(__out long *pStyle,long WindowLong); + BOOL IsAutoShowEnabled() { return m_bAutoShow; }; + COLORREF GetBorderColour() { return m_BorderColour; }; + HWND GetOwnerWindow() { return m_hwndOwner; }; + BOOL IsCursorHidden() { return m_bCursorHidden; }; + + inline BOOL PossiblyEatMessage(UINT uMsg, WPARAM wParam, LPARAM lParam) + { + return ::PossiblyEatMessage(m_hwndDrain, uMsg, wParam, lParam); + } + + // Derived classes must call this to set the pin the filter is using + // We don't have the pin passed in to the constructor (as we do with + // the CBaseFilter object) because filters typically create the + // pins dynamically when requested in CBaseFilter::GetPin. This can + // not be called from our constructor because is is a virtual method + + void SetControlWindowPin(CBasePin *pPin) { + m_pPin = pPin; + } + +public: + + CBaseControlWindow(__inout CBaseFilter *pFilter, // Owning media filter + __in CCritSec *pInterfaceLock, // Locking object + __in_opt LPCTSTR pName, // Object description + __inout_opt LPUNKNOWN pUnk, // Normal COM ownership + __inout HRESULT *phr); // OLE return code + + // These are the properties we support + + STDMETHODIMP put_Caption(__in BSTR strCaption); + STDMETHODIMP get_Caption(__out BSTR *pstrCaption); + STDMETHODIMP put_AutoShow(long AutoShow); + STDMETHODIMP get_AutoShow(__out long *AutoShow); + STDMETHODIMP put_WindowStyle(long WindowStyle); + STDMETHODIMP get_WindowStyle(__out long *pWindowStyle); + STDMETHODIMP put_WindowStyleEx(long WindowStyleEx); + STDMETHODIMP get_WindowStyleEx(__out long *pWindowStyleEx); + STDMETHODIMP put_WindowState(long WindowState); + STDMETHODIMP get_WindowState(__out long *pWindowState); + STDMETHODIMP put_BackgroundPalette(long BackgroundPalette); + STDMETHODIMP get_BackgroundPalette(__out long *pBackgroundPalette); + STDMETHODIMP put_Visible(long Visible); + STDMETHODIMP get_Visible(__out long *pVisible); + STDMETHODIMP put_Left(long Left); + STDMETHODIMP get_Left(__out long *pLeft); + STDMETHODIMP put_Width(long Width); + STDMETHODIMP get_Width(__out long *pWidth); + STDMETHODIMP put_Top(long Top); + STDMETHODIMP get_Top(__out long *pTop); + STDMETHODIMP put_Height(long Height); + STDMETHODIMP get_Height(__out long *pHeight); + STDMETHODIMP put_Owner(OAHWND Owner); + STDMETHODIMP get_Owner(__out OAHWND *Owner); + STDMETHODIMP put_MessageDrain(OAHWND Drain); + STDMETHODIMP get_MessageDrain(__out OAHWND *Drain); + STDMETHODIMP get_BorderColor(__out long *Color); + STDMETHODIMP put_BorderColor(long Color); + STDMETHODIMP get_FullScreenMode(__out long *FullScreenMode); + STDMETHODIMP put_FullScreenMode(long FullScreenMode); + + // And these are the methods + + STDMETHODIMP SetWindowForeground(long Focus); + STDMETHODIMP NotifyOwnerMessage(OAHWND hwnd,long uMsg,LONG_PTR wParam,LONG_PTR lParam); + STDMETHODIMP GetMinIdealImageSize(__out long *pWidth,__out long *pHeight); + STDMETHODIMP GetMaxIdealImageSize(__out long *pWidth,__out long *pHeight); + STDMETHODIMP SetWindowPosition(long Left,long Top,long Width,long Height); + STDMETHODIMP GetWindowPosition(__out long *pLeft,__out long *pTop,__out long *pWidth,__out long *pHeight); + STDMETHODIMP GetRestorePosition(__out long *pLeft,__out long *pTop,__out long *pWidth,__out long *pHeight); + STDMETHODIMP HideCursor(long HideCursor); + STDMETHODIMP IsCursorHidden(__out long *CursorHidden); +}; + +// This class implements the IBasicVideo interface + +class CBaseControlVideo : public CBaseBasicVideo +{ +protected: + + CBaseFilter *m_pFilter; // Pointer to owning media filter + CBasePin *m_pPin; // Controls media types for connection + CCritSec *m_pInterfaceLock; // Externally defined critical section + +public: + + // Derived classes must provide these for the implementation + + virtual HRESULT IsDefaultTargetRect() PURE; + virtual HRESULT SetDefaultTargetRect() PURE; + virtual HRESULT SetTargetRect(RECT *pTargetRect) PURE; + virtual HRESULT GetTargetRect(RECT *pTargetRect) PURE; + virtual HRESULT IsDefaultSourceRect() PURE; + virtual HRESULT SetDefaultSourceRect() PURE; + virtual HRESULT SetSourceRect(RECT *pSourceRect) PURE; + virtual HRESULT GetSourceRect(RECT *pSourceRect) PURE; + virtual HRESULT GetStaticImage(__inout long *pBufferSize,__out_bcount_part(*pBufferSize, *pBufferSize) long *pDIBImage) PURE; + + // Derived classes must override this to return a VIDEOINFO representing + // the video format. We cannot call IPin ConnectionMediaType to get this + // format because various filters dynamically change the type when using + // DirectDraw such that the format shows the position of the logical + // bitmap in a frame buffer surface, so the size might be returned as + // 1024x768 pixels instead of 320x240 which is the real video dimensions + + __out virtual VIDEOINFOHEADER *GetVideoFormat() PURE; + + // Helper functions for creating memory renderings of a DIB image + + HRESULT GetImageSize(__in VIDEOINFOHEADER *pVideoInfo, + __out LONG *pBufferSize, + __in RECT *pSourceRect); + + HRESULT CopyImage(IMediaSample *pMediaSample, + __in VIDEOINFOHEADER *pVideoInfo, + __inout LONG *pBufferSize, + __out_bcount_part(*pBufferSize, *pBufferSize) BYTE *pVideoImage, + __in RECT *pSourceRect); + + // Override this if you want notifying when the rectangles change + virtual HRESULT OnUpdateRectangles() { return NOERROR; }; + virtual HRESULT OnVideoSizeChange(); + + // Derived classes must call this to set the pin the filter is using + // We don't have the pin passed in to the constructor (as we do with + // the CBaseFilter object) because filters typically create the + // pins dynamically when requested in CBaseFilter::GetPin. This can + // not be called from our constructor because is is a virtual method + + void SetControlVideoPin(__inout CBasePin *pPin) { + m_pPin = pPin; + } + + // Helper methods for checking rectangles + virtual HRESULT CheckSourceRect(__in RECT *pSourceRect); + virtual HRESULT CheckTargetRect(__in RECT *pTargetRect); + +public: + + CBaseControlVideo(__inout CBaseFilter *pFilter, // Owning media filter + __in CCritSec *pInterfaceLock, // Serialise interface + __in_opt LPCTSTR pName, // Object description + __inout_opt LPUNKNOWN pUnk, // Normal COM ownership + __inout HRESULT *phr); // OLE return code + + // These are the properties we support + + STDMETHODIMP get_AvgTimePerFrame(__out REFTIME *pAvgTimePerFrame); + STDMETHODIMP get_BitRate(__out long *pBitRate); + STDMETHODIMP get_BitErrorRate(__out long *pBitErrorRate); + STDMETHODIMP get_VideoWidth(__out long *pVideoWidth); + STDMETHODIMP get_VideoHeight(__out long *pVideoHeight); + STDMETHODIMP put_SourceLeft(long SourceLeft); + STDMETHODIMP get_SourceLeft(__out long *pSourceLeft); + STDMETHODIMP put_SourceWidth(long SourceWidth); + STDMETHODIMP get_SourceWidth(__out long *pSourceWidth); + STDMETHODIMP put_SourceTop(long SourceTop); + STDMETHODIMP get_SourceTop(__out long *pSourceTop); + STDMETHODIMP put_SourceHeight(long SourceHeight); + STDMETHODIMP get_SourceHeight(__out long *pSourceHeight); + STDMETHODIMP put_DestinationLeft(long DestinationLeft); + STDMETHODIMP get_DestinationLeft(__out long *pDestinationLeft); + STDMETHODIMP put_DestinationWidth(long DestinationWidth); + STDMETHODIMP get_DestinationWidth(__out long *pDestinationWidth); + STDMETHODIMP put_DestinationTop(long DestinationTop); + STDMETHODIMP get_DestinationTop(__out long *pDestinationTop); + STDMETHODIMP put_DestinationHeight(long DestinationHeight); + STDMETHODIMP get_DestinationHeight(__out long *pDestinationHeight); + + // And these are the methods + + STDMETHODIMP GetVideoSize(__out long *pWidth,__out long *pHeight); + STDMETHODIMP SetSourcePosition(long Left,long Top,long Width,long Height); + STDMETHODIMP GetSourcePosition(__out long *pLeft,__out long *pTop,__out long *pWidth,__out long *pHeight); + STDMETHODIMP GetVideoPaletteEntries(long StartIndex,long Entries,__out long *pRetrieved,__out_ecount_part(Entries, *pRetrieved) long *pPalette); + STDMETHODIMP SetDefaultSourcePosition(); + STDMETHODIMP IsUsingDefaultSource(); + STDMETHODIMP SetDestinationPosition(long Left,long Top,long Width,long Height); + STDMETHODIMP GetDestinationPosition(__out long *pLeft,__out long *pTop,__out long *pWidth,__out long *pHeight); + STDMETHODIMP SetDefaultDestinationPosition(); + STDMETHODIMP IsUsingDefaultDestination(); + STDMETHODIMP GetCurrentImage(__inout long *pBufferSize,__out_bcount_part(*pBufferSize, *pBufferSize) long *pVideoImage); +}; + +#endif // __WINCTRL__ + diff --git a/third_party/BaseClasses/winutil.cpp b/third_party/BaseClasses/winutil.cpp new file mode 100644 index 00000000..6653f457 --- /dev/null +++ b/third_party/BaseClasses/winutil.cpp @@ -0,0 +1,2746 @@ +//------------------------------------------------------------------------------ +// File: WinUtil.cpp +// +// Desc: DirectShow base classes - implements generic window handler class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#include +#include +#include +#include + +static UINT MsgDestroy; + +// Constructor + +CBaseWindow::CBaseWindow(BOOL bDoGetDC, bool bDoPostToDestroy) : + m_hInstance(g_hInst), + m_hwnd(NULL), + m_hdc(NULL), + m_bActivated(FALSE), + m_pClassName(NULL), + m_ClassStyles(0), + m_WindowStyles(0), + m_WindowStylesEx(0), + m_ShowStageMessage(0), + m_ShowStageTop(0), + m_MemoryDC(NULL), + m_hPalette(NULL), + m_bBackground(FALSE), +#ifdef DEBUG + m_bRealizing(FALSE), +#endif + m_bNoRealize(FALSE), + m_bDoPostToDestroy(bDoPostToDestroy) +{ + m_bDoGetDC = bDoGetDC; +} + + +// Prepare a window by spinning off a worker thread to do the creation and +// also poll the message input queue. We leave this to be called by derived +// classes because they might want to override methods like MessageLoop and +// InitialiseWindow, if we do this during construction they'll ALWAYS call +// this base class methods. We make the worker thread create the window so +// it owns it rather than the filter graph thread which is constructing us + +HRESULT CBaseWindow::PrepareWindow() +{ + if (m_hwnd) return NOERROR; + ASSERT(m_hwnd == NULL); + ASSERT(m_hdc == NULL); + + // Get the derived object's window and class styles + + m_pClassName = GetClassWindowStyles(&m_ClassStyles, + &m_WindowStyles, + &m_WindowStylesEx); + if (m_pClassName == NULL) { + return E_FAIL; + } + + // Register our special private messages + m_ShowStageMessage = RegisterWindowMessage(SHOWSTAGE); + + // RegisterWindowMessage() returns 0 if an error occurs. + if (0 == m_ShowStageMessage) { + return AmGetLastErrorToHResult(); + } + + m_ShowStageTop = RegisterWindowMessage(SHOWSTAGETOP); + if (0 == m_ShowStageTop) { + return AmGetLastErrorToHResult(); + } + + m_RealizePalette = RegisterWindowMessage(REALIZEPALETTE); + if (0 == m_RealizePalette) { + return AmGetLastErrorToHResult(); + } + + MsgDestroy = RegisterWindowMessage(TEXT("AM_DESTROY")); + if (0 == MsgDestroy) { + return AmGetLastErrorToHResult(); + } + + return DoCreateWindow(); +} + + +// Destructor just a placeholder so that we know it becomes virtual +// Derived classes MUST call DoneWithWindow in their destructors so +// that no messages arrive after the derived class constructor ends + +#ifdef DEBUG +CBaseWindow::~CBaseWindow() +{ + ASSERT(m_hwnd == NULL); + ASSERT(m_hdc == NULL); +} +#endif + + +// We use the sync worker event to have the window destroyed. All we do is +// signal the event and wait on the window thread handle. Trying to send it +// messages causes too many problems, furthermore to be on the safe side we +// just wait on the thread handle while it returns WAIT_TIMEOUT or there is +// a sent message to process on this thread. If the constructor failed to +// create the thread in the first place then the loop will get terminated + +HRESULT CBaseWindow::DoneWithWindow() +{ + if (!IsWindow(m_hwnd) || (GetWindowThreadProcessId(m_hwnd, NULL) != GetCurrentThreadId())) { + + if (IsWindow(m_hwnd)) { + + // This code should only be executed if the window exists and if the window's + // messages are processed on a different thread. + ASSERT(GetWindowThreadProcessId(m_hwnd, NULL) != GetCurrentThreadId()); + + if (m_bDoPostToDestroy) { + + HRESULT hr = S_OK; + CAMEvent m_evDone(FALSE, &hr); + if (FAILED(hr)) { + return hr; + } + + // We must post a message to destroy the window + // That way we can't be in the middle of processing a + // message posted to our window when we do go away + // Sending a message gives less synchronization. + PostMessage(m_hwnd, MsgDestroy, (WPARAM)(HANDLE)m_evDone, 0); + WaitDispatchingMessages(m_evDone, INFINITE); + } else { + SendMessage(m_hwnd, MsgDestroy, 0, 0); + } + } + + // + // This is not a leak, the window manager automatically free's + // hdc's that were got via GetDC, which is the case here. + // We set it to NULL so that we don't get any asserts later. + // + m_hdc = NULL; + + // + // We need to free this DC though because USER32 does not know + // anything about it. + // + if (m_MemoryDC) + { + EXECUTE_ASSERT(DeleteDC(m_MemoryDC)); + m_MemoryDC = NULL; + } + + // Reset the window variables + m_hwnd = NULL; + + return NOERROR; + } + const HWND hwnd = m_hwnd; + if (hwnd == NULL) { + return NOERROR; + } + + InactivateWindow(); + NOTE("Inactivated"); + + // Reset the window styles before destruction + + SetWindowLong(hwnd,GWL_STYLE,m_WindowStyles); + ASSERT(GetParent(hwnd) == NULL); + NOTE1("Reset window styles %d",m_WindowStyles); + + // UnintialiseWindow sets m_hwnd to NULL so save a copy + UninitialiseWindow(); + DbgLog((LOG_TRACE, 2, TEXT("Destroying 0x%8.8X"), hwnd)); + if (!DestroyWindow(hwnd)) { + DbgLog((LOG_TRACE, 0, TEXT("DestroyWindow %8.8X failed code %d"), + hwnd, GetLastError())); + DbgBreak(""); + } + + // Reset our state so we can be prepared again + + m_pClassName = NULL; + m_ClassStyles = 0; + m_WindowStyles = 0; + m_WindowStylesEx = 0; + m_ShowStageMessage = 0; + m_ShowStageTop = 0; + + return NOERROR; +} + + +// Called at the end to put the window in an inactive state. The pending list +// will always have been cleared by this time so event if the worker thread +// gets has been signaled and gets in to render something it will find both +// the state has been changed and that there are no available sample images +// Since we wait on the window thread to complete we don't lock the object + +HRESULT CBaseWindow::InactivateWindow() +{ + // Has the window been activated + if (m_bActivated == FALSE) { + return S_FALSE; + } + + m_bActivated = FALSE; + ShowWindow(m_hwnd,SW_HIDE); + return NOERROR; +} + + +HRESULT CBaseWindow::CompleteConnect() +{ + m_bActivated = FALSE; + return NOERROR; +} + +// This displays a normal window. We ask the base window class for default +// sizes which unless overriden will return DEFWIDTH and DEFHEIGHT. We go +// through a couple of extra hoops to get the client area the right size +// as the object specifies which accounts for the AdjustWindowRectEx calls +// We also DWORD align the left and top coordinates of the window here to +// maximise the chance of being able to use DCI/DirectDraw primary surface + +HRESULT CBaseWindow::ActivateWindow() +{ + // Has the window been sized and positioned already + + if (m_bActivated == TRUE || GetParent(m_hwnd) != NULL) { + + SetWindowPos(m_hwnd, // Our window handle + HWND_TOP, // Put it at the top + 0, 0, 0, 0, // Leave in current position + SWP_NOMOVE | // Don't change it's place + SWP_NOSIZE); // Change Z-order only + + m_bActivated = TRUE; + return S_FALSE; + } + + // Calculate the desired client rectangle + + RECT WindowRect, ClientRect = GetDefaultRect(); + GetWindowRect(m_hwnd,&WindowRect); + AdjustWindowRectEx(&ClientRect,GetWindowLong(m_hwnd,GWL_STYLE), + FALSE,GetWindowLong(m_hwnd,GWL_EXSTYLE)); + + // Align left and top edges on DWORD boundaries + + UINT WindowFlags = (SWP_NOACTIVATE | SWP_FRAMECHANGED); + WindowRect.left -= (WindowRect.left & 3); + WindowRect.top -= (WindowRect.top & 3); + + SetWindowPos(m_hwnd, // Window handle + HWND_TOP, // Put it at the top + WindowRect.left, // Align left edge + WindowRect.top, // And also top place + WIDTH(&ClientRect), // Horizontal size + HEIGHT(&ClientRect), // Vertical size + WindowFlags); // Don't show window + + m_bActivated = TRUE; + return NOERROR; +} + + +// This can be used to DWORD align the window for maximum performance + +HRESULT CBaseWindow::PerformanceAlignWindow() +{ + RECT ClientRect,WindowRect; + GetWindowRect(m_hwnd,&WindowRect); + ASSERT(m_bActivated == TRUE); + + // Don't do this if we're owned + + if (GetParent(m_hwnd)) { + return NOERROR; + } + + // Align left and top edges on DWORD boundaries + + GetClientRect(m_hwnd, &ClientRect); + MapWindowPoints(m_hwnd, HWND_DESKTOP, (LPPOINT) &ClientRect, 2); + WindowRect.left -= (ClientRect.left & 3); + WindowRect.top -= (ClientRect.top & 3); + UINT WindowFlags = (SWP_NOACTIVATE | SWP_NOSIZE); + + SetWindowPos(m_hwnd, // Window handle + HWND_TOP, // Put it at the top + WindowRect.left, // Align left edge + WindowRect.top, // And also top place + (int) 0,(int) 0, // Ignore these sizes + WindowFlags); // Don't show window + + return NOERROR; +} + + +// Install a palette into the base window - we may be called by a different +// thread to the one that owns the window. We have to be careful how we do +// the palette realisation as we could be a different thread to the window +// which would cause an inter thread send message. Therefore we realise the +// palette by sending it a special message but without the window locked + +HRESULT CBaseWindow::SetPalette(HPALETTE hPalette) +{ + // We must own the window lock during the change + { + CAutoLock cWindowLock(&m_WindowLock); + CAutoLock cPaletteLock(&m_PaletteLock); + ASSERT(hPalette); + m_hPalette = hPalette; + } + return SetPalette(); +} + + +HRESULT CBaseWindow::SetPalette() +{ + if (!m_bNoRealize) { + SendMessage(m_hwnd, m_RealizePalette, 0, 0); + return S_OK; + } else { + // Just select the palette + ASSERT(m_hdc); + ASSERT(m_MemoryDC); + + CAutoLock cPaletteLock(&m_PaletteLock); + SelectPalette(m_hdc,m_hPalette,m_bBackground); + SelectPalette(m_MemoryDC,m_hPalette,m_bBackground); + + return S_OK; + } +} + + +void CBaseWindow::UnsetPalette() +{ + CAutoLock cWindowLock(&m_WindowLock); + CAutoLock cPaletteLock(&m_PaletteLock); + + // Get a standard VGA colour palette + + HPALETTE hPalette = (HPALETTE) GetStockObject(DEFAULT_PALETTE); + ASSERT(hPalette); + + SelectPalette(GetWindowHDC(), hPalette, TRUE); + SelectPalette(GetMemoryHDC(), hPalette, TRUE); + + m_hPalette = NULL; +} + + +void CBaseWindow::LockPaletteLock() +{ + m_PaletteLock.Lock(); +} + + +void CBaseWindow::UnlockPaletteLock() +{ + m_PaletteLock.Unlock(); +} + + +// Realise our palettes in the window and device contexts + +HRESULT CBaseWindow::DoRealisePalette(BOOL bForceBackground) +{ + { + CAutoLock cPaletteLock(&m_PaletteLock); + + if (m_hPalette == NULL) { + return NOERROR; + } + + // Realize the palette on the window thread + ASSERT(m_hdc); + ASSERT(m_MemoryDC); + + SelectPalette(m_hdc,m_hPalette,m_bBackground || bForceBackground); + SelectPalette(m_MemoryDC,m_hPalette,m_bBackground); + } + + // If we grab a critical section here we can deadlock + // with the window thread because one of the side effects + // of RealizePalette is to send a WM_PALETTECHANGED message + // to every window in the system. In our handling + // of WM_PALETTECHANGED we used to grab this CS too. + // The really bad case is when our renderer calls DoRealisePalette() + // while we're in the middle of processing a palette change + // for another window. + // So don't hold the critical section while actually realising + // the palette. In any case USER is meant to manage palette + // handling - we shouldn't have to serialize everything as well + ASSERT(CritCheckOut(&m_WindowLock)); + ASSERT(CritCheckOut(&m_PaletteLock)); + + EXECUTE_ASSERT(RealizePalette(m_hdc) != GDI_ERROR); + EXECUTE_ASSERT(RealizePalette(m_MemoryDC) != GDI_ERROR); + + return (GdiFlush() == FALSE ? S_FALSE : S_OK); +} + + +// This is the global window procedure + +LRESULT CALLBACK WndProc(HWND hwnd, // Window handle + UINT uMsg, // Message ID + WPARAM wParam, // First parameter + LPARAM lParam) // Other parameter +{ + + // Get the window long that holds our window object pointer + // If it is NULL then we are initialising the window in which + // case the object pointer has been passed in the window creation + // structure. IF we get any messages before WM_NCCREATE we will + // pass them to DefWindowProc. + + CBaseWindow *pBaseWindow = _GetWindowLongPtr(hwnd,0); + + if (pBaseWindow == NULL) { + + // Get the structure pointer from the create struct. + // We can only do this for WM_NCCREATE which should be one of + // the first messages we receive. Anything before this will + // have to be passed to DefWindowProc (i.e. WM_GETMINMAXINFO) + + // If the message is WM_NCCREATE we set our pBaseWindow pointer + // and will then place it in the window structure + + // turn off WS_EX_LAYOUTRTL style for quartz windows + if (uMsg == WM_NCCREATE) { + SetWindowLong(hwnd, GWL_EXSTYLE, GetWindowLong(hwnd, GWL_EXSTYLE) & ~0x400000); + } + + if ((uMsg != WM_NCCREATE) + || (NULL == (pBaseWindow = *(CBaseWindow**) ((LPCREATESTRUCT)lParam)->lpCreateParams))) + { + return(DefWindowProc(hwnd, uMsg, wParam, lParam)); + } + + // Set the window LONG to be the object who created us +#ifdef DEBUG + SetLastError(0); // because of the way SetWindowLong works +#endif + + LONG_PTR rc = _SetWindowLongPtr(hwnd, (DWORD) 0, pBaseWindow); + + +#ifdef DEBUG + if (0 == rc) { + // SetWindowLong MIGHT have failed. (Read the docs which admit + // that it is awkward to work out if you have had an error.) + LONG lasterror = GetLastError(); + ASSERT(0 == lasterror); + // If this is not the case we have not set the pBaseWindow pointer + // into the window structure and we will blow up. + } +#endif + + } + // See if this is the packet of death + if (uMsg == MsgDestroy && uMsg != 0) { + pBaseWindow->DoneWithWindow(); + if (pBaseWindow->m_bDoPostToDestroy) { + EXECUTE_ASSERT(SetEvent((HANDLE)wParam)); + } + return 0; + } + return pBaseWindow->OnReceiveMessage(hwnd,uMsg,wParam,lParam); +} + + +// When the window size changes we adjust our member variables that +// contain the dimensions of the client rectangle for our window so +// that we come to render an image we will know whether to stretch + +BOOL CBaseWindow::OnSize(LONG Width, LONG Height) +{ + m_Width = Width; + m_Height = Height; + return TRUE; +} + + +// This function handles the WM_CLOSE message + +BOOL CBaseWindow::OnClose() +{ + ShowWindow(m_hwnd,SW_HIDE); + return TRUE; +} + + +// This is called by the worker window thread when it receives a terminate +// message from the window object destructor to delete all the resources we +// allocated during initialisation. By the time the worker thread exits all +// processing will have been completed as the source filter disconnection +// flushes the image pending sample, therefore the GdiFlush should succeed + +HRESULT CBaseWindow::UninitialiseWindow() +{ + // Have we already cleaned up + + if (m_hwnd == NULL) { + ASSERT(m_hdc == NULL); + ASSERT(m_MemoryDC == NULL); + return NOERROR; + } + + // Release the window resources + + EXECUTE_ASSERT(GdiFlush()); + + if (m_hdc) + { + EXECUTE_ASSERT(ReleaseDC(m_hwnd,m_hdc)); + m_hdc = NULL; + } + + if (m_MemoryDC) + { + EXECUTE_ASSERT(DeleteDC(m_MemoryDC)); + m_MemoryDC = NULL; + } + + // Reset the window variables + m_hwnd = NULL; + + return NOERROR; +} + + +// This is called by the worker window thread after it has created the main +// window and it wants to initialise the rest of the owner objects window +// variables such as the device contexts. We execute this function with the +// critical section still locked. Nothing in this function must generate any +// SendMessage calls to the window because this is executing on the window +// thread so the message will never be processed and we will deadlock + +HRESULT CBaseWindow::InitialiseWindow(HWND hwnd) +{ + // Initialise the window variables + + ASSERT(IsWindow(hwnd)); + m_hwnd = hwnd; + + if (m_bDoGetDC) + { + EXECUTE_ASSERT(m_hdc = GetDC(hwnd)); + EXECUTE_ASSERT(m_MemoryDC = CreateCompatibleDC(m_hdc)); + + EXECUTE_ASSERT(SetStretchBltMode(m_hdc,COLORONCOLOR)); + EXECUTE_ASSERT(SetStretchBltMode(m_MemoryDC,COLORONCOLOR)); + } + + return NOERROR; +} + +HRESULT CBaseWindow::DoCreateWindow() +{ + WNDCLASS wndclass; // Used to register classes + BOOL bRegistered; // Is this class registered + HWND hwnd; // Handle to our window + + bRegistered = GetClassInfo(m_hInstance, // Module instance + m_pClassName, // Window class + &wndclass); // Info structure + + // if the window is to be used for drawing puposes and we are getting a DC + // for the entire lifetime of the window then changes the class style to do + // say so. If we don't set this flag then the DC comes from the cache and is + // really bad. + if (m_bDoGetDC) + { + m_ClassStyles |= CS_OWNDC; + } + + if (bRegistered == FALSE) { + + // Register the renderer window class + + wndclass.lpszClassName = m_pClassName; + wndclass.style = m_ClassStyles; + wndclass.lpfnWndProc = WndProc; + wndclass.cbClsExtra = 0; + wndclass.cbWndExtra = sizeof(CBaseWindow *); + wndclass.hInstance = m_hInstance; + wndclass.hIcon = NULL; + wndclass.hCursor = LoadCursor (NULL, IDC_ARROW); + wndclass.hbrBackground = (HBRUSH) NULL; + wndclass.lpszMenuName = NULL; + + RegisterClass(&wndclass); + } + + // Create the frame window. Pass the pBaseWindow information in the + // CreateStruct which allows our message handling loop to get hold of + // the pBaseWindow pointer. + + CBaseWindow *pBaseWindow = this; // The owner window object + hwnd = CreateWindowEx(m_WindowStylesEx, // Extended styles + m_pClassName, // Registered name + TEXT("ActiveMovie Window"), // Window title + m_WindowStyles, // Window styles + CW_USEDEFAULT, // Start x position + CW_USEDEFAULT, // Start y position + DEFWIDTH, // Window width + DEFHEIGHT, // Window height + NULL, // Parent handle + NULL, // Menu handle + m_hInstance, // Instance handle + &pBaseWindow); // Creation data + + // If we failed signal an error to the object constructor (based on the + // last Win32 error on this thread) then signal the constructor thread + // to continue, release the mutex to let others have a go and exit + + if (hwnd == NULL) { + DWORD Error = GetLastError(); + return AmHresultFromWin32(Error); + } + + // Check the window LONG is the object who created us + ASSERT(GetWindowLongPtr(hwnd, 0) == (LONG_PTR)this); + + // Initialise the window and then signal the constructor so that it can + // continue and then finally unlock the object's critical section. The + // window class is left registered even after we terminate the thread + // as we don't know when the last window has been closed. So we allow + // the operating system to free the class resources as appropriate + + InitialiseWindow(hwnd); + + DbgLog((LOG_TRACE, 2, TEXT("Created window class (%s) HWND(%8.8X)"), + m_pClassName, hwnd)); + + return S_OK; +} + + +// The base class provides some default handling and calls DefWindowProc + +LRESULT CBaseWindow::OnReceiveMessage(HWND hwnd, // Window handle + UINT uMsg, // Message ID + WPARAM wParam, // First parameter + LPARAM lParam) // Other parameter +{ + ASSERT(IsWindow(hwnd)); + + if (PossiblyEatMessage(uMsg, wParam, lParam)) + return 0; + + // This is sent by the IVideoWindow SetWindowForeground method. If the + // window is invisible we will show it and make it topmost without the + // foreground focus. If the window is visible it will also be made the + // topmost window without the foreground focus. If wParam is TRUE then + // for both cases the window will be forced into the foreground focus + + if (uMsg == m_ShowStageMessage) { + + BOOL bVisible = IsWindowVisible(hwnd); + SetWindowPos(hwnd, HWND_TOP, 0, 0, 0, 0, + SWP_NOMOVE | SWP_NOSIZE | SWP_SHOWWINDOW | + (bVisible ? SWP_NOACTIVATE : 0)); + + // Should we bring the window to the foreground + if (wParam == TRUE) { + SetForegroundWindow(hwnd); + } + return (LRESULT) 1; + } + + // When we go fullscreen we have to add the WS_EX_TOPMOST style to the + // video window so that it comes out above any task bar (this is more + // relevant to WindowsNT than Windows95). However the SetWindowPos call + // must be on the same thread as that which created the window. The + // wParam parameter can be TRUE or FALSE to set and reset the topmost + + if (uMsg == m_ShowStageTop) { + HWND HwndTop = (wParam == TRUE ? HWND_TOPMOST : HWND_NOTOPMOST); + BOOL bVisible = IsWindowVisible(hwnd); + SetWindowPos(hwnd, HwndTop, 0, 0, 0, 0, + SWP_NOMOVE | SWP_NOSIZE | + (wParam == TRUE ? SWP_SHOWWINDOW : 0) | + (bVisible ? SWP_NOACTIVATE : 0)); + return (LRESULT) 1; + } + + // New palette stuff + if (uMsg == m_RealizePalette) { + ASSERT(m_hwnd == hwnd); + return OnPaletteChange(m_hwnd,WM_QUERYNEWPALETTE); + } + + switch (uMsg) { + + // Repaint the window if the system colours change + + case WM_SYSCOLORCHANGE: + + InvalidateRect(hwnd,NULL,FALSE); + return (LRESULT) 1; + + // Somebody has changed the palette + case WM_PALETTECHANGED: + + OnPaletteChange((HWND)wParam,uMsg); + return (LRESULT) 0; + + // We are about to receive the keyboard focus so we ask GDI to realise + // our logical palette again and hopefully it will be fully installed + // without any mapping having to be done during any picture rendering + + case WM_QUERYNEWPALETTE: + ASSERT(m_hwnd == hwnd); + return OnPaletteChange(m_hwnd,uMsg); + + // do NOT fwd WM_MOVE. the parameters are the location of the parent + // window, NOT what the renderer should be looking at. But we need + // to make sure the overlay is moved with the parent window, so we + // do this. + case WM_MOVE: + if (IsWindowVisible(m_hwnd)) { + PostMessage(m_hwnd,WM_PAINT,0,0); + } + break; + + // Store the width and height as useful base class members + + case WM_SIZE: + + OnSize(LOWORD(lParam), HIWORD(lParam)); + return (LRESULT) 0; + + // Intercept the WM_CLOSE messages to hide the window + + case WM_CLOSE: + + OnClose(); + return (LRESULT) 0; + } + return DefWindowProc(hwnd,uMsg,wParam,lParam); +} + + +// This handles the Windows palette change messages - if we do realise our +// palette then we return TRUE otherwise we return FALSE. If our window is +// foreground application then we should get first choice of colours in the +// system palette entries. We get best performance when our logical palette +// includes the standard VGA colours (at the beginning and end) otherwise +// GDI may have to map from our palette to the device palette while drawing + +LRESULT CBaseWindow::OnPaletteChange(HWND hwnd,UINT Message) +{ + // First check we are not changing the palette during closedown + + if (m_hwnd == NULL || hwnd == NULL) { + return (LRESULT) 0; + } + ASSERT(!m_bRealizing); + + // Should we realise our palette again + + if ((Message == WM_QUERYNEWPALETTE || hwnd != m_hwnd)) { + // It seems that even if we're invisible that we can get asked + // to realize our palette and this can cause really ugly side-effects + // Seems like there's another bug but this masks it a least for the + // shutting down case. + if (!IsWindowVisible(m_hwnd)) { + DbgLog((LOG_TRACE, 1, TEXT("Realizing when invisible!"))); + return (LRESULT) 0; + } + + // Avoid recursion with multiple graphs in the same app +#ifdef DEBUG + m_bRealizing = TRUE; +#endif + DoRealisePalette(Message != WM_QUERYNEWPALETTE); +#ifdef DEBUG + m_bRealizing = FALSE; +#endif + + // Should we redraw the window with the new palette + if (Message == WM_PALETTECHANGED) { + InvalidateRect(m_hwnd,NULL,FALSE); + } + } + + return (LRESULT) 1; +} + + +// Determine if the window exists. + +bool CBaseWindow::WindowExists() +{ + return !!IsWindow(m_hwnd); +} + + +// Return the default window rectangle + +RECT CBaseWindow::GetDefaultRect() +{ + RECT DefaultRect = {0,0,DEFWIDTH,DEFHEIGHT}; + ASSERT(m_hwnd); + // ASSERT(m_hdc); + return DefaultRect; +} + + +// Return the current window width + +LONG CBaseWindow::GetWindowWidth() +{ + ASSERT(m_hwnd); + // ASSERT(m_hdc); + return m_Width; +} + + +// Return the current window height + +LONG CBaseWindow::GetWindowHeight() +{ + ASSERT(m_hwnd); + // ASSERT(m_hdc); + return m_Height; +} + + +// Return the window handle + +HWND CBaseWindow::GetWindowHWND() +{ + ASSERT(m_hwnd); + // ASSERT(m_hdc); + return m_hwnd; +} + + +// Return the window drawing device context + +HDC CBaseWindow::GetWindowHDC() +{ + ASSERT(m_hwnd); + ASSERT(m_hdc); + return m_hdc; +} + + +// Return the offscreen window drawing device context + +HDC CBaseWindow::GetMemoryHDC() +{ + ASSERT(m_hwnd); + ASSERT(m_MemoryDC); + return m_MemoryDC; +} + + +#ifdef DEBUG +HPALETTE CBaseWindow::GetPalette() +{ + // The palette lock should always be held when accessing + // m_hPalette. + ASSERT(CritCheckIn(&m_PaletteLock)); + return m_hPalette; +} +#endif // DEBUG + + +// This is available to clients who want to change the window visiblity. It's +// little more than an indirection to the Win32 ShowWindow although these is +// some benefit in going through here as this function may change sometime + +HRESULT CBaseWindow::DoShowWindow(LONG ShowCmd) +{ + ShowWindow(m_hwnd,ShowCmd); + return NOERROR; +} + + +// Generate a WM_PAINT message for the video window + +void CBaseWindow::PaintWindow(BOOL bErase) +{ + InvalidateRect(m_hwnd,NULL,bErase); +} + + +// Allow an application to have us set the video window in the foreground. We +// have this because it is difficult for one thread to do do this to a window +// owned by another thread. Rather than expose the message we use to execute +// the inter thread send message we provide the interface function. All we do +// is to SendMessage to the video window renderer thread with a WM_SHOWSTAGE + +void CBaseWindow::DoSetWindowForeground(BOOL bFocus) +{ + SendMessage(m_hwnd,m_ShowStageMessage,(WPARAM) bFocus,(LPARAM) 0); +} + + +// Constructor initialises the owning object pointer. Since we are a worker +// class for the main window object we have relatively few state variables to +// look after. We are given device context handles to use later on as well as +// the source and destination rectangles (but reset them here just in case) + +CDrawImage::CDrawImage(__inout CBaseWindow *pBaseWindow) : + m_pBaseWindow(pBaseWindow), + m_hdc(NULL), + m_MemoryDC(NULL), + m_bStretch(FALSE), + m_pMediaType(NULL), + m_bUsingImageAllocator(FALSE) +{ + ASSERT(pBaseWindow); + ResetPaletteVersion(); + SetRectEmpty(&m_TargetRect); + SetRectEmpty(&m_SourceRect); + + m_perfidRenderTime = MSR_REGISTER(TEXT("Single Blt time")); +} + + +// Overlay the image time stamps on the picture. Access to this method is +// serialised by the caller. We display the sample start and end times on +// top of the video using TextOut on the device context we are handed. If +// there isn't enough room in the window for the times we don't show them + +void CDrawImage::DisplaySampleTimes(IMediaSample *pSample) +{ +#ifdef DEBUG + // + // Only allow the "annoying" time messages if the users has turned the + // logging "way up" + // + BOOL bAccept = DbgCheckModuleLevel(LOG_TRACE, 5); + if (bAccept == FALSE) { + return; + } +#endif + + TCHAR szTimes[TIMELENGTH]; // Time stamp strings + ASSERT(pSample); // Quick sanity check + RECT ClientRect; // Client window size + SIZE Size; // Size of text output + + // Get the time stamps and window size + + pSample->GetTime((REFERENCE_TIME*)&m_StartSample, (REFERENCE_TIME*)&m_EndSample); + HWND hwnd = m_pBaseWindow->GetWindowHWND(); + EXECUTE_ASSERT(GetClientRect(hwnd,&ClientRect)); + + // Format the sample time stamps + + (void)StringCchPrintf(szTimes,NUMELMS(szTimes),TEXT("%08d : %08d"), + m_StartSample.Millisecs(), + m_EndSample.Millisecs()); + + ASSERT(lstrlen(szTimes) < TIMELENGTH); + + // Put the times in the middle at the bottom of the window + + GetTextExtentPoint32(m_hdc,szTimes,lstrlen(szTimes),&Size); + INT XPos = ((ClientRect.right - ClientRect.left) - Size.cx) / 2; + INT YPos = ((ClientRect.bottom - ClientRect.top) - Size.cy) * 4 / 5; + + // Check the window is big enough to have sample times displayed + + if ((XPos > 0) && (YPos > 0)) { + TextOut(m_hdc,XPos,YPos,szTimes,lstrlen(szTimes)); + } +} + + +// This is called when the drawing code sees that the image has a down level +// palette cookie. We simply call the SetDIBColorTable Windows API with the +// palette that is found after the BITMAPINFOHEADER - we return no errors + +void CDrawImage::UpdateColourTable(HDC hdc,__in BITMAPINFOHEADER *pbmi) +{ + ASSERT(pbmi->biClrUsed); + RGBQUAD *pColourTable = (RGBQUAD *)(pbmi+1); + + // Set the new palette in the device context + + UINT uiReturn = SetDIBColorTable(hdc,(UINT) 0, + pbmi->biClrUsed, + pColourTable); + + // Should always succeed but check in debug builds + ASSERT(uiReturn == pbmi->biClrUsed); +} + + +// No source rectangle scaling is done by the base class + +RECT CDrawImage::ScaleSourceRect(const RECT *pSource) +{ + ASSERT(pSource); + return *pSource; +} + + +// This is called when the funky output pin uses our allocator. The samples we +// allocate are special because the memory is shared between us and GDI thus +// removing one copy when we ask for the image to be rendered. The source type +// information is in the main renderer m_mtIn field which is initialised when +// the media type is agreed in SetMediaType, the media type may be changed on +// the fly if, for example, the source filter needs to change the palette + +void CDrawImage::FastRender(IMediaSample *pMediaSample) +{ + BITMAPINFOHEADER *pbmi; // Image format data + DIBDATA *pDibData; // Stores DIB information + BYTE *pImage; // Pointer to image data + HBITMAP hOldBitmap; // Store the old bitmap + CImageSample *pSample; // Pointer to C++ object + + ASSERT(m_pMediaType); + + // From the untyped source format block get the VIDEOINFO and subsequently + // the BITMAPINFOHEADER structure. We can cast the IMediaSample interface + // to a CImageSample object so we can retrieve it's DIBSECTION details + + pbmi = HEADER(m_pMediaType->Format()); + pSample = (CImageSample *) pMediaSample; + pDibData = pSample->GetDIBData(); + hOldBitmap = (HBITMAP) SelectObject(m_MemoryDC,pDibData->hBitmap); + + // Get a pointer to the real image data + + HRESULT hr = pMediaSample->GetPointer(&pImage); + if (FAILED(hr)) { + return; + } + + // Do we need to update the colour table, we increment our palette cookie + // each time we get a dynamic format change. The sample palette cookie is + // stored in the DIBDATA structure so we try to keep the fields in sync + // By the time we get to draw the images the format change will be done + // so all we do is ask the renderer for what it's palette version is + + if (pDibData->PaletteVersion < GetPaletteVersion()) { + ASSERT(pbmi->biBitCount <= iPALETTE); + UpdateColourTable(m_MemoryDC,pbmi); + pDibData->PaletteVersion = GetPaletteVersion(); + } + + // This allows derived classes to change the source rectangle that we do + // the drawing with. For example a renderer may ask a codec to stretch + // the video from 320x240 to 640x480, in which case the source we see in + // here will still be 320x240, although the source we want to draw with + // should be scaled up to 640x480. The base class implementation of this + // method does nothing but return the same rectangle as we are passed in + + RECT SourceRect = ScaleSourceRect(&m_SourceRect); + + // Is the window the same size as the video + + if (m_bStretch == FALSE) { + + // Put the image straight into the window + + BitBlt( + (HDC) m_hdc, // Target device HDC + m_TargetRect.left, // X sink position + m_TargetRect.top, // Y sink position + m_TargetRect.right - m_TargetRect.left, // Destination width + m_TargetRect.bottom - m_TargetRect.top, // Destination height + m_MemoryDC, // Source device context + SourceRect.left, // X source position + SourceRect.top, // Y source position + SRCCOPY); // Simple copy + + } else { + + // Stretch the image when copying to the window + + StretchBlt( + (HDC) m_hdc, // Target device HDC + m_TargetRect.left, // X sink position + m_TargetRect.top, // Y sink position + m_TargetRect.right - m_TargetRect.left, // Destination width + m_TargetRect.bottom - m_TargetRect.top, // Destination height + m_MemoryDC, // Source device HDC + SourceRect.left, // X source position + SourceRect.top, // Y source position + SourceRect.right - SourceRect.left, // Source width + SourceRect.bottom - SourceRect.top, // Source height + SRCCOPY); // Simple copy + } + + // This displays the sample times over the top of the image. This used to + // draw the times into the offscreen device context however that actually + // writes the text into the image data buffer which may not be writable + + #ifdef DEBUG + DisplaySampleTimes(pMediaSample); + #endif + + // Put the old bitmap back into the device context so we don't leak + SelectObject(m_MemoryDC,hOldBitmap); +} + + +// This is called when there is a sample ready to be drawn, unfortunately the +// output pin was being rotten and didn't choose our super excellent shared +// memory DIB allocator so we have to do this slow render using boring old GDI +// SetDIBitsToDevice and StretchDIBits. The down side of using these GDI +// functions is that the image data has to be copied across from our address +// space into theirs before going to the screen (although in reality the cost +// is small because all they do is to map the buffer into their address space) + +void CDrawImage::SlowRender(IMediaSample *pMediaSample) +{ + // Get the BITMAPINFOHEADER for the connection + + ASSERT(m_pMediaType); + BITMAPINFOHEADER *pbmi = HEADER(m_pMediaType->Format()); + BYTE *pImage; + + // Get the image data buffer + + HRESULT hr = pMediaSample->GetPointer(&pImage); + if (FAILED(hr)) { + return; + } + + // This allows derived classes to change the source rectangle that we do + // the drawing with. For example a renderer may ask a codec to stretch + // the video from 320x240 to 640x480, in which case the source we see in + // here will still be 320x240, although the source we want to draw with + // should be scaled up to 640x480. The base class implementation of this + // method does nothing but return the same rectangle as we are passed in + + RECT SourceRect = ScaleSourceRect(&m_SourceRect); + + LONG lAdjustedSourceTop = SourceRect.top; + // if the origin of bitmap is bottom-left, adjust soruce_rect_top + // to be the bottom-left corner instead of the top-left. + if (pbmi->biHeight > 0) { + lAdjustedSourceTop = pbmi->biHeight - SourceRect.bottom; + } + // Is the window the same size as the video + + if (m_bStretch == FALSE) { + + // Put the image straight into the window + + SetDIBitsToDevice( + (HDC) m_hdc, // Target device HDC + m_TargetRect.left, // X sink position + m_TargetRect.top, // Y sink position + m_TargetRect.right - m_TargetRect.left, // Destination width + m_TargetRect.bottom - m_TargetRect.top, // Destination height + SourceRect.left, // X source position + lAdjustedSourceTop, // Adjusted Y source position + (UINT) 0, // Start scan line + pbmi->biHeight, // Scan lines present + pImage, // Image data + (BITMAPINFO *) pbmi, // DIB header + DIB_RGB_COLORS); // Type of palette + + } else { + + // Stretch the image when copying to the window + + StretchDIBits( + (HDC) m_hdc, // Target device HDC + m_TargetRect.left, // X sink position + m_TargetRect.top, // Y sink position + m_TargetRect.right - m_TargetRect.left, // Destination width + m_TargetRect.bottom - m_TargetRect.top, // Destination height + SourceRect.left, // X source position + lAdjustedSourceTop, // Adjusted Y source position + SourceRect.right - SourceRect.left, // Source width + SourceRect.bottom - SourceRect.top, // Source height + pImage, // Image data + (BITMAPINFO *) pbmi, // DIB header + DIB_RGB_COLORS, // Type of palette + SRCCOPY); // Simple image copy + } + + // This shows the sample reference times over the top of the image which + // looks a little flickery. I tried using GdiSetBatchLimit and GdiFlush to + // control the screen updates but it doesn't quite work as expected and + // only partially reduces the flicker. I also tried using a memory context + // and combining the two in that before doing a final BitBlt operation to + // the screen, unfortunately this has considerable performance penalties + // and also means that this code is not executed when compiled retail + + #ifdef DEBUG + DisplaySampleTimes(pMediaSample); + #endif +} + + +// This is called with an IMediaSample interface on the image to be drawn. We +// decide on the drawing mechanism based on who's allocator we are using. We +// may be called when the window wants an image painted by WM_PAINT messages +// We can't realise the palette here because we have the renderer lock, any +// call to realise may cause an interthread send message to the window thread +// which may in turn be waiting to get the renderer lock before servicing it + +BOOL CDrawImage::DrawImage(IMediaSample *pMediaSample) +{ + ASSERT(m_hdc); + ASSERT(m_MemoryDC); + NotifyStartDraw(); + + // If the output pin used our allocator then the samples passed are in + // fact CVideoSample objects that contain CreateDIBSection data that we + // use to do faster image rendering, they may optionally also contain a + // DirectDraw surface pointer in which case we do not do the drawing + + if (m_bUsingImageAllocator == FALSE) { + SlowRender(pMediaSample); + EXECUTE_ASSERT(GdiFlush()); + NotifyEndDraw(); + return TRUE; + } + + // This is a DIBSECTION buffer + + FastRender(pMediaSample); + EXECUTE_ASSERT(GdiFlush()); + NotifyEndDraw(); + return TRUE; +} + + +BOOL CDrawImage::DrawVideoImageHere( + HDC hdc, + IMediaSample *pMediaSample, + __in LPRECT lprcSrc, + __in LPRECT lprcDst + ) +{ + ASSERT(m_pMediaType); + BITMAPINFOHEADER *pbmi = HEADER(m_pMediaType->Format()); + BYTE *pImage; + + // Get the image data buffer + + HRESULT hr = pMediaSample->GetPointer(&pImage); + if (FAILED(hr)) { + return FALSE; + } + + RECT SourceRect; + RECT TargetRect; + + if (lprcSrc) { + SourceRect = *lprcSrc; + } + else SourceRect = ScaleSourceRect(&m_SourceRect); + + if (lprcDst) { + TargetRect = *lprcDst; + } + else TargetRect = m_TargetRect; + + LONG lAdjustedSourceTop = SourceRect.top; + // if the origin of bitmap is bottom-left, adjust soruce_rect_top + // to be the bottom-left corner instead of the top-left. + if (pbmi->biHeight > 0) { + lAdjustedSourceTop = pbmi->biHeight - SourceRect.bottom; + } + + + // Stretch the image when copying to the DC + + BOOL bRet = (0 != StretchDIBits(hdc, + TargetRect.left, + TargetRect.top, + TargetRect.right - TargetRect.left, + TargetRect.bottom - TargetRect.top, + SourceRect.left, + lAdjustedSourceTop, + SourceRect.right - SourceRect.left, + SourceRect.bottom - SourceRect.top, + pImage, + (BITMAPINFO *)pbmi, + DIB_RGB_COLORS, + SRCCOPY)); + return bRet; +} + + +// This is called by the owning window object after it has created the window +// and it's drawing contexts. We are constructed with the base window we'll +// be drawing into so when given the notification we retrive the device HDCs +// to draw with. We cannot call these in our constructor as they are virtual + +void CDrawImage::SetDrawContext() +{ + m_MemoryDC = m_pBaseWindow->GetMemoryHDC(); + m_hdc = m_pBaseWindow->GetWindowHDC(); +} + + +// This is called to set the target rectangle in the video window, it will be +// called whenever a WM_SIZE message is retrieved from the message queue. We +// simply store the rectangle and use it later when we do the drawing calls + +void CDrawImage::SetTargetRect(__in RECT *pTargetRect) +{ + ASSERT(pTargetRect); + m_TargetRect = *pTargetRect; + SetStretchMode(); +} + + +// Return the current target rectangle + +void CDrawImage::GetTargetRect(__out RECT *pTargetRect) +{ + ASSERT(pTargetRect); + *pTargetRect = m_TargetRect; +} + + +// This is called when we want to change the section of the image to draw. We +// use this information in the drawing operation calls later on. We must also +// see if the source and destination rectangles have the same dimensions. If +// not we must stretch during the drawing rather than a direct pixel copy + +void CDrawImage::SetSourceRect(__in RECT *pSourceRect) +{ + ASSERT(pSourceRect); + m_SourceRect = *pSourceRect; + SetStretchMode(); +} + + +// Return the current source rectangle + +void CDrawImage::GetSourceRect(__out RECT *pSourceRect) +{ + ASSERT(pSourceRect); + *pSourceRect = m_SourceRect; +} + + +// This is called when either the source or destination rectanges change so we +// can update the stretch flag. If the rectangles don't match we stretch the +// video during the drawing otherwise we call the fast pixel copy functions +// NOTE the source and/or the destination rectangle may be completely empty + +void CDrawImage::SetStretchMode() +{ + // Calculate the overall rectangle dimensions + + LONG SourceWidth = m_SourceRect.right - m_SourceRect.left; + LONG SinkWidth = m_TargetRect.right - m_TargetRect.left; + LONG SourceHeight = m_SourceRect.bottom - m_SourceRect.top; + LONG SinkHeight = m_TargetRect.bottom - m_TargetRect.top; + + m_bStretch = TRUE; + if (SourceWidth == SinkWidth) { + if (SourceHeight == SinkHeight) { + m_bStretch = FALSE; + } + } +} + + +// Tell us whose allocator we are using. This should be called with TRUE if +// the filter agrees to use an allocator based around the CImageAllocator +// SDK base class - whose image buffers are made through CreateDIBSection. +// Otherwise this should be called with FALSE and we will draw the images +// using SetDIBitsToDevice and StretchDIBitsToDevice. None of these calls +// can handle buffers which have non zero strides (like DirectDraw uses) + +void CDrawImage::NotifyAllocator(BOOL bUsingImageAllocator) +{ + m_bUsingImageAllocator = bUsingImageAllocator; +} + + +// Are we using the image DIBSECTION allocator + +BOOL CDrawImage::UsingImageAllocator() +{ + return m_bUsingImageAllocator; +} + + +// We need the media type of the connection so that we can get the BITMAPINFO +// from it. We use that in the calls to draw the image such as StretchDIBits +// and also when updating the colour table held in shared memory DIBSECTIONs + +void CDrawImage::NotifyMediaType(__in CMediaType *pMediaType) +{ + m_pMediaType = pMediaType; +} + + +// We store in this object a cookie maintaining the current palette version. +// Each time a palettised format is changed we increment this value so that +// when we come to draw the images we look at the colour table value they +// have and if less than the current we know to update it. This version is +// only needed and indeed used when working with shared memory DIBSECTIONs + +LONG CDrawImage::GetPaletteVersion() +{ + return m_PaletteVersion; +} + + +// Resets the current palette version number + +void CDrawImage::ResetPaletteVersion() +{ + m_PaletteVersion = PALETTE_VERSION; +} + + +// Increment the current palette version + +void CDrawImage::IncrementPaletteVersion() +{ + m_PaletteVersion++; +} + + +// Constructor must initialise the base allocator. Each sample we create has a +// palette version cookie on board. When the source filter changes the palette +// during streaming the window object increments an internal cookie counter it +// keeps as well. When it comes to render the samples it looks at the cookie +// values and if they don't match then it knows to update the sample's colour +// table. However we always create samples with a cookie of PALETTE_VERSION +// If there have been multiple format changes and we disconnect and reconnect +// thereby causing the samples to be reallocated we will create them with a +// cookie much lower than the current version, this isn't a problem since it +// will be seen by the window object and the versions will then be updated + +CImageAllocator::CImageAllocator(__inout CBaseFilter *pFilter, + __in_opt LPCTSTR pName, + __inout HRESULT *phr) : + CBaseAllocator(pName,NULL,phr,TRUE,TRUE), + m_pFilter(pFilter) +{ + ASSERT(phr); + ASSERT(pFilter); +} + + +// Check our DIB buffers have been released + +#ifdef DEBUG +CImageAllocator::~CImageAllocator() +{ + ASSERT(m_bCommitted == FALSE); +} +#endif + + +// Called from destructor and also from base class to free resources. We work +// our way through the list of media samples deleting the DIBSECTION created +// for each. All samples should be back in our list so there is no chance a +// filter is still using one to write on the display or hold on a pending list + +void CImageAllocator::Free() +{ + ASSERT(m_lAllocated == m_lFree.GetCount()); + EXECUTE_ASSERT(GdiFlush()); + CImageSample *pSample; + DIBDATA *pDibData; + + while (m_lFree.GetCount() != 0) { + pSample = (CImageSample *) m_lFree.RemoveHead(); + pDibData = pSample->GetDIBData(); + EXECUTE_ASSERT(DeleteObject(pDibData->hBitmap)); + EXECUTE_ASSERT(CloseHandle(pDibData->hMapping)); + delete pSample; + } + + m_lAllocated = 0; +} + + +// Prepare the allocator by checking all the input parameters + +STDMETHODIMP CImageAllocator::CheckSizes(__in ALLOCATOR_PROPERTIES *pRequest) +{ + // Check we have a valid connection + + if (m_pMediaType == NULL) { + return VFW_E_NOT_CONNECTED; + } + + // NOTE We always create a DIB section with the source format type which + // may contain a source palette. When we do the BitBlt drawing operation + // the target display device may contain a different palette (we may not + // have the focus) in which case GDI will do after the palette mapping + + VIDEOINFOHEADER *pVideoInfo = (VIDEOINFOHEADER *) m_pMediaType->Format(); + + // When we call CreateDIBSection it implicitly maps only enough memory + // for the image as defined by thee BITMAPINFOHEADER. If the user asks + // for an image smaller than this then we reject the call, if they ask + // for an image larger than this then we return what they can have + + if ((DWORD) pRequest->cbBuffer < pVideoInfo->bmiHeader.biSizeImage) { + return E_INVALIDARG; + } + + // Reject buffer prefixes + + if (pRequest->cbPrefix > 0) { + return E_INVALIDARG; + } + + pRequest->cbBuffer = pVideoInfo->bmiHeader.biSizeImage; + return NOERROR; +} + + +// Agree the number of media sample buffers and their sizes. The base class +// this allocator is derived from allows samples to be aligned only on byte +// boundaries NOTE the buffers are not allocated until the Commit call + +STDMETHODIMP CImageAllocator::SetProperties( + __in ALLOCATOR_PROPERTIES * pRequest, + __out ALLOCATOR_PROPERTIES * pActual) +{ + ALLOCATOR_PROPERTIES Adjusted = *pRequest; + + // Check the parameters fit with the current connection + + HRESULT hr = CheckSizes(&Adjusted); + if (FAILED(hr)) { + return hr; + } + return CBaseAllocator::SetProperties(&Adjusted, pActual); +} + + +// Commit the memory by allocating the agreed number of media samples. For +// each sample we are committed to creating we have a CImageSample object +// that we use to manage it's resources. This is initialised with a DIBDATA +// structure that contains amongst other things the GDI DIBSECTION handle +// We will access the renderer media type during this so we must have locked +// (to prevent the format changing for example). The class overrides Commit +// and Decommit to do this locking (base class Commit in turn calls Alloc) + +HRESULT CImageAllocator::Alloc(void) +{ + ASSERT(m_pMediaType); + CImageSample *pSample; + DIBDATA DibData; + + // Check the base allocator says it's ok to continue + + HRESULT hr = CBaseAllocator::Alloc(); + if (FAILED(hr)) { + return hr; + } + + // We create a new memory mapped object although we don't map it into our + // address space because GDI does that in CreateDIBSection. It is possible + // that we run out of resources before creating all the samples in which + // case the available sample list is left with those already created + + ASSERT(m_lAllocated == 0); + while (m_lAllocated < m_lCount) { + + // Create and initialise a shared memory GDI buffer + + hr = CreateDIB(m_lSize,DibData); + if (FAILED(hr)) { + return hr; + } + + // Create the sample object and pass it the DIBDATA + + pSample = CreateImageSample(DibData.pBase,m_lSize); + if (pSample == NULL) { + EXECUTE_ASSERT(DeleteObject(DibData.hBitmap)); + EXECUTE_ASSERT(CloseHandle(DibData.hMapping)); + return E_OUTOFMEMORY; + } + + // Add the completed sample to the available list + + pSample->SetDIBData(&DibData); + m_lFree.Add(pSample); + m_lAllocated++; + } + return NOERROR; +} + + +// We have a virtual method that allocates the samples so that a derived class +// may override it and allocate more specialised sample objects. So long as it +// derives its samples from CImageSample then all this code will still work ok + +CImageSample *CImageAllocator::CreateImageSample(__in_bcount(Length) LPBYTE pData,LONG Length) +{ + HRESULT hr = NOERROR; + CImageSample *pSample; + + // Allocate the new sample and check the return codes + + pSample = new CImageSample((CBaseAllocator *) this, // Base class + NAME("Video sample"), // DEBUG name + (HRESULT *) &hr, // Return code + (LPBYTE) pData, // DIB address + (LONG) Length); // Size of DIB + + if (pSample == NULL || FAILED(hr)) { + delete pSample; + return NULL; + } + return pSample; +} + + +// This function allocates a shared memory block for use by the source filter +// generating DIBs for us to render. The memory block is created in shared +// memory so that GDI doesn't have to copy the memory when we do a BitBlt + +HRESULT CImageAllocator::CreateDIB(LONG InSize,DIBDATA &DibData) +{ + BITMAPINFO *pbmi; // Format information for pin + BYTE *pBase; // Pointer to the actual image + HANDLE hMapping; // Handle to mapped object + HBITMAP hBitmap; // DIB section bitmap handle + + // Create a file mapping object and map into our address space + + hMapping = CreateFileMapping(hMEMORY, // Use system page file + NULL, // No security attributes + PAGE_READWRITE, // Full access to memory + (DWORD) 0, // Less than 4Gb in size + InSize, // Size of buffer + NULL); // No name to section + if (hMapping == NULL) { + DWORD Error = GetLastError(); + return MAKE_HRESULT(SEVERITY_ERROR, FACILITY_WIN32, Error); + } + + // NOTE We always create a DIB section with the source format type which + // may contain a source palette. When we do the BitBlt drawing operation + // the target display device may contain a different palette (we may not + // have the focus) in which case GDI will do after the palette mapping + + pbmi = (BITMAPINFO *) HEADER(m_pMediaType->Format()); + if (m_pMediaType == NULL) { + DbgBreak("Invalid media type"); + } + + hBitmap = CreateDIBSection((HDC) NULL, // NO device context + pbmi, // Format information + DIB_RGB_COLORS, // Use the palette + (VOID **) &pBase, // Pointer to image data + hMapping, // Mapped memory handle + (DWORD) 0); // Offset into memory + + if (hBitmap == NULL || pBase == NULL) { + EXECUTE_ASSERT(CloseHandle(hMapping)); + DWORD Error = GetLastError(); + return MAKE_HRESULT(SEVERITY_ERROR, FACILITY_WIN32, Error); + } + + // Initialise the DIB information structure + + DibData.hBitmap = hBitmap; + DibData.hMapping = hMapping; + DibData.pBase = pBase; + DibData.PaletteVersion = PALETTE_VERSION; + GetObject(hBitmap,sizeof(DIBSECTION),(VOID *)&DibData.DibSection); + + return NOERROR; +} + + +// We use the media type during the DIBSECTION creation + +void CImageAllocator::NotifyMediaType(__in CMediaType *pMediaType) +{ + m_pMediaType = pMediaType; +} + + +// Overriden to increment the owning object's reference count + +STDMETHODIMP_(ULONG) CImageAllocator::NonDelegatingAddRef() +{ + return m_pFilter->AddRef(); +} + + +// Overriden to decrement the owning object's reference count + +STDMETHODIMP_(ULONG) CImageAllocator::NonDelegatingRelease() +{ + return m_pFilter->Release(); +} + + +// If you derive a class from CMediaSample that has to transport specialised +// member variables and entry points then there are three alternate solutions +// The first is to create a memory buffer larger than actually required by the +// sample and store your information either at the beginning of it or at the +// end, the former being moderately safer allowing for misbehaving transform +// filters. You then adjust the buffer address when you create the base media +// sample. This has the disadvantage of breaking up the memory allocated to +// the samples into separate blocks. The second solution is to implement a +// class derived from CMediaSample and support additional interface(s) that +// convey your private data. This means defining a custom interface. The final +// alternative is to create a class that inherits from CMediaSample and adds +// the private data structures, when you get an IMediaSample in your Receive() +// call check to see if your allocator is being used, and if it is then cast +// the IMediaSample into one of your objects. Additional checks can be made +// to ensure the sample's this pointer is known to be one of your own objects + +CImageSample::CImageSample(__inout CBaseAllocator *pAllocator, + __in_opt LPCTSTR pName, + __inout HRESULT *phr, + __in_bcount(length) LPBYTE pBuffer, + LONG length) : + CMediaSample(pName,pAllocator,phr,pBuffer,length), + m_bInit(FALSE) +{ + ASSERT(pAllocator); + ASSERT(pBuffer); +} + + +// Set the shared memory DIB information + +void CImageSample::SetDIBData(__in DIBDATA *pDibData) +{ + ASSERT(pDibData); + m_DibData = *pDibData; + m_bInit = TRUE; +} + + +// Retrieve the shared memory DIB data + +__out DIBDATA *CImageSample::GetDIBData() +{ + ASSERT(m_bInit == TRUE); + return &m_DibData; +} + + +// This class handles the creation of a palette. It is fairly specialist and +// is intended to simplify palette management for video renderer filters. It +// is for this reason that the constructor requires three other objects with +// which it interacts, namely a base media filter, a base window and a base +// drawing object although the base window or the draw object may be NULL to +// ignore that part of us. We try not to create and install palettes unless +// absolutely necessary as they typically require WM_PALETTECHANGED messages +// to be sent to every window thread in the system which is very expensive + +CImagePalette::CImagePalette(__inout CBaseFilter *pBaseFilter, + __inout CBaseWindow *pBaseWindow, + __inout CDrawImage *pDrawImage) : + m_pBaseWindow(pBaseWindow), + m_pFilter(pBaseFilter), + m_pDrawImage(pDrawImage), + m_hPalette(NULL) +{ + ASSERT(m_pFilter); +} + + +// Destructor + +#ifdef DEBUG +CImagePalette::~CImagePalette() +{ + ASSERT(m_hPalette == NULL); +} +#endif + + +// We allow dynamic format changes of the palette but rather than change the +// palette every time we call this to work out whether an update is required. +// If the original type didn't use a palette and the new one does (or vica +// versa) then we return TRUE. If neither formats use a palette we'll return +// FALSE. If both formats use a palette we compare their colours and return +// FALSE if they match. This therefore short circuits palette creation unless +// absolutely necessary since installing palettes is an expensive operation + +BOOL CImagePalette::ShouldUpdate(const VIDEOINFOHEADER *pNewInfo, + const VIDEOINFOHEADER *pOldInfo) +{ + // We may not have a current format yet + + if (pOldInfo == NULL) { + return TRUE; + } + + // Do both formats not require a palette + + if (ContainsPalette(pNewInfo) == FALSE) { + if (ContainsPalette(pOldInfo) == FALSE) { + return FALSE; + } + } + + // Compare the colours to see if they match + + DWORD VideoEntries = pNewInfo->bmiHeader.biClrUsed; + if (ContainsPalette(pNewInfo) == TRUE) + if (ContainsPalette(pOldInfo) == TRUE) + if (pOldInfo->bmiHeader.biClrUsed == VideoEntries) + if (pOldInfo->bmiHeader.biClrUsed > 0) + if (memcmp((PVOID) GetBitmapPalette(pNewInfo), + (PVOID) GetBitmapPalette(pOldInfo), + VideoEntries * sizeof(RGBQUAD)) == 0) { + + return FALSE; + } + return TRUE; +} + + +// This is normally called when the input pin type is set to install a palette +// We will typically be called from two different places. The first is when we +// have negotiated a palettised media type after connection, the other is when +// we receive a new type during processing with an updated palette in which +// case we must remove and release the resources held by the current palette + +// We can be passed an optional device name if we wish to prepare a palette +// for a specific monitor on a multi monitor system + +HRESULT CImagePalette::PreparePalette(const CMediaType *pmtNew, + const CMediaType *pmtOld, + __in LPSTR szDevice) +{ + const VIDEOINFOHEADER *pNewInfo = (VIDEOINFOHEADER *) pmtNew->Format(); + const VIDEOINFOHEADER *pOldInfo = (VIDEOINFOHEADER *) pmtOld->Format(); + ASSERT(pNewInfo); + + // This is an performance optimisation, when we get a media type we check + // to see if the format requires a palette change. If either we need one + // when previously we didn't or vica versa then this returns TRUE, if we + // previously needed a palette and we do now it compares their colours + + if (ShouldUpdate(pNewInfo,pOldInfo) == FALSE) { + NOTE("No update needed"); + return S_FALSE; + } + + // We must notify the filter graph that the application may have changed + // the palette although in practice we don't bother checking to see if it + // is really different. If it tries to get the palette either the window + // or renderer lock will ensure it doesn't get in until we are finished + + RemovePalette(); + m_pFilter->NotifyEvent(EC_PALETTE_CHANGED,0,0); + + // Do we need a palette for the new format + + if (ContainsPalette(pNewInfo) == FALSE) { + NOTE("New has no palette"); + return S_FALSE; + } + + if (m_pBaseWindow) { + m_pBaseWindow->LockPaletteLock(); + } + + // If we're changing the palette on the fly then we increment our palette + // cookie which is compared against the cookie also stored in all of our + // DIBSECTION media samples. If they don't match when we come to draw it + // then we know the sample is out of date and we'll update it's palette + + NOTE("Making new colour palette"); + m_hPalette = MakePalette(pNewInfo, szDevice); + ASSERT(m_hPalette != NULL); + + if (m_pBaseWindow) { + m_pBaseWindow->UnlockPaletteLock(); + } + + // The window in which the new palette is to be realised may be a NULL + // pointer to signal that no window is in use, if so we don't call it + // Some filters just want to use this object to create/manage palettes + + if (m_pBaseWindow) m_pBaseWindow->SetPalette(m_hPalette); + + // This is the only time where we need access to the draw object to say + // to it that a new palette will be arriving on a sample real soon. The + // constructor may take a NULL pointer in which case we don't call this + + if (m_pDrawImage) m_pDrawImage->IncrementPaletteVersion(); + return NOERROR; +} + + +// Helper function to copy a palette out of any kind of VIDEOINFO (ie it may +// be YUV or true colour) into a palettised VIDEOINFO. We use this changing +// palettes on DirectDraw samples as a source filter can attach a palette to +// any buffer (eg YUV) and hand it back. We make a new palette out of that +// format and then copy the palette colours into the current connection type + +HRESULT CImagePalette::CopyPalette(const CMediaType *pSrc,__out CMediaType *pDest) +{ + // Reset the destination palette before starting + + VIDEOINFOHEADER *pDestInfo = (VIDEOINFOHEADER *) pDest->Format(); + pDestInfo->bmiHeader.biClrUsed = 0; + pDestInfo->bmiHeader.biClrImportant = 0; + + // Does the destination have a palette + + if (PALETTISED(pDestInfo) == FALSE) { + NOTE("No destination palette"); + return S_FALSE; + } + + // Does the source contain a palette + + const VIDEOINFOHEADER *pSrcInfo = (VIDEOINFOHEADER *) pSrc->Format(); + if (ContainsPalette(pSrcInfo) == FALSE) { + NOTE("No source palette"); + return S_FALSE; + } + + // The number of colours may be zero filled + + DWORD PaletteEntries = pSrcInfo->bmiHeader.biClrUsed; + if (PaletteEntries == 0) { + DWORD Maximum = (1 << pSrcInfo->bmiHeader.biBitCount); + NOTE1("Setting maximum colours (%d)",Maximum); + PaletteEntries = Maximum; + } + + // Make sure the destination has enough room for the palette + + ASSERT(pSrcInfo->bmiHeader.biClrUsed <= iPALETTE_COLORS); + ASSERT(pSrcInfo->bmiHeader.biClrImportant <= PaletteEntries); + ASSERT(COLORS(pDestInfo) == GetBitmapPalette(pDestInfo)); + pDestInfo->bmiHeader.biClrUsed = PaletteEntries; + pDestInfo->bmiHeader.biClrImportant = pSrcInfo->bmiHeader.biClrImportant; + ULONG BitmapSize = GetBitmapFormatSize(HEADER(pSrcInfo)); + + if (pDest->FormatLength() < BitmapSize) { + NOTE("Reallocating destination"); + pDest->ReallocFormatBuffer(BitmapSize); + } + + // Now copy the palette colours across + + CopyMemory((PVOID) COLORS(pDestInfo), + (PVOID) GetBitmapPalette(pSrcInfo), + PaletteEntries * sizeof(RGBQUAD)); + + return NOERROR; +} + + +// This is normally called when the palette is changed (typically during a +// dynamic format change) to remove any palette we previously installed. We +// replace it (if necessary) in the video window with a standard VGA palette +// that should always be available even if this is a true colour display + +HRESULT CImagePalette::RemovePalette() +{ + if (m_pBaseWindow) { + m_pBaseWindow->LockPaletteLock(); + } + + // Do we have a palette to remove + + if (m_hPalette != NULL) { + + if (m_pBaseWindow) { + // Make sure that the window's palette handle matches + // our palette handle. + ASSERT(m_hPalette == m_pBaseWindow->GetPalette()); + + m_pBaseWindow->UnsetPalette(); + } + + EXECUTE_ASSERT(DeleteObject(m_hPalette)); + m_hPalette = NULL; + } + + if (m_pBaseWindow) { + m_pBaseWindow->UnlockPaletteLock(); + } + + return NOERROR; +} + + +// Called to create a palette for the object, the data structure used by GDI +// to describe a palette is a LOGPALETTE, this includes a variable number of +// PALETTEENTRY fields which are the colours, we have to convert the RGBQUAD +// colour fields we are handed in a BITMAPINFO from the media type into these +// This handles extraction of palettes from true colour and YUV media formats + +// We can be passed an optional device name if we wish to prepare a palette +// for a specific monitor on a multi monitor system + +HPALETTE CImagePalette::MakePalette(const VIDEOINFOHEADER *pVideoInfo, __in LPSTR szDevice) +{ + ASSERT(ContainsPalette(pVideoInfo) == TRUE); + ASSERT(pVideoInfo->bmiHeader.biClrUsed <= iPALETTE_COLORS); + BITMAPINFOHEADER *pHeader = HEADER(pVideoInfo); + + const RGBQUAD *pColours; // Pointer to the palette + LOGPALETTE *lp; // Used to create a palette + HPALETTE hPalette; // Logical palette object + + lp = (LOGPALETTE *) new BYTE[sizeof(LOGPALETTE) + SIZE_PALETTE]; + if (lp == NULL) { + return NULL; + } + + // Unfortunately for some hare brained reason a GDI palette entry (a + // PALETTEENTRY structure) is different to a palette entry from a DIB + // format (a RGBQUAD structure) so we have to do the field conversion + // The VIDEOINFO containing the palette may be a true colour type so + // we use GetBitmapPalette to skip over any bit fields if they exist + + lp->palVersion = PALVERSION; + lp->palNumEntries = (USHORT) pHeader->biClrUsed; + if (lp->palNumEntries == 0) lp->palNumEntries = (1 << pHeader->biBitCount); + pColours = GetBitmapPalette(pVideoInfo); + + for (DWORD dwCount = 0;dwCount < lp->palNumEntries;dwCount++) { + lp->palPalEntry[dwCount].peRed = pColours[dwCount].rgbRed; + lp->palPalEntry[dwCount].peGreen = pColours[dwCount].rgbGreen; + lp->palPalEntry[dwCount].peBlue = pColours[dwCount].rgbBlue; + lp->palPalEntry[dwCount].peFlags = 0; + } + + MakeIdentityPalette(lp->palPalEntry, lp->palNumEntries, szDevice); + + // Create a logical palette + + hPalette = CreatePalette(lp); + ASSERT(hPalette != NULL); + delete[] lp; + return hPalette; +} + + +// GDI does a fair job of compressing the palette entries you give it, so for +// example if you have five entries with an RGB colour (0,0,0) it will remove +// all but one of them. When you subsequently draw an image it will map from +// your logical palette to the compressed device palette. This function looks +// to see if it is trying to be an identity palette and if so sets the flags +// field in the PALETTEENTRYs so they remain expanded to boost performance + +// We can be passed an optional device name if we wish to prepare a palette +// for a specific monitor on a multi monitor system + +HRESULT CImagePalette::MakeIdentityPalette(__inout_ecount_full(iColours) PALETTEENTRY *pEntry,INT iColours, __in LPSTR szDevice) +{ + PALETTEENTRY SystemEntries[10]; // System palette entries + BOOL bIdentityPalette = TRUE; // Is an identity palette + ASSERT(iColours <= iPALETTE_COLORS); // Should have a palette + const int PalLoCount = 10; // First ten reserved colours + const int PalHiStart = 246; // Last VGA palette entries + + // Does this have the full colour range + + if (iColours < 10) { + return S_FALSE; + } + + // Apparently some displays have odd numbers of system colours + + // Get a DC on the right monitor - it's ugly, but this is the way you have + // to do it + HDC hdc; + if (szDevice == NULL || lstrcmpiLocaleIndependentA(szDevice, "DISPLAY") == 0) + hdc = CreateDCA("DISPLAY", NULL, NULL, NULL); + else + hdc = CreateDCA(NULL, szDevice, NULL, NULL); + if (NULL == hdc) { + return E_OUTOFMEMORY; + } + INT Reserved = GetDeviceCaps(hdc,NUMRESERVED); + if (Reserved != 20) { + DeleteDC(hdc); + return S_FALSE; + } + + // Compare our palette against the first ten system entries. The reason I + // don't do a memory compare between our two arrays of colours is because + // I am not sure what will be in the flags fields for the system entries + + UINT Result = GetSystemPaletteEntries(hdc,0,PalLoCount,SystemEntries); + for (UINT Count = 0;Count < Result;Count++) { + if (SystemEntries[Count].peRed != pEntry[Count].peRed || + SystemEntries[Count].peGreen != pEntry[Count].peGreen || + SystemEntries[Count].peBlue != pEntry[Count].peBlue) { + bIdentityPalette = FALSE; + } + } + + // And likewise compare against the last ten entries + + Result = GetSystemPaletteEntries(hdc,PalHiStart,PalLoCount,SystemEntries); + for (UINT Count = 0;Count < Result;Count++) { + if (INT(Count) + PalHiStart < iColours) { + if (SystemEntries[Count].peRed != pEntry[PalHiStart + Count].peRed || + SystemEntries[Count].peGreen != pEntry[PalHiStart + Count].peGreen || + SystemEntries[Count].peBlue != pEntry[PalHiStart + Count].peBlue) { + bIdentityPalette = FALSE; + } + } + } + + // If not an identity palette then return S_FALSE + + DeleteDC(hdc); + if (bIdentityPalette == FALSE) { + return S_FALSE; + } + + // Set the non VGA entries so that GDI doesn't map them + + for (UINT Count = PalLoCount;INT(Count) < min(PalHiStart,iColours);Count++) { + pEntry[Count].peFlags = PC_NOCOLLAPSE; + } + return NOERROR; +} + + +// Constructor initialises the VIDEOINFO we keep storing the current display +// format. The format can be changed at any time, to reset the format held +// by us call the RefreshDisplayType directly (it's a public method). Since +// more than one thread will typically call us (ie window threads resetting +// the type and source threads in the type checking methods) we have a lock + +CImageDisplay::CImageDisplay() +{ + RefreshDisplayType(NULL); +} + + + +// This initialises the format we hold which contains the display device type +// We do a conversion on the display device type in here so that when we start +// type checking input formats we can assume that certain fields have been set +// correctly, an example is when we make the 16 bit mask fields explicit. This +// is normally called when we receive WM_DEVMODECHANGED device change messages + +// The optional szDeviceName parameter tells us which monitor we are interested +// in for a multi monitor system + +HRESULT CImageDisplay::RefreshDisplayType(__in_opt LPSTR szDeviceName) +{ + CAutoLock cDisplayLock(this); + + // Set the preferred format type + + ZeroMemory((PVOID)&m_Display,sizeof(VIDEOINFOHEADER)+sizeof(TRUECOLORINFO)); + m_Display.bmiHeader.biSize = sizeof(BITMAPINFOHEADER); + m_Display.bmiHeader.biBitCount = FALSE; + + // Get the bit depth of a device compatible bitmap + + // get caps of whichever monitor they are interested in (multi monitor) + HDC hdcDisplay; + // it's ugly, but this is the way you have to do it + if (szDeviceName == NULL || lstrcmpiLocaleIndependentA(szDeviceName, "DISPLAY") == 0) + hdcDisplay = CreateDCA("DISPLAY", NULL, NULL, NULL); + else + hdcDisplay = CreateDCA(NULL, szDeviceName, NULL, NULL); + if (hdcDisplay == NULL) { + ASSERT(FALSE); + DbgLog((LOG_ERROR,1,TEXT("ACK! Can't get a DC for %hs"), + szDeviceName ? szDeviceName : "")); + return E_FAIL; + } else { + DbgLog((LOG_TRACE,3,TEXT("Created a DC for %s"), + szDeviceName ? szDeviceName : "")); + } + HBITMAP hbm = CreateCompatibleBitmap(hdcDisplay,1,1); + if ( hbm ) + { + GetDIBits(hdcDisplay,hbm,0,1,NULL,(BITMAPINFO *)&m_Display.bmiHeader,DIB_RGB_COLORS); + + // This call will get the colour table or the proper bitfields + GetDIBits(hdcDisplay,hbm,0,1,NULL,(BITMAPINFO *)&m_Display.bmiHeader,DIB_RGB_COLORS); + DeleteObject(hbm); + } + DeleteDC(hdcDisplay); + + // Complete the display type initialisation + + ASSERT(CheckHeaderValidity(&m_Display)); + UpdateFormat(&m_Display); + DbgLog((LOG_TRACE,3,TEXT("New DISPLAY bit depth =%d"), + m_Display.bmiHeader.biBitCount)); + return NOERROR; +} + + +// We assume throughout this code that any bitfields masks are allowed no +// more than eight bits to store a colour component. This checks that the +// bit count assumption is enforced and also makes sure that all the bits +// set are contiguous. We return a boolean TRUE if the field checks out ok + +BOOL CImageDisplay::CheckBitFields(const VIDEOINFO *pInput) +{ + DWORD *pBitFields = (DWORD *) BITMASKS(pInput); + + for (INT iColour = iRED;iColour <= iBLUE;iColour++) { + + // First of all work out how many bits are set + + DWORD SetBits = CountSetBits(pBitFields[iColour]); + if (SetBits > iMAXBITS || SetBits == 0) { + NOTE1("Bit fields for component %d invalid",iColour); + return FALSE; + } + + // Next work out the number of zero bits prefix + DWORD PrefixBits = CountPrefixBits(pBitFields[iColour]); + + // This is going to see if all the bits set are contiguous (as they + // should be). We know how much to shift them right by from the + // count of prefix bits. The number of bits set defines a mask, we + // invert this (ones complement) and AND it with the shifted bit + // fields. If the result is NON zero then there are bit(s) sticking + // out the left hand end which means they are not contiguous + + DWORD TestField = pBitFields[iColour] >> PrefixBits; + DWORD Mask = ULONG_MAX << SetBits; + if (TestField & Mask) { + NOTE1("Bit fields for component %d not contiguous",iColour); + return FALSE; + } + } + return TRUE; +} + + +// This counts the number of bits set in the input field + +DWORD CImageDisplay::CountSetBits(DWORD Field) +{ + // This is a relatively well known bit counting algorithm + + DWORD Count = 0; + DWORD init = Field; + + // Until the input is exhausted, count the number of bits + + while (init) { + init = init & (init - 1); // Turn off the bottommost bit + Count++; + } + return Count; +} + + +// This counts the number of zero bits upto the first one set NOTE the input +// field should have been previously checked to ensure there is at least one +// set although if we don't find one set we return the impossible value 32 + +DWORD CImageDisplay::CountPrefixBits(DWORD Field) +{ + DWORD Mask = 1; + DWORD Count = 0; + + while (TRUE) { + if (Field & Mask) { + return Count; + } + Count++; + + ASSERT(Mask != 0x80000000); + if (Mask == 0x80000000) { + return Count; + } + Mask <<= 1; + } +} + + +// This is called to check the BITMAPINFOHEADER for the input type. There are +// many implicit dependancies between the fields in a header structure which +// if we validate now make for easier manipulation in subsequent handling. We +// also check that the BITMAPINFOHEADER matches it's specification such that +// fields likes the number of planes is one, that it's structure size is set +// correctly and that the bitmap dimensions have not been set as negative + +BOOL CImageDisplay::CheckHeaderValidity(const VIDEOINFO *pInput) +{ + // Check the bitmap width and height are not negative. + + if (pInput->bmiHeader.biWidth <= 0 || + pInput->bmiHeader.biHeight <= 0) { + NOTE("Invalid bitmap dimensions"); + return FALSE; + } + + // Check the compression is either BI_RGB or BI_BITFIELDS + + if (pInput->bmiHeader.biCompression != BI_RGB) { + if (pInput->bmiHeader.biCompression != BI_BITFIELDS) { + NOTE("Invalid compression format"); + return FALSE; + } + } + + // If BI_BITFIELDS compression format check the colour depth + + if (pInput->bmiHeader.biCompression == BI_BITFIELDS) { + if (pInput->bmiHeader.biBitCount != 16) { + if (pInput->bmiHeader.biBitCount != 32) { + NOTE("BI_BITFIELDS not 16/32 bit depth"); + return FALSE; + } + } + } + + // Check the assumptions about the layout of the bit fields + + if (pInput->bmiHeader.biCompression == BI_BITFIELDS) { + if (CheckBitFields(pInput) == FALSE) { + NOTE("Bit fields are not valid"); + return FALSE; + } + } + + // Are the number of planes equal to one + + if (pInput->bmiHeader.biPlanes != 1) { + NOTE("Number of planes not one"); + return FALSE; + } + + // Check the image size is consistent (it can be zero) + + if (pInput->bmiHeader.biSizeImage != GetBitmapSize(&pInput->bmiHeader)) { + if (pInput->bmiHeader.biSizeImage) { + NOTE("Image size incorrectly set"); + return FALSE; + } + } + + // Check the size of the structure + + if (pInput->bmiHeader.biSize != sizeof(BITMAPINFOHEADER)) { + NOTE("Size of BITMAPINFOHEADER wrong"); + return FALSE; + } + return CheckPaletteHeader(pInput); +} + + +// This runs a few simple tests against the palette fields in the input to +// see if it looks vaguely correct. The tests look at the number of palette +// colours present, the number considered important and the biCompression +// field which should always be BI_RGB as no other formats are meaningful + +BOOL CImageDisplay::CheckPaletteHeader(const VIDEOINFO *pInput) +{ + // The checks here are for palettised videos only + + if (PALETTISED(pInput) == FALSE) { + if (pInput->bmiHeader.biClrUsed) { + NOTE("Invalid palette entries"); + return FALSE; + } + return TRUE; + } + + // Compression type of BI_BITFIELDS is meaningless for palette video + + if (pInput->bmiHeader.biCompression != BI_RGB) { + NOTE("Palettised video must be BI_RGB"); + return FALSE; + } + + // Check the number of palette colours is correct + + if (pInput->bmiHeader.biClrUsed > PALETTE_ENTRIES(pInput)) { + NOTE("Too many colours in palette"); + return FALSE; + } + + // The number of important colours shouldn't exceed the number used + + if (pInput->bmiHeader.biClrImportant > pInput->bmiHeader.biClrUsed) { + NOTE("Too many important colours"); + return FALSE; + } + return TRUE; +} + + +// Return the format of the video display + +const VIDEOINFO *CImageDisplay::GetDisplayFormat() +{ + return &m_Display; +} + + +// Return TRUE if the display uses a palette + +BOOL CImageDisplay::IsPalettised() +{ + return PALETTISED(&m_Display); +} + + +// Return the bit depth of the current display setting + +WORD CImageDisplay::GetDisplayDepth() +{ + return m_Display.bmiHeader.biBitCount; +} + + +// Initialise the optional fields in a VIDEOINFO. These are mainly to do with +// the source and destination rectangles and palette information such as the +// number of colours present. It simplifies our code just a little if we don't +// have to keep checking for all the different valid permutations in a header +// every time we want to do anything with it (an example would be creating a +// palette). We set the base class media type before calling this function so +// that the media types between the pins match after a connection is made + +HRESULT CImageDisplay::UpdateFormat(__inout VIDEOINFO *pVideoInfo) +{ + ASSERT(pVideoInfo); + + BITMAPINFOHEADER *pbmi = HEADER(pVideoInfo); + SetRectEmpty(&pVideoInfo->rcSource); + SetRectEmpty(&pVideoInfo->rcTarget); + + // Set the number of colours explicitly + + if (PALETTISED(pVideoInfo)) { + if (pVideoInfo->bmiHeader.biClrUsed == 0) { + pVideoInfo->bmiHeader.biClrUsed = PALETTE_ENTRIES(pVideoInfo); + } + } + + // The number of important colours shouldn't exceed the number used, on + // some displays the number of important colours is not initialised when + // retrieving the display type so we set the colours used correctly + + if (pVideoInfo->bmiHeader.biClrImportant > pVideoInfo->bmiHeader.biClrUsed) { + pVideoInfo->bmiHeader.biClrImportant = PALETTE_ENTRIES(pVideoInfo); + } + + // Change the image size field to be explicit + + if (pVideoInfo->bmiHeader.biSizeImage == 0) { + pVideoInfo->bmiHeader.biSizeImage = GetBitmapSize(&pVideoInfo->bmiHeader); + } + return NOERROR; +} + + +// Lots of video rendering filters want code to check proposed formats are ok +// This checks the VIDEOINFO we are passed as a media type. If the media type +// is a valid media type then we return NOERROR otherwise E_INVALIDARG. Note +// however we only accept formats that can be easily displayed in the display +// so if we are on a 16 bit device we will not accept 24 bit images. The one +// complexity is that most displays draw 8 bit palettised images efficiently +// Also if the input format is less colour bits per pixel then we also accept + +HRESULT CImageDisplay::CheckVideoType(const VIDEOINFO *pInput) +{ + // First of all check the VIDEOINFOHEADER looks correct + + if (CheckHeaderValidity(pInput) == FALSE) { + return E_INVALIDARG; + } + + // Virtually all devices support palettised images efficiently + + if (m_Display.bmiHeader.biBitCount == pInput->bmiHeader.biBitCount) { + if (PALETTISED(pInput) == TRUE) { + ASSERT(PALETTISED(&m_Display) == TRUE); + NOTE("(Video) Type connection ACCEPTED"); + return NOERROR; + } + } + + + // Is the display depth greater than the input format + + if (m_Display.bmiHeader.biBitCount > pInput->bmiHeader.biBitCount) { + NOTE("(Video) Mismatch agreed"); + return NOERROR; + } + + // Is the display depth less than the input format + + if (m_Display.bmiHeader.biBitCount < pInput->bmiHeader.biBitCount) { + NOTE("(Video) Format mismatch"); + return E_INVALIDARG; + } + + + // Both input and display formats are either BI_RGB or BI_BITFIELDS + + ASSERT(m_Display.bmiHeader.biBitCount == pInput->bmiHeader.biBitCount); + ASSERT(PALETTISED(pInput) == FALSE); + ASSERT(PALETTISED(&m_Display) == FALSE); + + // BI_RGB 16 bit representation is implicitly RGB555, and likewise BI_RGB + // 24 bit representation is RGB888. So we initialise a pointer to the bit + // fields they really mean and check against the display device format + // This is only going to be called when both formats are equal bits pixel + + const DWORD *pInputMask = GetBitMasks(pInput); + const DWORD *pDisplayMask = GetBitMasks((VIDEOINFO *)&m_Display); + + if (pInputMask[iRED] != pDisplayMask[iRED] || + pInputMask[iGREEN] != pDisplayMask[iGREEN] || + pInputMask[iBLUE] != pDisplayMask[iBLUE]) { + + NOTE("(Video) Bit field mismatch"); + return E_INVALIDARG; + } + + NOTE("(Video) Type connection ACCEPTED"); + return NOERROR; +} + + +// Return the bit masks for the true colour VIDEOINFO provided + +const DWORD *CImageDisplay::GetBitMasks(const VIDEOINFO *pVideoInfo) +{ + static const DWORD FailMasks[] = {0,0,0}; + + if (pVideoInfo->bmiHeader.biCompression == BI_BITFIELDS) { + return BITMASKS(pVideoInfo); + } + + ASSERT(pVideoInfo->bmiHeader.biCompression == BI_RGB); + + switch (pVideoInfo->bmiHeader.biBitCount) { + case 16: return bits555; + case 24: return bits888; + case 32: return bits888; + default: return FailMasks; + } +} + + +// Check to see if we can support media type pmtIn as proposed by the output +// pin - We first check that the major media type is video and also identify +// the media sub type. Then we thoroughly check the VIDEOINFO type provided +// As well as the contained VIDEOINFO being correct the major type must be +// video, the subtype a recognised video format and the type GUID correct + +HRESULT CImageDisplay::CheckMediaType(const CMediaType *pmtIn) +{ + // Does this have a VIDEOINFOHEADER format block + + const GUID *pFormatType = pmtIn->FormatType(); + if (*pFormatType != FORMAT_VideoInfo) { + NOTE("Format GUID not a VIDEOINFOHEADER"); + return E_INVALIDARG; + } + ASSERT(pmtIn->Format()); + + // Check the format looks reasonably ok + + ULONG Length = pmtIn->FormatLength(); + if (Length < SIZE_VIDEOHEADER) { + NOTE("Format smaller than a VIDEOHEADER"); + return E_FAIL; + } + + VIDEOINFO *pInput = (VIDEOINFO *) pmtIn->Format(); + + // Check the major type is MEDIATYPE_Video + + const GUID *pMajorType = pmtIn->Type(); + if (*pMajorType != MEDIATYPE_Video) { + NOTE("Major type not MEDIATYPE_Video"); + return E_INVALIDARG; + } + + // Check we can identify the media subtype + + const GUID *pSubType = pmtIn->Subtype(); + if (GetBitCount(pSubType) == USHRT_MAX) { + NOTE("Invalid video media subtype"); + return E_INVALIDARG; + } + return CheckVideoType(pInput); +} + + +// Given a video format described by a VIDEOINFO structure we return the mask +// that is used to obtain the range of acceptable colours for this type, for +// example, the mask for a 24 bit true colour format is 0xFF in all cases. A +// 16 bit 5:6:5 display format uses 0xF8, 0xFC and 0xF8, therefore given any +// RGB triplets we can AND them with these fields to find one that is valid + +BOOL CImageDisplay::GetColourMask(__out DWORD *pMaskRed, + __out DWORD *pMaskGreen, + __out DWORD *pMaskBlue) +{ + CAutoLock cDisplayLock(this); + *pMaskRed = 0xFF; + *pMaskGreen = 0xFF; + *pMaskBlue = 0xFF; + + // If this format is palettised then it doesn't have bit fields + + if (m_Display.bmiHeader.biBitCount < 16) { + return FALSE; + } + + // If this is a 24 bit true colour display then it can handle all the + // possible colour component ranges described by a byte. It is never + // allowed for a 24 bit colour depth image to have BI_BITFIELDS set + + if (m_Display.bmiHeader.biBitCount == 24) { + ASSERT(m_Display.bmiHeader.biCompression == BI_RGB); + return TRUE; + } + + // Calculate the mask based on the format's bit fields + + const DWORD *pBitFields = (DWORD *) GetBitMasks((VIDEOINFO *)&m_Display); + DWORD *pOutputMask[] = { pMaskRed, pMaskGreen, pMaskBlue }; + + // We know from earlier testing that there are no more than iMAXBITS + // bits set in the mask and that they are all contiguous. All that + // therefore remains is to shift them into the correct position + + for (INT iColour = iRED;iColour <= iBLUE;iColour++) { + + // This works out how many bits there are and where they live + + DWORD PrefixBits = CountPrefixBits(pBitFields[iColour]); + DWORD SetBits = CountSetBits(pBitFields[iColour]); + + // The first shift moves the bit field so that it is right justified + // in the DWORD, after which we then shift it back left which then + // puts the leading bit in the bytes most significant bit position + + *(pOutputMask[iColour]) = pBitFields[iColour] >> PrefixBits; + *(pOutputMask[iColour]) <<= (iMAXBITS - SetBits); + } + return TRUE; +} + + +/* Helper to convert to VIDEOINFOHEADER2 +*/ +STDAPI ConvertVideoInfoToVideoInfo2(__inout AM_MEDIA_TYPE *pmt) +{ + if (pmt->formattype != FORMAT_VideoInfo) { + return E_INVALIDARG; + } + if (NULL == pmt->pbFormat || pmt->cbFormat < sizeof(VIDEOINFOHEADER)) { + return E_INVALIDARG; + } + VIDEOINFO *pVideoInfo = (VIDEOINFO *)pmt->pbFormat; + DWORD dwNewSize; + HRESULT hr = DWordAdd(pmt->cbFormat, sizeof(VIDEOINFOHEADER2) - sizeof(VIDEOINFOHEADER), &dwNewSize); + if (FAILED(hr)) { + return hr; + } + PVOID pvNew = CoTaskMemAlloc(dwNewSize); + if (pvNew == NULL) { + return E_OUTOFMEMORY; + } + CopyMemory(pvNew, pmt->pbFormat, FIELD_OFFSET(VIDEOINFOHEADER, bmiHeader)); + ZeroMemory((PBYTE)pvNew + FIELD_OFFSET(VIDEOINFOHEADER, bmiHeader), + sizeof(VIDEOINFOHEADER2) - sizeof(VIDEOINFOHEADER)); + CopyMemory((PBYTE)pvNew + FIELD_OFFSET(VIDEOINFOHEADER2, bmiHeader), + pmt->pbFormat + FIELD_OFFSET(VIDEOINFOHEADER, bmiHeader), + pmt->cbFormat - FIELD_OFFSET(VIDEOINFOHEADER, bmiHeader)); + VIDEOINFOHEADER2 *pVideoInfo2 = (VIDEOINFOHEADER2 *)pvNew; + pVideoInfo2->dwPictAspectRatioX = (DWORD)pVideoInfo2->bmiHeader.biWidth; + pVideoInfo2->dwPictAspectRatioY = (DWORD)abs(pVideoInfo2->bmiHeader.biHeight); + pmt->formattype = FORMAT_VideoInfo2; + CoTaskMemFree(pmt->pbFormat); + pmt->pbFormat = (PBYTE)pvNew; + pmt->cbFormat += sizeof(VIDEOINFOHEADER2) - sizeof(VIDEOINFOHEADER); + return S_OK; +} + + +// Check a media type containing VIDEOINFOHEADER +STDAPI CheckVideoInfoType(const AM_MEDIA_TYPE *pmt) +{ + if (NULL == pmt || NULL == pmt->pbFormat) { + return E_POINTER; + } + if (pmt->majortype != MEDIATYPE_Video || + pmt->formattype != FORMAT_VideoInfo || + pmt->cbFormat < sizeof(VIDEOINFOHEADER)) { + return VFW_E_TYPE_NOT_ACCEPTED; + } + const VIDEOINFOHEADER *pHeader = (const VIDEOINFOHEADER *)pmt->pbFormat; + if (!ValidateBitmapInfoHeader( + &pHeader->bmiHeader, + pmt->cbFormat - FIELD_OFFSET(VIDEOINFOHEADER, bmiHeader))) { + return VFW_E_TYPE_NOT_ACCEPTED; + } + + return S_OK; +} + +// Check a media type containing VIDEOINFOHEADER2 +STDAPI CheckVideoInfo2Type(const AM_MEDIA_TYPE *pmt) +{ + if (NULL == pmt || NULL == pmt->pbFormat) { + return E_POINTER; + } + if (pmt->majortype != MEDIATYPE_Video || + pmt->formattype != FORMAT_VideoInfo2 || + pmt->cbFormat < sizeof(VIDEOINFOHEADER2)) { + return VFW_E_TYPE_NOT_ACCEPTED; + } + const VIDEOINFOHEADER2 *pHeader = (const VIDEOINFOHEADER2 *)pmt->pbFormat; + if (!ValidateBitmapInfoHeader( + &pHeader->bmiHeader, + pmt->cbFormat - FIELD_OFFSET(VIDEOINFOHEADER2, bmiHeader))) { + return VFW_E_TYPE_NOT_ACCEPTED; + } + + return S_OK; +} diff --git a/third_party/BaseClasses/winutil.h b/third_party/BaseClasses/winutil.h new file mode 100644 index 00000000..6bd62354 --- /dev/null +++ b/third_party/BaseClasses/winutil.h @@ -0,0 +1,419 @@ +//------------------------------------------------------------------------------ +// File: WinUtil.h +// +// Desc: DirectShow base classes - defines generic handler classes. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +// Make sure that you call PrepareWindow to initialise the window after +// the object has been constructed. It is a separate method so that +// derived classes can override useful methods like MessageLoop. Also +// any derived class must call DoneWithWindow in its destructor. If it +// doesn't a message may be retrieved and call a derived class member +// function while a thread is executing the base class destructor code + +#ifndef __WINUTIL__ +#define __WINUTIL__ + +const int DEFWIDTH = 320; // Initial window width +const int DEFHEIGHT = 240; // Initial window height +const int CAPTION = 256; // Maximum length of caption +const int TIMELENGTH = 50; // Maximum length of times +const int PROFILESTR = 128; // Normal profile string +const WORD PALVERSION = 0x300; // GDI palette version +const LONG PALETTE_VERSION = (LONG) 1; // Initial palette version +const COLORREF VIDEO_COLOUR = 0; // Defaults to black background +const HANDLE hMEMORY = (HANDLE) (-1); // Says to open as memory file + +#define WIDTH(x) ((*(x)).right - (*(x)).left) +#define HEIGHT(x) ((*(x)).bottom - (*(x)).top) +#define SHOWSTAGE TEXT("WM_SHOWSTAGE") +#define SHOWSTAGETOP TEXT("WM_SHOWSTAGETOP") +#define REALIZEPALETTE TEXT("WM_REALIZEPALETTE") + +class AM_NOVTABLE CBaseWindow +{ +protected: + + HINSTANCE m_hInstance; // Global module instance handle + HWND m_hwnd; // Handle for our window + HDC m_hdc; // Device context for the window + LONG m_Width; // Client window width + LONG m_Height; // Client window height + BOOL m_bActivated; // Has the window been activated + LPTSTR m_pClassName; // Static string holding class name + DWORD m_ClassStyles; // Passed in to our constructor + DWORD m_WindowStyles; // Likewise the initial window styles + DWORD m_WindowStylesEx; // And the extended window styles + UINT m_ShowStageMessage; // Have the window shown with focus + UINT m_ShowStageTop; // Makes the window WS_EX_TOPMOST + UINT m_RealizePalette; // Makes us realize our new palette + HDC m_MemoryDC; // Used for fast BitBlt operations + HPALETTE m_hPalette; // Handle to any palette we may have + BYTE m_bNoRealize; // Don't realize palette now + BYTE m_bBackground; // Should we realise in background + BYTE m_bRealizing; // already realizing the palette + CCritSec m_WindowLock; // Serialise window object access + BOOL m_bDoGetDC; // Should this window get a DC + bool m_bDoPostToDestroy; // Use PostMessage to destroy + CCritSec m_PaletteLock; // This lock protects m_hPalette. + // It should be held anytime the + // program use the value of m_hPalette. + + // Maps windows message procedure into C++ methods + friend LRESULT CALLBACK WndProc(HWND hwnd, // Window handle + UINT uMsg, // Message ID + WPARAM wParam, // First parameter + LPARAM lParam); // Other parameter + + virtual LRESULT OnPaletteChange(HWND hwnd, UINT Message); + +public: + + CBaseWindow(BOOL bDoGetDC = TRUE, bool bPostToDestroy = false); + +#ifdef DEBUG + virtual ~CBaseWindow(); +#endif + + virtual HRESULT DoneWithWindow(); + virtual HRESULT PrepareWindow(); + virtual HRESULT InactivateWindow(); + virtual HRESULT ActivateWindow(); + virtual BOOL OnSize(LONG Width, LONG Height); + virtual BOOL OnClose(); + virtual RECT GetDefaultRect(); + virtual HRESULT UninitialiseWindow(); + virtual HRESULT InitialiseWindow(HWND hwnd); + + HRESULT CompleteConnect(); + HRESULT DoCreateWindow(); + + HRESULT PerformanceAlignWindow(); + HRESULT DoShowWindow(LONG ShowCmd); + void PaintWindow(BOOL bErase); + void DoSetWindowForeground(BOOL bFocus); + virtual HRESULT SetPalette(HPALETTE hPalette); + void SetRealize(BOOL bRealize) + { + m_bNoRealize = !bRealize; + } + + // Jump over to the window thread to set the current palette + HRESULT SetPalette(); + void UnsetPalette(void); + virtual HRESULT DoRealisePalette(BOOL bForceBackground = FALSE); + + void LockPaletteLock(); + void UnlockPaletteLock(); + + virtual BOOL PossiblyEatMessage(UINT uMsg, WPARAM wParam, LPARAM lParam) + { return FALSE; }; + + // Access our window information + + bool WindowExists(); + LONG GetWindowWidth(); + LONG GetWindowHeight(); + HWND GetWindowHWND(); + HDC GetMemoryHDC(); + HDC GetWindowHDC(); + + #ifdef DEBUG + HPALETTE GetPalette(); + #endif // DEBUG + + // This is the window procedure the derived object should override + + virtual LRESULT OnReceiveMessage(HWND hwnd, // Window handle + UINT uMsg, // Message ID + WPARAM wParam, // First parameter + LPARAM lParam); // Other parameter + + // Must be overriden to return class and window styles + + virtual LPTSTR GetClassWindowStyles( + __out DWORD *pClassStyles, // Class styles + __out DWORD *pWindowStyles, // Window styles + __out DWORD *pWindowStylesEx) PURE; // Extended styles +}; + + +// This helper class is entirely subservient to the owning CBaseWindow object +// All this object does is to split out the actual drawing operation from the +// main object (because it was becoming too large). We have a number of entry +// points to set things like the draw device contexts, to implement the actual +// drawing and to set the destination rectangle in the client window. We have +// no critical section locking in this class because we are used exclusively +// by the owning window object which looks after serialising calls into us + +// If you want to use this class make sure you call NotifyAllocator once the +// allocate has been agreed, also call NotifyMediaType with a pointer to a +// NON stack based CMediaType once that has been set (we keep a pointer to +// the original rather than taking a copy). When the palette changes call +// IncrementPaletteVersion (easiest thing to do is to also call this method +// in the SetMediaType method most filters implement). Finally before you +// start rendering anything call SetDrawContext so that we can get the HDCs +// for drawing from the CBaseWindow object we are given during construction + +class CDrawImage +{ +protected: + + CBaseWindow *m_pBaseWindow; // Owning video window object + CRefTime m_StartSample; // Start time for the current sample + CRefTime m_EndSample; // And likewise it's end sample time + HDC m_hdc; // Main window device context + HDC m_MemoryDC; // Offscreen draw device context + RECT m_TargetRect; // Target destination rectangle + RECT m_SourceRect; // Source image rectangle + BOOL m_bStretch; // Do we have to stretch the images + BOOL m_bUsingImageAllocator; // Are the samples shared DIBSECTIONs + CMediaType *m_pMediaType; // Pointer to the current format + int m_perfidRenderTime; // Time taken to render an image + LONG m_PaletteVersion; // Current palette version cookie + + // Draw the video images in the window + + void SlowRender(IMediaSample *pMediaSample); + void FastRender(IMediaSample *pMediaSample); + void DisplaySampleTimes(IMediaSample *pSample); + void UpdateColourTable(HDC hdc,__in BITMAPINFOHEADER *pbmi); + void SetStretchMode(); + +public: + + // Used to control the image drawing + + CDrawImage(__inout CBaseWindow *pBaseWindow); + BOOL DrawImage(IMediaSample *pMediaSample); + BOOL DrawVideoImageHere(HDC hdc, IMediaSample *pMediaSample, + __in LPRECT lprcSrc, __in LPRECT lprcDst); + void SetDrawContext(); + void SetTargetRect(__in RECT *pTargetRect); + void SetSourceRect(__in RECT *pSourceRect); + void GetTargetRect(__out RECT *pTargetRect); + void GetSourceRect(__out RECT *pSourceRect); + virtual RECT ScaleSourceRect(const RECT *pSource); + + // Handle updating palettes as they change + + LONG GetPaletteVersion(); + void ResetPaletteVersion(); + void IncrementPaletteVersion(); + + // Tell us media types and allocator assignments + + void NotifyAllocator(BOOL bUsingImageAllocator); + void NotifyMediaType(__in CMediaType *pMediaType); + BOOL UsingImageAllocator(); + + // Called when we are about to draw an image + + void NotifyStartDraw() { + MSR_START(m_perfidRenderTime); + }; + + // Called when we complete an image rendering + + void NotifyEndDraw() { + MSR_STOP(m_perfidRenderTime); + }; +}; + + +// This is the structure used to keep information about each GDI DIB. All the +// samples we create from our allocator will have a DIBSECTION allocated to +// them. When we receive the sample we know we can BitBlt straight to an HDC + +typedef struct tagDIBDATA { + + LONG PaletteVersion; // Current palette version in use + DIBSECTION DibSection; // Details of DIB section allocated + HBITMAP hBitmap; // Handle to bitmap for drawing + HANDLE hMapping; // Handle to shared memory block + BYTE *pBase; // Pointer to base memory address + +} DIBDATA; + + +// This class inherits from CMediaSample and uses all of it's methods but it +// overrides the constructor to initialise itself with the DIBDATA structure +// When we come to render an IMediaSample we will know if we are using our own +// allocator, and if we are, we can cast the IMediaSample to a pointer to one +// of these are retrieve the DIB section information and hence the HBITMAP + +class CImageSample : public CMediaSample +{ +protected: + + DIBDATA m_DibData; // Information about the DIBSECTION + BOOL m_bInit; // Is the DIB information setup + +public: + + // Constructor + + CImageSample(__inout CBaseAllocator *pAllocator, + __in_opt LPCTSTR pName, + __inout HRESULT *phr, + __in_bcount(length) LPBYTE pBuffer, + LONG length); + + // Maintain the DIB/DirectDraw state + + void SetDIBData(__in DIBDATA *pDibData); + __out DIBDATA *GetDIBData(); +}; + + +// This is an allocator based on the abstract CBaseAllocator base class that +// allocates sample buffers in shared memory. The number and size of these +// are determined when the output pin calls Prepare on us. The shared memory +// blocks are used in subsequent calls to GDI CreateDIBSection, once that +// has been done the output pin can fill the buffers with data which will +// then be handed to GDI through BitBlt calls and thereby remove one copy + +class CImageAllocator : public CBaseAllocator +{ +protected: + + CBaseFilter *m_pFilter; // Delegate reference counts to + CMediaType *m_pMediaType; // Pointer to the current format + + // Used to create and delete samples + + HRESULT Alloc(); + void Free(); + + // Manage the shared DIBSECTION and DCI/DirectDraw buffers + + HRESULT CreateDIB(LONG InSize,DIBDATA &DibData); + STDMETHODIMP CheckSizes(__in ALLOCATOR_PROPERTIES *pRequest); + virtual CImageSample *CreateImageSample(__in_bcount(Length) LPBYTE pData,LONG Length); + +public: + + // Constructor and destructor + + CImageAllocator(__inout CBaseFilter *pFilter,__in_opt LPCTSTR pName,__inout HRESULT *phr); +#ifdef DEBUG + ~CImageAllocator(); +#endif + + STDMETHODIMP_(ULONG) NonDelegatingAddRef(); + STDMETHODIMP_(ULONG) NonDelegatingRelease(); + void NotifyMediaType(__in CMediaType *pMediaType); + + // Agree the number of buffers to be used and their size + + STDMETHODIMP SetProperties( + __in ALLOCATOR_PROPERTIES *pRequest, + __out ALLOCATOR_PROPERTIES *pActual); +}; + + +// This class is a fairly specialised helper class for image renderers that +// have to create and manage palettes. The CBaseWindow class looks after +// realising palettes once they have been installed. This class can be used +// to create the palette handles from a media format (which must contain a +// VIDEOINFO structure in the format block). We try to make the palette an +// identity palette to maximise performance and also only change palettes +// if actually required to (we compare palette colours before updating). +// All the methods are virtual so that they can be overriden if so required + +class CImagePalette +{ +protected: + + CBaseWindow *m_pBaseWindow; // Window to realise palette in + CBaseFilter *m_pFilter; // Media filter to send events + CDrawImage *m_pDrawImage; // Object who will be drawing + HPALETTE m_hPalette; // The palette handle we own + +public: + + CImagePalette(__inout CBaseFilter *pBaseFilter, + __inout CBaseWindow *pBaseWindow, + __inout CDrawImage *pDrawImage); + +#ifdef DEBUG + virtual ~CImagePalette(); +#endif + + static HPALETTE MakePalette(const VIDEOINFOHEADER *pVideoInfo, __in LPSTR szDevice); + HRESULT RemovePalette(); + static HRESULT MakeIdentityPalette(__inout_ecount_full(iColours) PALETTEENTRY *pEntry,INT iColours, __in LPSTR szDevice); + HRESULT CopyPalette(const CMediaType *pSrc,__out CMediaType *pDest); + BOOL ShouldUpdate(const VIDEOINFOHEADER *pNewInfo,const VIDEOINFOHEADER *pOldInfo); + HRESULT PreparePalette(const CMediaType *pmtNew,const CMediaType *pmtOld,__in LPSTR szDevice); + + BOOL DrawVideoImageHere(HDC hdc, IMediaSample *pMediaSample, __in LPRECT lprcSrc, __in LPRECT lprcDst) + { + return m_pDrawImage->DrawVideoImageHere(hdc, pMediaSample, lprcSrc,lprcDst); + } +}; + + +// Another helper class really for video based renderers. Most such renderers +// need to know what the display format is to some degree or another. This +// class initialises itself with the display format. The format can be asked +// for through GetDisplayFormat and various other accessor functions. If a +// filter detects a display format change (perhaps it gets a WM_DEVMODECHANGE +// message then it can call RefreshDisplayType to reset that format). Also +// many video renderers will want to check formats as they are proposed by +// source filters. This class provides methods to check formats and only +// accept those video formats that can be efficiently drawn using GDI calls + +class CImageDisplay : public CCritSec +{ +protected: + + // This holds the display format; biSize should not be too big, so we can + // safely use the VIDEOINFO structure + VIDEOINFO m_Display; + + static DWORD CountSetBits(const DWORD Field); + static DWORD CountPrefixBits(const DWORD Field); + static BOOL CheckBitFields(const VIDEOINFO *pInput); + +public: + + // Constructor and destructor + + CImageDisplay(); + + // Used to manage BITMAPINFOHEADERs and the display format + + const VIDEOINFO *GetDisplayFormat(); + HRESULT RefreshDisplayType(__in_opt LPSTR szDeviceName); + static BOOL CheckHeaderValidity(const VIDEOINFO *pInput); + static BOOL CheckPaletteHeader(const VIDEOINFO *pInput); + BOOL IsPalettised(); + WORD GetDisplayDepth(); + + // Provide simple video format type checking + + HRESULT CheckMediaType(const CMediaType *pmtIn); + HRESULT CheckVideoType(const VIDEOINFO *pInput); + HRESULT UpdateFormat(__inout VIDEOINFO *pVideoInfo); + const DWORD *GetBitMasks(const VIDEOINFO *pVideoInfo); + + BOOL GetColourMask(__out DWORD *pMaskRed, + __out DWORD *pMaskGreen, + __out DWORD *pMaskBlue); +}; + +// Convert a FORMAT_VideoInfo to FORMAT_VideoInfo2 +STDAPI ConvertVideoInfoToVideoInfo2(__inout AM_MEDIA_TYPE *pmt); + +// Check a media type containing VIDEOINFOHEADER +STDAPI CheckVideoInfoType(const AM_MEDIA_TYPE *pmt); + +// Check a media type containing VIDEOINFOHEADER +STDAPI CheckVideoInfo2Type(const AM_MEDIA_TYPE *pmt); + +#endif // __WINUTIL__ + diff --git a/third_party/BaseClasses/wxdebug.cpp b/third_party/BaseClasses/wxdebug.cpp new file mode 100644 index 00000000..3c433031 --- /dev/null +++ b/third_party/BaseClasses/wxdebug.cpp @@ -0,0 +1,1474 @@ +//------------------------------------------------------------------------------ +// File: WXDebug.cpp +// +// Desc: DirectShow base classes - implements ActiveX system debugging +// facilities. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#define _WINDLL + +#include +#include +#include +#include + +#ifdef DEBUG +#ifdef UNICODE +#ifndef _UNICODE +#define _UNICODE +#endif // _UNICODE +#endif // UNICODE +#endif // DEBUG + +#include +#include + +#ifdef DEBUG +static void DisplayBITMAPINFO(const BITMAPINFOHEADER* pbmi); +static void DisplayRECT(LPCTSTR szLabel, const RECT& rc); + +// The Win32 wsprintf() function writes a maximum of 1024 characters to it's output buffer. +// See the documentation for wsprintf()'s lpOut parameter for more information. +const INT iDEBUGINFO = 1024; // Used to format strings + +/* For every module and executable we store a debugging level for each of + the five categories (eg LOG_ERROR and LOG_TIMING). This makes it easy + to isolate and debug individual modules without seeing everybody elses + spurious debug output. The keys are stored in the registry under the + HKEY_LOCAL_MACHINE\SOFTWARE\Debug\\ key values + NOTE these must be in the same order as their enumeration definition */ + +const LPCTSTR pKeyNames[] = { + TEXT("TIMING"), // Timing and performance measurements + TEXT("TRACE"), // General step point call tracing + TEXT("MEMORY"), // Memory and object allocation/destruction + TEXT("LOCKING"), // Locking/unlocking of critical sections + TEXT("ERROR"), // Debug error notification + TEXT("CUSTOM1"), + TEXT("CUSTOM2"), + TEXT("CUSTOM3"), + TEXT("CUSTOM4"), + TEXT("CUSTOM5") + }; + +const TCHAR CAutoTrace::_szEntering[] = TEXT("->: %s"); +const TCHAR CAutoTrace::_szLeaving[] = TEXT("<-: %s"); + +const INT iMAXLEVELS = NUMELMS(pKeyNames); // Maximum debug categories + +HINSTANCE m_hInst; // Module instance handle +TCHAR m_ModuleName[iDEBUGINFO]; // Cut down module name +DWORD m_Levels[iMAXLEVELS]; // Debug level per category +CRITICAL_SECTION m_CSDebug; // Controls access to list +DWORD m_dwNextCookie; // Next active object ID +ObjectDesc *pListHead = NULL; // First active object +DWORD m_dwObjectCount; // Active object count +BOOL m_bInit = FALSE; // Have we been initialised +HANDLE m_hOutput = INVALID_HANDLE_VALUE; // Optional output written here +DWORD dwWaitTimeout = INFINITE; // Default timeout value +DWORD dwTimeOffset; // Time of first DbgLog call +bool g_fUseKASSERT = false; // don't create messagebox +bool g_fDbgInDllEntryPoint = false; +bool g_fAutoRefreshLevels = false; + +LPCTSTR pBaseKey = TEXT("SOFTWARE\\Microsoft\\DirectShow\\Debug"); +LPCTSTR pGlobalKey = TEXT("GLOBAL"); +static CHAR *pUnknownName = "UNKNOWN"; + +LPCTSTR TimeoutName = TEXT("TIMEOUT"); + +/* This sets the instance handle that the debug library uses to find + the module's file name from the Win32 GetModuleFileName function */ + +void WINAPI DbgInitialise(HINSTANCE hInst) +{ + InitializeCriticalSection(&m_CSDebug); + m_bInit = TRUE; + + m_hInst = hInst; + DbgInitModuleName(); + if (GetProfileInt(m_ModuleName, TEXT("BreakOnLoad"), 0)) + DebugBreak(); + DbgInitModuleSettings(false); + DbgInitGlobalSettings(true); + dwTimeOffset = timeGetTime(); +} + + +/* This is called to clear up any resources the debug library uses - at the + moment we delete our critical section and the object list. The values we + retrieve from the registry are all done during initialisation but we don't + go looking for update notifications while we are running, if the values + are changed then the application has to be restarted to pick them up */ + +void WINAPI DbgTerminate() +{ + if (m_hOutput != INVALID_HANDLE_VALUE) { + EXECUTE_ASSERT(CloseHandle(m_hOutput)); + m_hOutput = INVALID_HANDLE_VALUE; + } + DeleteCriticalSection(&m_CSDebug); + m_bInit = FALSE; +} + + +/* This is called by DbgInitLogLevels to read the debug settings + for each logging category for this module from the registry */ + +void WINAPI DbgInitKeyLevels(HKEY hKey, bool fTakeMax) +{ + LONG lReturn; // Create key return value + LONG lKeyPos; // Current key category + DWORD dwKeySize; // Size of the key value + DWORD dwKeyType; // Receives it's type + DWORD dwKeyValue; // This fields value + + /* Try and read a value for each key position in turn */ + for (lKeyPos = 0;lKeyPos < iMAXLEVELS;lKeyPos++) { + + dwKeySize = sizeof(DWORD); + lReturn = RegQueryValueEx( + hKey, // Handle to an open key + pKeyNames[lKeyPos], // Subkey name derivation + NULL, // Reserved field + &dwKeyType, // Returns the field type + (LPBYTE) &dwKeyValue, // Returns the field's value + &dwKeySize ); // Number of bytes transferred + + /* If either the key was not available or it was not a DWORD value + then we ensure only the high priority debug logging is output + but we try and update the field to a zero filled DWORD value */ + + if (lReturn != ERROR_SUCCESS || dwKeyType != REG_DWORD) { + + dwKeyValue = 0; + lReturn = RegSetValueEx( + hKey, // Handle of an open key + pKeyNames[lKeyPos], // Address of subkey name + (DWORD) 0, // Reserved field + REG_DWORD, // Type of the key field + (PBYTE) &dwKeyValue, // Value for the field + sizeof(DWORD)); // Size of the field buffer + + if (lReturn != ERROR_SUCCESS) { + DbgLog((LOG_ERROR,1,TEXT("Could not create subkey %s"),pKeyNames[lKeyPos])); + dwKeyValue = 0; + } + } + if(fTakeMax) + { + m_Levels[lKeyPos] = max(dwKeyValue,m_Levels[lKeyPos]); + } + else + { + if((m_Levels[lKeyPos] & LOG_FORCIBLY_SET) == 0) { + m_Levels[lKeyPos] = dwKeyValue; + } + } + } + + /* Read the timeout value for catching hangs */ + dwKeySize = sizeof(DWORD); + lReturn = RegQueryValueEx( + hKey, // Handle to an open key + TimeoutName, // Subkey name derivation + NULL, // Reserved field + &dwKeyType, // Returns the field type + (LPBYTE) &dwWaitTimeout, // Returns the field's value + &dwKeySize ); // Number of bytes transferred + + /* If either the key was not available or it was not a DWORD value + then we ensure only the high priority debug logging is output + but we try and update the field to a zero filled DWORD value */ + + if (lReturn != ERROR_SUCCESS || dwKeyType != REG_DWORD) { + + dwWaitTimeout = INFINITE; + lReturn = RegSetValueEx( + hKey, // Handle of an open key + TimeoutName, // Address of subkey name + (DWORD) 0, // Reserved field + REG_DWORD, // Type of the key field + (PBYTE) &dwWaitTimeout, // Value for the field + sizeof(DWORD)); // Size of the field buffer + + if (lReturn != ERROR_SUCCESS) { + DbgLog((LOG_ERROR,1,TEXT("Could not create subkey %s"),pKeyNames[lKeyPos])); + dwWaitTimeout = INFINITE; + } + } +} + +void WINAPI DbgOutString(LPCTSTR psz) +{ + if (m_hOutput != INVALID_HANDLE_VALUE) { + UINT cb = lstrlen(psz); + DWORD dw; +#ifdef UNICODE + CHAR szDest[2048]; + WideCharToMultiByte(CP_ACP, 0, psz, -1, szDest, NUMELMS(szDest), 0, 0); + WriteFile (m_hOutput, szDest, cb, &dw, NULL); +#else + WriteFile (m_hOutput, psz, cb, &dw, NULL); +#endif + } else { + OutputDebugString (psz); + } +} + + + + +HRESULT DbgUniqueProcessName(LPCTSTR inName, LPTSTR outName) +{ + HRESULT hr = S_OK; + const TCHAR *pIn = inName; + int dotPos = -1; + + //scan the input and record the last '.' position + while (*pIn && (pIn - inName) < MAX_PATH) + { + if ( TEXT('.') == *pIn ) + dotPos = (int)(pIn-inName); + ++pIn; + } + + if (*pIn) //input should be zero-terminated within MAX_PATH + return E_INVALIDARG; + + DWORD dwProcessId = GetCurrentProcessId(); + + if (dotPos < 0) + { + //no extension in the input, appending process id to the input + hr = StringCchPrintf(outName, MAX_PATH, TEXT("%s_%d"), inName, dwProcessId); + } + else + { + TCHAR pathAndBasename[MAX_PATH] = {0}; + + //there's an extension - zero-terminate the path and basename first by copying + hr = StringCchCopyN(pathAndBasename, MAX_PATH, inName, (size_t)dotPos); + + //re-combine path, basename and extension with processId appended to a basename + if (SUCCEEDED(hr)) + hr = StringCchPrintf(outName, MAX_PATH, TEXT("%s_%d%s"), pathAndBasename, dwProcessId, inName + dotPos); + } + + return hr; +} + + +/* Called by DbgInitGlobalSettings to setup alternate logging destinations + */ + +void WINAPI DbgInitLogTo ( + HKEY hKey) +{ + LONG lReturn; + DWORD dwKeyType; + DWORD dwKeySize; + TCHAR szFile[MAX_PATH] = {0}; + static const TCHAR cszKey[] = TEXT("LogToFile"); + + dwKeySize = MAX_PATH; + lReturn = RegQueryValueEx( + hKey, // Handle to an open key + cszKey, // Subkey name derivation + NULL, // Reserved field + &dwKeyType, // Returns the field type + (LPBYTE) szFile, // Returns the field's value + &dwKeySize); // Number of bytes transferred + + // create an empty key if it does not already exist + // + if (lReturn != ERROR_SUCCESS || dwKeyType != REG_SZ) + { + dwKeySize = sizeof(TCHAR); + lReturn = RegSetValueEx( + hKey, // Handle of an open key + cszKey, // Address of subkey name + (DWORD) 0, // Reserved field + REG_SZ, // Type of the key field + (PBYTE)szFile, // Value for the field + dwKeySize); // Size of the field buffer + } + + // if an output-to was specified. try to open it. + // + if (m_hOutput != INVALID_HANDLE_VALUE) { + EXECUTE_ASSERT(CloseHandle (m_hOutput)); + m_hOutput = INVALID_HANDLE_VALUE; + } + if (szFile[0] != 0) + { + if (!lstrcmpi(szFile, TEXT("Console"))) { + m_hOutput = GetStdHandle (STD_OUTPUT_HANDLE); + if (m_hOutput == INVALID_HANDLE_VALUE) { + AllocConsole (); + m_hOutput = GetStdHandle (STD_OUTPUT_HANDLE); + } + SetConsoleTitle (TEXT("ActiveX Debug Output")); + } else if (szFile[0] && + lstrcmpi(szFile, TEXT("Debug")) && + lstrcmpi(szFile, TEXT("Debugger")) && + lstrcmpi(szFile, TEXT("Deb"))) + { + m_hOutput = CreateFile(szFile, GENERIC_WRITE, + FILE_SHARE_READ, + NULL, OPEN_ALWAYS, + FILE_ATTRIBUTE_NORMAL, + NULL); + + if (INVALID_HANDLE_VALUE == m_hOutput && + GetLastError() == ERROR_SHARING_VIOLATION) + { + TCHAR uniqueName[MAX_PATH] = {0}; + if (SUCCEEDED(DbgUniqueProcessName(szFile, uniqueName))) + { + m_hOutput = CreateFile(uniqueName, GENERIC_WRITE, + FILE_SHARE_READ, + NULL, OPEN_ALWAYS, + FILE_ATTRIBUTE_NORMAL, + NULL); + } + } + + if (INVALID_HANDLE_VALUE != m_hOutput) + { + static const TCHAR cszBar[] = TEXT("\r\n\r\n=====DbgInitialize()=====\r\n\r\n"); + SetFilePointer (m_hOutput, 0, NULL, FILE_END); + DbgOutString (cszBar); + } + } + } +} + + + +/* This is called by DbgInitLogLevels to read the global debug settings for + each logging category for this module from the registry. Normally each + module has it's own values set for it's different debug categories but + setting the global SOFTWARE\Debug\Global applies them to ALL modules */ + +void WINAPI DbgInitGlobalSettings(bool fTakeMax) +{ + LONG lReturn; // Create key return value + TCHAR szInfo[iDEBUGINFO]; // Constructs key names + HKEY hGlobalKey; // Global override key + + /* Construct the global base key name */ + (void)StringCchPrintf(szInfo,NUMELMS(szInfo),TEXT("%s\\%s"),pBaseKey,pGlobalKey); + + /* Create or open the key for this module */ + lReturn = RegCreateKeyEx(HKEY_LOCAL_MACHINE, // Handle of an open key + szInfo, // Address of subkey name + (DWORD) 0, // Reserved value + NULL, // Address of class name + (DWORD) 0, // Special options flags + GENERIC_READ | GENERIC_WRITE, // Desired security access + NULL, // Key security descriptor + &hGlobalKey, // Opened handle buffer + NULL); // What really happened + + if (lReturn != ERROR_SUCCESS) { + lReturn = RegCreateKeyEx(HKEY_LOCAL_MACHINE, // Handle of an open key + szInfo, // Address of subkey name + (DWORD) 0, // Reserved value + NULL, // Address of class name + (DWORD) 0, // Special options flags + GENERIC_READ, // Desired security access + NULL, // Key security descriptor + &hGlobalKey, // Opened handle buffer + NULL); // What really happened + if (lReturn != ERROR_SUCCESS) { + DbgLog((LOG_ERROR,1,TEXT("Could not access GLOBAL module key"))); + } + return; + } + + DbgInitKeyLevels(hGlobalKey, fTakeMax); + RegCloseKey(hGlobalKey); +} + + +/* This sets the debugging log levels for the different categories. We start + by opening (or creating if not already available) the SOFTWARE\Debug key + that all these settings live under. We then look at the global values + set under SOFTWARE\Debug\Global which apply on top of the individual + module settings. We then load the individual module registry settings */ + +void WINAPI DbgInitModuleSettings(bool fTakeMax) +{ + LONG lReturn; // Create key return value + TCHAR szInfo[iDEBUGINFO]; // Constructs key names + HKEY hModuleKey; // Module key handle + + /* Construct the base key name */ + (void)StringCchPrintf(szInfo,NUMELMS(szInfo),TEXT("%s\\%s"),pBaseKey,m_ModuleName); + + /* Create or open the key for this module */ + lReturn = RegCreateKeyEx(HKEY_LOCAL_MACHINE, // Handle of an open key + szInfo, // Address of subkey name + (DWORD) 0, // Reserved value + NULL, // Address of class name + (DWORD) 0, // Special options flags + GENERIC_READ | GENERIC_WRITE, // Desired security access + NULL, // Key security descriptor + &hModuleKey, // Opened handle buffer + NULL); // What really happened + + if (lReturn != ERROR_SUCCESS) { + lReturn = RegCreateKeyEx(HKEY_LOCAL_MACHINE, // Handle of an open key + szInfo, // Address of subkey name + (DWORD) 0, // Reserved value + NULL, // Address of class name + (DWORD) 0, // Special options flags + GENERIC_READ, // Desired security access + NULL, // Key security descriptor + &hModuleKey, // Opened handle buffer + NULL); // What really happened + if (lReturn != ERROR_SUCCESS) { + DbgLog((LOG_ERROR,1,TEXT("Could not access module key"))); + } + return; + } + + DbgInitLogTo(hModuleKey); + DbgInitKeyLevels(hModuleKey, fTakeMax); + RegCloseKey(hModuleKey); +} + + +/* Initialise the module file name */ + +void WINAPI DbgInitModuleName() +{ + TCHAR FullName[iDEBUGINFO]; // Load the full path and module name + LPTSTR pName; // Searches from the end for a backslash + + GetModuleFileName(m_hInst,FullName,iDEBUGINFO); + pName = _tcsrchr(FullName,'\\'); + if (pName == NULL) { + pName = FullName; + } else { + pName++; + } + (void)StringCchCopy(m_ModuleName,NUMELMS(m_ModuleName), pName); +} + +struct MsgBoxMsg +{ + HWND hwnd; + LPCTSTR szTitle; + LPCTSTR szMessage; + DWORD dwFlags; + INT iResult; +}; + +// +// create a thread to call MessageBox(). calling MessageBox() on +// random threads at bad times can confuse the host (eg IE). +// +DWORD WINAPI MsgBoxThread( + __inout LPVOID lpParameter // thread data + ) +{ + MsgBoxMsg *pmsg = (MsgBoxMsg *)lpParameter; + pmsg->iResult = MessageBox( + pmsg->hwnd, + pmsg->szTitle, + pmsg->szMessage, + pmsg->dwFlags); + + return 0; +} + +INT MessageBoxOtherThread( + HWND hwnd, + LPCTSTR szTitle, + LPCTSTR szMessage, + DWORD dwFlags) +{ + if(g_fDbgInDllEntryPoint) + { + // can't wait on another thread because we have the loader + // lock held in the dll entry point. + // This can crash sometimes so just skip it + // return MessageBox(hwnd, szTitle, szMessage, dwFlags); + return IDCANCEL; + } + else + { + MsgBoxMsg msg = {hwnd, szTitle, szMessage, dwFlags, 0}; + DWORD dwid; + HANDLE hThread = CreateThread( + 0, // security + 0, // stack size + MsgBoxThread, + (void *)&msg, // arg + 0, // flags + &dwid); + if(hThread) + { + WaitForSingleObject(hThread, INFINITE); + CloseHandle(hThread); + return msg.iResult; + } + + // break into debugger on failure. + return IDCANCEL; + } +} + +/* Displays a message box if the condition evaluated to FALSE */ + +void WINAPI DbgAssert(LPCTSTR pCondition,LPCTSTR pFileName,INT iLine) +{ + if(g_fUseKASSERT) + { + DbgKernelAssert(pCondition, pFileName, iLine); + } + else + { + + TCHAR szInfo[iDEBUGINFO]; + + (void)StringCchPrintf(szInfo, NUMELMS(szInfo),TEXT("%s \nAt line %d of %s\nContinue? (Cancel to debug)"), + pCondition, iLine, pFileName); + + INT MsgId = MessageBoxOtherThread(NULL,szInfo,TEXT("ASSERT Failed"), + MB_SYSTEMMODAL | + MB_ICONHAND | + MB_YESNOCANCEL | + MB_SETFOREGROUND); + switch (MsgId) + { + case IDNO: /* Kill the application */ + + FatalAppExit(FALSE, TEXT("Application terminated")); + break; + + case IDCANCEL: /* Break into the debugger */ + + DebugBreak(); + break; + + case IDYES: /* Ignore assertion continue execution */ + break; + } + } +} + +/* Displays a message box at a break point */ + +void WINAPI DbgBreakPoint(LPCTSTR pCondition,LPCTSTR pFileName,INT iLine) +{ + if(g_fUseKASSERT) + { + DbgKernelAssert(pCondition, pFileName, iLine); + } + else + { + TCHAR szInfo[iDEBUGINFO]; + + (void)StringCchPrintf(szInfo, NUMELMS(szInfo),TEXT("%s \nAt line %d of %s\nContinue? (Cancel to debug)"), + pCondition, iLine, pFileName); + + INT MsgId = MessageBoxOtherThread(NULL,szInfo,TEXT("Hard coded break point"), + MB_SYSTEMMODAL | + MB_ICONHAND | + MB_YESNOCANCEL | + MB_SETFOREGROUND); + switch (MsgId) + { + case IDNO: /* Kill the application */ + + FatalAppExit(FALSE, TEXT("Application terminated")); + break; + + case IDCANCEL: /* Break into the debugger */ + + DebugBreak(); + break; + + case IDYES: /* Ignore break point continue execution */ + break; + } + } +} + +void WINAPI DbgBreakPoint(LPCTSTR pFileName,INT iLine,__format_string LPCTSTR szFormatString,...) +{ + // A debug break point message can have at most 2000 characters if + // ANSI or UNICODE characters are being used. A debug break point message + // can have between 1000 and 2000 double byte characters in it. If a + // particular message needs more characters, then the value of this constant + // should be increased. + const DWORD MAX_BREAK_POINT_MESSAGE_SIZE = 2000; + + TCHAR szBreakPointMessage[MAX_BREAK_POINT_MESSAGE_SIZE]; + + va_list va; + va_start( va, szFormatString ); + + HRESULT hr = StringCchVPrintf( szBreakPointMessage, NUMELMS(szBreakPointMessage), szFormatString, va ); + + va_end(va); + + if( FAILED(hr) ) { + DbgBreak( "ERROR in DbgBreakPoint(). The variable length debug message could not be displayed because StringCchVPrintf() failed." ); + return; + } + + ::DbgBreakPoint( szBreakPointMessage, pFileName, iLine ); +} + + +/* When we initialised the library we stored in the m_Levels array the current + debug output level for this module for each of the five categories. When + some debug logging is sent to us it can be sent with a combination of the + categories (if it is applicable to many for example) in which case we map + the type's categories into their current debug levels and see if any of + them can be accepted. The function looks at each bit position in turn from + the input type field and then compares it's debug level with the modules. + + A level of 0 means that output is always sent to the debugger. This is + due to producing output if the input level is <= m_Levels. +*/ + + +BOOL WINAPI DbgCheckModuleLevel(DWORD Type,DWORD Level) +{ + if(g_fAutoRefreshLevels) + { + // re-read the registry every second. We cannot use RegNotify() to + // notice registry changes because it's not available on win9x. + static DWORD g_dwLastRefresh = 0; + DWORD dwTime = timeGetTime(); + if(dwTime - g_dwLastRefresh > 1000) { + g_dwLastRefresh = dwTime; + + // there's a race condition: multiple threads could update the + // values. plus read and write not synchronized. no harm + // though. + DbgInitModuleSettings(false); + } + } + + + DWORD Mask = 0x01; + + // If no valid bits are set return FALSE + if ((Type & ((1<m_szName = szObjectName; + pObject->m_wszName = wszObjectName; + pObject->m_dwCookie = ++m_dwNextCookie; + pObject->m_pNext = pListHead; + + pListHead = pObject; + m_dwObjectCount++; + + DWORD ObjectCookie = pObject->m_dwCookie; + ASSERT(ObjectCookie); + + if(wszObjectName) { + DbgLog((LOG_MEMORY,2,TEXT("Object created %d (%ls) %d Active"), + pObject->m_dwCookie, wszObjectName, m_dwObjectCount)); + } else { + DbgLog((LOG_MEMORY,2,TEXT("Object created %d (%hs) %d Active"), + pObject->m_dwCookie, szObjectName, m_dwObjectCount)); + } + + LeaveCriticalSection(&m_CSDebug); + return ObjectCookie; +} + + +/* This is called by the CBaseObject destructor when an object is about to be + destroyed, we are passed the cookie we returned during construction that + identifies this object. We scan the object list for a matching cookie and + remove the object if successful. We also update the active object count */ + +BOOL WINAPI DbgRegisterObjectDestruction(DWORD dwCookie) +{ + /* Grab the list critical section */ + EnterCriticalSection(&m_CSDebug); + + ObjectDesc *pObject = pListHead; + ObjectDesc *pPrevious = NULL; + + /* Scan the object list looking for a cookie match */ + + while (pObject) { + if (pObject->m_dwCookie == dwCookie) { + break; + } + pPrevious = pObject; + pObject = pObject->m_pNext; + } + + if (pObject == NULL) { + DbgBreak("Apparently destroying a bogus object"); + LeaveCriticalSection(&m_CSDebug); + return FALSE; + } + + /* Is the object at the head of the list */ + + if (pPrevious == NULL) { + pListHead = pObject->m_pNext; + } else { + pPrevious->m_pNext = pObject->m_pNext; + } + + /* Delete the object and update the housekeeping information */ + + m_dwObjectCount--; + + if(pObject->m_wszName) { + DbgLog((LOG_MEMORY,2,TEXT("Object destroyed %d (%ls) %d Active"), + pObject->m_dwCookie, pObject->m_wszName, m_dwObjectCount)); + } else { + DbgLog((LOG_MEMORY,2,TEXT("Object destroyed %d (%hs) %d Active"), + pObject->m_dwCookie, pObject->m_szName, m_dwObjectCount)); + } + + delete pObject; + LeaveCriticalSection(&m_CSDebug); + return TRUE; +} + + +/* This runs through the active object list displaying their details */ + +void WINAPI DbgDumpObjectRegister() +{ + TCHAR szInfo[iDEBUGINFO]; + + /* Grab the list critical section */ + + EnterCriticalSection(&m_CSDebug); + ObjectDesc *pObject = pListHead; + + /* Scan the object list displaying the name and cookie */ + + DbgLog((LOG_MEMORY,2,TEXT(""))); + DbgLog((LOG_MEMORY,2,TEXT(" ID Object Description"))); + DbgLog((LOG_MEMORY,2,TEXT(""))); + + while (pObject) { + if(pObject->m_wszName) { + (void)StringCchPrintf(szInfo,NUMELMS(szInfo),TEXT("%5d (%p) %30ls"),pObject->m_dwCookie, &pObject, pObject->m_wszName); + } else { + (void)StringCchPrintf(szInfo,NUMELMS(szInfo),TEXT("%5d (%p) %30hs"),pObject->m_dwCookie, &pObject, pObject->m_szName); + } + DbgLog((LOG_MEMORY,2,szInfo)); + pObject = pObject->m_pNext; + } + + (void)StringCchPrintf(szInfo,NUMELMS(szInfo),TEXT("Total object count %5d"),m_dwObjectCount); + DbgLog((LOG_MEMORY,2,TEXT(""))); + DbgLog((LOG_MEMORY,1,szInfo)); + LeaveCriticalSection(&m_CSDebug); +} + +/* Debug infinite wait stuff */ +DWORD WINAPI DbgWaitForSingleObject(HANDLE h) +{ + DWORD dwWaitResult; + do { + dwWaitResult = WaitForSingleObject(h, dwWaitTimeout); + ASSERT(dwWaitResult == WAIT_OBJECT_0); + } while (dwWaitResult == WAIT_TIMEOUT); + return dwWaitResult; +} +DWORD WINAPI DbgWaitForMultipleObjects(DWORD nCount, + __in_ecount(nCount) CONST HANDLE *lpHandles, + BOOL bWaitAll) +{ + DWORD dwWaitResult; + do { + dwWaitResult = WaitForMultipleObjects(nCount, + lpHandles, + bWaitAll, + dwWaitTimeout); + ASSERT((DWORD)(dwWaitResult - WAIT_OBJECT_0) < MAXIMUM_WAIT_OBJECTS); + } while (dwWaitResult == WAIT_TIMEOUT); + return dwWaitResult; +} + +void WINAPI DbgSetWaitTimeout(DWORD dwTimeout) +{ + dwWaitTimeout = dwTimeout; +} + +#endif /* DEBUG */ + +#ifdef _OBJBASE_H_ + + /* Stuff for printing out our GUID names */ + + GUID_STRING_ENTRY g_GuidNames[] = { + #define OUR_GUID_ENTRY(name, l, w1, w2, b1, b2, b3, b4, b5, b6, b7, b8) \ + { #name, { l, w1, w2, { b1, b2, b3, b4, b5, b6, b7, b8 } } }, + #include + }; + + CGuidNameList GuidNames; + int g_cGuidNames = sizeof(g_GuidNames) / sizeof(g_GuidNames[0]); + + char *CGuidNameList::operator [] (const GUID &guid) + { + for (int i = 0; i < g_cGuidNames; i++) { + if (g_GuidNames[i].guid == guid) { + return g_GuidNames[i].szName; + } + } + if (guid == GUID_NULL) { + return "GUID_NULL"; + } + + // !!! add something to print FOURCC guids? + + // shouldn't this print the hex CLSID? + return "Unknown GUID Name"; + } + +#endif /* _OBJBASE_H_ */ + +/* CDisp class - display our data types */ + +// clashes with REFERENCE_TIME +CDisp::CDisp(LONGLONG ll, int Format) +{ + // note: this could be combined with CDisp(LONGLONG) by + // introducing a default format of CDISP_REFTIME + LARGE_INTEGER li; + li.QuadPart = ll; + switch (Format) { + case CDISP_DEC: + { + TCHAR temp[20]; + int pos=20; + temp[--pos] = 0; + int digit; + // always output at least one digit + do { + // Get the rightmost digit - we only need the low word + digit = li.LowPart % 10; + li.QuadPart /= 10; + temp[--pos] = (TCHAR) digit+L'0'; + } while (li.QuadPart); + (void)StringCchCopy(m_String, NUMELMS(m_String), temp+pos); + break; + } + case CDISP_HEX: + default: + (void)StringCchPrintf(m_String, NUMELMS(m_String), TEXT("0x%X%8.8X"), li.HighPart, li.LowPart); + } +}; + +CDisp::CDisp(REFCLSID clsid) +{ +#ifdef UNICODE + (void)StringFromGUID2(clsid, m_String, NUMELMS(m_String)); +#else + WCHAR wszTemp[50]; + (void)StringFromGUID2(clsid, wszTemp, NUMELMS(wszTemp)); + (void)StringCchPrintf(m_String, NUMELMS(m_String), TEXT("%S"), wszTemp); +#endif +}; + +#ifdef __STREAMS__ +/* Display stuff */ +CDisp::CDisp(CRefTime llTime) +{ + LONGLONG llDiv; + if (llTime < 0) { + llTime = -llTime; + (void)StringCchCopy(m_String, NUMELMS(m_String), TEXT("-")); + } + llDiv = (LONGLONG)24 * 3600 * 10000000; + if (llTime >= llDiv) { + (void)StringCchPrintf(m_String + lstrlen(m_String), NUMELMS(m_String) - lstrlen(m_String), TEXT("%d days "), (LONG)(llTime / llDiv)); + llTime = llTime % llDiv; + } + llDiv = (LONGLONG)3600 * 10000000; + if (llTime >= llDiv) { + (void)StringCchPrintf(m_String + lstrlen(m_String), NUMELMS(m_String) - lstrlen(m_String), TEXT("%d hrs "), (LONG)(llTime / llDiv)); + llTime = llTime % llDiv; + } + llDiv = (LONGLONG)60 * 10000000; + if (llTime >= llDiv) { + (void)StringCchPrintf(m_String + lstrlen(m_String), NUMELMS(m_String) - lstrlen(m_String), TEXT("%d mins "), (LONG)(llTime / llDiv)); + llTime = llTime % llDiv; + } + (void)StringCchPrintf(m_String + lstrlen(m_String), NUMELMS(m_String) - lstrlen(m_String), TEXT("%d.%3.3d sec"), + (LONG)llTime / 10000000, + (LONG)((llTime % 10000000) / 10000)); +}; + +#endif // __STREAMS__ + + +/* Display pin */ +CDisp::CDisp(IPin *pPin) +{ + PIN_INFO pi; + TCHAR str[MAX_PIN_NAME]; + CLSID clsid; + + if (pPin) { + pPin->QueryPinInfo(&pi); + pi.pFilter->GetClassID(&clsid); + QueryPinInfoReleaseFilter(pi); + #ifndef UNICODE + WideCharToMultiByte(GetACP(), 0, pi.achName, lstrlenW(pi.achName) + 1, + str, MAX_PIN_NAME, NULL, NULL); + #else + (void)StringCchCopy(str, NUMELMS(str), pi.achName); + #endif + } else { + (void)StringCchCopy(str, NUMELMS(str), TEXT("NULL IPin")); + } + + m_pString = (PTCHAR) new TCHAR[lstrlen(str)+64]; + if (!m_pString) { + return; + } + + (void)StringCchPrintf(m_pString, lstrlen(str) + 64, TEXT("%hs(%s)"), GuidNames[clsid], str); +} + +/* Display filter or pin */ +CDisp::CDisp(IUnknown *pUnk) +{ + IBaseFilter *pf; + HRESULT hr = pUnk->QueryInterface(IID_IBaseFilter, (void **)&pf); + if(SUCCEEDED(hr)) + { + FILTER_INFO fi; + hr = pf->QueryFilterInfo(&fi); + if(SUCCEEDED(hr)) + { + QueryFilterInfoReleaseGraph(fi); + + size_t len = lstrlenW(fi.achName) + 1; + + m_pString = new TCHAR[len]; + if(m_pString) + { +#ifdef UNICODE + (void)StringCchCopy(m_pString, len, fi.achName); +#else + (void)StringCchPrintf(m_pString, len, "%S", fi.achName); +#endif + } + } + + pf->Release(); + + return; + } + + IPin *pp; + hr = pUnk->QueryInterface(IID_IPin, (void **)&pp); + if(SUCCEEDED(hr)) + { + CDisp::CDisp(pp); + pp->Release(); + return; + } +} + + +CDisp::~CDisp() +{ +} + +CDispBasic::~CDispBasic() +{ + if (m_pString != m_String) { + delete [] m_pString; + } +} + +CDisp::CDisp(double d) +{ + (void)StringCchPrintf(m_String, NUMELMS(m_String), TEXT("%d.%03d"), (int) d, (int) ((d - (int) d) * 1000)); +} + + +/* If built for debug this will display the media type details. We convert the + major and subtypes into strings and also ask the base classes for a string + description of the subtype, so MEDIASUBTYPE_RGB565 becomes RGB 565 16 bit + We also display the fields in the BITMAPINFOHEADER structure, this should + succeed as we do not accept input types unless the format is big enough */ + +#ifdef DEBUG +void WINAPI DisplayType(LPCTSTR label, const AM_MEDIA_TYPE *pmtIn) +{ + + /* Dump the GUID types and a short description */ + + DbgLog((LOG_TRACE,5,TEXT(""))); + DbgLog((LOG_TRACE,2,TEXT("%s M type %hs S type %hs"), label, + GuidNames[pmtIn->majortype], + GuidNames[pmtIn->subtype])); + DbgLog((LOG_TRACE,5,TEXT("Subtype description %s"),GetSubtypeName(&pmtIn->subtype))); + + /* Dump the generic media types */ + + if (pmtIn->bTemporalCompression) { + DbgLog((LOG_TRACE,5,TEXT("Temporally compressed"))); + } else { + DbgLog((LOG_TRACE,5,TEXT("Not temporally compressed"))); + } + + if (pmtIn->bFixedSizeSamples) { + DbgLog((LOG_TRACE,5,TEXT("Sample size %d"),pmtIn->lSampleSize)); + } else { + DbgLog((LOG_TRACE,5,TEXT("Variable size samples"))); + } + + if (pmtIn->formattype == FORMAT_VideoInfo) { + + VIDEOINFOHEADER *pVideoInfo = (VIDEOINFOHEADER *)pmtIn->pbFormat; + + DisplayRECT(TEXT("Source rectangle"),pVideoInfo->rcSource); + DisplayRECT(TEXT("Target rectangle"),pVideoInfo->rcTarget); + DisplayBITMAPINFO(HEADER(pmtIn->pbFormat)); + + } if (pmtIn->formattype == FORMAT_VideoInfo2) { + + VIDEOINFOHEADER2 *pVideoInfo2 = (VIDEOINFOHEADER2 *)pmtIn->pbFormat; + + DisplayRECT(TEXT("Source rectangle"),pVideoInfo2->rcSource); + DisplayRECT(TEXT("Target rectangle"),pVideoInfo2->rcTarget); + DbgLog((LOG_TRACE, 5, TEXT("Aspect Ratio: %d:%d"), + pVideoInfo2->dwPictAspectRatioX, + pVideoInfo2->dwPictAspectRatioY)); + DisplayBITMAPINFO(&pVideoInfo2->bmiHeader); + + } else if (pmtIn->majortype == MEDIATYPE_Audio) { + DbgLog((LOG_TRACE,2,TEXT(" Format type %hs"), + GuidNames[pmtIn->formattype])); + DbgLog((LOG_TRACE,2,TEXT(" Subtype %hs"), + GuidNames[pmtIn->subtype])); + + if ((pmtIn->subtype != MEDIASUBTYPE_MPEG1Packet) + && (pmtIn->cbFormat >= sizeof(PCMWAVEFORMAT))) + { + /* Dump the contents of the WAVEFORMATEX type-specific format structure */ + + WAVEFORMATEX *pwfx = (WAVEFORMATEX *) pmtIn->pbFormat; + DbgLog((LOG_TRACE,2,TEXT("wFormatTag %u"), pwfx->wFormatTag)); + DbgLog((LOG_TRACE,2,TEXT("nChannels %u"), pwfx->nChannels)); + DbgLog((LOG_TRACE,2,TEXT("nSamplesPerSec %lu"), pwfx->nSamplesPerSec)); + DbgLog((LOG_TRACE,2,TEXT("nAvgBytesPerSec %lu"), pwfx->nAvgBytesPerSec)); + DbgLog((LOG_TRACE,2,TEXT("nBlockAlign %u"), pwfx->nBlockAlign)); + DbgLog((LOG_TRACE,2,TEXT("wBitsPerSample %u"), pwfx->wBitsPerSample)); + + /* PCM uses a WAVEFORMAT and does not have the extra size field */ + + if (pmtIn->cbFormat >= sizeof(WAVEFORMATEX)) { + DbgLog((LOG_TRACE,2,TEXT("cbSize %u"), pwfx->cbSize)); + } + } else { + } + + } else { + DbgLog((LOG_TRACE,2,TEXT(" Format type %hs"), + GuidNames[pmtIn->formattype])); + } +} + + +void DisplayBITMAPINFO(const BITMAPINFOHEADER* pbmi) +{ + DbgLog((LOG_TRACE,5,TEXT("Size of BITMAPINFO structure %d"),pbmi->biSize)); + if (pbmi->biCompression < 256) { + DbgLog((LOG_TRACE,2,TEXT("%dx%dx%d bit (%d)"), + pbmi->biWidth, pbmi->biHeight, + pbmi->biBitCount, pbmi->biCompression)); + } else { + DbgLog((LOG_TRACE,2,TEXT("%dx%dx%d bit '%4.4hs'"), + pbmi->biWidth, pbmi->biHeight, + pbmi->biBitCount, &pbmi->biCompression)); + } + + DbgLog((LOG_TRACE,2,TEXT("Image size %d"),pbmi->biSizeImage)); + DbgLog((LOG_TRACE,5,TEXT("Planes %d"),pbmi->biPlanes)); + DbgLog((LOG_TRACE,5,TEXT("X Pels per metre %d"),pbmi->biXPelsPerMeter)); + DbgLog((LOG_TRACE,5,TEXT("Y Pels per metre %d"),pbmi->biYPelsPerMeter)); + DbgLog((LOG_TRACE,5,TEXT("Colours used %d"),pbmi->biClrUsed)); +} + + +void DisplayRECT(LPCTSTR szLabel, const RECT& rc) +{ + DbgLog((LOG_TRACE,5,TEXT("%s (Left %d Top %d Right %d Bottom %d)"), + szLabel, + rc.left, + rc.top, + rc.right, + rc.bottom)); +} + + +void WINAPI DumpGraph(IFilterGraph *pGraph, DWORD dwLevel) +{ + if( !pGraph ) + { + return; + } + + IEnumFilters *pFilters; + + DbgLog((LOG_TRACE,dwLevel,TEXT("DumpGraph [%x]"), pGraph)); + + if (FAILED(pGraph->EnumFilters(&pFilters))) { + DbgLog((LOG_TRACE,dwLevel,TEXT("EnumFilters failed!"))); + } + + IBaseFilter *pFilter; + ULONG n; + while (pFilters->Next(1, &pFilter, &n) == S_OK) { + FILTER_INFO info; + + if (FAILED(pFilter->QueryFilterInfo(&info))) { + DbgLog((LOG_TRACE,dwLevel,TEXT(" Filter [%p] -- failed QueryFilterInfo"), pFilter)); + } else { + QueryFilterInfoReleaseGraph(info); + + // !!! should QueryVendorInfo here! + + DbgLog((LOG_TRACE,dwLevel,TEXT(" Filter [%p] '%ls'"), pFilter, info.achName)); + + IEnumPins *pins; + + if (FAILED(pFilter->EnumPins(&pins))) { + DbgLog((LOG_TRACE,dwLevel,TEXT("EnumPins failed!"))); + } else { + + IPin *pPin; + while (pins->Next(1, &pPin, &n) == S_OK) { + PIN_INFO pinInfo; + + if (FAILED(pPin->QueryPinInfo(&pinInfo))) { + DbgLog((LOG_TRACE,dwLevel,TEXT(" Pin [%x] -- failed QueryPinInfo"), pPin)); + } else { + QueryPinInfoReleaseFilter(pinInfo); + + IPin *pPinConnected = NULL; + + HRESULT hr = pPin->ConnectedTo(&pPinConnected); + + if (pPinConnected) { + DbgLog((LOG_TRACE,dwLevel,TEXT(" Pin [%p] '%ls' [%sput]") + TEXT(" Connected to pin [%p]"), + pPin, pinInfo.achName, + pinInfo.dir == PINDIR_INPUT ? TEXT("In") : TEXT("Out"), + pPinConnected)); + + pPinConnected->Release(); + + // perhaps we should really dump the type both ways as a sanity + // check? + if (pinInfo.dir == PINDIR_OUTPUT) { + AM_MEDIA_TYPE mt; + + hr = pPin->ConnectionMediaType(&mt); + + if (SUCCEEDED(hr)) { + DisplayType(TEXT("Connection type"), &mt); + + FreeMediaType(mt); + } + } + } else { + DbgLog((LOG_TRACE,dwLevel, + TEXT(" Pin [%x] '%ls' [%sput]"), + pPin, pinInfo.achName, + pinInfo.dir == PINDIR_INPUT ? TEXT("In") : TEXT("Out"))); + + } + } + + pPin->Release(); + + } + + pins->Release(); + } + + } + + pFilter->Release(); + } + + pFilters->Release(); + +} + +#endif + diff --git a/third_party/BaseClasses/wxdebug.h b/third_party/BaseClasses/wxdebug.h new file mode 100644 index 00000000..d4c69dbb --- /dev/null +++ b/third_party/BaseClasses/wxdebug.h @@ -0,0 +1,359 @@ +//------------------------------------------------------------------------------ +// File: WXDebug.h +// +// Desc: DirectShow base classes - provides debugging facilities. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __WXDEBUG__ +#define __WXDEBUG__ + +// This library provides fairly straight forward debugging functionality, this +// is split into two main sections. The first is assertion handling, there are +// three types of assertions provided here. The most commonly used one is the +// ASSERT(condition) macro which will pop up a message box including the file +// and line number if the condition evaluates to FALSE. Then there is the +// EXECUTE_ASSERT macro which is the same as ASSERT except the condition will +// still be executed in NON debug builds. The final type of assertion is the +// KASSERT macro which is more suitable for pure (perhaps kernel) filters as +// the condition is printed onto the debugger rather than in a message box. +// +// The other part of the debug module facilties is general purpose logging. +// This is accessed by calling DbgLog(). The function takes a type and level +// field which define the type of informational string you are presenting and +// it's relative importance. The type field can be a combination (one or more) +// of LOG_TIMING, LOG_TRACE, LOG_MEMORY, LOG_LOCKING and LOG_ERROR. The level +// is a DWORD value where zero defines highest important. Use of zero as the +// debug logging level is to be encouraged ONLY for major errors or events as +// they will ALWAYS be displayed on the debugger. Other debug output has it's +// level matched against the current debug output level stored in the registry +// for this module and if less than the current setting it will be displayed. +// +// Each module or executable has it's own debug output level for each of the +// five types. These are read in when the DbgInitialise function is called +// for DLLs linking to STRMBASE.LIB this is done automatically when the DLL +// is loaded, executables must call it explicitely with the module instance +// handle given to them through the WINMAIN entry point. An executable must +// also call DbgTerminate when they have finished to clean up the resources +// the debug library uses, once again this is done automatically for DLLs + +// These are the five different categories of logging information + +enum { LOG_TIMING = 0x01, // Timing and performance measurements + LOG_TRACE = 0x02, // General step point call tracing + LOG_MEMORY = 0x04, // Memory and object allocation/destruction + LOG_LOCKING = 0x08, // Locking/unlocking of critical sections + LOG_ERROR = 0x10, // Debug error notification + LOG_CUSTOM1 = 0x20, + LOG_CUSTOM2 = 0x40, + LOG_CUSTOM3 = 0x80, + LOG_CUSTOM4 = 0x100, + LOG_CUSTOM5 = 0x200, +}; + +#define LOG_FORCIBLY_SET 0x80000000 + +enum { CDISP_HEX = 0x01, + CDISP_DEC = 0x02}; + +// For each object created derived from CBaseObject (in debug builds) we +// create a descriptor that holds it's name (statically allocated memory) +// and a cookie we assign it. We keep a list of all the active objects +// we have registered so that we can dump a list of remaining objects + +typedef struct tag_ObjectDesc { + LPCSTR m_szName; + LPCWSTR m_wszName; + DWORD m_dwCookie; + tag_ObjectDesc *m_pNext; +} ObjectDesc; + +#define DLLIMPORT __declspec(dllimport) +#define DLLEXPORT __declspec(dllexport) + +#ifdef DEBUG + + #define NAME(x) TEXT(x) + + // These are used internally by the debug library (PRIVATE) + + void WINAPI DbgInitKeyLevels(HKEY hKey, bool fTakeMax); + void WINAPI DbgInitGlobalSettings(bool fTakeMax); + void WINAPI DbgInitModuleSettings(bool fTakeMax); + void WINAPI DbgInitModuleName(); + DWORD WINAPI DbgRegisterObjectCreation( + LPCSTR szObjectName, LPCWSTR wszObjectName); + + BOOL WINAPI DbgRegisterObjectDestruction(DWORD dwCookie); + + // These are the PUBLIC entry points + + BOOL WINAPI DbgCheckModuleLevel(DWORD Type,DWORD Level); + void WINAPI DbgSetModuleLevel(DWORD Type,DWORD Level); + void WINAPI DbgSetAutoRefreshLevels(bool fAuto); + + // Initialise the library with the module handle + + void WINAPI DbgInitialise(HINSTANCE hInst); + void WINAPI DbgTerminate(); + + void WINAPI DbgDumpObjectRegister(); + + // Display error and logging to the user + + void WINAPI DbgAssert(LPCTSTR pCondition,LPCTSTR pFileName,INT iLine); + void WINAPI DbgBreakPoint(LPCTSTR pCondition,LPCTSTR pFileName,INT iLine); + void WINAPI DbgBreakPoint(LPCTSTR pFileName,INT iLine,__format_string LPCTSTR szFormatString,...); + + void WINAPI DbgKernelAssert(LPCTSTR pCondition,LPCTSTR pFileName,INT iLine); + void WINAPI DbgLogInfo(DWORD Type,DWORD Level,__format_string LPCTSTR pFormat,...); +#ifdef UNICODE + void WINAPI DbgLogInfo(DWORD Type,DWORD Level,__format_string LPCSTR pFormat,...); + void WINAPI DbgAssert(LPCSTR pCondition,LPCSTR pFileName,INT iLine); + void WINAPI DbgBreakPoint(LPCSTR pCondition,LPCSTR pFileName,INT iLine); + void WINAPI DbgKernelAssert(LPCSTR pCondition,LPCSTR pFileName,INT iLine); +#endif + void WINAPI DbgOutString(LPCTSTR psz); + + // Debug infinite wait stuff + DWORD WINAPI DbgWaitForSingleObject(HANDLE h); + DWORD WINAPI DbgWaitForMultipleObjects(DWORD nCount, + __in_ecount(nCount) CONST HANDLE *lpHandles, + BOOL bWaitAll); + void WINAPI DbgSetWaitTimeout(DWORD dwTimeout); + +#ifdef __strmif_h__ + // Display a media type: Terse at level 2, verbose at level 5 + void WINAPI DisplayType(LPCTSTR label, const AM_MEDIA_TYPE *pmtIn); + + // Dump lots of information about a filter graph + void WINAPI DumpGraph(IFilterGraph *pGraph, DWORD dwLevel); +#endif + + #define KASSERT(_x_) if (!(_x_)) \ + DbgKernelAssert(TEXT(#_x_),TEXT(__FILE__),__LINE__) + + // Break on the debugger without putting up a message box + // message goes to debugger instead + + #define KDbgBreak(_x_) \ + DbgKernelAssert(TEXT(#_x_),TEXT(__FILE__),__LINE__) + + // We chose a common name for our ASSERT macro, MFC also uses this name + // So long as the implementation evaluates the condition and handles it + // then we will be ok. Rather than override the behaviour expected we + // will leave whatever first defines ASSERT as the handler (i.e. MFC) + #ifndef ASSERT + #define ASSERT(_x_) if (!(_x_)) \ + DbgAssert(TEXT(#_x_),TEXT(__FILE__),__LINE__) + #endif + + #define DbgAssertAligned( _ptr_, _alignment_ ) ASSERT( ((DWORD_PTR) (_ptr_)) % (_alignment_) == 0) + + // Put up a message box informing the user of a halt + // condition in the program + + #define DbgBreak(_x_) \ + DbgBreakPoint(TEXT(#_x_),TEXT(__FILE__),__LINE__) + + #define EXECUTE_ASSERT(_x_) ASSERT(_x_) + #define DbgLog(_x_) DbgLogInfo _x_ + // MFC style trace macros + + #define NOTE(_x_) DbgLog((LOG_TRACE,5,TEXT(_x_))) + #define NOTE1(_x_,a) DbgLog((LOG_TRACE,5,TEXT(_x_),a)) + #define NOTE2(_x_,a,b) DbgLog((LOG_TRACE,5,TEXT(_x_),a,b)) + #define NOTE3(_x_,a,b,c) DbgLog((LOG_TRACE,5,TEXT(_x_),a,b,c)) + #define NOTE4(_x_,a,b,c,d) DbgLog((LOG_TRACE,5,TEXT(_x_),a,b,c,d)) + #define NOTE5(_x_,a,b,c,d,e) DbgLog((LOG_TRACE,5,TEXT(_x_),a,b,c,d,e)) + +#else + + // Retail builds make public debug functions inert - WARNING the source + // files do not define or build any of the entry points in debug builds + // (public entry points compile to nothing) so if you go trying to call + // any of the private entry points in your source they won't compile + + #define NAME(_x_) ((LPTSTR) NULL) + + #define DbgInitialise(hInst) + #define DbgTerminate() + #define DbgLog(_x_) 0 + #define DbgOutString(psz) + #define DbgAssertAligned( _ptr_, _alignment_ ) 0 + + #define DbgRegisterObjectCreation(pObjectName) + #define DbgRegisterObjectDestruction(dwCookie) + #define DbgDumpObjectRegister() + + #define DbgCheckModuleLevel(Type,Level) + #define DbgSetModuleLevel(Type,Level) + #define DbgSetAutoRefreshLevels(fAuto) + + #define DbgWaitForSingleObject(h) WaitForSingleObject(h, INFINITE) + #define DbgWaitForMultipleObjects(nCount, lpHandles, bWaitAll) \ + WaitForMultipleObjects(nCount, lpHandles, bWaitAll, INFINITE) + #define DbgSetWaitTimeout(dwTimeout) + + #define KDbgBreak(_x_) + #define DbgBreak(_x_) + + #define KASSERT(_x_) ((void)0) + #ifndef ASSERT + #define ASSERT(_x_) ((void)0) + #endif + #define EXECUTE_ASSERT(_x_) ((void)(_x_)) + + // MFC style trace macros + + #define NOTE(_x_) ((void)0) + #define NOTE1(_x_,a) ((void)0) + #define NOTE2(_x_,a,b) ((void)0) + #define NOTE3(_x_,a,b,c) ((void)0) + #define NOTE4(_x_,a,b,c,d) ((void)0) + #define NOTE5(_x_,a,b,c,d,e) ((void)0) + + #define DisplayType(label, pmtIn) ((void)0) + #define DumpGraph(pGraph, label) ((void)0) +#endif + + +// Checks a pointer which should be non NULL - can be used as follows. + +#define CheckPointer(p,ret) {if((p)==NULL) return (ret);} + +// HRESULT Foo(VOID *pBar) +// { +// CheckPointer(pBar,E_INVALIDARG) +// } +// +// Or if the function returns a boolean +// +// BOOL Foo(VOID *pBar) +// { +// CheckPointer(pBar,FALSE) +// } + +#define ValidateReadPtr(p,cb) 0 +#define ValidateWritePtr(p,cb) 0 +#define ValidateReadWritePtr(p,cb) 0 +#define ValidateStringPtr(p) 0 +#define ValidateStringPtrA(p) 0 +#define ValidateStringPtrW(p) 0 + + +#ifdef _OBJBASE_H_ + + // Outputting GUID names. If you want to include the name + // associated with a GUID (eg CLSID_...) then + // + // GuidNames[yourGUID] + // + // Returns the name defined in uuids.h as a string + + typedef struct { + CHAR *szName; + GUID guid; + } GUID_STRING_ENTRY; + + class CGuidNameList { + public: + CHAR *operator [] (const GUID& guid); + }; + + extern CGuidNameList GuidNames; + +#endif + +#ifndef REMIND + // REMIND macro - generates warning as reminder to complete coding + // (eg) usage: + // + // #pragma message (REMIND("Add automation support")) + + + #define QUOTE(x) #x + #define QQUOTE(y) QUOTE(y) + #define REMIND(str) __FILE__ "(" QQUOTE(__LINE__) ") : " str +#endif + +// Method to display objects in a useful format +// +// eg If you want to display a LONGLONG ll in a debug string do (eg) +// +// DbgLog((LOG_TRACE, n, TEXT("Value is %s"), (LPCTSTR)CDisp(ll, CDISP_HEX))); + + +class CDispBasic +{ +public: + CDispBasic() { m_pString = m_String; }; + ~CDispBasic(); +protected: + PTCHAR m_pString; // normally points to m_String... unless too much data + TCHAR m_String[50]; +}; +class CDisp : public CDispBasic +{ +public: + CDisp(LONGLONG ll, int Format = CDISP_HEX); // Display a LONGLONG in CDISP_HEX or CDISP_DEC form + CDisp(REFCLSID clsid); // Display a GUID + CDisp(double d); // Display a floating point number +#ifdef __strmif_h__ +#ifdef __STREAMS__ + CDisp(CRefTime t); // Display a Reference Time +#endif + CDisp(IPin *pPin); // Display a pin as {filter clsid}(pin name) + CDisp(IUnknown *pUnk); // Display a filter or pin +#endif // __strmif_h__ + ~CDisp(); + + // Implement cast to (LPCTSTR) as parameter to logger + operator LPCTSTR() + { + return (LPCTSTR)m_pString; + }; +}; + + +#if defined(DEBUG) +class CAutoTrace +{ +private: + LPCTSTR _szBlkName; + const int _level; + static const TCHAR _szEntering[]; + static const TCHAR _szLeaving[]; +public: + CAutoTrace(LPCTSTR szBlkName, const int level = 15) + : _szBlkName(szBlkName), _level(level) + {DbgLog((LOG_TRACE, _level, _szEntering, _szBlkName));} + + ~CAutoTrace() + {DbgLog((LOG_TRACE, _level, _szLeaving, _szBlkName));} +}; + +#if defined (__FUNCTION__) + +#define AMTRACEFN() CAutoTrace __trace(TEXT(__FUNCTION__)) +#define AMTRACE(_x_) CAutoTrace __trace(TEXT(__FUNCTION__)) + +#else + +#define AMTRACE(_x_) CAutoTrace __trace _x_ +#define AMTRACEFN() + +#endif + +#else + +#define AMTRACE(_x_) +#define AMTRACEFN() + +#endif + +#endif // __WXDEBUG__ + + diff --git a/third_party/BaseClasses/wxlist.cpp b/third_party/BaseClasses/wxlist.cpp new file mode 100644 index 00000000..2ec67a45 --- /dev/null +++ b/third_party/BaseClasses/wxlist.cpp @@ -0,0 +1,891 @@ +//------------------------------------------------------------------------------ +// File: WXList.cpp +// +// Desc: DirectShow base classes - implements a non-MFC based generic list +// template class. +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +/* A generic list of pointers to objects. + Objectives: avoid using MFC libraries in ndm kernel mode and + provide a really useful list type. + + The class is thread safe in that separate threads may add and + delete items in the list concurrently although the application + must ensure that constructor and destructor access is suitably + synchronised. + + The list name must not conflict with MFC classes as an + application may use both + + The nodes form a doubly linked, NULL terminated chain with an anchor + block (the list object per se) holding pointers to the first and last + nodes and a count of the nodes. + There is a node cache to reduce the allocation and freeing overhead. + It optionally (determined at construction time) has an Event which is + set whenever the list becomes non-empty and reset whenever it becomes + empty. + It optionally (determined at construction time) has a Critical Section + which is entered during the important part of each operation. (About + all you can do outside it is some parameter checking). + + The node cache is a repository of nodes that are NOT in the list to speed + up storage allocation. Each list has its own cache to reduce locking and + serialising. The list accesses are serialised anyway for a given list - a + common cache would mean that we would have to separately serialise access + of all lists within the cache. Because the cache only stores nodes that are + not in the list, releasing the cache does not release any list nodes. This + means that list nodes can be copied or rechained from one list to another + without danger of creating a dangling reference if the original cache goes + away. + + Questionable design decisions: + 1. Retaining the warts for compatibility + 2. Keeping an element count -i.e. counting whenever we do anything + instead of only when we want the count. + 3. Making the chain pointers NULL terminated. If the list object + itself looks just like a node and the list is kept as a ring then + it reduces the number of special cases. All inserts look the same. +*/ + + +#include + +/* set cursor to the position of each element of list in turn */ +#define INTERNALTRAVERSELIST(list, cursor) \ +for ( cursor = (list).GetHeadPositionI() \ + ; cursor!=NULL \ + ; cursor = (list).Next(cursor) \ + ) + + +/* set cursor to the position of each element of list in turn + in reverse order +*/ +#define INTERNALREVERSETRAVERSELIST(list, cursor) \ +for ( cursor = (list).GetTailPositionI() \ + ; cursor!=NULL \ + ; cursor = (list).Prev(cursor) \ + ) + +/* Constructor calls a separate initialisation function that + creates a node cache, optionally creates a lock object + and optionally creates a signaling object. + + By default we create a locking object, a DEFAULTCACHE sized + cache but no event object so the list cannot be used in calls + to WaitForSingleObject +*/ +CBaseList::CBaseList(__in_opt LPCTSTR pName, // Descriptive list name + INT iItems) : // Node cache size +#ifdef DEBUG + CBaseObject(pName), +#endif + m_pFirst(NULL), + m_pLast(NULL), + m_Count(0), + m_Cache(iItems) +{ +} // constructor + +CBaseList::CBaseList(__in_opt LPCTSTR pName) : // Descriptive list name +#ifdef DEBUG + CBaseObject(pName), +#endif + m_pFirst(NULL), + m_pLast(NULL), + m_Count(0), + m_Cache(DEFAULTCACHE) +{ +} // constructor + +#ifdef UNICODE +CBaseList::CBaseList(__in_opt LPCSTR pName, // Descriptive list name + INT iItems) : // Node cache size +#ifdef DEBUG + CBaseObject(pName), +#endif + m_pFirst(NULL), + m_pLast(NULL), + m_Count(0), + m_Cache(iItems) +{ +} // constructor + +CBaseList::CBaseList(__in_opt LPCSTR pName) : // Descriptive list name +#ifdef DEBUG + CBaseObject(pName), +#endif + m_pFirst(NULL), + m_pLast(NULL), + m_Count(0), + m_Cache(DEFAULTCACHE) +{ +} // constructor + +#endif + +/* The destructor enumerates all the node objects in the list and + in the cache deleting each in turn. We do not do any processing + on the objects that the list holds (i.e. points to) so if they + represent interfaces for example the creator of the list should + ensure that each of them is released before deleting us +*/ +CBaseList::~CBaseList() +{ + /* Delete all our list nodes */ + + RemoveAll(); + +} // destructor + +/* Remove all the nodes from the list but don't do anything + with the objects that each node looks after (this is the + responsibility of the creator). + Aa a last act we reset the signalling event + (if available) to indicate to clients that the list + does not have any entries in it. +*/ +void CBaseList::RemoveAll() +{ + /* Free up all the CNode objects NOTE we don't bother putting the + deleted nodes into the cache as this method is only really called + in serious times of change such as when we are being deleted at + which point the cache will be deleted anway */ + + CNode *pn = m_pFirst; + while (pn) { + CNode *op = pn; + pn = pn->Next(); + delete op; + } + + /* Reset the object count and the list pointers */ + + m_Count = 0; + m_pFirst = m_pLast = NULL; + +} // RemoveAll + + + +/* Return a position enumerator for the entire list. + A position enumerator is a pointer to a node object cast to a + transparent type so all we do is return the head/tail node + pointer in the list. + WARNING because the position is a pointer to a node there is + an implicit assumption for users a the list class that after + deleting an object from the list that any other position + enumerators that you have may be invalid (since the node + may be gone). +*/ +__out_opt POSITION CBaseList::GetHeadPositionI() const +{ + return (POSITION) m_pFirst; +} // GetHeadPosition + + + +__out_opt POSITION CBaseList::GetTailPositionI() const +{ + return (POSITION) m_pLast; +} // GetTailPosition + + + +/* Get the number of objects in the list, + Get the lock before accessing the count. + Locking may not be entirely necessary but it has the side effect + of making sure that all operations are complete before we get it. + So for example if a list is being added to this list then that + will have completed in full before we continue rather than seeing + an intermediate albeit valid state +*/ +int CBaseList::GetCountI() const +{ + return m_Count; +} // GetCount + + + +/* Return the object at rp, update rp to the next object from + the list or NULL if you have moved over the last object. + You may still call this function once we return NULL but + we will continue to return a NULL position value +*/ +__out void *CBaseList::GetNextI(__inout POSITION& rp) const +{ + /* have we reached the end of the list */ + + if (rp == NULL) { + return NULL; + } + + /* Lock the object before continuing */ + + void *pObject; + + /* Copy the original position then step on */ + + CNode *pn = (CNode *) rp; + ASSERT(pn != NULL); + rp = (POSITION) pn->Next(); + + /* Get the object at the original position from the list */ + + pObject = pn->GetData(); + // ASSERT(pObject != NULL); // NULL pointers in the list are allowed. + return pObject; +} //GetNext + + + +/* Return the object at p. + Asking for the object at NULL ASSERTs then returns NULL + The object is NOT locked. The list is not being changed + in any way. If another thread is busy deleting the object + then locking would only result in a change from one bad + behaviour to another. +*/ +__out_opt void *CBaseList::GetI(__in_opt POSITION p) const +{ + if (p == NULL) { + return NULL; + } + + CNode * pn = (CNode *) p; + void *pObject = pn->GetData(); + // ASSERT(pObject != NULL); // NULL pointers in the list are allowed. + return pObject; +} //Get + +__out void *CBaseList::GetValidI(__in POSITION p) const +{ + CNode * pn = (CNode *) p; + void *pObject = pn->GetData(); + // ASSERT(pObject != NULL); // NULL pointers in the list are allowed. + return pObject; +} //Get + + +/* Return the first position in the list which holds the given pointer. + Return NULL if it's not found. +*/ +__out_opt POSITION CBaseList::FindI( __in void * pObj) const +{ + POSITION pn; + INTERNALTRAVERSELIST(*this, pn){ + if (GetI(pn)==pObj) { + return pn; + } + } + return NULL; +} // Find + + + +/* Remove the first node in the list (deletes the pointer to its object + from the list, does not free the object itself). + Return the pointer to its object or NULL if empty +*/ +__out_opt void *CBaseList::RemoveHeadI() +{ + /* All we do is get the head position and ask for that to be deleted. + We could special case this since some of the code path checking + in Remove() is redundant as we know there is no previous + node for example but it seems to gain little over the + added complexity + */ + + return RemoveI((POSITION)m_pFirst); +} // RemoveHead + + + +/* Remove the last node in the list (deletes the pointer to its object + from the list, does not free the object itself). + Return the pointer to its object or NULL if empty +*/ +__out_opt void *CBaseList::RemoveTailI() +{ + /* All we do is get the tail position and ask for that to be deleted. + We could special case this since some of the code path checking + in Remove() is redundant as we know there is no previous + node for example but it seems to gain little over the + added complexity + */ + + return RemoveI((POSITION)m_pLast); +} // RemoveTail + + + +/* Remove the pointer to the object in this position from the list. + Deal with all the chain pointers + Return a pointer to the object removed from the list. + The node object that is freed as a result + of this operation is added to the node cache where + it can be used again. + Remove(NULL) is a harmless no-op - but probably is a wart. +*/ +__out_opt void *CBaseList::RemoveI(__in_opt POSITION pos) +{ + /* Lock the critical section before continuing */ + + // ASSERT (pos!=NULL); // Removing NULL is to be harmless! + if (pos==NULL) return NULL; + + + CNode *pCurrent = (CNode *) pos; + ASSERT(pCurrent != NULL); + + /* Update the previous node */ + + CNode *pNode = pCurrent->Prev(); + if (pNode == NULL) { + m_pFirst = pCurrent->Next(); + } else { + pNode->SetNext(pCurrent->Next()); + } + + /* Update the following node */ + + pNode = pCurrent->Next(); + if (pNode == NULL) { + m_pLast = pCurrent->Prev(); + } else { + pNode->SetPrev(pCurrent->Prev()); + } + + /* Get the object this node was looking after */ + + void *pObject = pCurrent->GetData(); + + // ASSERT(pObject != NULL); // NULL pointers in the list are allowed. + + /* Try and add the node object to the cache - + a NULL return code from the cache means we ran out of room. + The cache size is fixed by a constructor argument when the + list is created and defaults to DEFAULTCACHE. + This means that the cache will have room for this many + node objects. So if you have a list of media samples + and you know there will never be more than five active at + any given time of them for example then override the default + constructor + */ + + m_Cache.AddToCache(pCurrent); + + /* If the list is empty then reset the list event */ + + --m_Count; + ASSERT(m_Count >= 0); + return pObject; +} // Remove + + + +/* Add this object to the tail end of our list + Return the new tail position. +*/ + +__out_opt POSITION CBaseList::AddTailI(__in void *pObject) +{ + /* Lock the critical section before continuing */ + + CNode *pNode; + // ASSERT(pObject); // NULL pointers in the list are allowed. + + /* If there is a node objects in the cache then use + that otherwise we will have to create a new one */ + + pNode = (CNode *) m_Cache.RemoveFromCache(); + if (pNode == NULL) { + pNode = new CNode; + } + + /* Check we have a valid object */ + + if (pNode == NULL) { + return NULL; + } + + /* Initialise all the CNode object + just in case it came from the cache + */ + + pNode->SetData(pObject); + pNode->SetNext(NULL); + pNode->SetPrev(m_pLast); + + if (m_pLast == NULL) { + m_pFirst = pNode; + } else { + m_pLast->SetNext(pNode); + } + + /* Set the new last node pointer and also increment the number + of list entries, the critical section is unlocked when we + exit the function + */ + + m_pLast = pNode; + ++m_Count; + + return (POSITION) pNode; +} // AddTail(object) + + + +/* Add this object to the head end of our list + Return the new head position. +*/ +__out_opt POSITION CBaseList::AddHeadI(__in void *pObject) +{ + CNode *pNode; + // ASSERT(pObject); // NULL pointers in the list are allowed. + + /* If there is a node objects in the cache then use + that otherwise we will have to create a new one */ + + pNode = (CNode *) m_Cache.RemoveFromCache(); + if (pNode == NULL) { + pNode = new CNode; + } + + /* Check we have a valid object */ + + if (pNode == NULL) { + return NULL; + } + + /* Initialise all the CNode object + just in case it came from the cache + */ + + pNode->SetData(pObject); + + /* chain it in (set four pointers) */ + pNode->SetPrev(NULL); + pNode->SetNext(m_pFirst); + + if (m_pFirst == NULL) { + m_pLast = pNode; + } else { + m_pFirst->SetPrev(pNode); + } + m_pFirst = pNode; + + ++m_Count; + + return (POSITION) pNode; +} // AddHead(object) + + + +/* Add all the elements in *pList to the tail of this list. + Return TRUE if it all worked, FALSE if it didn't. + If it fails some elements may have been added. +*/ +BOOL CBaseList::AddTail(__in CBaseList *pList) +{ + /* lock the object before starting then enumerate + each entry in the source list and add them one by one to + our list (while still holding the object lock) + Lock the other list too. + */ + POSITION pos = pList->GetHeadPositionI(); + + while (pos) { + if (NULL == AddTailI(pList->GetNextI(pos))) { + return FALSE; + } + } + return TRUE; +} // AddTail(list) + + + +/* Add all the elements in *pList to the head of this list. + Return TRUE if it all worked, FALSE if it didn't. + If it fails some elements may have been added. +*/ +BOOL CBaseList::AddHead(__in CBaseList *pList) +{ + /* lock the object before starting then enumerate + each entry in the source list and add them one by one to + our list (while still holding the object lock) + Lock the other list too. + + To avoid reversing the list, traverse it backwards. + */ + + POSITION pos; + + INTERNALREVERSETRAVERSELIST(*pList, pos) { + if (NULL== AddHeadI(pList->GetValidI(pos))){ + return FALSE; + } + } + return TRUE; +} // AddHead(list) + + + +/* Add the object after position p + p is still valid after the operation. + AddAfter(NULL,x) adds x to the start - same as AddHead + Return the position of the new object, NULL if it failed +*/ +__out_opt POSITION CBaseList::AddAfterI(__in_opt POSITION pos, __in void * pObj) +{ + if (pos==NULL) + return AddHeadI(pObj); + + /* As someone else might be furkling with the list - + Lock the critical section before continuing + */ + CNode *pAfter = (CNode *) pos; + ASSERT(pAfter != NULL); + if (pAfter==m_pLast) + return AddTailI(pObj); + + /* set pnode to point to a new node, preferably from the cache */ + + CNode *pNode = (CNode *) m_Cache.RemoveFromCache(); + if (pNode == NULL) { + pNode = new CNode; + } + + /* Check we have a valid object */ + + if (pNode == NULL) { + return NULL; + } + + /* Initialise all the CNode object + just in case it came from the cache + */ + + pNode->SetData(pObj); + + /* It is to be added to the middle of the list - there is a before + and after node. Chain it after pAfter, before pBefore. + */ + CNode * pBefore = pAfter->Next(); + ASSERT(pBefore != NULL); + + /* chain it in (set four pointers) */ + pNode->SetPrev(pAfter); + pNode->SetNext(pBefore); + pBefore->SetPrev(pNode); + pAfter->SetNext(pNode); + + ++m_Count; + + return (POSITION) pNode; + +} // AddAfter(object) + + + +BOOL CBaseList::AddAfter(__in_opt POSITION p, __in CBaseList *pList) +{ + POSITION pos; + INTERNALTRAVERSELIST(*pList, pos) { + /* p follows along the elements being added */ + p = AddAfterI(p, pList->GetValidI(pos)); + if (p==NULL) return FALSE; + } + return TRUE; +} // AddAfter(list) + + + +/* Mirror images: + Add the element or list after position p. + p is still valid after the operation. + AddBefore(NULL,x) adds x to the end - same as AddTail +*/ +__out_opt POSITION CBaseList::AddBeforeI(__in_opt POSITION pos, __in void * pObj) +{ + if (pos==NULL) + return AddTailI(pObj); + + /* set pnode to point to a new node, preferably from the cache */ + + CNode *pBefore = (CNode *) pos; + ASSERT(pBefore != NULL); + if (pBefore==m_pFirst) + return AddHeadI(pObj); + + CNode * pNode = (CNode *) m_Cache.RemoveFromCache(); + if (pNode == NULL) { + pNode = new CNode; + } + + /* Check we have a valid object */ + + if (pNode == NULL) { + return NULL; + } + + /* Initialise all the CNode object + just in case it came from the cache + */ + + pNode->SetData(pObj); + + /* It is to be added to the middle of the list - there is a before + and after node. Chain it after pAfter, before pBefore. + */ + + CNode * pAfter = pBefore->Prev(); + ASSERT(pAfter != NULL); + + /* chain it in (set four pointers) */ + pNode->SetPrev(pAfter); + pNode->SetNext(pBefore); + pBefore->SetPrev(pNode); + pAfter->SetNext(pNode); + + ++m_Count; + + return (POSITION) pNode; + +} // Addbefore(object) + + + +BOOL CBaseList::AddBefore(__in_opt POSITION p, __in CBaseList *pList) +{ + POSITION pos; + INTERNALREVERSETRAVERSELIST(*pList, pos) { + /* p follows along the elements being added */ + p = AddBeforeI(p, pList->GetValidI(pos)); + if (p==NULL) return FALSE; + } + return TRUE; +} // AddBefore(list) + + + +/* Split *this after position p in *this + Retain as *this the tail portion of the original *this + Add the head portion to the tail end of *pList + Return TRUE if it all worked, FALSE if it didn't. + + e.g. + foo->MoveToTail(foo->GetHeadPosition(), bar); + moves one element from the head of foo to the tail of bar + foo->MoveToTail(NULL, bar); + is a no-op + foo->MoveToTail(foo->GetTailPosition, bar); + concatenates foo onto the end of bar and empties foo. + + A better, except excessively long name might be + MoveElementsFromHeadThroughPositionToOtherTail +*/ +BOOL CBaseList::MoveToTail + (__in_opt POSITION pos, __in CBaseList *pList) +{ + /* Algorithm: + Note that the elements (including their order) in the concatenation + of *pList to the head of *this is invariant. + 1. Count elements to be moved + 2. Join *pList onto the head of this to make one long chain + 3. Set first/Last pointers in *this and *pList + 4. Break the chain at the new place + 5. Adjust counts + 6. Set/Reset any events + */ + + if (pos==NULL) return TRUE; // no-op. Eliminates special cases later. + + + /* Make cMove the number of nodes to move */ + CNode * p = (CNode *)pos; + int cMove = 0; // number of nodes to move + while(p!=NULL) { + p = p->Prev(); + ++cMove; + } + + + /* Join the two chains together */ + if (pList->m_pLast!=NULL) + pList->m_pLast->SetNext(m_pFirst); + if (m_pFirst!=NULL) + m_pFirst->SetPrev(pList->m_pLast); + + + /* set first and last pointers */ + p = (CNode *)pos; + + if (pList->m_pFirst==NULL) + pList->m_pFirst = m_pFirst; + m_pFirst = p->Next(); + if (m_pFirst==NULL) + m_pLast = NULL; + pList->m_pLast = p; + + + /* Break the chain after p to create the new pieces */ + if (m_pFirst!=NULL) + m_pFirst->SetPrev(NULL); + p->SetNext(NULL); + + + /* Adjust the counts */ + m_Count -= cMove; + pList->m_Count += cMove; + + return TRUE; + +} // MoveToTail + + + +/* Mirror image of MoveToTail: + Split *this before position p in *this. + Retain in *this the head portion of the original *this + Add the tail portion to the start (i.e. head) of *pList + Return TRUE if it all worked, FALSE if it didn't. + + e.g. + foo->MoveToHead(foo->GetTailPosition(), bar); + moves one element from the tail of foo to the head of bar + foo->MoveToHead(NULL, bar); + is a no-op + foo->MoveToHead(foo->GetHeadPosition, bar); + concatenates foo onto the start of bar and empties foo. +*/ +BOOL CBaseList::MoveToHead + (__in_opt POSITION pos, __in CBaseList *pList) +{ + + /* See the comments on the algorithm in MoveToTail */ + + if (pos==NULL) return TRUE; // no-op. Eliminates special cases later. + + /* Make cMove the number of nodes to move */ + CNode * p = (CNode *)pos; + int cMove = 0; // number of nodes to move + while(p!=NULL) { + p = p->Next(); + ++cMove; + } + + + /* Join the two chains together */ + if (pList->m_pFirst!=NULL) + pList->m_pFirst->SetPrev(m_pLast); + if (m_pLast!=NULL) + m_pLast->SetNext(pList->m_pFirst); + + + /* set first and last pointers */ + p = (CNode *)pos; + + + if (pList->m_pLast==NULL) + pList->m_pLast = m_pLast; + + m_pLast = p->Prev(); + if (m_pLast==NULL) + m_pFirst = NULL; + pList->m_pFirst = p; + + + /* Break the chain after p to create the new pieces */ + if (m_pLast!=NULL) + m_pLast->SetNext(NULL); + p->SetPrev(NULL); + + + /* Adjust the counts */ + m_Count -= cMove; + pList->m_Count += cMove; + + return TRUE; + +} // MoveToHead + + + +/* Reverse the order of the [pointers to] objects in *this +*/ +void CBaseList::Reverse() +{ + /* algorithm: + The obvious booby trap is that you flip pointers around and lose + addressability to the node that you are going to process next. + The easy way to avoid this is do do one chain at a time. + + Run along the forward chain, + For each node, set the reverse pointer to the one ahead of us. + The reverse chain is now a copy of the old forward chain, including + the NULL termination. + + Run along the reverse chain (i.e. old forward chain again) + For each node set the forward pointer of the node ahead to point back + to the one we're standing on. + The first node needs special treatment, + it's new forward pointer is NULL. + Finally set the First/Last pointers + + */ + CNode * p; + + // Yes we COULD use a traverse, but it would look funny! + p = m_pFirst; + while (p!=NULL) { + CNode * q; + q = p->Next(); + p->SetNext(p->Prev()); + p->SetPrev(q); + p = q; + } + + p = m_pFirst; + m_pFirst = m_pLast; + m_pLast = p; + + +#if 0 // old version + + if (m_pFirst==NULL) return; // empty list + if (m_pFirst->Next()==NULL) return; // single node list + + + /* run along forward chain */ + for ( p = m_pFirst + ; p!=NULL + ; p = p->Next() + ){ + p->SetPrev(p->Next()); + } + + + /* special case first element */ + m_pFirst->SetNext(NULL); // fix the old first element + + + /* run along new reverse chain i.e. old forward chain again */ + for ( p = m_pFirst // start at the old first element + ; p->Prev()!=NULL // while there's a node still to be set + ; p = p->Prev() // work in the same direction as before + ){ + p->Prev()->SetNext(p); + } + + + /* fix forward and reverse pointers + - the triple XOR swap would work but all the casts look hideous */ + p = m_pFirst; + m_pFirst = m_pLast; + m_pLast = p; +#endif + +} // Reverse diff --git a/third_party/BaseClasses/wxlist.h b/third_party/BaseClasses/wxlist.h new file mode 100644 index 00000000..47e71230 --- /dev/null +++ b/third_party/BaseClasses/wxlist.h @@ -0,0 +1,553 @@ +//------------------------------------------------------------------------------ +// File: WXList.h +// +// Desc: DirectShow base classes - defines a non-MFC generic template list +// class. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +/* A generic list of pointers to objects. + No storage management or copying is done on the objects pointed to. + Objectives: avoid using MFC libraries in ndm kernel mode and + provide a really useful list type. + + The class is thread safe in that separate threads may add and + delete items in the list concurrently although the application + must ensure that constructor and destructor access is suitably + synchronised. An application can cause deadlock with operations + which use two lists by simultaneously calling + list1->Operation(list2) and list2->Operation(list1). So don't! + + The names must not conflict with MFC classes as an application + may use both. + */ + +#ifndef __WXLIST__ +#define __WXLIST__ + + /* A POSITION represents (in some fashion that's opaque) a cursor + on the list that can be set to identify any element. NULL is + a valid value and several operations regard NULL as the position + "one step off the end of the list". (In an n element list there + are n+1 places to insert and NULL is that "n+1-th" value). + The POSITION of an element in the list is only invalidated if + that element is deleted. Move operations may mean that what + was a valid POSITION in one list is now a valid POSITION in + a different list. + + Some operations which at first sight are illegal are allowed as + harmless no-ops. For instance RemoveHead is legal on an empty + list and it returns NULL. This allows an atomic way to test if + there is an element there, and if so, get it. The two operations + AddTail and RemoveHead thus implement a MONITOR (See Hoare's paper). + + Single element operations return POSITIONs, non-NULL means it worked. + whole list operations return a BOOL. TRUE means it all worked. + + This definition is the same as the POSITION type for MFCs, so we must + avoid defining it twice. + */ +#ifndef __AFX_H__ +struct __POSITION { int unused; }; +typedef __POSITION* POSITION; +#endif + +const int DEFAULTCACHE = 10; /* Default node object cache size */ + +/* A class representing one node in a list. + Each node knows a pointer to it's adjacent nodes and also a pointer + to the object that it looks after. + All of these pointers can be retrieved or set through member functions. +*/ +class CBaseList +#ifdef DEBUG + : public CBaseObject +#endif +{ + /* Making these classes inherit from CBaseObject does nothing + functionally but it allows us to check there are no memory + leaks in debug builds. + */ + +public: + +#ifdef DEBUG + class CNode : public CBaseObject { +#else + class CNode { +#endif + + CNode *m_pPrev; /* Previous node in the list */ + CNode *m_pNext; /* Next node in the list */ + void *m_pObject; /* Pointer to the object */ + + public: + + /* Constructor - initialise the object's pointers */ + CNode() +#ifdef DEBUG + : CBaseObject(NAME("List node")) +#endif + { + }; + + + /* Return the previous node before this one */ + __out CNode *Prev() const { return m_pPrev; }; + + + /* Return the next node after this one */ + __out CNode *Next() const { return m_pNext; }; + + + /* Set the previous node before this one */ + void SetPrev(__in_opt CNode *p) { m_pPrev = p; }; + + + /* Set the next node after this one */ + void SetNext(__in_opt CNode *p) { m_pNext = p; }; + + + /* Get the pointer to the object for this node */ + __out void *GetData() const { return m_pObject; }; + + + /* Set the pointer to the object for this node */ + void SetData(__in void *p) { m_pObject = p; }; + }; + + class CNodeCache + { + public: + CNodeCache(INT iCacheSize) : m_iCacheSize(iCacheSize), + m_pHead(NULL), + m_iUsed(0) + {}; + ~CNodeCache() { + CNode *pNode = m_pHead; + while (pNode) { + CNode *pCurrent = pNode; + pNode = pNode->Next(); + delete pCurrent; + } + }; + void AddToCache(__inout CNode *pNode) + { + if (m_iUsed < m_iCacheSize) { + pNode->SetNext(m_pHead); + m_pHead = pNode; + m_iUsed++; + } else { + delete pNode; + } + }; + CNode *RemoveFromCache() + { + CNode *pNode = m_pHead; + if (pNode != NULL) { + m_pHead = pNode->Next(); + m_iUsed--; + ASSERT(m_iUsed >= 0); + } else { + ASSERT(m_iUsed == 0); + } + return pNode; + }; + private: + INT m_iCacheSize; + INT m_iUsed; + CNode *m_pHead; + }; + +protected: + + CNode* m_pFirst; /* Pointer to first node in the list */ + CNode* m_pLast; /* Pointer to the last node in the list */ + LONG m_Count; /* Number of nodes currently in the list */ + +private: + + CNodeCache m_Cache; /* Cache of unused node pointers */ + +private: + + /* These override the default copy constructor and assignment + operator for all list classes. They are in the private class + declaration section so that anybody trying to pass a list + object by value will generate a compile time error of + "cannot access the private member function". If these were + not here then the compiler will create default constructors + and assignment operators which when executed first take a + copy of all member variables and then during destruction + delete them all. This must not be done for any heap + allocated data. + */ + CBaseList(const CBaseList &refList); + CBaseList &operator=(const CBaseList &refList); + +public: + + CBaseList(__in_opt LPCTSTR pName, + INT iItems); + + CBaseList(__in_opt LPCTSTR pName); +#ifdef UNICODE + CBaseList(__in_opt LPCSTR pName, + INT iItems); + + CBaseList(__in_opt LPCSTR pName); +#endif + ~CBaseList(); + + /* Remove all the nodes from *this i.e. make the list empty */ + void RemoveAll(); + + + /* Return a cursor which identifies the first element of *this */ + __out_opt POSITION GetHeadPositionI() const; + + + /* Return a cursor which identifies the last element of *this */ + __out_opt POSITION GetTailPositionI() const; + + + /* Return the number of objects in *this */ + int GetCountI() const; + +protected: + /* Return the pointer to the object at rp, + Update rp to the next node in *this + but make it NULL if it was at the end of *this. + This is a wart retained for backwards compatibility. + GetPrev is not implemented. + Use Next, Prev and Get separately. + */ + __out void *GetNextI(__inout POSITION& rp) const; + + + /* Return a pointer to the object at p + Asking for the object at NULL will return NULL harmlessly. + */ + __out_opt void *GetI(__in_opt POSITION p) const; + __out void *GetValidI(__in POSITION p) const; + +public: + /* return the next / prev position in *this + return NULL when going past the end/start. + Next(NULL) is same as GetHeadPosition() + Prev(NULL) is same as GetTailPosition() + An n element list therefore behaves like a n+1 element + cycle with NULL at the start/end. + + !!WARNING!! - This handling of NULL is DIFFERENT from GetNext. + + Some reasons are: + 1. For a list of n items there are n+1 positions to insert + These are conveniently encoded as the n POSITIONs and NULL. + 2. If you are keeping a list sorted (fairly common) and you + search forward for an element to insert before and don't + find it you finish up with NULL as the element before which + to insert. You then want that NULL to be a valid POSITION + so that you can insert before it and you want that insertion + point to mean the (n+1)-th one that doesn't have a POSITION. + (symmetrically if you are working backwards through the list). + 3. It simplifies the algebra which the methods generate. + e.g. AddBefore(p,x) is identical to AddAfter(Prev(p),x) + in ALL cases. All the other arguments probably are reflections + of the algebraic point. + */ + __out_opt POSITION Next(__in_opt POSITION pos) const + { + if (pos == NULL) { + return (POSITION) m_pFirst; + } + CNode *pn = (CNode *) pos; + return (POSITION) pn->Next(); + } //Next + + // See Next + __out_opt POSITION Prev(__in_opt POSITION pos) const + { + if (pos == NULL) { + return (POSITION) m_pLast; + } + CNode *pn = (CNode *) pos; + return (POSITION) pn->Prev(); + } //Prev + + + /* Return the first position in *this which holds the given + pointer. Return NULL if the pointer was not not found. + */ +protected: + __out_opt POSITION FindI( __in void * pObj) const; + + // ??? Should there be (or even should there be only) + // ??? POSITION FindNextAfter(void * pObj, POSITION p) + // ??? And of course FindPrevBefore too. + // ??? List.Find(&Obj) then becomes List.FindNextAfter(&Obj, NULL) + + + /* Remove the first node in *this (deletes the pointer to its + object from the list, does not free the object itself). + Return the pointer to its object. + If *this was already empty it will harmlessly return NULL. + */ + __out_opt void *RemoveHeadI(); + + + /* Remove the last node in *this (deletes the pointer to its + object from the list, does not free the object itself). + Return the pointer to its object. + If *this was already empty it will harmlessly return NULL. + */ + __out_opt void *RemoveTailI(); + + + /* Remove the node identified by p from the list (deletes the pointer + to its object from the list, does not free the object itself). + Asking to Remove the object at NULL will harmlessly return NULL. + Return the pointer to the object removed. + */ + __out_opt void *RemoveI(__in_opt POSITION p); + + /* Add single object *pObj to become a new last element of the list. + Return the new tail position, NULL if it fails. + If you are adding a COM objects, you might want AddRef it first. + Other existing POSITIONs in *this are still valid + */ + __out_opt POSITION AddTailI(__in void * pObj); +public: + + + /* Add all the elements in *pList to the tail of *this. + This duplicates all the nodes in *pList (i.e. duplicates + all its pointers to objects). It does not duplicate the objects. + If you are adding a list of pointers to a COM object into the list + it's a good idea to AddRef them all it when you AddTail it. + Return TRUE if it all worked, FALSE if it didn't. + If it fails some elements may have been added. + Existing POSITIONs in *this are still valid + + If you actually want to MOVE the elements, use MoveToTail instead. + */ + BOOL AddTail(__in CBaseList *pList); + + + /* Mirror images of AddHead: */ + + /* Add single object to become a new first element of the list. + Return the new head position, NULL if it fails. + Existing POSITIONs in *this are still valid + */ +protected: + __out_opt POSITION AddHeadI(__in void * pObj); +public: + + /* Add all the elements in *pList to the head of *this. + Same warnings apply as for AddTail. + Return TRUE if it all worked, FALSE if it didn't. + If it fails some of the objects may have been added. + + If you actually want to MOVE the elements, use MoveToHead instead. + */ + BOOL AddHead(__in CBaseList *pList); + + + /* Add the object *pObj to *this after position p in *this. + AddAfter(NULL,x) adds x to the start - equivalent to AddHead + Return the position of the object added, NULL if it failed. + Existing POSITIONs in *this are undisturbed, including p. + */ +protected: + __out_opt POSITION AddAfterI(__in_opt POSITION p, __in void * pObj); +public: + + /* Add the list *pList to *this after position p in *this + AddAfter(NULL,x) adds x to the start - equivalent to AddHead + Return TRUE if it all worked, FALSE if it didn't. + If it fails, some of the objects may be added + Existing POSITIONs in *this are undisturbed, including p. + */ + BOOL AddAfter(__in_opt POSITION p, __in CBaseList *pList); + + + /* Mirror images: + Add the object *pObj to this-List after position p in *this. + AddBefore(NULL,x) adds x to the end - equivalent to AddTail + Return the position of the new object, NULL if it fails + Existing POSITIONs in *this are undisturbed, including p. + */ + protected: + __out_opt POSITION AddBeforeI(__in_opt POSITION p, __in void * pObj); + public: + + /* Add the list *pList to *this before position p in *this + AddAfter(NULL,x) adds x to the start - equivalent to AddHead + Return TRUE if it all worked, FALSE if it didn't. + If it fails, some of the objects may be added + Existing POSITIONs in *this are undisturbed, including p. + */ + BOOL AddBefore(__in_opt POSITION p, __in CBaseList *pList); + + + /* Note that AddAfter(p,x) is equivalent to AddBefore(Next(p),x) + even in cases where p is NULL or Next(p) is NULL. + Similarly for mirror images etc. + This may make it easier to argue about programs. + */ + + + + /* The following operations do not copy any elements. + They move existing blocks of elements around by switching pointers. + They are fairly efficient for long lists as for short lists. + (Alas, the Count slows things down). + + They split the list into two parts. + One part remains as the original list, the other part + is appended to the second list. There are eight possible + variations: + Split the list {after/before} a given element + keep the {head/tail} portion in the original list + append the rest to the {head/tail} of the new list. + + Since After is strictly equivalent to Before Next + we are not in serious need of the Before/After variants. + That leaves only four. + + If you are processing a list left to right and dumping + the bits that you have processed into another list as + you go, the Tail/Tail variant gives the most natural result. + If you are processing in reverse order, Head/Head is best. + + By using NULL positions and empty lists judiciously either + of the other two can be built up in two operations. + + The definition of NULL (see Next/Prev etc) means that + degenerate cases include + "move all elements to new list" + "Split a list into two lists" + "Concatenate two lists" + (and quite a few no-ops) + + !!WARNING!! The type checking won't buy you much if you get list + positions muddled up - e.g. use a POSITION that's in a different + list and see what a mess you get! + */ + + /* Split *this after position p in *this + Retain as *this the tail portion of the original *this + Add the head portion to the tail end of *pList + Return TRUE if it all worked, FALSE if it didn't. + + e.g. + foo->MoveToTail(foo->GetHeadPosition(), bar); + moves one element from the head of foo to the tail of bar + foo->MoveToTail(NULL, bar); + is a no-op, returns NULL + foo->MoveToTail(foo->GetTailPosition, bar); + concatenates foo onto the end of bar and empties foo. + + A better, except excessively long name might be + MoveElementsFromHeadThroughPositionToOtherTail + */ + BOOL MoveToTail(__in_opt POSITION pos, __in CBaseList *pList); + + + /* Mirror image: + Split *this before position p in *this. + Retain in *this the head portion of the original *this + Add the tail portion to the start (i.e. head) of *pList + + e.g. + foo->MoveToHead(foo->GetTailPosition(), bar); + moves one element from the tail of foo to the head of bar + foo->MoveToHead(NULL, bar); + is a no-op, returns NULL + foo->MoveToHead(foo->GetHeadPosition, bar); + concatenates foo onto the start of bar and empties foo. + */ + BOOL MoveToHead(__in_opt POSITION pos, __in CBaseList *pList); + + + /* Reverse the order of the [pointers to] objects in *this + */ + void Reverse(); + + + /* set cursor to the position of each element of list in turn */ + #define TRAVERSELIST(list, cursor) \ + for ( cursor = (list).GetHeadPosition() \ + ; cursor!=NULL \ + ; cursor = (list).Next(cursor) \ + ) + + + /* set cursor to the position of each element of list in turn + in reverse order + */ + #define REVERSETRAVERSELIST(list, cursor) \ + for ( cursor = (list).GetTailPosition() \ + ; cursor!=NULL \ + ; cursor = (list).Prev(cursor) \ + ) + +}; // end of class declaration + +template class CGenericList : public CBaseList +{ +public: + CGenericList(__in_opt LPCTSTR pName, + INT iItems, + BOOL bLock = TRUE, + BOOL bAlert = FALSE) : + CBaseList(pName, iItems) { + UNREFERENCED_PARAMETER(bAlert); + UNREFERENCED_PARAMETER(bLock); + }; + CGenericList(__in_opt LPCTSTR pName) : + CBaseList(pName) { + }; + + __out_opt POSITION GetHeadPosition() const { return (POSITION)m_pFirst; } + __out_opt POSITION GetTailPosition() const { return (POSITION)m_pLast; } + int GetCount() const { return m_Count; } + + __out OBJECT *GetNext(__inout POSITION& rp) const { return (OBJECT *) GetNextI(rp); } + + __out_opt OBJECT *Get(__in_opt POSITION p) const { return (OBJECT *) GetI(p); } + __out OBJECT *GetValid(__in POSITION p) const { return (OBJECT *) GetValidI(p); } + __out_opt OBJECT *GetHead() const { return Get(GetHeadPosition()); } + + __out_opt OBJECT *RemoveHead() { return (OBJECT *) RemoveHeadI(); } + + __out_opt OBJECT *RemoveTail() { return (OBJECT *) RemoveTailI(); } + + __out_opt OBJECT *Remove(__in_opt POSITION p) { return (OBJECT *) RemoveI(p); } + __out_opt POSITION AddBefore(__in_opt POSITION p, __in OBJECT * pObj) { return AddBeforeI(p, pObj); } + __out_opt POSITION AddAfter(__in_opt POSITION p, __in OBJECT * pObj) { return AddAfterI(p, pObj); } + __out_opt POSITION AddHead(__in OBJECT * pObj) { return AddHeadI(pObj); } + __out_opt POSITION AddTail(__in OBJECT * pObj) { return AddTailI(pObj); } + BOOL AddTail(__in CGenericList *pList) + { return CBaseList::AddTail((CBaseList *) pList); } + BOOL AddHead(__in CGenericList *pList) + { return CBaseList::AddHead((CBaseList *) pList); } + BOOL AddAfter(__in_opt POSITION p, __in CGenericList *pList) + { return CBaseList::AddAfter(p, (CBaseList *) pList); }; + BOOL AddBefore(__in_opt POSITION p, __in CGenericList *pList) + { return CBaseList::AddBefore(p, (CBaseList *) pList); }; + __out_opt POSITION Find( __in OBJECT * pObj) const { return FindI(pObj); } +}; // end of class declaration + + + +/* These define the standard list types */ + +typedef CGenericList CBaseObjectList; +typedef CGenericList CBaseInterfaceList; + +#endif /* __WXLIST__ */ + diff --git a/third_party/BaseClasses/wxutil.cpp b/third_party/BaseClasses/wxutil.cpp new file mode 100644 index 00000000..5bc97a9a --- /dev/null +++ b/third_party/BaseClasses/wxutil.cpp @@ -0,0 +1,769 @@ +//------------------------------------------------------------------------------ +// File: WXUtil.cpp +// +// Desc: DirectShow base classes - implements helper classes for building +// multimedia filters. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#include +#define STRSAFE_NO_DEPRECATE +#include + + +// --- CAMEvent ----------------------- +CAMEvent::CAMEvent(BOOL fManualReset, __inout_opt HRESULT *phr) +{ + m_hEvent = CreateEvent(NULL, fManualReset, FALSE, NULL); + if (NULL == m_hEvent) { + if (NULL != phr && SUCCEEDED(*phr)) { + *phr = E_OUTOFMEMORY; + } + } +} + +CAMEvent::CAMEvent(__inout_opt HRESULT *phr) +{ + m_hEvent = CreateEvent(NULL, FALSE, FALSE, NULL); + if (NULL == m_hEvent) { + if (NULL != phr && SUCCEEDED(*phr)) { + *phr = E_OUTOFMEMORY; + } + } +} + +CAMEvent::~CAMEvent() +{ + if (m_hEvent) { + EXECUTE_ASSERT(CloseHandle(m_hEvent)); + } +} + + +// --- CAMMsgEvent ----------------------- +// One routine. The rest is handled in CAMEvent + +CAMMsgEvent::CAMMsgEvent(__inout_opt HRESULT *phr) : CAMEvent(FALSE, phr) +{ +} + +BOOL CAMMsgEvent::WaitMsg(DWORD dwTimeout) +{ + // wait for the event to be signalled, or for the + // timeout (in MS) to expire. allow SENT messages + // to be processed while we wait + DWORD dwWait; + DWORD dwStartTime; + + // set the waiting period. + DWORD dwWaitTime = dwTimeout; + + // the timeout will eventually run down as we iterate + // processing messages. grab the start time so that + // we can calculate elapsed times. + if (dwWaitTime != INFINITE) { + dwStartTime = timeGetTime(); + } + + do { + dwWait = MsgWaitForMultipleObjects(1,&m_hEvent,FALSE, dwWaitTime, QS_SENDMESSAGE); + if (dwWait == WAIT_OBJECT_0 + 1) { + MSG Message; + PeekMessage(&Message,NULL,0,0,PM_NOREMOVE); + + // If we have an explicit length of time to wait calculate + // the next wake up point - which might be now. + // If dwTimeout is INFINITE, it stays INFINITE + if (dwWaitTime != INFINITE) { + + DWORD dwElapsed = timeGetTime()-dwStartTime; + + dwWaitTime = + (dwElapsed >= dwTimeout) + ? 0 // wake up with WAIT_TIMEOUT + : dwTimeout-dwElapsed; + } + } + } while (dwWait == WAIT_OBJECT_0 + 1); + + // return TRUE if we woke on the event handle, + // FALSE if we timed out. + return (dwWait == WAIT_OBJECT_0); +} + +// --- CAMThread ---------------------- + + +CAMThread::CAMThread(__inout_opt HRESULT *phr) + : m_EventSend(TRUE, phr), // must be manual-reset for CheckRequest() + m_EventComplete(FALSE, phr) +{ + m_hThread = NULL; +} + +CAMThread::~CAMThread() { + Close(); +} + + +// when the thread starts, it calls this function. We unwrap the 'this' +//pointer and call ThreadProc. +DWORD WINAPI +CAMThread::InitialThreadProc(__inout LPVOID pv) +{ + HRESULT hrCoInit = CAMThread::CoInitializeHelper(); + if(FAILED(hrCoInit)) { + DbgLog((LOG_ERROR, 1, TEXT("CoInitializeEx failed."))); + } + + CAMThread * pThread = (CAMThread *) pv; + + HRESULT hr = pThread->ThreadProc(); + + if(SUCCEEDED(hrCoInit)) { + CoUninitialize(); + } + + return hr; +} + +BOOL +CAMThread::Create() +{ + DWORD threadid; + + CAutoLock lock(&m_AccessLock); + + if (ThreadExists()) { + return FALSE; + } + + m_hThread = CreateThread( + NULL, + 0, + CAMThread::InitialThreadProc, + this, + 0, + &threadid); + + if (!m_hThread) { + return FALSE; + } + + return TRUE; +} + +DWORD +CAMThread::CallWorker(DWORD dwParam) +{ + // lock access to the worker thread for scope of this object + CAutoLock lock(&m_AccessLock); + + if (!ThreadExists()) { + return (DWORD) E_FAIL; + } + + // set the parameter + m_dwParam = dwParam; + + // signal the worker thread + m_EventSend.Set(); + + // wait for the completion to be signalled + m_EventComplete.Wait(); + + // done - this is the thread's return value + return m_dwReturnVal; +} + +// Wait for a request from the client +DWORD +CAMThread::GetRequest() +{ + m_EventSend.Wait(); + return m_dwParam; +} + +// is there a request? +BOOL +CAMThread::CheckRequest(__out_opt DWORD * pParam) +{ + if (!m_EventSend.Check()) { + return FALSE; + } else { + if (pParam) { + *pParam = m_dwParam; + } + return TRUE; + } +} + +// reply to the request +void +CAMThread::Reply(DWORD dw) +{ + m_dwReturnVal = dw; + + // The request is now complete so CheckRequest should fail from + // now on + // + // This event should be reset BEFORE we signal the client or + // the client may Set it before we reset it and we'll then + // reset it (!) + + m_EventSend.Reset(); + + // Tell the client we're finished + + m_EventComplete.Set(); +} + +HRESULT CAMThread::CoInitializeHelper() +{ + // call CoInitializeEx and tell OLE not to create a window (this + // thread probably won't dispatch messages and will hang on + // broadcast msgs o/w). + // + // If CoInitEx is not available, threads that don't call CoCreate + // aren't affected. Threads that do will have to handle the + // failure. Perhaps we should fall back to CoInitialize and risk + // hanging? + // + + // older versions of ole32.dll don't have CoInitializeEx + + HRESULT hr = E_FAIL; + HINSTANCE hOle = GetModuleHandle(TEXT("ole32.dll")); + if(hOle) + { + typedef HRESULT (STDAPICALLTYPE *PCoInitializeEx)( + LPVOID pvReserved, DWORD dwCoInit); + PCoInitializeEx pCoInitializeEx = + (PCoInitializeEx)(GetProcAddress(hOle, "CoInitializeEx")); + if(pCoInitializeEx) + { + hr = (*pCoInitializeEx)(0, COINIT_DISABLE_OLE1DDE ); + } + } + else + { + // caller must load ole32.dll + DbgBreak("couldn't locate ole32.dll"); + } + + return hr; +} + + +// destructor for CMsgThread - cleans up any messages left in the +// queue when the thread exited +CMsgThread::~CMsgThread() +{ + if (m_hThread != NULL) { + WaitForSingleObject(m_hThread, INFINITE); + EXECUTE_ASSERT(CloseHandle(m_hThread)); + } + + POSITION pos = m_ThreadQueue.GetHeadPosition(); + while (pos) { + CMsg * pMsg = m_ThreadQueue.GetNext(pos); + delete pMsg; + } + m_ThreadQueue.RemoveAll(); + + if (m_hSem != NULL) { + EXECUTE_ASSERT(CloseHandle(m_hSem)); + } +} + +BOOL +CMsgThread::CreateThread( + ) +{ + m_hSem = CreateSemaphore(NULL, 0, 0x7FFFFFFF, NULL); + if (m_hSem == NULL) { + return FALSE; + } + + m_hThread = ::CreateThread(NULL, 0, DefaultThreadProc, + (LPVOID)this, 0, &m_ThreadId); + return m_hThread != NULL; +} + + +// This is the threads message pump. Here we get and dispatch messages to +// clients thread proc until the client refuses to process a message. +// The client returns a non-zero value to stop the message pump, this +// value becomes the threads exit code. + +DWORD WINAPI +CMsgThread::DefaultThreadProc( + __inout LPVOID lpParam + ) +{ + CMsgThread *lpThis = (CMsgThread *)lpParam; + CMsg msg; + LRESULT lResult; + + // !!! + CoInitialize(NULL); + + // allow a derived class to handle thread startup + lpThis->OnThreadInit(); + + do { + lpThis->GetThreadMsg(&msg); + lResult = lpThis->ThreadMessageProc(msg.uMsg,msg.dwFlags, + msg.lpParam, msg.pEvent); + } while (lResult == 0L); + + // !!! + CoUninitialize(); + + return (DWORD)lResult; +} + + +// Block until the next message is placed on the list m_ThreadQueue. +// copies the message to the message pointed to by *pmsg +void +CMsgThread::GetThreadMsg(__out CMsg *msg) +{ + CMsg * pmsg = NULL; + + // keep trying until a message appears + while (TRUE) { + { + CAutoLock lck(&m_Lock); + pmsg = m_ThreadQueue.RemoveHead(); + if (pmsg == NULL) { + m_lWaiting++; + } else { + break; + } + } + // the semaphore will be signalled when it is non-empty + WaitForSingleObject(m_hSem, INFINITE); + } + // copy fields to caller's CMsg + *msg = *pmsg; + + // this CMsg was allocated by the 'new' in PutThreadMsg + delete pmsg; + +} + +// Helper function - convert int to WSTR +void WINAPI IntToWstr(int i, __out_ecount(12) LPWSTR wstr) +{ +#ifdef UNICODE + if (FAILED(StringCchPrintf(wstr, 12, L"%d", i))) { + wstr[0] = 0; + } +#else + TCHAR temp[12]; + if (FAILED(StringCchPrintf(temp, NUMELMS(temp), "%d", i))) { + wstr[0] = 0; + } else { + MultiByteToWideChar(CP_ACP, 0, temp, -1, wstr, 12); + } +#endif +} // IntToWstr + + +#define MEMORY_ALIGNMENT 4 +#define MEMORY_ALIGNMENT_LOG2 2 +#define MEMORY_ALIGNMENT_MASK MEMORY_ALIGNMENT - 1 + +void * __stdcall memmoveInternal(void * dst, const void * src, size_t count) +{ + void * ret = dst; + +#ifdef _X86_ + if (dst <= src || (char *)dst >= ((char *)src + count)) { + + /* + * Non-Overlapping Buffers + * copy from lower addresses to higher addresses + */ + _asm { + mov esi,src + mov edi,dst + mov ecx,count + cld + mov edx,ecx + and edx,MEMORY_ALIGNMENT_MASK + shr ecx,MEMORY_ALIGNMENT_LOG2 + rep movsd + or ecx,edx + jz memmove_done + rep movsb +memmove_done: + } + } + else { + + /* + * Overlapping Buffers + * copy from higher addresses to lower addresses + */ + _asm { + mov esi,src + mov edi,dst + mov ecx,count + std + add esi,ecx + add edi,ecx + dec esi + dec edi + rep movsb + cld + } + } +#else + MoveMemory(dst, src, count); +#endif + + return ret; +} + +HRESULT AMSafeMemMoveOffset( + __in_bcount(dst_size) void * dst, + __in size_t dst_size, + __in DWORD cb_dst_offset, + __in_bcount(src_size) const void * src, + __in size_t src_size, + __in DWORD cb_src_offset, + __in size_t count) +{ + // prevent read overruns + if( count + cb_src_offset < count || // prevent integer overflow + count + cb_src_offset > src_size) // prevent read overrun + { + return E_INVALIDARG; + } + + // prevent write overruns + if( count + cb_dst_offset < count || // prevent integer overflow + count + cb_dst_offset > dst_size) // prevent write overrun + { + return E_INVALIDARG; + } + + memmoveInternal( (BYTE *)dst+cb_dst_offset, (BYTE *)src+cb_src_offset, count); + return S_OK; +} + + +#ifdef DEBUG +/******************************Public*Routine******************************\ +* Debug CCritSec helpers +* +* We provide debug versions of the Constructor, destructor, Lock and Unlock +* routines. The debug code tracks who owns each critical section by +* maintaining a depth count. +* +* History: +* +\**************************************************************************/ + +CCritSec::CCritSec() +{ + InitializeCriticalSection(&m_CritSec); + m_currentOwner = m_lockCount = 0; + m_fTrace = FALSE; +} + +CCritSec::~CCritSec() +{ + DeleteCriticalSection(&m_CritSec); +} + +void CCritSec::Lock() +{ + UINT tracelevel=3; + DWORD us = GetCurrentThreadId(); + DWORD currentOwner = m_currentOwner; + if (currentOwner && (currentOwner != us)) { + // already owned, but not by us + if (m_fTrace) { + DbgLog((LOG_LOCKING, 2, TEXT("Thread %d about to wait for lock %x owned by %d"), + GetCurrentThreadId(), &m_CritSec, currentOwner)); + tracelevel=2; + // if we saw the message about waiting for the critical + // section we ensure we see the message when we get the + // critical section + } + } + EnterCriticalSection(&m_CritSec); + if (0 == m_lockCount++) { + // we now own it for the first time. Set owner information + m_currentOwner = us; + + if (m_fTrace) { + DbgLog((LOG_LOCKING, tracelevel, TEXT("Thread %d now owns lock %x"), m_currentOwner, &m_CritSec)); + } + } +} + +void CCritSec::Unlock() { + if (0 == --m_lockCount) { + // about to be unowned + if (m_fTrace) { + DbgLog((LOG_LOCKING, 3, TEXT("Thread %d releasing lock %x"), m_currentOwner, &m_CritSec)); + } + + m_currentOwner = 0; + } + LeaveCriticalSection(&m_CritSec); +} + +void WINAPI DbgLockTrace(CCritSec * pcCrit, BOOL fTrace) +{ + pcCrit->m_fTrace = fTrace; +} + +BOOL WINAPI CritCheckIn(CCritSec * pcCrit) +{ + return (GetCurrentThreadId() == pcCrit->m_currentOwner); +} + +BOOL WINAPI CritCheckIn(const CCritSec * pcCrit) +{ + return (GetCurrentThreadId() == pcCrit->m_currentOwner); +} + +BOOL WINAPI CritCheckOut(CCritSec * pcCrit) +{ + return (GetCurrentThreadId() != pcCrit->m_currentOwner); +} + +BOOL WINAPI CritCheckOut(const CCritSec * pcCrit) +{ + return (GetCurrentThreadId() != pcCrit->m_currentOwner); +} +#endif + + +STDAPI WriteBSTR(__deref_out BSTR *pstrDest, LPCWSTR szSrc) +{ + *pstrDest = SysAllocString( szSrc ); + if( !(*pstrDest) ) return E_OUTOFMEMORY; + return NOERROR; +} + + +STDAPI FreeBSTR(__deref_in BSTR* pstr) +{ + if( (PVOID)*pstr == NULL ) return S_FALSE; + SysFreeString( *pstr ); + return NOERROR; +} + + +// Return a wide string - allocating memory for it +// Returns: +// S_OK - no error +// E_POINTER - ppszReturn == NULL +// E_OUTOFMEMORY - can't allocate memory for returned string +STDAPI AMGetWideString(LPCWSTR psz, __deref_out LPWSTR *ppszReturn) +{ + CheckPointer(ppszReturn, E_POINTER); + ValidateReadWritePtr(ppszReturn, sizeof(LPWSTR)); + *ppszReturn = NULL; + size_t nameLen; + HRESULT hr = StringCbLengthW(psz, 100000, &nameLen); + if (FAILED(hr)) { + return hr; + } + *ppszReturn = (LPWSTR)CoTaskMemAlloc(nameLen + sizeof(WCHAR)); + if (*ppszReturn == NULL) { + return E_OUTOFMEMORY; + } + CopyMemory(*ppszReturn, psz, nameLen + sizeof(WCHAR)); + return NOERROR; +} + +// Waits for the HANDLE hObject. While waiting messages sent +// to windows on our thread by SendMessage will be processed. +// Using this function to do waits and mutual exclusion +// avoids some deadlocks in objects with windows. +// Return codes are the same as for WaitForSingleObject +DWORD WINAPI WaitDispatchingMessages( + HANDLE hObject, + DWORD dwWait, + HWND hwnd, + UINT uMsg, + HANDLE hEvent) +{ + BOOL bPeeked = FALSE; + DWORD dwResult; + DWORD dwStart; + DWORD dwThreadPriority; + + static UINT uMsgId = 0; + + HANDLE hObjects[2] = { hObject, hEvent }; + if (dwWait != INFINITE && dwWait != 0) { + dwStart = GetTickCount(); + } + for (; ; ) { + DWORD nCount = NULL != hEvent ? 2 : 1; + + // Minimize the chance of actually dispatching any messages + // by seeing if we can lock immediately. + dwResult = WaitForMultipleObjects(nCount, hObjects, FALSE, 0); + if (dwResult < WAIT_OBJECT_0 + nCount) { + break; + } + + DWORD dwTimeOut = dwWait; + if (dwTimeOut > 10) { + dwTimeOut = 10; + } + dwResult = MsgWaitForMultipleObjects( + nCount, + hObjects, + FALSE, + dwTimeOut, + hwnd == NULL ? QS_SENDMESSAGE : + QS_SENDMESSAGE + QS_POSTMESSAGE); + if (dwResult == WAIT_OBJECT_0 + nCount || + dwResult == WAIT_TIMEOUT && dwTimeOut != dwWait) { + MSG msg; + if (hwnd != NULL) { + while (PeekMessage(&msg, hwnd, uMsg, uMsg, PM_REMOVE)) { + DispatchMessage(&msg); + } + } + // Do this anyway - the previous peek doesn't flush out the + // messages + PeekMessage(&msg, NULL, 0, 0, PM_NOREMOVE); + + if (dwWait != INFINITE && dwWait != 0) { + DWORD dwNow = GetTickCount(); + + // Working with differences handles wrap-around + DWORD dwDiff = dwNow - dwStart; + if (dwDiff > dwWait) { + dwWait = 0; + } else { + dwWait -= dwDiff; + } + dwStart = dwNow; + } + if (!bPeeked) { + // Raise our priority to prevent our message queue + // building up + dwThreadPriority = GetThreadPriority(GetCurrentThread()); + if (dwThreadPriority < THREAD_PRIORITY_HIGHEST) { + SetThreadPriority(GetCurrentThread(), THREAD_PRIORITY_HIGHEST); + } + bPeeked = TRUE; + } + } else { + break; + } + } + if (bPeeked) { + SetThreadPriority(GetCurrentThread(), dwThreadPriority); + if (HIWORD(GetQueueStatus(QS_POSTMESSAGE)) & QS_POSTMESSAGE) { + if (uMsgId == 0) { + uMsgId = RegisterWindowMessage(TEXT("AMUnblock")); + } + if (uMsgId != 0) { + MSG msg; + // Remove old ones + while (PeekMessage(&msg, (HWND)-1, uMsgId, uMsgId, PM_REMOVE)) { + } + } + PostThreadMessage(GetCurrentThreadId(), uMsgId, 0, 0); + } + } + return dwResult; +} + +HRESULT AmGetLastErrorToHResult() +{ + DWORD dwLastError = GetLastError(); + if(dwLastError != 0) + { + return HRESULT_FROM_WIN32(dwLastError); + } + else + { + return E_FAIL; + } +} + +IUnknown* QzAtlComPtrAssign(__deref_inout_opt IUnknown** pp, __in_opt IUnknown* lp) +{ + if (lp != NULL) + lp->AddRef(); + if (*pp) + (*pp)->Release(); + *pp = lp; + return lp; +} + +/****************************************************************************** + +CompatibleTimeSetEvent + + CompatibleTimeSetEvent() sets the TIME_KILL_SYNCHRONOUS flag before calling +timeSetEvent() if the current operating system supports it. TIME_KILL_SYNCHRONOUS +is supported on Windows XP and later operating systems. + +Parameters: +- The same parameters as timeSetEvent(). See timeSetEvent()'s documentation in +the Platform SDK for more information. + +Return Value: +- The same return value as timeSetEvent(). See timeSetEvent()'s documentation in +the Platform SDK for more information. + +******************************************************************************/ +MMRESULT CompatibleTimeSetEvent( UINT uDelay, UINT uResolution, __in LPTIMECALLBACK lpTimeProc, DWORD_PTR dwUser, UINT fuEvent ) +{ + #if WINVER >= 0x0501 + { + static bool fCheckedVersion = false; + static bool fTimeKillSynchronousFlagAvailable = false; + + if( !fCheckedVersion ) { + fTimeKillSynchronousFlagAvailable = TimeKillSynchronousFlagAvailable(); + fCheckedVersion = true; + } + + if( fTimeKillSynchronousFlagAvailable ) { + fuEvent = fuEvent | TIME_KILL_SYNCHRONOUS; + } + } + #endif // WINVER >= 0x0501 + + return timeSetEvent( uDelay, uResolution, lpTimeProc, dwUser, fuEvent ); +} + +bool TimeKillSynchronousFlagAvailable( void ) +{ + OSVERSIONINFO osverinfo; + + osverinfo.dwOSVersionInfoSize = sizeof(osverinfo); + + if( GetVersionEx( &osverinfo ) ) { + + // Windows XP's major version is 5 and its' minor version is 1. + // timeSetEvent() started supporting the TIME_KILL_SYNCHRONOUS flag + // in Windows XP. + if( (osverinfo.dwMajorVersion > 5) || + ( (osverinfo.dwMajorVersion == 5) && (osverinfo.dwMinorVersion >= 1) ) ) { + return true; + } + } + + return false; +} + + diff --git a/third_party/BaseClasses/wxutil.h b/third_party/BaseClasses/wxutil.h new file mode 100644 index 00000000..305974a5 --- /dev/null +++ b/third_party/BaseClasses/wxutil.h @@ -0,0 +1,532 @@ +//------------------------------------------------------------------------------ +// File: WXUtil.h +// +// Desc: DirectShow base classes - defines helper classes and functions for +// building multimedia filters. +// +// Copyright (c) 1992-2001 Microsoft Corporation. All rights reserved. +//------------------------------------------------------------------------------ + + +#ifndef __WXUTIL__ +#define __WXUTIL__ + +// eliminate spurious "statement has no effect" warnings. +#pragma warning(disable: 4705) + +// wrapper for whatever critical section we have +class CCritSec { + + // make copy constructor and assignment operator inaccessible + + CCritSec(const CCritSec &refCritSec); + CCritSec &operator=(const CCritSec &refCritSec); + + CRITICAL_SECTION m_CritSec; + +#ifdef DEBUG +public: + DWORD m_currentOwner; + DWORD m_lockCount; + BOOL m_fTrace; // Trace this one +public: + CCritSec(); + ~CCritSec(); + void Lock(); + void Unlock(); +#else + +public: + CCritSec() { + InitializeCriticalSection(&m_CritSec); + }; + + ~CCritSec() { + DeleteCriticalSection(&m_CritSec); + }; + + void Lock() { + EnterCriticalSection(&m_CritSec); + }; + + void Unlock() { + LeaveCriticalSection(&m_CritSec); + }; +#endif +}; + +// +// To make deadlocks easier to track it is useful to insert in the +// code an assertion that says whether we own a critical section or +// not. We make the routines that do the checking globals to avoid +// having different numbers of member functions in the debug and +// retail class implementations of CCritSec. In addition we provide +// a routine that allows usage of specific critical sections to be +// traced. This is NOT on by default - there are far too many. +// + +#ifdef DEBUG + BOOL WINAPI CritCheckIn(CCritSec * pcCrit); + BOOL WINAPI CritCheckIn(const CCritSec * pcCrit); + BOOL WINAPI CritCheckOut(CCritSec * pcCrit); + BOOL WINAPI CritCheckOut(const CCritSec * pcCrit); + void WINAPI DbgLockTrace(CCritSec * pcCrit, BOOL fTrace); +#else + #define CritCheckIn(x) TRUE + #define CritCheckOut(x) TRUE + #define DbgLockTrace(pc, fT) +#endif + + +// locks a critical section, and unlocks it automatically +// when the lock goes out of scope +class CAutoLock { + + // make copy constructor and assignment operator inaccessible + + CAutoLock(const CAutoLock &refAutoLock); + CAutoLock &operator=(const CAutoLock &refAutoLock); + +protected: + CCritSec * m_pLock; + +public: + CAutoLock(CCritSec * plock) + { + m_pLock = plock; + m_pLock->Lock(); + }; + + ~CAutoLock() { + m_pLock->Unlock(); + }; +}; + + + +// wrapper for event objects +class CAMEvent +{ + + // make copy constructor and assignment operator inaccessible + + CAMEvent(const CAMEvent &refEvent); + CAMEvent &operator=(const CAMEvent &refEvent); + +protected: + HANDLE m_hEvent; +public: + CAMEvent(BOOL fManualReset = FALSE, __inout_opt HRESULT *phr = NULL); + CAMEvent(__inout_opt HRESULT *phr); + ~CAMEvent(); + + // Cast to HANDLE - we don't support this as an lvalue + operator HANDLE () const { return m_hEvent; }; + + void Set() {EXECUTE_ASSERT(SetEvent(m_hEvent));}; + BOOL Wait(DWORD dwTimeout = INFINITE) { + return (WaitForSingleObject(m_hEvent, dwTimeout) == WAIT_OBJECT_0); + }; + void Reset() { ResetEvent(m_hEvent); }; + BOOL Check() { return Wait(0); }; +}; + + +// wrapper for event objects that do message processing +// This adds ONE method to the CAMEvent object to allow sent +// messages to be processed while waiting + +class CAMMsgEvent : public CAMEvent +{ + +public: + + CAMMsgEvent(__inout_opt HRESULT *phr = NULL); + + // Allow SEND messages to be processed while waiting + BOOL WaitMsg(DWORD dwTimeout = INFINITE); +}; + +// old name supported for the time being +#define CTimeoutEvent CAMEvent + +// support for a worker thread + +#ifdef AM_NOVTABLE +// simple thread class supports creation of worker thread, synchronization +// and communication. Can be derived to simplify parameter passing +class AM_NOVTABLE CAMThread { + + // make copy constructor and assignment operator inaccessible + + CAMThread(const CAMThread &refThread); + CAMThread &operator=(const CAMThread &refThread); + + CAMEvent m_EventSend; + CAMEvent m_EventComplete; + + DWORD m_dwParam; + DWORD m_dwReturnVal; + +protected: + HANDLE m_hThread; + + // thread will run this function on startup + // must be supplied by derived class + virtual DWORD ThreadProc() = 0; + +public: + CAMThread(__inout_opt HRESULT *phr = NULL); + virtual ~CAMThread(); + + CCritSec m_AccessLock; // locks access by client threads + CCritSec m_WorkerLock; // locks access to shared objects + + // thread initially runs this. param is actually 'this'. function + // just gets this and calls ThreadProc + static DWORD WINAPI InitialThreadProc(__inout LPVOID pv); + + // start thread running - error if already running + BOOL Create(); + + // signal the thread, and block for a response + // + DWORD CallWorker(DWORD); + + // accessor thread calls this when done with thread (having told thread + // to exit) + void Close() { + + // Disable warning: Conversion from LONG to PVOID of greater size +#pragma warning(push) +#pragma warning(disable: 4312) + HANDLE hThread = (HANDLE)InterlockedExchangePointer(&m_hThread, 0); +#pragma warning(pop) + + if (hThread) { + WaitForSingleObject(hThread, INFINITE); + CloseHandle(hThread); + } + }; + + // ThreadExists + // Return TRUE if the thread exists. FALSE otherwise + BOOL ThreadExists(void) const + { + if (m_hThread == 0) { + return FALSE; + } else { + return TRUE; + } + } + + // wait for the next request + DWORD GetRequest(); + + // is there a request? + BOOL CheckRequest(__out_opt DWORD * pParam); + + // reply to the request + void Reply(DWORD); + + // If you want to do WaitForMultipleObjects you'll need to include + // this handle in your wait list or you won't be responsive + HANDLE GetRequestHandle() const { return m_EventSend; }; + + // Find out what the request was + DWORD GetRequestParam() const { return m_dwParam; }; + + // call CoInitializeEx (COINIT_DISABLE_OLE1DDE) if + // available. S_FALSE means it's not available. + static HRESULT CoInitializeHelper(); +}; +#endif // AM_NOVTABLE + + +// CQueue +// +// Implements a simple Queue ADT. The queue contains a finite number of +// objects, access to which is controlled by a semaphore. The semaphore +// is created with an initial count (N). Each time an object is added +// a call to WaitForSingleObject is made on the semaphore's handle. When +// this function returns a slot has been reserved in the queue for the new +// object. If no slots are available the function blocks until one becomes +// available. Each time an object is removed from the queue ReleaseSemaphore +// is called on the semaphore's handle, thus freeing a slot in the queue. +// If no objects are present in the queue the function blocks until an +// object has been added. + +#define DEFAULT_QUEUESIZE 2 + +template class CQueue { +private: + HANDLE hSemPut; // Semaphore controlling queue "putting" + HANDLE hSemGet; // Semaphore controlling queue "getting" + CRITICAL_SECTION CritSect; // Thread seriallization + int nMax; // Max objects allowed in queue + int iNextPut; // Array index of next "PutMsg" + int iNextGet; // Array index of next "GetMsg" + T *QueueObjects; // Array of objects (ptr's to void) + + void Initialize(int n) { + iNextPut = iNextGet = 0; + nMax = n; + InitializeCriticalSection(&CritSect); + hSemPut = CreateSemaphore(NULL, n, n, NULL); + hSemGet = CreateSemaphore(NULL, 0, n, NULL); + QueueObjects = new T[n]; + } + + +public: + CQueue(int n) { + Initialize(n); + } + + CQueue() { + Initialize(DEFAULT_QUEUESIZE); + } + + ~CQueue() { + delete [] QueueObjects; + DeleteCriticalSection(&CritSect); + CloseHandle(hSemPut); + CloseHandle(hSemGet); + } + + T GetQueueObject() { + int iSlot; + T Object; + LONG lPrevious; + + // Wait for someone to put something on our queue, returns straight + // away is there is already an object on the queue. + // + WaitForSingleObject(hSemGet, INFINITE); + + EnterCriticalSection(&CritSect); + iSlot = iNextGet++ % nMax; + Object = QueueObjects[iSlot]; + LeaveCriticalSection(&CritSect); + + // Release anyone waiting to put an object onto our queue as there + // is now space available in the queue. + // + ReleaseSemaphore(hSemPut, 1L, &lPrevious); + return Object; + } + + void PutQueueObject(T Object) { + int iSlot; + LONG lPrevious; + + // Wait for someone to get something from our queue, returns straight + // away is there is already an empty slot on the queue. + // + WaitForSingleObject(hSemPut, INFINITE); + + EnterCriticalSection(&CritSect); + iSlot = iNextPut++ % nMax; + QueueObjects[iSlot] = Object; + LeaveCriticalSection(&CritSect); + + // Release anyone waiting to remove an object from our queue as there + // is now an object available to be removed. + // + ReleaseSemaphore(hSemGet, 1L, &lPrevious); + } +}; + +// Ensures that memory is not read past the length source buffer +// and that memory is not written past the length of the dst buffer +// dst - buffer to copy to +// dst_size - total size of destination buffer +// cb_dst_offset - offset, first byte copied to dst+cb_dst_offset +// src - buffer to copy from +// src_size - total size of source buffer +// cb_src_offset - offset, first byte copied from src+cb_src_offset +// count - number of bytes to copy +// +// Returns: +// S_OK - no error +// E_INVALIDARG - values passed would lead to overrun +HRESULT AMSafeMemMoveOffset( + __in_bcount(dst_size) void * dst, + __in size_t dst_size, + __in DWORD cb_dst_offset, + __in_bcount(src_size) const void * src, + __in size_t src_size, + __in DWORD cb_src_offset, + __in size_t count); + +extern "C" +void * __stdcall memmoveInternal(void *, const void *, size_t); + +inline void * __cdecl memchrInternal(const void *buf, int chr, size_t cnt) +{ +#ifdef _X86_ + void *pRet = NULL; + + _asm { + cld // make sure we get the direction right + mov ecx, cnt // num of bytes to scan + mov edi, buf // pointer byte stream + mov eax, chr // byte to scan for + repne scasb // look for the byte in the byte stream + jnz exit_memchr // Z flag set if byte found + dec edi // scasb always increments edi even when it + // finds the required byte + mov pRet, edi +exit_memchr: + } + return pRet; + +#else + while ( cnt && (*(unsigned char *)buf != (unsigned char)chr) ) { + buf = (unsigned char *)buf + 1; + cnt--; + } + + return(cnt ? (void *)buf : NULL); +#endif +} + +void WINAPI IntToWstr(int i, __out_ecount(12) LPWSTR wstr); + +#define WstrToInt(sz) _wtoi(sz) +#define atoiW(sz) _wtoi(sz) +#define atoiA(sz) atoi(sz) + +// These are available to help managing bitmap VIDEOINFOHEADER media structures + +extern const DWORD bits555[3]; +extern const DWORD bits565[3]; +extern const DWORD bits888[3]; + +// These help convert between VIDEOINFOHEADER and BITMAPINFO structures + +STDAPI_(const GUID) GetTrueColorType(const BITMAPINFOHEADER *pbmiHeader); +STDAPI_(const GUID) GetBitmapSubtype(const BITMAPINFOHEADER *pbmiHeader); +STDAPI_(WORD) GetBitCount(const GUID *pSubtype); + +// strmbase.lib implements this for compatibility with people who +// managed to link to this directly. we don't want to advertise it. +// +// STDAPI_(/* T */ CHAR *) GetSubtypeName(const GUID *pSubtype); + +STDAPI_(CHAR *) GetSubtypeNameA(const GUID *pSubtype); +STDAPI_(WCHAR *) GetSubtypeNameW(const GUID *pSubtype); + +#ifdef UNICODE +#define GetSubtypeName GetSubtypeNameW +#else +#define GetSubtypeName GetSubtypeNameA +#endif + +STDAPI_(LONG) GetBitmapFormatSize(const BITMAPINFOHEADER *pHeader); +STDAPI_(DWORD) GetBitmapSize(const BITMAPINFOHEADER *pHeader); + +#ifdef __AMVIDEO__ +STDAPI_(BOOL) ContainsPalette(const VIDEOINFOHEADER *pVideoInfo); +STDAPI_(const RGBQUAD *) GetBitmapPalette(const VIDEOINFOHEADER *pVideoInfo); +#endif // __AMVIDEO__ + + +// Compares two interfaces and returns TRUE if they are on the same object +BOOL WINAPI IsEqualObject(IUnknown *pFirst, IUnknown *pSecond); + +// This is for comparing pins +#define EqualPins(pPin1, pPin2) IsEqualObject(pPin1, pPin2) + + +// Arithmetic helper functions + +// Compute (a * b + rnd) / c +LONGLONG WINAPI llMulDiv(LONGLONG a, LONGLONG b, LONGLONG c, LONGLONG rnd); +LONGLONG WINAPI Int64x32Div32(LONGLONG a, LONG b, LONG c, LONG rnd); + + +// Avoids us dyna-linking to SysAllocString to copy BSTR strings +STDAPI WriteBSTR(__deref_out BSTR * pstrDest, LPCWSTR szSrc); +STDAPI FreeBSTR(__deref_in BSTR* pstr); + +// Return a wide string - allocating memory for it +// Returns: +// S_OK - no error +// E_POINTER - ppszReturn == NULL +// E_OUTOFMEMORY - can't allocate memory for returned string +STDAPI AMGetWideString(LPCWSTR pszString, __deref_out LPWSTR *ppszReturn); + +// Special wait for objects owning windows +DWORD WINAPI WaitDispatchingMessages( + HANDLE hObject, + DWORD dwWait, + HWND hwnd = NULL, + UINT uMsg = 0, + HANDLE hEvent = NULL); + +// HRESULT_FROM_WIN32 converts ERROR_SUCCESS to a success code, but in +// our use of HRESULT_FROM_WIN32, it typically means a function failed +// to call SetLastError(), and we still want a failure code. +// +#define AmHresultFromWin32(x) (MAKE_HRESULT(SEVERITY_ERROR, FACILITY_WIN32, x)) + +// call GetLastError and return an HRESULT value that will fail the +// SUCCEEDED() macro. +HRESULT AmGetLastErrorToHResult(void); + +// duplicate of ATL's CComPtr to avoid linker conflicts. + +IUnknown* QzAtlComPtrAssign(__deref_inout_opt IUnknown** pp, __in_opt IUnknown* lp); + +template +class QzCComPtr +{ +public: + typedef T _PtrClass; + QzCComPtr() {p=NULL;} + QzCComPtr(T* lp) + { + if ((p = lp) != NULL) + p->AddRef(); + } + QzCComPtr(const QzCComPtr& lp) + { + if ((p = lp.p) != NULL) + p->AddRef(); + } + ~QzCComPtr() {if (p) p->Release();} + void Release() {if (p) p->Release(); p=NULL;} + operator T*() {return (T*)p;} + T& operator*() {ASSERT(p!=NULL); return *p; } + //The assert on operator& usually indicates a bug. If this is really + //what is needed, however, take the address of the p member explicitly. + T** operator&() { ASSERT(p==NULL); return &p; } + T* operator->() { ASSERT(p!=NULL); return p; } + T* operator=(T* lp){return (T*)QzAtlComPtrAssign((IUnknown**)&p, lp);} + T* operator=(const QzCComPtr& lp) + { + return (T*)QzAtlComPtrAssign((IUnknown**)&p, lp.p); + } +#if _MSC_VER>1020 + bool operator!(){return (p == NULL);} +#else + BOOL operator!(){return (p == NULL) ? TRUE : FALSE;} +#endif + T* p; +}; + +MMRESULT CompatibleTimeSetEvent( UINT uDelay, UINT uResolution, __in LPTIMECALLBACK lpTimeProc, DWORD_PTR dwUser, UINT fuEvent ); +bool TimeKillSynchronousFlagAvailable( void ); + +// Helper to replace lstrcpmi +__inline int lstrcmpiLocaleIndependentW(LPCWSTR lpsz1, LPCWSTR lpsz2) +{ + return CompareStringW(LOCALE_INVARIANT, NORM_IGNORECASE, lpsz1, -1, lpsz2, -1) - CSTR_EQUAL; +} +__inline int lstrcmpiLocaleIndependentA(LPCSTR lpsz1, LPCSTR lpsz2) +{ + return CompareStringA(LOCALE_INVARIANT, NORM_IGNORECASE, lpsz1, -1, lpsz2, -1) - CSTR_EQUAL; +} + +#endif /* __WXUTIL__ */ -- cgit v1.2.3